diff options
Diffstat (limited to 'maintainers')
| -rw-r--r-- | maintainers/README.md | 7 | ||||
| -rw-r--r-- | maintainers/maintainer-list.nix | 1756 | ||||
| -rw-r--r-- | maintainers/scripts/README.md | 62 | ||||
| -rw-r--r-- | maintainers/scripts/all-tarballs.nix | 2 | ||||
| l--------- | maintainers/scripts/check-by-name.sh | 1 | ||||
| -rwxr-xr-x | maintainers/scripts/doc/list-systemd-manpages.zsh | 33 | ||||
| -rwxr-xr-x | maintainers/scripts/fix-maintainers.pl | 14 | ||||
| -rwxr-xr-x | maintainers/scripts/get-maintainer.sh | 73 | ||||
| -rwxr-xr-x | maintainers/scripts/haskell/hydra-report.hs | 55 | ||||
| -rwxr-xr-x | maintainers/scripts/haskell/merge-and-open-pr.sh | 4 | ||||
| -rwxr-xr-x | maintainers/scripts/haskell/update-stackage.sh | 5 | ||||
| -rwxr-xr-x | maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh | 2 | ||||
| -rw-r--r-- | maintainers/scripts/luarocks-packages.csv | 38 | ||||
| -rw-r--r-- | maintainers/scripts/pluginupdate.py | 28 | ||||
| -rwxr-xr-x | maintainers/scripts/update-luarocks-packages | 224 | ||||
| -rw-r--r-- | maintainers/scripts/update-luarocks-shell.nix | 13 | ||||
| -rw-r--r-- | maintainers/team-list.nix | 79 |
17 files changed, 1924 insertions, 472 deletions
diff --git a/maintainers/README.md b/maintainers/README.md index 5bb9c58db024b..f121ec7564135 100644 --- a/maintainers/README.md +++ b/maintainers/README.md @@ -165,3 +165,10 @@ team after giving the existing members a few days to respond. *Important:* If a team says it is a closed group, do not merge additions to the team without an approval by at least one existing member. + + +# Maintainer scripts + +Various utility scripts, which are mainly useful for nixpkgs maintainers, +are available under `./scripts/`. See its [README](./scripts/README.md) +for further information. diff --git a/maintainers/maintainer-list.nix b/maintainers/maintainer-list.nix index aee0066f766ca..75704e7c9c7e9 100644 --- a/maintainers/maintainer-list.nix +++ b/maintainers/maintainer-list.nix @@ -26,8 +26,10 @@ - `githubId` is your GitHub user ID, which can be found at `https://api.github.com/users/<userhandle>`, - `keys` is a list of your PGP/GPG key fingerprints. - Specifying a GitHub account ensures that you automatically get a review request on - pull requests that modify a package for which you are a maintainer. + Specifying a GitHub account ensures that you automatically: + - get invited to the @NixOS/nixpkgs-maintainers team ; + - once you are part of the @NixOS org, OfBorg will request you review + pull requests that modify a package for which you are a maintainer. `handle == github` is strongly preferred whenever `github` is an acceptable attribute name and is short and convenient. @@ -149,6 +151,12 @@ github = "360ied"; githubId = 19516527; }; + _365tuwe = { + name = "Uwe Schlifkowitz"; + email = "supertuwe@gmail.com"; + github = "365tuwe"; + githubId = 10263091; + }; _3699n = { email = "nicholas@nvk.pm"; github = "3699n"; @@ -371,6 +379,21 @@ githubId = 124545; name = "Anthony Cowley"; }; + acuteenvy = { + matrix = "@acuteenvy:matrix.org"; + github = "acuteenvy"; + githubId = 126529524; + name = "Lena"; + keys = [{ + fingerprint = "CE85 54F7 B9BC AC0D D648 5661 AB5F C04C 3C94 443F"; + }]; + }; + adam248 = { + email = "adamjbutler091@gmail.com"; + github = "adam248"; + githubId = 85082674; + name = "Adam J. Butler"; + }; adamcstephens = { email = "happy.plan4249@valkor.net"; matrix = "@adam:valkor.net"; @@ -446,6 +469,13 @@ githubId = 25236206; name = "Adrian Dole"; }; + adriangl = { + email = "adrian@lauterer.it"; + matrix = "@adriangl:pvv.ntnu.no"; + github = "adrlau"; + githubId = 25004152; + name = "Adrian Gunnar Lauterer"; + }; AdsonCicilioti = { name = "Adson Cicilioti"; email = "adson.cicilioti@live.com"; @@ -504,7 +534,7 @@ name = "James Alexander Feldman-Crough"; }; afontain = { - email = "antoine.fontaine@epfl.ch"; + email = "afontain@posteo.net"; github = "necessarily-equal"; githubId = 59283660; name = "Antoine Fontaine"; @@ -533,6 +563,18 @@ githubId = 732652; name = "Andreas Herrmann"; }; + ahirner = { + email = "a.hirner+nixpkgs@gmail.com"; + github = "ahirner"; + githubId = 6055037; + name = "Alexander Hirner"; + }; + ahoneybun = { + email = "aaron@system76.com"; + github = "ahoneybun"; + githubId = 4884946; + name = "Aaron Honeycutt"; + }; ahrzb = { email = "ahrzb5@gmail.com"; github = "ahrzb"; @@ -557,6 +599,16 @@ githubId = 4732885; name = "Ivan Jager"; }; + aikooo7 = { + name = "Diogo Fernandes"; + email = "prozinhopro1973@gmail.com"; + matrix = "@aikoo7:matrix.org"; + github = "aikooo7"; + githubId = 79667753; + keys = [{ + fingerprint = "B0D7 2955 235F 6AB5 ACFA 1619 8C7F F5BB 1ADE F191"; + }]; + }; aiotter = { email = "git@aiotter.com"; github = "aiotter"; @@ -575,6 +627,12 @@ githubId = 4717906; name = "Jakub Skokan"; }; + ajaxbits = { + email = "contact@ajaxbits.com"; + github = "ajaxbits"; + githubId = 45179933; + name = "Alex Jackson"; + }; ajgrf = { email = "a@ajgrf.com"; github = "ajgrf"; @@ -588,6 +646,12 @@ githubId = 1229027; name = "Andreas Schrägle"; }; + ajwhouse = { + email = "adam@ajwh.chat"; + github = "ajwhouse"; + githubId = 56616368; + name = "Adam House"; + }; ak = { email = "ak@formalprivacy.com"; github = "alexanderkjeldaas"; @@ -663,6 +727,15 @@ githubId = 20405311; name = "Aksh Gupta"; }; + al3xtjames = { + email = "nix@alextjam.es"; + github = "al3xtjames"; + githubId = 5672538; + name = "Alex James"; + keys = [{ + fingerprint = "F354 FFAB EA89 A49D 33ED 2590 4729 B829 AC5F CC72"; + }]; + }; alanpearce = { email = "alan@alanpearce.eu"; github = "alanpearce"; @@ -753,6 +826,12 @@ githubId = 2335822; name = "Alexandre Esteves"; }; + alex-fu27 = { + email = "alex.fu27@gmail.com"; + github = "alex-fu27"; + githubId = 49982580; + name = "Alexander Fuchs"; + }; alexnortung = { name = "alexnortung"; email = "alex_nortung@live.dk"; @@ -793,6 +872,12 @@ githubId = 5053729; name = "Alias Gram"; }; + alias-dev = { + email = "alias-dev@protonmail.com"; + github = "alias-dev"; + githubId = 30437811; + name = "Alex Andrews"; + }; alibabzo = { email = "alistair.bill@gmail.com"; github = "alistairbill"; @@ -829,6 +914,12 @@ githubId = 5892756; name = "Alec Snyder"; }; + allusive = { + email = "jasper@allusive.dev"; + name = "Allusive"; + github = "allusive-dev"; + githubId = 99632976; + }; almac = { email = "alma.cemerlic@gmail.com"; github = "a1mac"; @@ -836,12 +927,15 @@ name = "Alma Cemerlic"; }; Alper-Celik = { - email = "dev.alpercelik@gmail.com"; + email = "alper@alper-celik.dev"; name = "Alper Çelik"; github = "Alper-Celik"; githubId = 110625473; keys = [{ fingerprint = "6B69 19DD CEE0 FAF3 5C9F 2984 FA90 C0AB 738A B873"; + } + { + fingerprint = "DF68 C500 4024 23CC F9C5 E6CA 3D17 C832 4696 FE70"; }]; }; alternateved = { @@ -1191,6 +1285,12 @@ githubId = 81317317; name = "Anna Aurora"; }; + a-n-n-a-l-e-e = { + github = "a-n-n-a-l-e-e"; + githubId = 150648636; + matrix = "@a-n-n-a-l-e-e:matrix.org"; + name = "annalee"; + }; anoa = { matrix = "@andrewm:amorgan.xyz"; email = "andrew@amorgan.xyz"; @@ -1210,9 +1310,11 @@ githubId = 6060545; matrix = "@anpin:matrix.org"; name = "Pavel Anpin"; - keys = [{ - fingerprint = "06E8 4FF6 0CCF 7AFD 5101 76C9 0FBC D3EE 6310 7407"; - }]; + keys = [ + { fingerprint = "06E8 4FF6 0CCF 7AFD 5101 76C9 0FBC D3EE 6310 7407"; } + # compare with https://keybase.io/anpin/pgp_keys.asc + { fingerprint = "DADF F3EA 06DC 8C1B 100A 24DB 312E 8F17 91C5 DA8C"; } + ]; }; anpryl = { email = "anpryl@gmail.com"; @@ -1262,6 +1364,9 @@ github = "antonmosich"; githubId = 27223336; name = "Anton Mosich"; + keys = [ { + fingerprint = "F401 287C 324F 0A1C B321 657B 9B96 97B8 FB18 7D14"; + } ]; }; antono = { email = "self@antono.info"; @@ -1371,6 +1476,12 @@ githubId = 59743220; name = "Vinícius Müller"; }; + arcuru = { + email = "patrick@jackson.dev"; + github = "arcuru"; + githubId = 160646; + name = "Patrick Jackson"; + }; ardumont = { email = "eniotna.t@gmail.com"; github = "ardumont"; @@ -1383,6 +1494,12 @@ githubId = 58516559; name = "Alexander Rezvov"; }; + argrat = { + email = "n.bertazzo@protonmail.com"; + github = "argrat"; + githubId = 98821629; + name = "Nicolò Bertazzo"; + }; arian-d = { email = "arianxdehghani@gmail.com"; github = "arian-d"; @@ -1476,6 +1593,11 @@ fingerprint = "3D2B B230 F9FA F0C5 1832 46DD 4FDC 96F1 61E7 BA8A"; }]; }; + arthsmn = { + name = "Arthur Cerqueira"; + github = "arthsmn"; + githubId = 150680976; + }; arthur = { email = "me@arthur.li"; github = "arthurl"; @@ -1520,6 +1642,13 @@ githubId = 1482768; name = "Benjamin Asbach"; }; + asbjornolling = { + email = "asbjorn@olli.ng"; + matrix = "@asbjorn:olli.ng"; + github = "AsbjornOlling"; + githubId = 11493130; + name = "Asbjørn Olling"; + }; asciimoth = { name = "Andrew"; email = "ascii@moth.contact"; @@ -1699,6 +1828,12 @@ github = "auchter"; githubId = 1190483; }; + augustebaum = { + email = "auguste.apple@gmail.com"; + github = "augustebaum"; + githubId = 52001167; + name = "Auguste Baum"; + }; auntie = { email = "auntieNeo@gmail.com"; github = "auntieNeo"; @@ -1750,12 +1885,6 @@ githubId = 1217745; name = "Aldwin Vlasblom"; }; - aveltras = { - email = "romain.viallard@outlook.fr"; - github = "aveltras"; - githubId = 790607; - name = "Romain Viallard"; - }; averelld = { email = "averell+nixos@rxd4.com"; github = "averelld"; @@ -1816,6 +1945,12 @@ githubId = 135230; name = "Aycan iRiCAN"; }; + ayes-web = { + email = "ayes2022@protonmail.com"; + github = "ayes-web"; + githubId = 52951851; + name = "ayes-web"; + }; aynish = { github = "Chickensoupwithrice"; githubId = 22575913; @@ -1948,6 +2083,12 @@ githubId = 80325; name = "Benjamin Andresen"; }; + barab-i = { + email = "barab_i@outlook.com"; + github = "barab-i"; + githubId = 92919899; + name = "Barab I"; + }; baracoder = { email = "baracoder@googlemail.com"; github = "baracoder"; @@ -2176,6 +2317,15 @@ githubId = 16821405; name = "Ben Kuhn"; }; + benlemasurier = { + email = "ben@crypt.ly"; + github = "benlemasurier"; + githubId = 47993; + name = "Ben LeMasurier"; + keys = [{ + fingerprint = "0FD4 7407 EFD4 8FD8 8BF5 87B3 248D 430A E8E7 4189"; + }]; + }; benley = { email = "benley@gmail.com"; github = "benley"; @@ -2372,6 +2522,12 @@ githubId = 5700358; name = "Thomas Blank"; }; + blinry = { + name = "blinry"; + email = "mail@blinry.org"; + github = "blinry"; + githubId = 81277; + }; blitz = { email = "js@alien8.de"; matrix = "@js:ukvly.org"; @@ -2379,6 +2535,12 @@ githubId = 37907; name = "Julian Stecklina"; }; + bloveless = { + email = "brennon.loveless@gmail.com"; + github = "bloveless"; + githubId = 535135; + name = "Brennon Loveless"; + }; bluescreen303 = { email = "mathijs@bluescreen303.nl"; github = "bluescreen303"; @@ -2434,6 +2596,12 @@ githubId = 50839; name = "Brian Jones"; }; + boltzmannrain = { + email = "boltzmannrain@gmail.com"; + github = "boltzmannrain"; + githubId = 150560585; + name = "Dmitry Ivankov"; + }; booklearner = { name = "booklearner"; email = "booklearner@proton.me"; @@ -2496,12 +2664,24 @@ fingerprint = "F549 3B7F 9372 5578 FDD3 D0B8 A1BC 8428 323E CFE8"; }]; }; + br337 = { + email = "brian.porumb@proton.me"; + github = "br337"; + githubId = 49288125; + name = "Brian Porumb"; + }; bradediger = { email = "brad@bradediger.com"; github = "bradediger"; githubId = 4621; name = "Brad Ediger"; }; + brahyerr = { + name = "Bryant Pham"; + email = "bp@1829847@gmail.com"; + github = "brahyerr"; + githubId = 120991075; + }; brainrape = { email = "martonboros@gmail.com"; github = "brainrake"; @@ -2562,6 +2742,12 @@ github = "brianmcgee"; githubId = 1173648; }; + brianmcgillion = { + name = "Brian McGillion"; + email = "bmg.avoin@gmail.com"; + github = "brianmcgillion"; + githubId = 1044263; + }; brodes = { email = "me@brod.es"; github = "brhoades"; @@ -2577,6 +2763,13 @@ githubId = 1071610; name = "Gunnar Nitsche"; }; + brokenpip3 = { + email = "brokenpip3@gmail.com"; + matrix = "@brokenpip3:matrix.org"; + github = "brokenpip3"; + githubId = 40476330; + name = "brokenpip3"; + }; bryanasdev000 = { email = "bryanasdev000@gmail.com"; matrix = "@bryanasdev000:matrix.org"; @@ -2584,6 +2777,12 @@ githubId = 53131727; name = "Bryan Albuquerque"; }; + bryango = { + name = "Bryan Lai"; + email = "bryanlais@gmail.com"; + github = "bryango"; + githubId = 26322692; + }; bryanhonof = { name = "Bryan Honof"; email = "bryanhonof@gmail.com"; @@ -2596,12 +2795,6 @@ githubId = 200617; name = "Ben Sima"; }; - bstrik = { - email = "dutchman55@gmx.com"; - github = "bstrik"; - githubId = 7716744; - name = "Berno Strik"; - }; btlvr = { email = "btlvr@protonmail.com"; github = "btlvr"; @@ -2639,6 +2832,12 @@ githubId = 61636; name = "Brad Langhorst"; }; + bycEEE = { + email = "bycEEE@gmail.com"; + github = "bycEEE"; + githubId = 8891115; + name = "Brian Choy"; + }; bzizou = { email = "Bruno@bzizou.net"; github = "bzizou"; @@ -2669,12 +2868,6 @@ githubId = 382011; name = "c4605"; }; - caadar = { - email = "v88m@posteo.net"; - github = "caadar"; - githubId = 15320726; - name = "Car Cdr"; - }; caarlos0 = { name = "Carlos A Becker"; email = "carlos@becker.software"; @@ -2754,6 +2947,12 @@ githubId = 7435854; name = "Victor Calvert"; }; + camelpunch = { + email = "me@andrewbruce.net"; + github = "camelpunch"; + githubId = 141733; + name = "Andrew Bruce"; + }; cameronfyfe = { email = "cameron.j.fyfe@gmail.com"; github = "cameronfyfe"; @@ -2811,12 +3010,25 @@ fingerprint = "8BC7 74E4 A2EC 7507 3B61 A647 0BBB 1C8B 1C36 39EE"; }]; }; + carloscraveiro = { + email = "carlos.craveiro@usp.br"; + github = "CarlosCraveiro"; + githubId = 85318248; + name = "Carlos Henrique Craveiro Aquino Veras"; + }; carlosdagos = { email = "m@cdagostino.io"; github = "carlosdagos"; githubId = 686190; name = "Carlos D'Agostino"; }; + carlossless = { + email = "contact@carlossless.io"; + matrix = "@carlossless:matrix.org"; + github = "carlossless"; + githubId = 498906; + name = "Karolis Stasaitis"; + }; carlsverre = { email = "accounts@carlsverre.com"; github = "carlsverre"; @@ -3033,6 +3245,9 @@ email = "chayleaf-nix@pavluk.org"; github = "chayleaf"; githubId = 9590981; + keys = [{ + fingerprint = "4314 3701 154D 9E5F 7051 7ECF 7817 1AD4 6227 E68E"; + }]; matrix = "@chayleaf:matrix.pavluk.org"; name = "Anna Pavlyuk"; }; @@ -3042,6 +3257,12 @@ githubId = 1689801; name = "Mikhail Chekan"; }; + chen = { + email = "i@cuichen.cc"; + github = "cu1ch3n"; + githubId = 80438676; + name = "Chen Cui"; + }; ChengCat = { email = "yu@cheng.cat"; github = "ChengCat"; @@ -3060,6 +3281,11 @@ githubId = 18648043; name = "Daniel Cartwright"; }; + chewblacka = { + github = "chewblacka"; + githubId = 18430320; + name = "John Garcia"; + }; Chili-Man = { email = "dr.elhombrechile@gmail.com"; name = "Diego Rodriguez"; @@ -3147,15 +3373,6 @@ githubId = 1103294; name = "Christopher Rosset"; }; - christianharke = { - email = "christian@harke.ch"; - github = "rake5k"; - githubId = 13007345; - name = "Christian Harke"; - keys = [{ - fingerprint = "4EBB 30F1 E89A 541A A7F2 52BE 830A 9728 6309 66F4"; - }]; - }; christophcharles = { github = "christophcharles"; githubId = 23055925; @@ -3189,8 +3406,7 @@ }; chuangzhu = { name = "Chuang Zhu"; - email = "chuang@melty.land"; - matrix = "@chuangzhu:matrix.org"; + email = "nixos@chuang.cz"; github = "chuangzhu"; githubId = 31200881; keys = [{ @@ -3587,6 +3803,12 @@ githubId = 1740337; name = "Chris Ostrouchov"; }; + cottand = { + email = "nico@dcotta.eu"; + github = "cottand"; + githubId = 45274424; + name = "Nico D'Cotta"; + }; couchemar = { email = "couchemar@yandex.ru"; github = "couchemar"; @@ -3655,6 +3877,18 @@ githubId = 1222362; name = "Matías Lang"; }; + criyle = { + email = "i+nixos@goj.ac"; + name = "Yang Gao"; + githubId = 6821729; + github = "criyle"; + }; + crschnick = { + email = "crschnick@xpipe.io"; + name = "Christopher Schnick"; + github = "crschnick"; + githubId = 72509152; + }; CRTified = { email = "carl.schneider+nixos@rub.de"; matrix = "@schnecfk:ruhr-uni-bochum.de"; @@ -3665,6 +3899,15 @@ fingerprint = "2017 E152 BB81 5C16 955C E612 45BC C1E2 709B 1788"; }]; }; + Cryolitia = { + name = "Beiyan Cryolitia"; + email = "Cryolitia@gmail.com"; + github = "Cryolitia"; + githubId = 23723294; + keys = [{ + fingerprint = "1C3C 6547 538D 7152 310C 0EEA 84DD 0C01 30A5 4DF7"; + }]; + }; cryptix = { email = "cryptix@riseup.net"; github = "cryptix"; @@ -3683,18 +3926,18 @@ githubId = 398996; name = "Christopher Singley"; }; - cstrahan = { - email = "charles@cstrahan.com"; - github = "cstrahan"; - githubId = 143982; - name = "Charles Strahan"; - }; cswank = { email = "craigswank@gmail.com"; github = "cswank"; githubId = 490965; name = "Craig Swank"; }; + ctron = { + email = "ctron@dentrassi.de"; + github = "ctron"; + githubId = 202474; + name = "Jens Reimann"; + }; cust0dian = { email = "serg@effectful.software"; github = "cust0dian"; @@ -3762,6 +4005,12 @@ githubId = 217899; name = "Cyryl Płotnicki"; }; + d3vil0p3r = { + name = "Antonio Voza"; + email = "vozaanthony@gmail.com"; + github = "D3vil0p3r"; + githubId = 83867734; + }; dadada = { name = "dadada"; email = "dadada@dadada.li"; @@ -3868,12 +4117,25 @@ githubId = 50051176; name = "Daniel Rolls"; }; + danielsidhion = { + email = "nixpkgs@sidhion.com"; + github = "DanielSidhion"; + githubId = 160084; + name = "Daniel Sidhion"; + }; daniyalsuri6 = { email = "daniyal.suri@gmail.com"; github = "daniyalsuri6"; githubId = 107034852; name = "Daniyal Suri"; }; + dannixon = { + email = "dan@dan-nixon.com"; + github = "DanNixon"; + githubId = 4037377; + name = "Dan Nixon"; + matrix = "@dannixon:matrix.org"; + }; dansbandit = { github = "dansbandit"; githubId = 4530687; @@ -3962,9 +4224,9 @@ }; davidarmstronglewis = { email = "davidlewis@mac.com"; - github = "davidarmstronglewis"; + github = "oceanlewis"; githubId = 6754950; - name = "David Armstrong Lewis"; + name = "Ocean Armstrong Lewis"; }; davidcromp = { email = "davidcrompton1192@gmail.com"; @@ -3978,6 +4240,15 @@ githubId = 118536343; name = "David Hamelin"; }; + david-r-cox = { + email = "david@integrated-reasoning.com"; + github = "david-r-cox"; + githubId = 4259949; + name = "David Cox"; + keys = [{ + fingerprint = "0056 A3F6 9918 1E0D 8FF0 BCDE 65BB 07FA A4D9 4634"; + }]; + }; davidrusu = { email = "davidrusu.me@gmail.com"; github = "davidrusu"; @@ -4050,6 +4321,12 @@ fingerprint = "B26F 9AD8 DA20 3392 EF87 C61A BB99 9F83 D9A1 9A36"; }]; }; + dblsaiko = { + email = "me@dblsaiko.net"; + github = "2xsaiko"; + githubId = 3987560; + name = "Marco Rebhan"; + }; dbohdan = { email = "dbohdan@dbohdan.com"; github = "dbohdan"; @@ -4122,6 +4399,15 @@ githubId = 156239; name = "D Anzorge"; }; + defelo = { + name = "Defelo"; + matrix = "@defelo:matrix.defelo.de"; + github = "Defelo"; + githubId = 41747605; + keys = [{ + fingerprint = "6130 3BBA D7D1 BF74 EFA4 4E3B E7FE 2087 E438 0E64"; + }]; + }; deifactor = { name = "Ash Zahlen"; email = "ext0l@riseup.net"; @@ -4162,6 +4448,12 @@ githubId = 12224254; name = "Delta"; }; + delta231 = { + email = "swstkbaranwal@gmail.com"; + github = "Delta456"; + githubId = 28479139; + name = "Swastik Baranwal"; + }; deltadelta = { email = "contact@libellules.eu"; name = "Dara Ly"; @@ -4180,6 +4472,12 @@ githubId = 5503422; name = "Dmitriy Demin"; }; + demine = { + email = "riches_tweaks0o@icloud.com"; + github = "demine0"; + githubId = 51992962; + name = "Nikita Demin"; + }; demize = { email = "johannes@kyriasis.com"; github = "kyrias"; @@ -4412,6 +4710,24 @@ githubId = 14034137; name = "Mostly Void"; }; + ditsuke = { + name = "Tushar"; + email = "hello@ditsuke.com"; + github = "ditsuke"; + githubId = 72784348; + keys = [{ + fingerprint = "8FD2 153F 4889 541A 54F1 E09E 71B6 C31C 8A5A 9D21"; + }]; + }; + dixslyf = { + name = "Dixon Sean Low Yan Feng"; + email = "dixonseanlow@protonmail.com"; + github = "dixslyf"; + githubId = 56017218; + keys = [{ + fingerprint = "E6F4 BFB4 8DE3 893F 68FC A15F FF5F 4B30 A41B BAC8"; + }]; + }; djacu = { email = "daniel.n.baker@gmail.com"; github = "djacu"; @@ -4489,6 +4805,12 @@ githubId = 1708810; name = "Daniel Vianna"; }; + dmytrokyrychuk = { + email = "dmytro@kyrych.uk"; + github = "dmytrokyrychuk"; + githubId = 699961; + name = "Dmytro Kyrychuk"; + }; dnr = { email = "dnr@dnr.im"; github = "dnr"; @@ -4813,6 +5135,12 @@ githubId = 424946; name = "James Earl Douglas"; }; + EBADBEEF = { + name = "EBADBEEF"; + email = "errno@ebadf.com"; + github = "EBADBEEF"; + githubId = 4167946; + }; ebbertd = { email = "daniel@ebbert.nrw"; github = "ebbertd"; @@ -4894,6 +5222,12 @@ matrix = "@edrex:matrix.org"; name = "Eric Drechsel"; }; + edswordsmith = { + email = "eduardo.espadeiro@tecnico.ulisboa.pt"; + github = "EdSwordsmith"; + githubId = 22300113; + name = "Eduardo Espadeiro"; + }; eduarrrd = { email = "e.bachmakov@gmail.com"; github = "eduarrrd"; @@ -4954,6 +5288,12 @@ name = "Edvin Källström"; githubId = 84442052; }; + ekimber = { + email = "ekimber@protonmail.com"; + github = "ekimber"; + name = "Edward Kimber"; + githubId = 99987; + }; ekleog = { email = "leo@gaspard.io"; matrix = "@leo:gaspard.ninja"; @@ -5145,6 +5485,13 @@ githubId = 231483; name = "Jack Kelly"; }; + endle = { + email = "lizhenbo@yahoo.com"; + github = "Endle"; + githubId = 3221521; + name = "Zhenbo Li"; + matrix = "@zhenbo:matrix.org"; + }; endocrimes = { email = "dani@builds.terrible.systems"; github = "endocrimes"; @@ -5257,6 +5604,13 @@ fingerprint = "F178 B4B4 6165 6D1B 7C15 B55D 4029 3358 C7B9 326B"; }]; }; + ericthemagician = { + email = "eric@ericyen.com"; + matrix = "@eric:jupiterbroadcasting.com"; + github = "EricTheMagician"; + githubId = 323436; + name = "Eric Yen"; + }; erikarvstedt = { email = "erik.arvstedt@gmail.com"; matrix = "@erikarvstedt:matrix.org"; @@ -5305,6 +5659,11 @@ githubId = 1855930; name = "Ertugrul Söylemez"; }; + esau79p = { + github = "EsAu79p"; + githubId = 21313906; + name = "EsAu"; + }; esclear = { github = "esclear"; githubId = 7432848; @@ -5372,6 +5731,12 @@ githubId = 2147649; name = "Euan Kemp"; }; + eureka-cpu = { + email = "github.eureka@gmail.com"; + github = "eureka-cpu"; + githubId = 57543709; + name = "Chris O'Brien"; + }; evalexpr = { name = "Jonathan Wilkins"; email = "nixos@wilkins.tech"; @@ -5438,6 +5803,12 @@ githubId = 454695; name = "Artur Taranchiev"; }; + ewuuwe = { + email = "ewu.uweq@pm.me"; + github = "ewuuwe"; + githubId = 63652646; + name = "Xaver Oswald"; + }; exarkun = { email = "exarkun@twistedmatrix.com"; github = "exarkun"; @@ -5491,6 +5862,12 @@ githubId = 25955146; name = "eyJhb"; }; + eymeric = { + name = "Eymeric Dechelette"; + email = "hatchchcien@protonmail.com"; + github = "hatch01"; + githubId = 42416805; + }; f2k1de = { name = "f2k1de"; email = "hi@f2k1.de"; @@ -5823,6 +6200,12 @@ githubId = 74379; name = "Florian Pester"; }; + fmhoeger = { + email = "fmhoeger@mirsem.org"; + name = "fmhoeger"; + github = "fmhoeger"; + githubId = 59626853; + }; fmoda3 = { email = "fmoda3@mac.com"; github = "fmoda3"; @@ -5842,10 +6225,14 @@ githubId = 1618343; }; foo-dogsquared = { - email = "foo.dogsquared@gmail.com"; + email = "foodogsquared@foodogsquared.one"; github = "foo-dogsquared"; githubId = 34962634; + matrix = "@foodogsquared:matrix.org"; name = "Gabriel Arazas"; + keys = [{ + fingerprint = "DDD7 D0BD 602E 564B AA04 FC35 1431 0D91 4115 2B92"; + }]; }; fooker = { email = "fooker@lab.sh"; @@ -5874,13 +6261,6 @@ githubId = 92793; name = "Friedrich von Never"; }; - fortuneteller2k = { - email = "lythe1107@gmail.com"; - matrix = "@fortuneteller2k:matrix.org"; - github = "fortuneteller2k"; - githubId = 20619776; - name = "fortuneteller2k"; - }; fpletz = { email = "fpletz@fnordicwalking.de"; github = "fpletz"; @@ -5908,6 +6288,11 @@ githubId = 119691; name = "Michael Gough"; }; + franciscod = { + github = "franciscod"; + githubId = 726447; + name = "Francisco Demartino"; + }; franzmondlichtmann = { name = "Franz Schroepf"; email = "franz-schroepf@t-online.de"; @@ -5984,6 +6369,10 @@ github = "frogamic"; githubId = 10263813; name = "Dominic Shelton"; + matrix = "@frogamic:beeper.com"; + keys = [{ + fingerprint = "779A 7CA8 D51C C53A 9C51 43F7 AAE0 70F0 67EC 00A5"; + }]; }; frontsideair = { email = "photonia@gmail.com"; @@ -6003,6 +6392,15 @@ githubId = 134872; name = "Sergei Lukianov"; }; + fryuni = { + name = "Luiz Ferraz"; + email = "luiz@lferraz.com"; + github = "Fryuni"; + githubId = 11063910; + keys = [{ + fingerprint = "2109 4B0E 560B 031E F539 62C8 2B56 8731 DB24 47EC"; + }]; + }; fsagbuya = { email = "fa@m-labs.ph"; github = "fsagbuya"; @@ -6041,7 +6439,7 @@ }; fugi = { email = "me@fugi.dev"; - github = "FugiMuffi"; + github = "fugidev"; githubId = 21362942; name = "Fugi"; }; @@ -6068,6 +6466,15 @@ githubId = 12715461; name = "Anders Bo Rasmussen"; }; + fwam = { + name = "Legion Orsetti"; + email = "fwam@queereen.dev"; + github = "fwam"; + githubId = 113541944; + keys = [{ + fingerprint = "3822 20B8 57ED 0602 3786 8A7A 18E1 AE22 D704 B4FC"; + }]; + }; fwc = { github = "fwc"; githubId = 29337229; @@ -6141,6 +6548,16 @@ githubId = 45048741; name = "Alwanga Oyango"; }; + galaxy = { + email = "galaxy@dmc.chat"; + matrix = "@galaxy:mozilla.org"; + name = "The Galaxy"; + github = "ga1aksy"; + githubId = 148551648; + keys = [{ + fingerprint = "48CA 3873 9E9F CA8E 76A0 835A E3DE CF85 4212 E1EA"; + }]; + }; gal_bolle = { email = "florent.becker@ens-lyon.org"; github = "FlorentBecker"; @@ -6284,6 +6701,16 @@ fingerprint = "D0CF 440A A703 E0F9 73CB A078 82BB 70D5 41AE 2DB4"; }]; }; + gepbird = { + email = "gutyina.gergo.2@gmail.com"; + github = "gepbird"; + githubId = 29818440; + name = "Gutyina Gergő"; + keys = [ + { fingerprint = "RoAfvqa6w1l8Vdm3W60TDXurYwJ6h03VEGD+wDNGEwc"; } + { fingerprint = "MP2UpIRtJpbFFqyucP431H/FPCfn58UhEUTro4lXtRs"; } + ]; + }; gerg-l = { email = "gregleyda@proton.me"; github = "Gerg-L"; @@ -6296,6 +6723,12 @@ githubId = 67984144; name = "Gerhard Schwanzer"; }; + gernotfeichter = { + email = "gernotfeichter@gmail.com"; + github = "gernotfeichter"; + githubId = 23199375; + name = "Gernot Feichter"; + }; gerschtli = { email = "tobias.happ@gmx.de"; github = "Gerschtli"; @@ -6310,7 +6743,7 @@ }; getpsyched = { name = "Priyanshu Tripathi"; - email = "priyanshutr@proton.me"; + email = "priyanshu@getpsyched.dev"; matrix = "@getpsyched:matrix.org"; github = "getpsyched"; githubId = 43472218; @@ -6379,6 +6812,12 @@ githubId = 1713676; name = "Luis G. Torres"; }; + giomf = { + email = "giomf@mailbox.org"; + github = "giomf"; + githubId = 35076723; + name = "Guillaume Fournier"; + }; giorgiga = { email = "giorgio.gallo@bitnic.it"; github = "giorgiga"; @@ -6436,6 +6875,10 @@ githubId = 1447245; name = "Robin Gloster"; }; + gm6k = { + email = "nix@quidecco.pl"; + name = "Isidor Zeuner"; + }; gmemstr = { email = "git@gmem.ca"; github = "gmemstr"; @@ -6541,6 +6984,12 @@ githubId = 6893840; name = "Yacine Hmito"; }; + gracicot = { + email = "gracicot42@gmail.com"; + github = "gracicot"; + githubId = 2906673; + name = "Guillaume Racicot"; + }; graham33 = { email = "graham@grahambennett.org"; github = "graham33"; @@ -6559,6 +7008,12 @@ githubId = 4656860; name = "Gaute Ravndal"; }; + gray-heron = { + email = "ave+nix@cezar.info"; + github = "gray-heron"; + githubId = 7032646; + name = "Cezary Siwek"; + }; graysonhead = { email = "grayson@graysonhead.net"; github = "graysonhead"; @@ -6640,6 +7095,11 @@ githubId = 21156405; name = "GuangTao Zhang"; }; + guekka = { + github = "Guekka"; + githubId = 39066502; + name = "Guekka"; + }; guibert = { email = "david.guibert@gmail.com"; github = "dguibert"; @@ -6783,6 +7243,12 @@ githubId = 33523827; name = "Harrison Thorne"; }; + haruki7049 = { + email = "tontonkirikiri@gmail.com"; + github = "haruki7049"; + githubId = 64677724; + name = "haruki7049"; + }; harvidsen = { email = "harvidsen@gmail.com"; github = "harvidsen"; @@ -6859,6 +7325,13 @@ githubId = 287769; name = "Sergii Paryzhskyi"; }; + heisfer = { + email = "heisfer@refract.dev"; + github = "heisfer"; + githubId = 28564678; + matrix = "@heisfer:matrix.org"; + name = "Heisfer"; + }; helium = { email = "helium.dev@tuta.io"; github = "helium18"; @@ -7089,6 +7562,16 @@ githubId = 362833; name = "Hongchang Wu"; }; + honnip = { + name = "Jung seungwoo"; + email = "me@honnip.page"; + matrix = "@honnip:matrix.org"; + github = "honnip"; + githubId = 108175486; + keys = [{ + fingerprint = "E4DD 51F7 FA3F DCF1 BAF6 A72C 576E 43EF 8482 E415"; + }]; + }; hoppla20 = { email = "privat@vincentcui.de"; github = "hoppla20"; @@ -7148,6 +7631,13 @@ fingerprint = "731A 7A05 AD8B 3AE5 956A C227 4A03 18E0 4E55 5DE5"; }]; }; + hubble = { + name = "Hubble the Wolverine"; + email = "hubblethewolverine@gmail.com"; + matrix = "@hubofeverything:bark.lgbt"; + github = "the-furry-hubofeverything"; + githubId = 53921912; + }; hufman = { email = "hufman@gmail.com"; github = "hufman"; @@ -7186,6 +7676,12 @@ githubId = 51334444; name = "Akshat Agarwal"; }; + hummeltech = { + email = "hummeltech2024@gmail.com"; + github = "hummeltech"; + githubId = 6109326; + name = "David Hummel"; + }; huyngo = { email = "huyngo@disroot.org"; github = "Huy-Ngo"; @@ -7318,6 +7814,13 @@ githubId = 1550265; name = "Dominic Steinitz"; }; + iFreilicht = { + github = "iFreilicht"; + githubId = 9742635; + matrix = "@ifreilicht:matrix.org"; + email = "nixpkgs@mail.felix-uhl.de"; + name = "Felix Uhl"; + }; ifurther = { github = "ifurther"; githubId = 55025025; @@ -7347,6 +7850,12 @@ githubId = 25505957; name = "Ilian"; }; + iliayar = { + email = "iliayar3@gmail.com"; + github = "iliayar"; + githubId = 17529355; + name = "Ilya Yaroshevskiy"; + }; ilikeavocadoes = { email = "ilikeavocadoes@hush.com"; github = "ilikeavocadoes"; @@ -7515,6 +8024,12 @@ githubId = 88038050; name = "Souvik Sen"; }; + iogamaster = { + email = "iogamastercode+nixpkgs@gmail.com"; + name = "IogaMaster"; + github = "iogamaster"; + githubId = 67164465; + }; ionutnechita = { email = "ionut_n2001@yahoo.com"; github = "ionutnechita"; @@ -7576,6 +8091,12 @@ githubId = 4458; name = "Ivan Kozik"; }; + ivan770 = { + email = "ivan@ivan770.me"; + github = "ivan770"; + githubId = 14003886; + name = "Ivan Leshchenko"; + }; ivan-babrou = { email = "nixpkgs@ivan.computer"; name = "Ivan Babrou"; @@ -7623,6 +8144,12 @@ githubId = 41924494; name = "Ivar"; }; + ivarmedi = { + email = "ivar@larsson.me"; + github = "ivarmedi"; + githubId = 1318743; + name = "Ivar"; + }; iwanb = { email = "tracnar@gmail.com"; github = "iwanb"; @@ -7759,6 +8286,12 @@ githubId = 2212681; name = "Jakub Grzgorz Sokołowski"; }; + jakuzure = { + email = "shin@posteo.jp"; + github = "jakuzure"; + githubId = 11823547; + name = "jakuzure"; + }; jali-clarke = { email = "jinnah.ali-clarke@outlook.com"; name = "Jinnah Ali-Clarke"; @@ -7776,12 +8309,6 @@ githubId = 1358764; name = "Jamie Magee"; }; - jammerful = { - email = "jammerful@gmail.com"; - github = "jammerful"; - githubId = 20176306; - name = "jammerful"; - }; janik = { name = "Janik"; email = "janik@aq0.de"; @@ -7789,6 +8316,12 @@ github = "Janik-Haag"; githubId = 80165193; }; + jankaifer = { + name = "Jan Kaifer"; + email = "jan@kaifer.cz"; + github = "jankaifer"; + githubId = 12820484; + }; jansol = { email = "jan.solanti@paivola.fi"; github = "jansol"; @@ -7819,6 +8352,12 @@ githubId = 488556; name = "Javier Aguirre"; }; + javimerino = { + email = "merino.jav@gmail.com"; + name = "Javi Merino"; + github = "JaviMerino"; + githubId = 44926; + }; jayesh-bhoot = { name = "Jayesh Bhoot"; email = "jb@jayeshbhoot.com"; @@ -8027,6 +8566,12 @@ githubId = 854319; name = "Matt McHenry"; }; + jerrysm64 = { + email = "jerry.starke@icloud.com"; + github = "jerrysm64"; + githubId = 42114389; + name = "Jerry Starke"; + }; jeschli = { email = "jeschli@gmail.com"; github = "0mbi"; @@ -8072,11 +8617,14 @@ githubId = 18501; name = "Julien Langlois"; }; - jfrankenau = { - email = "johannes@frankenau.net"; - github = "jfrankenau"; - githubId = 2736480; - name = "Johannes Frankenau"; + jfly = { + name = "Jeremy Fleischman"; + email = "jeremyfleischman@gmail.com"; + github = "jfly"; + githubId = 277474; + keys = [{ + fingerprint = "F1F1 3395 8E8E 9CC4 D9FC 9647 1931 9CD8 416A 642B"; + }]; }; jfroche = { name = "Jean-François Roche"; @@ -8095,11 +8643,6 @@ githubId = 31008330; name = "Jann Marc Villablanca"; }; - jgarcia = { - github = "chewblacka"; - githubId = 18430320; - name = "John Garcia"; - }; jgart = { email = "jgart@dismail.de"; github = "jgarte"; @@ -8130,6 +8673,12 @@ githubId = 6445082; name = "Joseph Lukasik"; }; + jgoux = { + email = "hi@jgoux.dev"; + github = "jgoux"; + githubId = 1443499; + name = "Julien Goux"; + }; jhh = { email = "jeff@j3ff.io"; github = "jhh"; @@ -8203,6 +8752,12 @@ githubId = 3081095; name = "Jürgen Keck"; }; + jl178 = { + email = "jeredlittle1996@gmail.com"; + github = "jl178"; + githubId = 72664723; + name = "Jered Little"; + }; jlamur = { email = "contact@juleslamur.fr"; github = "jlamur"; @@ -8432,6 +8987,12 @@ githubId = 6321578; name = "John Rinehart"; }; + john-rodewald = { + email = "jnrodewald99@gmail.com"; + github = "john-rodewald"; + githubId = 51028009; + name = "John Rodewald"; + }; john-shaffer = { email = "jdsha@proton.me"; github = "john-shaffer"; @@ -8530,6 +9091,12 @@ github = "jorsn"; githubId = 4646725; }; + joscha = { + name = "Joscha Loos"; + email = "j.loos@posteo.net"; + github = "jooooscha"; + githubId = 57965027; + }; josephst = { name = "Joseph Stahl"; email = "hello@josephstahl.com"; @@ -8572,6 +9139,12 @@ githubId = 1918771; name = "Joe Doyle"; }; + jpentland = { + email = "joe.pentland@gmail.com"; + github = "jpentland"; + githubId = 1135582; + name = "Joe Pentland"; + }; jperras = { email = "joel@nerderati.com"; github = "jperras"; @@ -8596,6 +9169,12 @@ githubId = 752510; name = "Martin Potier"; }; + jpts = { + email = "james+nixpkgs@cleverley-prance.uk"; + github = "jpts"; + githubId = 5352661; + name = "James Cleverley-Prance"; + }; jqqqqqqqqqq = { email = "jqqqqqqqqqq@gmail.com"; github = "jqqqqqqqqqq"; @@ -8704,6 +9283,12 @@ githubId = 1189739; name = "Julio Borja Barra"; }; + jue89 = { + email = "me@jue.yt"; + github = "jue89"; + githubId = 6105784; + name = "Juergen Fitschen"; + }; jugendhacker = { name = "j.r"; email = "j.r@jugendhacker.de"; @@ -8760,6 +9345,12 @@ githubId = 5124422; name = "Julien Urraca"; }; + justanotherariel = { + email = "ariel@ebersberger.io"; + github = "justanotherariel"; + githubId = 31776703; + name = "Ariel Ebersberger"; + }; justinas = { email = "justinas@justinas.org"; github = "justinas"; @@ -8848,6 +9439,15 @@ githubId = 386765; matrix = "@k900:0upti.me"; }; + kachick = { + email = "kachick1@gmail.com"; + github = "kachick"; + githubId = 1180335; + name = "Kenichi Kamiya"; + keys = [{ + fingerprint = "9121 5D87 20CA B405 C63F 24D2 EF6E 574D 040A E2A5"; + }]; + }; kaction = { name = "Dmitry Bogatov"; email = "KAction@disroot.org"; @@ -8937,6 +9537,7 @@ katexochen = { github = "katexochen"; githubId = 49727155; + matrix = "@katexochen:matrix.org"; name = "Paul Meyer"; }; kayhide = { @@ -9201,6 +9802,12 @@ githubId = 691290; name = "Keshav Kini"; }; + kinzoku = { + email = "kinzokudev4869@gmail.com"; + github = "kinzoku-dev"; + githubId = 140647311; + name = "Ayman Hamza"; + }; kip93 = { name = "Leandro Reina Kiperman"; email = "leandro@kip93.net"; @@ -9624,12 +10231,23 @@ }]; name = "Joseph LaFreniere"; }; + lagoja = { + github = "Lagoja"; + githubId =750845; + name = "John Lago"; + }; laikq = { email = "gwen@quasebarth.de"; github = "laikq"; githubId = 55911173; name = "Gwendolyn Quasebarth"; }; + lamarios = { + matrix = "@lamarios:matrix.org"; + github = "lamarios"; + githubId = 1192563; + name = "Paul Fauchon"; + }; lambda-11235 = { email = "taranlynn0@gmail.com"; github = "lambda-11235"; @@ -9683,6 +10301,12 @@ githubId = 21087104; name = "Laurent Fainsin"; }; + lavafroth = { + email = "lavafroth@protonmail.com"; + github = "lavafroth"; + githubId = 107522312; + name = "Himadri Bhattacharjee"; + }; layus = { email = "layus.on@gmail.com"; github = "layus"; @@ -9726,6 +10350,13 @@ githubId = 2472678; name = "Lucas Desgouilles"; }; + ldprg = { + email = "lukas_4dr@gmx.at"; + matrix = "@ldprg:matrix.org"; + github = "LDprg"; + githubId = 71488985; + name = "LDprg"; + }; league = { email = "league@contrapunctus.net"; github = "league"; @@ -9744,6 +10375,15 @@ githubId = 887072; name = "Alexander Lebedev"; }; + lecoqjacob = { + name = "Jacob LeCoq"; + email = "lecoqjacob@gmail.com"; + githubId = 9278174; + github = "lecoqjacob"; + keys = [{ + fingerprint = "C505 1E8B 06AC 1776 6875 1B60 93AF DAD0 10B3 CB8D"; + }]; + }; ledif = { email = "refuse@gmail.com"; github = "ledif"; @@ -9935,6 +10575,17 @@ githubId = 3696783; name = "Leroy Hopson"; }; + liketechnik = { + name = "Florian Warzecha"; + + email = "liketechnik@disroot.org"; + github = "liketechnik"; + githubId = 24209689; + + keys = [{ + fingerprint = "92D8 A09D 03DD B774 AABD 53B9 E136 2F07 D750 DB5C"; + }]; + }; lillycham = { email = "lillycat332@gmail.com"; github = "lillycat332"; @@ -10222,6 +10873,16 @@ githubId = 8555953; name = "Laure Tavard"; }; + ltstf1re = { + email = "ltstf1re@disroot.org"; + github = "lsf1re"; + githubId = 153414530; + matrix = "@ltstf1re:converser.eu"; + name = "Little Starfire"; + keys = [{ + fingerprint = "FE6C C3C9 2ACF 4367 2B56 5B22 8603 2ACC 051A 873D"; + }]; + }; lu15w1r7h = { email = "lwirth2000@gmail.com"; github = "LU15W1R7H"; @@ -10264,6 +10925,12 @@ githubId = 2487922; name = "Lars Jellema"; }; + ludat = { + email = "lucas6246@gmail.com"; + github = "ludat"; + githubId = 4952044; + name = "Lucas David Traverso"; + }; ludo = { email = "ludo@gnu.org"; github = "civodul"; @@ -10344,18 +11011,18 @@ fingerprint = "97A0 AE5E 03F3 499B 7D7A 65C6 76A4 1432 37EF 5817"; }]; }; + lukas-heiligenbrunner = { + email = "lukas.heiligenbrunner@gmail.com"; + github = "lukas-heiligenbrunner"; + githubId = 30468956; + name = "Lukas Heiligenbrunner"; + }; lukaswrz = { email = "lukas@wrz.one"; github = "lukaswrz"; githubId = 84395723; name = "Lukas Wurzinger"; }; - lukeadams = { - email = "luke.adams@belljar.io"; - github = "lukeadams"; - githubId = 3508077; - name = "Luke Adams"; - }; lukebfox = { email = "lbentley-fox1@sheffield.ac.uk"; github = "lukebfox"; @@ -10381,6 +11048,12 @@ githubId = 2486026; name = "Luca Fulchir"; }; + luleyleo = { + email = "git@leopoldluley.de"; + github = "luleyleo"; + githubId = 10746692; + name = "Leopold Luley"; + }; lumi = { email = "lumi@pew.im"; github = "lumi-me-not"; @@ -10478,9 +11151,6 @@ github = "Ma27"; githubId = 6025220; name = "Maximilian Bosch"; - keys = [{ - fingerprint = "62B9 9C26 F046 721E 26B0 04F6 D006 A998 C6AB FDF1"; - }]; }; ma9e = { email = "sean@lfo.team"; @@ -10662,6 +11332,12 @@ githubId = 3507; name = "Michael Fellinger"; }; + maolonglong = { + email = "shaolong.chen@outlook.it"; + github = "maolonglong"; + githubId = 50797868; + name = "Shaolong Chen"; + }; maralorn = { email = "mail@maralorn.de"; matrix = "@maralorn:maralorn.de"; @@ -10669,6 +11345,12 @@ githubId = 1651325; name = "maralorn"; }; + marcovergueira = { + email = "vergueira.marco@gmail.com"; + github = "marcovergueira"; + githubId = 929114; + name = "Marco Vergueira"; + }; marcus7070 = { email = "marcus@geosol.com.au"; github = "marcus7070"; @@ -10718,6 +11400,12 @@ github = "marius851000"; githubId = 22586596; }; + mariuskimmina = { + email = "mar.kimmina@gmail.com"; + name = "Marius Kimmina"; + github = "mariuskimmina"; + githubId = 38843153; + }; markbeep = { email = "mrkswrn@gmail.com"; github = "markbeep"; @@ -10771,6 +11459,12 @@ githubId = 458783; name = "Martin Gammelsæter"; }; + martinjlowm = { + email = "martin@martinjlowm.dk"; + github = "martinjlowm"; + githubId = 110860; + name = "Martin Jesper Low Madsen"; + }; martinramm = { email = "martin-ramm@gmx.de"; github = "MartinRamm"; @@ -10804,6 +11498,18 @@ githubId = 29855073; name = "Michael Colicchia"; }; + massimogengarelli = { + email = "massimo.gengarelli@gmail.com"; + github = "massix"; + githubId = 585424; + name = "Massimo Gengarelli"; + }; + matdibu = { + email = "contact@mateidibu.dev"; + github = "matdibu"; + githubId = 24750154; + name = "Matei Dibu"; + }; matejc = { email = "cotman.matej@gmail.com"; github = "matejc"; @@ -10919,12 +11625,24 @@ githubId = 279868; name = "Matti Kariluoma"; }; + mattpolzin = { + email = "matt.polzin@gmail.com"; + github = "mattpolzin"; + githubId = 2075353; + name = "Matt Polzin"; + }; matt-snider = { email = "matt.snider@protonmail.com"; github = "matt-snider"; githubId = 11810057; name = "Matt Snider"; }; + matusf = { + email = "matus.ferech@gmail.com"; + github = "matusf"; + githubId = 18228995; + name = "Matúš Ferech"; + }; maurer = { email = "matthew.r.maurer+nix@gmail.com"; github = "maurer"; @@ -10973,18 +11691,18 @@ githubId = 1187050; name = "Maximilian Huber"; }; + maxhearnden = { + email = "max@hearnden.org.uk"; + github = "MaxHearnden"; + githubId = 8320393; + name = "Max Hearnden"; + }; maxhero = { email = "contact@maxhero.dev"; github = "themaxhero"; githubId = 4708337; name = "Marcelo A. de L. Santos"; }; - maxhille = { - email = "mh@lambdasoup.com"; - github = "maxhille"; - githubId = 693447; - name = "Max Hille"; - }; maximsmol = { email = "maximsmol@gmail.com"; github = "maximsmol"; @@ -11227,6 +11945,12 @@ github = "Mephistophiles"; githubId = 4850908; }; + mevatron = { + email = "mevatron@gmail.com"; + name = "mevatron"; + github = "mevatron"; + githubId = 714585; + }; mfossen = { email = "msfossen@gmail.com"; github = "mfossen"; @@ -11448,6 +12172,12 @@ githubId = 34864484; name = "Mikael Fangel"; }; + mikecm = { + email = "mikecmcleod@gmail.com"; + github = "MaxwellDupre"; + githubId = 14096356; + name = "Michael McLeod"; + }; mikefaille = { email = "michael@faille.io"; github = "mikefaille"; @@ -11507,7 +12237,7 @@ }; milran = { email = "milranmike@protonmail.com"; - github = "milran"; + github = "wattmto"; githubId = 93639059; name = "Milran Mike"; }; @@ -11523,6 +12253,12 @@ githubId = 9799623; name = "Rick van Schijndel"; }; + mindstorms6 = { + email = "breland@bdawg.org"; + github = "mindstorms6"; + githubId = 92937; + name = "Breland Miley"; + }; minijackson = { email = "minijackson@riseup.net"; github = "minijackson"; @@ -11560,12 +12296,28 @@ githubId = 149558; name = "Merlin Gaillard"; }; + mirkolenz = { + name = "Mirko Lenz"; + email = "mirko@mirkolenz.com"; + matrix = "@mlenz:matrix.org"; + github = "mirkolenz"; + githubId = 5160954; + }; mirrexagon = { email = "mirrexagon@mirrexagon.com"; github = "mirrexagon"; githubId = 1776903; name = "Andrew Abbott"; }; + mirrorwitch = { + email = "mirrorwitch@transmom.love"; + github = "mirrorwitch"; + githubId = 146672255; + name = "mirrorwitch"; + keys = [{ + fingerprint = "C3E7 F8C4 9CBC 9320 D360 B117 8516 D0FA 7D8F 58FC"; + }]; + }; Misaka13514 = { name = "Misaka13514"; email = "Misaka13514@gmail.com"; @@ -11709,7 +12461,7 @@ name = "Martin Milata"; }; mmlb = { - email = "manny@peekaboo.mmlb.icu"; + email = "i@m.mmlb.dev"; github = "mmlb"; githubId = 708570; name = "Manuel Mendez"; @@ -11767,6 +12519,13 @@ github = "ribosomerocker"; githubId = 46468162; }; + moni = { + email = "lythe1107@gmail.com"; + matrix = "@fortuneteller2k:matrix.org"; + github = "moni-dz"; + githubId = 20619776; + name = "moni"; + }; monsieurp = { email = "monsieurp@gentoo.org"; github = "monsieurp"; @@ -11918,12 +12677,30 @@ github = "MrTarantoga"; githubId = 53876219; }; + mrtnvgr = { + name = "Egor Martynov"; + github = "mrtnvgr"; + githubId = 48406064; + keys = [{ + fingerprint = "6FAD DB43 D5A5 FE52 6835 0943 5B33 79E9 81EF 48B1"; + }]; + }; mrVanDalo = { email = "contact@ingolf-wagner.de"; github = "mrVanDalo"; githubId = 839693; name = "Ingolf Wanger"; }; + msanft = { + email = "moritz.sanft@outlook.de"; + matrix = "@msanft:matrix.org"; + name = "Moritz Sanft"; + github = "msanft"; + githubId = 58110325; + keys = [{ + fingerprint = "3CAC 1D21 3D97 88FF 149A E116 BB8B 30F5 A024 C31C"; + }]; + }; mschristiansen = { email = "mikkel@rheosystems.com"; github = "mschristiansen"; @@ -12138,6 +12915,12 @@ githubId = 9636071; name = "Myrl Hex"; }; + n00b0ss = { + email = "nixpkgs@n00b0ss.de"; + github = "n00b0ss"; + githubId = 61601147; + name = "basti n00b0ss"; + }; n0emis = { email = "nixpkgs@n0emis.network"; github = "n0emis"; @@ -12154,6 +12937,11 @@ fingerprint = "9E6A 25F2 C1F2 9D76 ED00 1932 1261 173A 01E1 0298"; }]; }; + nadir-ishiguro = { + github = "nadir-ishiguro"; + githubId = 23151917; + name = "nadir-ishiguro"; + }; nadrieril = { email = "nadrieril@gmail.com"; github = "Nadrieril"; @@ -12197,6 +12985,11 @@ githubId = 6709831; name = "Jake Hill"; }; + nasageek = { + github = "NasaGeek"; + githubId = 474937; + name = "Chris Roberts"; + }; nasirhm = { email = "nasirhussainm14@gmail.com"; github = "nasirhm"; @@ -12217,6 +13010,12 @@ githubId = 330943; name = "Nathan Bijnens"; }; + nathanielbrough = { + github = "silvergasp"; + githubId = 7277663; + email = "nathaniel.brough@gmail.com"; + name = "Nathaniel Brough"; + }; nathanruiz = { email = "nathanruiz@protonmail.com"; github = "nathanruiz"; @@ -12263,6 +13062,13 @@ githubId = 1386642; name = "Noah Brenowitz"; }; + nbsp = { + email = "aoife@enby.space"; + matrix = "@nbsp:enby.space"; + github = "enbyspace"; + githubId = 57151943; + name = "aoife cassidy"; + }; ncfavier = { email = "n@monade.li"; matrix = "@ncfavier:matrix.org"; @@ -12291,6 +13097,12 @@ githubId = 77314501; name = "Maurice Zhou"; }; + Nebucatnetzer = { + email = "andreas+nixpkgs@zweili.ch"; + github = "Nebucatnetzer"; + githubId = 2287221; + name = "Andreas Zweili"; + }; Necior = { email = "adrian@sadlocha.eu"; github = "Necior"; @@ -12402,6 +13214,12 @@ githubId = 13920346; name = "Sébastien Iooss"; }; + netthier = { + email = "netthier@proton.me"; + name = "nett_hier"; + github = "netthier"; + githubId = 66856670; + }; networkexception = { name = "networkException"; email = "nix@nwex.de"; @@ -12505,6 +13323,15 @@ githubId = 8214542; name = "Nicolò Balzarotti"; }; + nicolas-goudry = { + email = "goudry.nicolas@gmail.com"; + github = "nicolas-goudry"; + githubId = 8753998; + name = "Nicolas Goudry"; + keys = [{ + fingerprint = "21B6 A59A 4E89 0B1B 83E3 0CDB 01C8 8C03 5450 9AA9"; + }]; + }; nicoo = { email = "nicoo@debian.org"; github = "nbraud"; @@ -12547,6 +13374,13 @@ githubId = 6391776; name = "Nikita Voloboev"; }; + niklaskorz = { + name = "Niklas Korz"; + email = "niklas@niklaskorz.de"; + matrix = "@niklaskorz:korz.dev"; + github = "niklaskorz"; + githubId = 590517; + }; NikolaMandic = { email = "nikola@mandic.email"; github = "NikolaMandic"; @@ -12587,12 +13421,11 @@ fingerprint = "9B1A 7906 5D2F 2B80 6C8A 5A1C 7D2A CDAF 4653 CF28"; }]; }; - ninjatrappeur = { - email = "felix@alternativebit.fr"; - matrix = "@ninjatrappeur:matrix.org"; - github = "NinjaTrappeur"; - githubId = 1219785; - name = "Félix Baylac-Jacqué"; + ninjafb = { + email = "oscar@oronberg.com"; + github = "NinjaFB"; + githubId = 54169044; + name = "NinjaFB"; }; nintron = { email = "nintron@sent.com"; @@ -12633,6 +13466,11 @@ githubId = 66913205; name = "Rick Sanchez"; }; + nix-julia = { + name = "nix-julia"; + github = "nix-julia"; + githubId = 149073815; + }; nixy = { email = "nixy@nixy.moe"; github = "nixy"; @@ -12709,6 +13547,13 @@ githubId = 40049608; name = "Andy Chun"; }; + noodlez1232 = { + email = "contact@nathanielbarragan.xyz"; + matrix = "@noodlez1232:matrix.org"; + github = "Noodlez1232"; + githubId = 12480453; + name = "Nathaniel Barragan"; + }; nook = { name = "Tom Nook"; email = "0xnook@protonmail.com"; @@ -12727,6 +13572,12 @@ githubId = 3521180; name = "Tom Sydney Kerckhove"; }; + nosewings = { + name = "Nicholas Coltharp"; + email = "coltharpnicholas@gmail.com"; + github = "nosewings"; + githubId = 24929858; + }; NotAShelf = { name = "NotAShelf"; email = "raf@notashelf.dev"; @@ -12792,6 +13643,19 @@ githubId = 9939720; name = "Philippe Nguyen"; }; + npulidomateo = { + matrix = "@npulidomateo:matrix.org"; + github = "npulidomateo"; + githubId = 13149442; + name = "Nico Pulido-Mateo"; + }; + nrabulinski = { + email = "1337-nix@nrab.lol"; + matrix = "@niko:nrab.lol"; + github = "nrabulinski"; + githubId = 24574288; + name = "Nikodem Rabuliński"; + }; nrdxp = { email = "tim.deh@pm.me"; matrix = "@timdeh:matrix.org"; @@ -12829,6 +13693,12 @@ githubId = 1839979; name = "Niklas Thörne"; }; + nudelsalat = { + email = "nudelsalat@clouz.de"; + name = "Fabian Dreßler"; + github = "Noodlesalat"; + githubId = 12748782; + }; nukaduka = { email = "ksgokte@gmail.com"; github = "NukaDuka"; @@ -12867,7 +13737,8 @@ name = "Nathan Viets"; }; nyanbinary = { - email = "vextium@skiff.com"; + email = "nyanbinary@keemail.me"; + matrix = "@niko:conduit.rs"; github = "nyabinary"; githubId = 97130632; name = "Niko"; @@ -13012,6 +13883,12 @@ githubId = 72201; name = "Ole Jørgen Brønner"; }; + oliver-koss = { + email = "oliver.koss06@gmail.com"; + github = "oliver-koss"; + githubId = 39134647; + name = "Oliver Koss"; + }; ollieB = { github = "oliverbunting"; githubId = 1237862; @@ -13113,10 +13990,10 @@ name = "Sandro Stikić"; }; OPNA2608 = { - email = "christoph.neidahl@gmail.com"; + email = "opna2608@protonmail.com"; github = "OPNA2608"; githubId = 23431373; - name = "Christoph Neidahl"; + name = "Cosima Neidahl"; }; orbekk = { email = "kjetil.orbekk@gmail.com"; @@ -13130,6 +14007,15 @@ githubId = 75299; name = "Malcolm Matalka"; }; + orhun = { + email = "orhunparmaksiz@gmail.com"; + github = "orhun"; + githubId = 24392180; + name = "Orhun Parmaksız"; + keys = [{ + fingerprint = "165E 0FF7 C48C 226E 1EC3 63A7 F834 2482 4B3E 4B90"; + }]; + }; orichter = { email = "richter-oliver@gmx.net"; github = "ORichterSec"; @@ -13252,6 +14138,12 @@ github = "p3psi-boo"; githubId = 43925055; }; + pabloaul = { + email = "contact@nojus.org"; + github = "pabloaul"; + githubId = 35423980; + name = "Nojus Dulskis"; + }; pablovsky = { email = "dealberapablo07@gmail.com"; github = "Pablo1107"; @@ -13374,6 +14266,12 @@ githubId = 6931743; name = "pasqui23"; }; + passivelemon = { + email = "jeremyseber@gmail.com"; + github = "PassiveLemon"; + githubId = 72527881; + name = "PassiveLemon"; + }; patricksjackson = { email = "patrick@jackson.dev"; github = "patricksjackson"; @@ -13401,6 +14299,23 @@ githubId = 15645854; name = "Brad Christensen"; }; + patwid = { + email = "patrick.widmer@tbwnet.ch"; + github = "patwid"; + githubId = 25278658; + name = "Patrick Widmer"; + }; + paulsmith = { + email = "paulsmith@pobox.com"; + github = "paulsmith"; + name = "Paul Smith"; + githubId = 1210; + }; + paumr = { + github = "paumr"; + name = "Michael Bergmeister"; + githubId = 53442728; + }; paveloom = { email = "paveloom@riseup.net"; github = "paveloom"; @@ -13462,6 +14377,7 @@ pbsds = { name = "Peder Bergebakken Sundt"; email = "pbsds@hotmail.com"; + matrix = "@pederbs:pvv.ntnu.no"; github = "pbsds"; githubId = 140964; }; @@ -13513,6 +14429,12 @@ githubId = 152312; name = "Periklis Tsirakidis"; }; + perstark = { + email = "perstark.se@gmail.com"; + github = "perstarkse"; + githubId = 63069986; + name = "Per Stark"; + }; petercommand = { email = "petercommand@gmail.com"; github = "petercommand"; @@ -13630,6 +14552,12 @@ githubId = 9267430; name = "Philipp Mildenberger"; }; + philiptaron = { + email = "philip.taron@gmail.com"; + github = "philiptaron"; + githubId = 43863; + name = "Philip Taron"; + }; phip1611 = { email = "phip1611@gmail.com"; github = "phip1611"; @@ -13654,6 +14582,12 @@ githubId = 301903; name = "Chip Collier"; }; + phrogg = { + name = "Phil Roggenbuck"; + email = "nixpkgs@phrogg.de"; + github = "phrogg"; + githubId = 1367949; + }; phryneas = { email = "mail@lenzw.de"; github = "phryneas"; @@ -13666,6 +14600,13 @@ githubId = 627831; name = "Hoang Xuan Phu"; }; + picnoir = { + email = "felix@alternativebit.fr"; + matrix = "@picnoir:alternativebit.fr"; + github = "picnoir"; + githubId = 1219785; + name = "Félix Baylac-Jacqué"; + }; piegames = { name = "piegames"; email = "nix@piegames.de"; @@ -13781,6 +14722,18 @@ githubId = 610615; name = "Chih-Mao Chen"; }; + pkosel = { + name = "pkosel"; + email = "philipp.kosel@gmail.com"; + github = "pkosel"; + githubId = 170943; + }; + pks = { + email = "ps@pks.im"; + github = "pks-t"; + githubId = 4056630; + name = "Patrick Steinhardt"; + }; plabadens = { name = "Pierre Labadens"; email = "labadens.pierre+nixpkgs@gmail.com"; @@ -13790,15 +14743,6 @@ fingerprint = "B00F E582 FD3F 0732 EA48 3937 F558 14E4 D687 4375"; }]; }; - PlayerNameHere = { - name = "Dixon Sean Low Yan Feng"; - email = "dixonseanlow@protonmail.com"; - github = "dixslyf"; - githubId = 56017218; - keys = [{ - fingerprint = "E6F4 BFB4 8DE3 893F 68FC A15F FF5F 4B30 A41B BAC8"; - }]; - }; plchldr = { email = "mail@oddco.de"; github = "plchldr"; @@ -13817,12 +14761,25 @@ githubId = 7839004; name = "Dmitriy Pleshevskiy"; }; + pluiedev = { + email = "hi@pluie.me"; + github = "pluiedev"; + githubId = 22406910; + name = "Leah Amelia Chen"; + }; plumps = { email = "maks.bronsky@web.de"; github = "plumps"; githubId = 13000278; name = "Maksim Bronsky"; }; + plusgut = { + name = "Carlo Jeske"; + email = "carlo.jeske+nixpkgs@webentwickler2-0.de"; + github = "plusgut"; + githubId = 277935; + matrix = "@plusgut5:matrix.org"; + }; PlushBeaver = { name = "Dmitry Kozlyuk"; email = "dmitry.kozliuk+nixpkgs@gmail.com"; @@ -13965,7 +14922,7 @@ name = "Pedro Pombeiro"; }; pongo1231 = { - email = "pongo1999712@gmail.com"; + email = "pongo12310@gmail.com"; github = "pongo1231"; githubId = 4201956; name = "pongo1231"; @@ -13991,6 +14948,11 @@ githubId = 146413; name = "Tobias Poschwatta"; }; + poweredbypie = { + name = "poweredbypie"; + github = "poweredbypie"; + githubId = 67135060; + }; PowerUser64 = { email = "blakelysnorth@gmail.com"; github = "PowerUser64"; @@ -14076,6 +15038,12 @@ name = "Philipp Rintz"; matrix = "@philipp:srv.icu"; }; + prit342 = { + email = "prithak342@gmail.com"; + github = "prit342"; + githubId = 20863431; + name = "Prithak S."; + }; ProducerMatt = { name = "Matthew Pherigo"; email = "ProducerMatt42@gmail.com"; @@ -14094,12 +15062,24 @@ githubId = 18549627; name = "Proglodyte"; }; + proglottis = { + email = "proglottis@gmail.com"; + github = "proglottis"; + githubId = 74465; + name = "James Fargher"; + }; progval = { email = "progval+nix@progval.net"; github = "progval"; githubId = 406946; name = "Valentin Lorentz"; }; + prominentretail = { + email = "me@jakepark.me"; + github = "ProminentRetail"; + githubId = 94048404; + name = "Jake Park"; + }; proofconstruction = { email = "source@proof.construction"; github = "proofconstruction"; @@ -14277,6 +15257,12 @@ fingerprint = "3586 3350 BFEA C101 DB1A 4AF0 1F81 112D 62A9 ADCE"; }]; }; + qdlmcfresh = { + name = "Philipp Urlbauer"; + email = "qdlmcfresh@gmail.com"; + github = "qdlmcfresh"; + githubId = 10837173; + }; qjoly = { email = "github@thoughtless.eu"; github = "qjoly"; @@ -14309,7 +15295,7 @@ }; quantenzitrone = { email = "quantenzitrone@protonmail.com"; - github = "Quantenzitrone"; + github = "quantenzitrone"; githubId = 74491719; matrix = "@quantenzitrone:matrix.org"; name = "quantenzitrone"; @@ -14341,6 +15327,12 @@ githubId = 1332289; name = "Quentin Machu"; }; + quinn-dougherty = { + email = "quinnd@riseup.net"; + github = "quinn-dougherty"; + githubId = 39039420; + name = "Quinn Dougherty"; + }; qyliss = { email = "hi@alyssa.is"; github = "alyssais"; @@ -14385,6 +15377,12 @@ githubId = 1016742; name = "Rafael García"; }; + rafaelrc = { + email = "contact@rafaelrc.com"; + name = "Rafael Carvalho"; + github = "rafaelrc7"; + githubId = 5376043; + }; ragge = { email = "r.dahlen@gmail.com"; github = "ragnard"; @@ -14410,6 +15408,15 @@ githubId = 314564; name = "Ryan Lahfa"; }; + rake5k = { + email = "christian@harke.ch"; + github = "rake5k"; + githubId = 13007345; + name = "Christian Harke"; + keys = [{ + fingerprint = "4EBB 30F1 E89A 541A A7F2 52BE 830A 9728 6309 66F4"; + }]; + }; rakesh4g = { email = "rakeshgupta4u@gmail.com"; github = "Rakesh4G"; @@ -14497,6 +15504,12 @@ githubId = 145816; name = "David McKay"; }; + rayslash = { + email = "stevemathewjoy@tutanota.com"; + github = "rayslash"; + githubId = 45141270; + name = "Steve Mathew Joy"; + }; razvan = { email = "razvan.panda@gmail.com"; github = "freeman42x"; @@ -14584,6 +15597,12 @@ githubId = 816465; name = "Redvers Davies"; }; + redxtech = { + email = "gabe@gabedunn.dev"; + github = "redxtech"; + githubId = 18155001; + name = "Gabe Dunn"; + }; reedrw = { email = "reedrw5601@gmail.com"; github = "reedrw"; @@ -14650,10 +15669,16 @@ githubId = 3302; name = "Renzo Carbonara"; }; + rettetdemdativ = { + email = "michael@koeppl.dev"; + github = "rettetdemdativ"; + githubId = 5265630; + name = "Michael Köppl"; + }; revol-xut = { email = "revol-xut@protonmail.com"; name = "Tassilo Tanneberger"; - github = "revol-xut"; + github = "tanneberger"; githubId = 32239737; keys = [{ fingerprint = "91EB E870 1639 1323 642A 6803 B966 009D 57E6 9CC6"; @@ -14671,6 +15696,21 @@ githubId = 165283; name = "Alexey Kutepov"; }; + rexxDigital = { + email = "joellarssonpriv@gmail.com"; + github = "rexxDigital"; + githubId = 44014925; + name = "Rexx Larsson"; + }; + RGBCube = { + name = "RGBCube"; + email = "rgbsphere+nixpkgs@gmail.com"; + github = "RGBCube"; + githubId = 78925721; + keys = [{ + fingerprint = "jPaU3Vpm/GN0tUuDg72n2+bd9dDMWe4bnKM325eP7eI"; + }]; + }; rgnns = { email = "jglievano@gmail.com"; github = "rgnns"; @@ -14743,6 +15783,12 @@ githubId = 42619; name = "Wei-Ming Yang"; }; + rickvanprim = { + email = "me@rickvanprim.com"; + github = "rickvanprim"; + githubId = 13792812; + name = "James Leitch"; + }; rickynils = { email = "rickynils@gmail.com"; github = "rickynils"; @@ -14813,6 +15859,12 @@ githubId = 7221768; name = "Andika Demas Riyandi"; }; + rjpcasalino = { + email = "ryan@rjpc.net"; + github = "rjpcasalino"; + githubId = 12821230; + name = "Ryan J.P. Casalino"; + }; rkitover = { email = "rkitover@gmail.com"; github = "rkitover"; @@ -14951,6 +16003,12 @@ githubId = 69053978; name = "rogarb"; }; + rollf = { + email = "rolf.schroeder@limbus-medtec.com"; + github = "rollf"; + githubId = 58295931; + name = "Rolf Schröder"; + }; roman = { email = "open-source@roman-gonzalez.info"; github = "roman"; @@ -15063,15 +16121,6 @@ }]; name = "Rahul Butani"; }; - rs0vere = { - email = "rs0vere@proton.me"; - github = "rs0vere"; - githubId = 140035635; - keys = [{ - fingerprint = "C6D8 B5C2 FA79 901B DCCF 95E1 FEC4 5C5A ED00 C58D"; - }]; - name = "Red Star Over Earth"; - }; rski = { name = "rski"; email = "rom.skiad+nix@gmail.com"; @@ -15096,6 +16145,12 @@ githubId = 47790121; name = "Ryan Burns"; }; + rtimush = { + email = "rtimush@gmail.com"; + github = "rtimush"; + githubId = 831307; + name = "Roman Timushev"; + }; rtreffer = { email = "treffer+nixos@measite.de"; github = "rtreffer"; @@ -15131,6 +16186,15 @@ github = "rumpelsepp"; githubId = 1961699; }; + running-grass = { + name = "Leo Liu"; + email = "hi@grass.show"; + github = "running-grass"; + githubId = 17241154; + keys = [{ + fingerprint = "5156 0FAB FF32 83EC BC8C EA13 9344 3660 9397 0138"; + }]; + }; rushmorem = { email = "rushmore@webenchanter.com"; github = "rushmorem"; @@ -15212,6 +16276,12 @@ fingerprint = "E4F4 1EAB BF0F C785 06D8 62EF EF68 CF41 D42A 593D"; }]; }; + ryangibb = { + email = "ryan@freumh.org"; + github = "ryangibb"; + githubId = 22669046; + name = "Ryan Gibb"; + }; ryanorendorff = { github = "ryanorendorff"; githubId = 12442942; @@ -15328,7 +16398,7 @@ SamirTalwar = { email = "lazy.git@functional.computer"; github = "SamirTalwar"; - githubId = 47852; + githubId = 47582; name = "Samir Talwar"; }; samlich = { @@ -15365,12 +16435,27 @@ githubId = 132835; name = "Samuel Dionne-Riel"; }; + samuel-martineau = { + name = "Samuel Martineau"; + email = "samuel@smartineau.me"; + github = "Samuel-Martineau"; + githubId = 44237969; + keys = [{ + fingerprint = "79A1 CC17 67C7 32B6 A8A2 BF4F 71E0 8761 642D ACD2"; + }]; + }; samuelrivas = { email = "samuelrivas@gmail.com"; github = "samuelrivas"; githubId = 107703; name = "Samuel Rivas"; }; + samueltardieu = { + email = "nixpkgs@sam.rfc1149.net"; + github = "samueltardieu"; + githubId = 44656; + name = "Samuel Tardieu"; + }; samw = { email = "sam@wlcx.cc"; github = "wlcx"; @@ -15475,6 +16560,12 @@ githubId = 3958212; name = "Tom Sorlie"; }; + schinmai-akamai = { + email = "schinmai@akamai.com"; + github = "schinmai-akamai"; + githubId = 70169773; + name = "Tarun Chinmai Sekar"; + }; schmitthenner = { email = "development@schmitthenner.eu"; github = "fkz"; @@ -15498,6 +16589,11 @@ githubId = 5104601; name = "schnusch"; }; + Schweber = { + github = "Schweber"; + githubId = 64630479; + name = "Schweber"; + }; sciencentistguy = { email = "jamie@quigley.xyz"; name = "Jamie Quigley"; @@ -15635,6 +16731,12 @@ githubId = 4927883; matrix = "@seirl:matrix.org"; }; + selfuryon = { + name = "Sergei Iakovlev"; + email = "siakovlev@pm.me"; + github = "selfuryon"; + githubId = 2993917; + }; sellout = { email = "greg@technomadic.org"; github = "sellout"; @@ -15739,13 +16841,6 @@ fingerprint = "7246 B6E1 ABB9 9A48 4395 FD11 DC26 B921 A9E9 DBDE"; }]; }; - sfr = { - email = "sol@solfisher.com"; - matrix = "@sfr:enby.space"; - github = "solfisher"; - githubId = 57151943; - name = "Sol Fisher Romanoff"; - }; sfrijters = { email = "sfrijters@gmail.com"; github = "SFrijters"; @@ -15758,6 +16853,13 @@ githubId = 75371; name = "Stig Palmquist"; }; + sg-qwt = { + email = "hello@edgerunners.eu.org"; + matrix = "@dhl:edgerunners.eu.org"; + github = "sg-qwt"; + name = "sg-qwt"; + githubId = 115715554; + }; sgraf = { email = "sgraf1337@gmail.com"; github = "sgraf812"; @@ -15769,6 +16871,12 @@ githubId = 543055; name = "Shadaj Laddad"; }; + shaddydc = { + email = "nixpkgs@shaddy.dev"; + github = "ShaddyDC"; + githubId = 18403034; + name = "Shaddy"; + }; shadowrz = { email = "shadowrz+nixpkgs@disroot.org"; matrix = "@ShadowRZ:matrixim.cc"; @@ -15804,6 +16912,12 @@ }]; name = "Shane Sveller"; }; + shard7 = { + email = "sh7user@gmail.com"; + github = "shard77"; + githubId = 106669955; + name = "Léon Gessner"; + }; shardy = { email = "shardul@baral.ca"; github = "shardulbee"; @@ -15888,6 +17002,12 @@ fingerprint = "AB63 4CD9 3322 BD42 6231 F764 C404 1EA6 B326 33DE"; }]; }; + shivaraj-bh = { + email = "sbh69840@gmail.com"; + name = "Shivaraj B H"; + github = "shivaraj-bh"; + githubId = 23645788; + }; shlevy = { email = "shea@shealevy.com"; github = "shlevy"; @@ -15996,6 +17116,12 @@ fingerprint = "ADF4 C13D 0E36 1240 BD01 9B51 D1DE 6D7F 6936 63A5"; }]; }; + Silver-Golden = { + name = "Brendan Golden"; + email = "github+nixpkgs@brendan.ie"; + github = "Silver-Golden"; + githubId = 7858375; + }; simarra = { name = "simarra"; email = "loic.martel@protonmail.com"; @@ -16014,6 +17140,11 @@ githubId = 50401154; name = "Simone Ruffini"; }; + simonhammes = { + github = "simonhammes"; + githubId = 10352679; + name = "Simon Hammes"; + }; simonkampe = { email = "simon.kampe+nix@gmail.com"; github = "simonkampe"; @@ -16026,6 +17157,13 @@ githubId = 2770647; name = "Simon Vandel Sillesen"; }; + sinanmohd = { + name = "Sinan Mohd"; + email = "sinan@firemail.cc"; + matrix = "@sinan:sinanmohd.com"; + github = "sinanmohd"; + githubId = 69694713; + }; sioodmy = { name = "Antoni Sokołowski"; github = "sioodmy"; @@ -16058,6 +17196,12 @@ fingerprint = "B234 EFD4 2B42 FE81 EE4D 7627 F72C 4A88 7F9A 24CA"; }]; }; + sironheart = { + email = "git@beisenherz.dev"; + github = "Sironheart"; + githubId = 13799656; + name = "Steffen Beisenherz"; + }; sirseruju = { email = "sir.seruju@yandex.ru"; github = "SirSeruju"; @@ -16076,6 +17220,12 @@ githubId = 8017899; name = "Sivaram Balakrishnan"; }; + sixstring982 = { + email = "sixstring982@gmail.com"; + github = "sixstring982"; + githubId = 1328977; + name = "Trent Small"; + }; sjagoe = { email = "simon@simonjagoe.com"; github = "sjagoe"; @@ -16100,17 +17250,27 @@ githubId = 158321; name = "Stewart Mackenzie"; }; - skeidel = { - email = "svenkeidel@gmail.com"; - github = "svenkeidel"; - githubId = 266500; - name = "Sven Keidel"; + skovati = { + github = "skovati"; + githubId = 49844593; + name = "skovati"; }; skykanin = { github = "skykanin"; githubId = 3789764; name = "skykanin"; }; + skyrina = { + email = "sorryu02@gmail.com"; + github = "skyrina"; + githubId = 116099351; + name = "Skylar"; + }; + slam-bert = { + github = "slam-bert"; + githubId = 106779009; + name = "Slambert"; + }; slbtty = { email = "shenlebantongying@gmail.com"; github = "shenlebantongying"; @@ -16191,6 +17351,12 @@ fingerprint = "897E 6BE3 0345 B43D CADD 05B7 290F CF08 1AED B3EC"; }]; }; + smrehman = { + name = "Syed Moiz Ur Rehman"; + email = "smrehman@proton.me"; + github = "syedmoizurrehman"; + githubId = 17818950; + }; sna = { email = "abouzahra.9@wright.edu"; github = "S-NA"; @@ -16226,6 +17392,16 @@ github = "SnO2WMaN"; githubId = 15155608; }; + snowflake = { + email = "snowflake@pissmail.com"; + name = "Snowflake"; + github = "snf1k"; + githubId = 149651684; + matrix = "@snowflake:mozilla.org"; + keys = [{ + fingerprint = "8223 7B6F 2FF4 8F16 B652 6CA3 934F 9E5F 9701 2C0B"; + }]; + }; snpschaaf = { email = "philipe.schaaf@secunet.com"; name = "Philippe Schaaf"; @@ -16265,6 +17441,16 @@ fingerprint = "E067 520F 5EF2 C175 3F60 50C0 BA46 725F 6A26 7442"; }]; }; + soispha = { + name = "Soispha"; + email = "soispha@vhack.eu"; + matrix = "@soispha:vhack.eu"; + github = "soispha"; + githubId = 132207423; + keys = [{ + fingerprint = "9606 FC74 9FCE 1636 0723 D4AD A5E9 4010 C3A6 42AD"; + }]; + }; solson = { email = "scott@solson.me"; matrix = "@solson:matrix.org"; @@ -16285,6 +17471,19 @@ githubId = 9720532; name = "Sergei K"; }; + sontek = { + email = "sontek@gmail.com"; + github = "sontek"; + githubId = 151924; + name = "John Anderson"; + }; + soopyc = { + name = "Cassie Cheung"; + email = "me@soopy.moe"; + github = "soopyc"; + githubId = 13762043; + matrix = "@sophie:nue.soopy.moe"; + }; sophrosyne = { email = "joshuaortiz@tutanota.com"; github = "sophrosyne97"; @@ -16329,6 +17528,11 @@ fingerprint = "75F0 AB7C FE01 D077 AEE6 CAFD 353E 4A18 EE0F AB72"; }]; }; + spacefault = { + github = "spacefault"; + githubId = 74156492; + name = "spacefault"; + }; spacefrogg = { email = "spacefrogg-nixos@meterriblecrew.net"; github = "spacefrogg"; @@ -16484,6 +17688,12 @@ githubId = 327943; name = "Scott Zhu Reeves"; }; + starzation = { + email = "nixpkgs@starzation.net"; + github = "starzation"; + githubId = 145975416; + name = "Starzation"; + }; stasjok = { name = "Stanislav Asunkin"; email = "nixpkgs@stasjok.ru"; @@ -16531,13 +17741,12 @@ name = "Stel Abrego"; }; stepbrobd = { - name = "StepBroBD"; - github = "StepBroBD"; + name = "Yifei Sun"; + email = "ysun@hey.com"; + github = "stepbrobd"; githubId = 81826728; - email = "Hi@StepBroBD.com"; - matrix = "@stepbrobd:matrix.org"; keys = [{ - fingerprint = "5D8B FA8B 286A C2EF 6EE4 8598 F742 B72C 8926 1A51"; + fingerprint = "AC7C 52E6 BA2F E8DE 8F0F 5D78 D973 170F 9B86 DB70"; }]; }; stephank = { @@ -16635,6 +17844,12 @@ githubId = 1694705; name = "Sam Stites"; }; + stnley = { + email = "michael@stnley.io"; + github = "stnley"; + githubId = 64174376; + name = "Michael Stanley"; + }; strager = { email = "strager.nds@gmail.com"; github = "strager"; @@ -16842,6 +18057,12 @@ githubId = 7075751; name = "Patrick Hilhorst"; }; + sysedwinistrator = { + email = "edwin.mowen@gmail.com"; + github = "sysedwinistrator"; + githubId = 71331875; + name = "Edwin Mackenzie-Owen"; + }; szczyp = { email = "qb@szczyp.com"; github = "Szczyp"; @@ -16967,6 +18188,12 @@ githubId = 1901799; name = "Nathan van Doorn"; }; + taranarmo = { + email = "taranarmo@gmail.com"; + github = "taranarmo"; + githubId = 11619234; + name = "Sergey Volkov"; + }; tari = { email = "peter@taricorp.net"; github = "tari"; @@ -17037,12 +18264,23 @@ githubId = 7914437; name = "Thomas Cheronneau"; }; + tc-kaluza = { + github = "tc-kaluza"; + githubId = 101565936; + name = "Tautvydas Cerniauskas"; + }; tckmn = { email = "andy@tck.mn"; github = "tckmn"; githubId = 2389333; name = "Andy Tockman"; }; + teatwig = { + email = "nix@teatwig.net"; + name = "tea"; + github = "teatwig"; + githubId = 18734648; + }; techknowlogick = { email = "techknowlogick@gitea.com"; github = "techknowlogick"; @@ -17215,6 +18453,15 @@ fingerprint = "D2A2 F0A1 E7A8 5E6F B711 DEE5 63A4 4817 A52E AB7B"; }]; }; + theaninova = { + name = "Thea Schöbl"; + email = "dev@theaninova.de"; + github = "Theaninova"; + githubId = 19289296; + keys = [{ + fingerprint = "6C9E EFC5 1AE0 0131 78DE B9C8 68FF FB1E C187 88CA"; + }]; + }; the-argus = { email = "i.mcfarlane2002@gmail.com"; github = "the-argus"; @@ -17519,6 +18766,11 @@ github = "NoneTirex"; githubId = 26038207; }; + tirimia = { + name = "Theodor-Alexandru Irimia"; + github = "tirimia"; + githubId = 11174371; + }; titanous = { email = "jonathan@titanous.com"; github = "titanous"; @@ -17609,6 +18861,12 @@ githubId = 858790; name = "Tobias Mayer"; }; + tochiaha = { + email = "tochiahan@proton.me"; + github = "Tochiaha"; + githubId = 74688871; + name = "Tochukwu Ahanonu"; + }; tokudan = { email = "git@danielfrank.net"; github = "tokudan"; @@ -17654,6 +18912,10 @@ githubId = 13155277; name = "Tom Houle"; }; + tomkoid = { + email = "tomaszierl@outlook.com"; + name = "Tomkoid"; + }; tomodachi94 = { email = "tomodachi94+nixpkgs@protonmail.com"; matrix = "@tomodachi94:matrix.org"; @@ -17687,6 +18949,12 @@ githubId = 1486805; name = "Toon Nolten"; }; + tornax = { + email = "tornax@pm.me"; + github = "TornaxO7"; + githubId = 50843046; + name = "tornax"; + }; toschmidt = { email = "tobias.schmidt@in.tum.de"; github = "toschmidt"; @@ -17724,12 +18992,6 @@ githubId = 10110; name = "Travis B. Hartwell"; }; - travisdavis-ops = { - email = "travisdavismedia@gmail.com"; - github = "TravisDavis-ops"; - githubId = 52011418; - name = "Travis Davis"; - }; traxys = { email = "quentin+dev@familleboyer.net"; github = "traxys"; @@ -17754,6 +19016,12 @@ githubId = 25440339; name = "Tom Repetti"; }; + trespaul = { + email = "paul@trespaul.com"; + github = "trespaul"; + githubId = 7453891; + name = "Paul Joubert"; + }; trevdev = { email = "trev@trevdev.ca"; matrix = "@trevdev:matrix.org"; @@ -17803,6 +19071,12 @@ github = "Trundle"; githubId = 332418; }; + tsandrini = { + email = "tomas.sandrini@seznam.cz"; + name = "Tomáš Sandrini"; + github = "tsandrini"; + githubId = 21975189; + }; tscholak = { email = "torsten.scholak@googlemail.com"; github = "tscholak"; @@ -17815,6 +19089,12 @@ githubId = 15064765; name = "tshaynik"; }; + tsowell = { + email = "tom@ldtlb.com"; + github = "tsowell"; + githubId = 4044033; + name = "Thomas Sowell"; + }; ttuegel = { email = "ttuegel@mailbox.org"; github = "ttuegel"; @@ -17927,6 +19207,13 @@ matrix = "@ty:tjll.net"; name = "Tyler Langlois"; }; + tylervick = { + email = "nix@tylervick.com"; + github = "tylervick"; + githubId = 1395852; + name = "Tyler Vick"; + matrix = "@tylervick:matrix.org"; + }; tymscar = { email = "oscar@tymscar.com"; github = "tymscar"; @@ -17939,24 +19226,51 @@ githubId = 1983821; name = "Eric Wolf"; }; + u2x1 = { + email = "u2x1@outlook.com"; + github = "u2x1"; + githubId = 30677291; + name = "u2x1"; + }; uakci = { name = "uakci"; - email = "uakci@uakci.pl"; + email = "git@uakci.space"; github = "uakci"; githubId = 6961268; }; + uartman = { + name = "Anton Gusev"; + email = "uartman@mail.ru"; + github = "UARTman"; + githubId = 21099202; + }; udono = { email = "udono@virtual-things.biz"; github = "udono"; githubId = 347983; name = "Udo Spallek"; }; + ufUNnxagpM = { + github = "ufUNnxagpM"; + githubId = 12422133; + name = "Chromo-residuum-opec"; + }; ulrikstrid = { email = "ulrik.strid@outlook.com"; github = "ulrikstrid"; githubId = 1607770; name = "Ulrik Strid"; }; + unclamped = { + name = "Maru"; + email = "clear6860@tutanota.com"; + matrix = "@unhidden0174:matrix.org"; + github = "unclamped"; + githubId = 104658278; + keys = [{ + fingerprint = "57A2 CC43 3068 CB62 89C1 F1DA 9137 BB2E 77AD DE7E"; + }]; + }; unclechu = { name = "Viacheslav Lotsmanov"; email = "lotsmanov89@gmail.com"; @@ -18135,6 +19449,12 @@ githubId = 223408; name = "Varun Madiath"; }; + vancluever = { + email = "chrism@vancluevertech.com"; + github = "vancluever"; + githubId = 10704423; + name = "Chris Marchesi"; + }; vandenoever = { email = "jos@vandenoever.info"; github = "vandenoever"; @@ -18248,6 +19568,15 @@ githubId = 245573; name = "Dmitry Kalinkin"; }; + vgskye = { + name = "Skye Green"; + email = "me@skye.vg"; + github = "vgskye"; + githubId = 116078858; + keys = [{ + fingerprint = "CDEA 7E04 69E3 0885 A754 4B05 0104 BC05 F41B 77B8"; + }]; + }; victormeriqui = { name = "Victor Meriqui"; email = "victor.meriqui@ororatech.com"; @@ -18335,6 +19664,12 @@ githubId = 118959; name = "VinyMeuh"; }; + viperML = { + email = "ayatsfer@gmail.com"; + github = "viperML"; + githubId = 11395853; + name = "Fernando Ayats"; + }; viraptor = { email = "nix@viraptor.info"; github = "viraptor"; @@ -18401,7 +19736,15 @@ githubId = 13259982; name = "Vanessa McHale"; }; - + vncsb = { + email = "viniciusbernardino1@hotmail.com"; + github = "vncsb"; + githubId = 19562240; + name = "Vinicius Bernardino"; + keys = [{ + fingerprint = "F0D3 920C 722A 541F 0CCD 66E3 A7BA BA05 3D78 E7CA"; + }]; + }; voidless = { email = "julius.schmitt@yahoo.de"; github = "voidIess"; @@ -18414,6 +19757,12 @@ githubId = 7038383; name = "Vojta Káně"; }; + volfyd = { + email = "lb.nix@lisbethmail.com"; + github = "volfyd"; + githubId = 3578382; + name = "Leif Huhn"; + }; volhovm = { email = "volhovm.cs@gmail.com"; github = "volhovm"; @@ -18426,12 +19775,24 @@ githubId = 3413119; name = "Vonfry"; }; + vonixxx = { + email = "vonixxx@tuta.io"; + github = "vonixxx"; + githubId = 144771550; + name = "Luca Uricariu"; + }; votava = { email = "votava@gmail.com"; github = "janvotava"; githubId = 367185; name = "Jan Votava"; }; + vpetersson = { + email = "vpetersson@screenly.io"; + github = "vpetersson"; + githubId = 357664; + name = "Viktor Petersson"; + }; vq = { email = "vq@erq.se"; github = "vq"; @@ -18519,6 +19880,13 @@ fingerprint = "47F7 009E 3AE3 1DA7 988E 12E1 8C9B 0A8F C0C0 D862"; }]; }; + wamirez = { + email = "wamirez@protonmail.com"; + matrix = "@wamirez:matrix.org"; + github = "wamirez"; + githubId = 24505474; + name = "Daniel Ramirez"; + }; wamserma = { name = "Markus S. Wamser"; email = "github-dev@mail2013.wamser.eu"; @@ -18613,6 +19981,12 @@ fingerprint = "F844 80B2 0CA9 D6CC C7F5 2479 A776 D2AD 099E 8BC0"; }]; }; + wexder = { + email = "wexder19@gmail.com"; + github = "wexder"; + githubId = 24979302; + name = "Vladimír Zahradník"; + }; wheelsandmetal = { email = "jakob@schmutz.co.uk"; github = "wheelsandmetal"; @@ -18628,6 +20002,12 @@ fingerprint = "640B EDDE 9734 310A BFA3 B257 52ED AE6A 3995 AFAB"; }]; }; + whiteley = { + email = "mattwhiteley@gmail.com"; + github = "whiteley"; + githubId = 2215; + name = "Matt Whiteley"; + }; WhittlesJr = { email = "alex.joseph.whitt@gmail.com"; github = "WhittlesJr"; @@ -18741,11 +20121,17 @@ githubId = 168610; name = "Ricardo M. Correia"; }; - wjlroe = { - email = "willroe@gmail.com"; - github = "wjlroe"; - githubId = 43315; - name = "William Roe"; + wkral = { + email = "william.kral@gmail.com"; + github = "wkral"; + githubId = 105114; + name = "William Kral"; + }; + wladmis = { + email = "dev@wladmis.org"; + github = "wladmis"; + githubId = 5000261; + name = "Wladmis"; }; wldhx = { email = "wldhx+nixpkgs@wldhx.me"; @@ -18876,6 +20262,12 @@ githubId = 3992240; name = "Elijah Rum"; }; + x0ba = { + name = "x0ba"; + email = "dax@omg.lol"; + github = "x0ba"; + githubId = 64868985; + }; x3ro = { name = "^x3ro"; email = "nix@x3ro.dev"; @@ -18925,11 +20317,11 @@ name = "Uli Baum"; }; xfix = { - email = "konrad@borowski.pw"; + email = "kamila@borowska.pw"; matrix = "@xfix:matrix.org"; - github = "xfix"; + github = "KamilaBorowska"; githubId = 1297598; - name = "Konrad Borowski"; + name = "Kamila Borowska"; }; xfnw = { email = "xfnw+nixos@riseup.net"; @@ -19021,7 +20413,7 @@ }; yana = { email = "yana@riseup.net"; - github = "yanalunaterra"; + github = "yanateras"; githubId = 1643293; name = "Yana Timoshenko"; }; @@ -19031,6 +20423,12 @@ github = "yanganto"; githubId = 10803111; }; + yannip = { + email = "yPapandreou7@gmail.com"; + github = "YanniPapandreou"; + githubId = 15948162; + name = "Yanni Papandreou"; + }; yarny = { github = "Yarny0"; githubId = 41838844; @@ -19054,7 +20452,7 @@ ]; }; yayayayaka = { - email = "nixpkgs@uwu.is"; + email = "github@uwu.is"; matrix = "@yaya:uwu.is"; github = "yayayayaka"; githubId = 73759599; @@ -19075,6 +20473,13 @@ fingerprint = "FD0A C425 9EF5 4084 F99F 9B47 2ACC 9749 7C68 FAD4"; }]; }; + YellowOnion = { + name = "Daniel Hill"; + email = "daniel@gluo.nz"; + github = "YellowOnion"; + githubId = 364160; + matrix = "@woobilicious:matrix.org"; + }; yesbox = { email = "jesper.geertsen.jonsson@gmail.com"; github = "yesbox"; @@ -19136,6 +20541,11 @@ github = "ymeister"; githubId = 47071325; }; + ymstnt = { + name = "YMSTNT"; + github = "ymstnt"; + githubId = 21342713; + }; yoavlavi = { email = "yoav@yoavlavi.com"; github = "yoav-lavi"; @@ -19168,6 +20578,13 @@ github = "YorikSar"; githubId = 428074; }; + YoshiRulz = { + name = "YoshiRulz"; + email = "OSSYoshiRulz+Nixpkgs@gmail.com"; + matrix = "@YoshiRulz:matrix.org"; + github = "YoshiRulz"; + githubId = 13409956; + }; yrashk = { email = "yrashk@gmail.com"; github = "yrashk"; @@ -19208,6 +20625,12 @@ fingerprint = "85F8 E850 F8F2 F823 F934 535B EC50 6589 9AEA AF4C"; }]; }; + yunfachi = { + email = "yunfachi@gmail.com"; + github = "yunfachi"; + githubId = 73419713; + name = "Yunfachi"; + }; yureien = { email = "contact@sohamsen.me"; github = "Yureien"; @@ -19368,6 +20791,15 @@ githubId = 1557253; name = "Lennart Eichhorn"; }; + zedseven = { + name = "Zacchary Dempsey-Plante"; + email = "zacc@ztdp.ca"; + github = "zedseven"; + githubId = 25164338; + keys = [{ + fingerprint = "065A 0A98 FE61 E1C1 41B0 AFE7 64FA BC62 F457 2875"; + }]; + }; zendo = { name = "zendo"; email = "linzway@qq.com"; @@ -19448,6 +20880,12 @@ github = "zmitchell"; githubId = 10246891; }; + znaniye = { + email = "zn4niye@proton.me"; + github = "znaniye"; + githubId = 134703788; + name = "Samuel Silva"; + }; znewman01 = { email = "znewman01@gmail.com"; github = "znewman01"; @@ -19493,6 +20931,12 @@ githubId = 81353; name = "Alexandre Macabies"; }; + zoriya = { + email = "zoe.roux@zoriya.dev"; + github = "zoriya"; + githubId = 32224410; + name = "Zoe Roux"; + }; zowoq = { github = "zowoq"; githubId = 59103226; @@ -19504,6 +20948,12 @@ githubId = 8100652; name = "David Mell"; }; + zshipko = { + email = "zachshipko@gmail.com"; + github = "zshipko"; + githubId = 332534; + name = "Zach Shipko"; + }; ztzg = { email = "dd@crosstwine.com"; github = "ztzg"; diff --git a/maintainers/scripts/README.md b/maintainers/scripts/README.md new file mode 100644 index 0000000000000..f8fc7aff955d3 --- /dev/null +++ b/maintainers/scripts/README.md @@ -0,0 +1,62 @@ +# Maintainer scripts + +This folder contains various executable scripts for nixpkgs maintainers, +and supporting data or nixlang files as needed. +These scripts generally aren't a stable interface and may changed or be removed. + +What follows is a (very incomplete) overview of available scripts. + + +## Metadata + +### `check-by-name.sh` + +An alias for `pkgs/test/nixpkgs-check-by-name/scripts/run-local.sh`, see [documentation](../../pkgs/test/nixpkgs-check-by-name/scripts/README.md). + +### `get-maintainer.sh` + +`get-maintainer.sh [selector] value` returns a JSON object describing +a given nixpkgs maintainer, equivalent to `lib.maintainers.${x} // { handle = x; }`. + +This allows looking up a maintainer's attrset (including GitHub and Matrix +handles, email address etc.) based on any of their handles, more correctly and +robustly than text search through `maintainers-list.nix`. + +``` +❯ ./get-maintainer.sh nicoo +{ + "email": "nicoo@debian.org", + "github": "nbraud", + "githubId": 1155801, + "keys": [ + { + "fingerprint": "E44E 9EA5 4B8E 256A FB73 49D3 EC9D 3708 72BC 7A8C" + } + ], + "name": "nicoo", + "handle": "nicoo" +} + +❯ ./get-maintainer.sh name 'Silvan Mosberger' +{ + "email": "contact@infinisil.com", + "github": "infinisil", + "githubId": 20525370, + "keys": [ + { + "fingerprint": "6C2B 55D4 4E04 8266 6B7D DA1A 422E 9EDA E015 7170" + } + ], + "matrix": "@infinisil:matrix.org", + "name": "Silvan Mosberger", + "handle": "infinisil" +} +``` + +The maintainer is designated by a `selector` which must be one of: +- `handle` (default): the maintainer's attribute name in `lib.maintainers`; +- `email`, `name`, `github`, `githubId`, `matrix`, `name`: + attributes of the maintainer's object, matched exactly; + see [`maintainer-list.nix`] for the fields' definition. + +[`maintainer-list.nix`]: ../maintainer-list.nix diff --git a/maintainers/scripts/all-tarballs.nix b/maintainers/scripts/all-tarballs.nix index 6a4de8a4b9511..83236e6fa91e9 100644 --- a/maintainers/scripts/all-tarballs.nix +++ b/maintainers/scripts/all-tarballs.nix @@ -12,5 +12,5 @@ import ../../pkgs/top-level/release.nix scrubJobs = false; # No need to evaluate on i686. supportedSystems = [ "x86_64-linux" ]; - limitedSupportedSystems = []; + bootstrapConfigs = []; } diff --git a/maintainers/scripts/check-by-name.sh b/maintainers/scripts/check-by-name.sh new file mode 120000 index 0000000000000..545dbedf0a317 --- /dev/null +++ b/maintainers/scripts/check-by-name.sh @@ -0,0 +1 @@ +../../pkgs/test/nixpkgs-check-by-name/scripts/run-local.sh \ No newline at end of file diff --git a/maintainers/scripts/doc/list-systemd-manpages.zsh b/maintainers/scripts/doc/list-systemd-manpages.zsh new file mode 100755 index 0000000000000..6737a4d3fef19 --- /dev/null +++ b/maintainers/scripts/doc/list-systemd-manpages.zsh @@ -0,0 +1,33 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i zsh -p zsh +set -euo pipefail + +# cd into nixpkgs' root, get the store path of `systemd.man` +cd "$(dirname "$0")/../../.." +SYSTEMD_MAN_DIR="$(nix-build -A systemd.man)/share/man" + +# For each manual section +for section in {1..8}; do + sec_dir="${SYSTEMD_MAN_DIR}/man${section}" + + # skip section 3 (library calls) + ! [[ $section -eq 3 ]] || continue + + # for each manpage in that section (potentially none) + for manpage in ${sec_dir}/*(N); do + # strip the directory prefix and (compressed) manpage suffix + page="$(basename "$manpage" ".${section}.gz")" + + # if this is the manpage of a service unit + if [[ "$page" =~ ".*\.service" ]]; then + # ... and a manpage exists without the `.service` suffix + potential_alias="${sec_dir}/${page%\.service}.${section}.gz" + ! [[ -e "${potential_alias}" && + # ... which points to the same file, then skip + "$(gunzip -c "${potential_alias}")" == ".so ${page}.${section}" ]] || continue + fi + + # else produce a JSON fragment, with the link to the upstream manpage (as HTML) + echo " \"${page}(${section})\": \"https://www.freedesktop.org/software/systemd/man/${page}.html\"," + done +done diff --git a/maintainers/scripts/fix-maintainers.pl b/maintainers/scripts/fix-maintainers.pl index a83df9ec0cf0f..c953cff5cc487 100755 --- a/maintainers/scripts/fix-maintainers.pl +++ b/maintainers/scripts/fix-maintainers.pl @@ -13,12 +13,15 @@ STDOUT->autoflush(1); my $ua = LWP::UserAgent->new(); +if (!defined $ENV{GH_TOKEN}) { + die "Set GH_TOKEN before running this script"; +} + keys %$maintainers_json; # reset the internal iterator so a prior each() doesn't affect the loop while(my($k, $v) = each %$maintainers_json) { my $current_user = %$v{'github'}; if (!defined $current_user) { print "$k has no github handle\n"; - next; } my $github_id = %$v{'githubId'}; if (!defined $github_id) { @@ -37,13 +40,16 @@ while(my($k, $v) = each %$maintainers_json) { sleep($ratelimit_reset - time() + 5); } if ($resp->code != 200) { - print $current_user . " likely deleted their github account\n"; + print "$k likely deleted their github account\n"; next; } my $resp_json = from_json($resp->content); my $api_user = %$resp_json{"login"}; - if (lc($current_user) ne lc($api_user)) { - print $current_user . " is now known on github as " . $api_user . ". Editing maintainer-list.nix…\n"; + if (!defined $current_user) { + print "$k is known on github as $api_user.\n"; + } + elsif (lc($current_user) ne lc($api_user)) { + print "$k is now known on github as $api_user. Editing maintainer-list.nix…\n"; my $file = path($maintainers_list_nix); my $data = $file->slurp_utf8; $data =~ s/github = "$current_user";$/github = "$api_user";/m; diff --git a/maintainers/scripts/get-maintainer.sh b/maintainers/scripts/get-maintainer.sh new file mode 100755 index 0000000000000..3061d2ccc72f9 --- /dev/null +++ b/maintainers/scripts/get-maintainer.sh @@ -0,0 +1,73 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i bash -p jq ncurses +# shellcheck shell=bash + +# Get a nixpkgs maintainer's metadata as a JSON object +# see HELP_MESSAGE just below, or README.md. + +set -euo pipefail + +declare -A SELECTORS=( [handle]= [email]= [github]= [githubId]= [matrix]= [name]= ) +HELP_MESSAGE="usage: '$0' [selector] value +examples: + get-maintainer.sh nicoo + get-maintainer.sh githubId 1155801 + +\`selector\` defaults to 'handle', can be one of: + ${!SELECTORS[*]} +" + +MAINTAINERS_DIR="$(dirname "$0")/.." + +die() { + tput setaf 1 # red + echo "'$0': $*" + tput setaf 0 # back to black + exit 1 +} + +listAsJSON() { + nix-instantiate --eval --strict --json "${MAINTAINERS_DIR}/maintainer-list.nix" +} + +parseArgs() { + [ $# -gt 0 -a $# -lt 3 ] || { + echo "$HELP_MESSAGE" + die "invalid number of arguments (must be 1 or 2)" + } + + if [ $# -eq 1 ]; then + selector=handle + else + selector="$1" + shift + fi + [ -z "${SELECTORS[$selector]-n}" ] || { + echo "Valid selectors are:" "${!SELECTORS[@]}" >&2 + die "invalid selector '$selector'" + } + + value="$1" + shift +} + +query() { + # explode { a: A, b: B, ... } into A + {handle: a}, B + {handle: b}, ... + local explode="to_entries[] | .value + { \"handle\": .key }" + + # select matching items from the list + # TODO(nicoo): Support approximate matching for `name` ? + local select + case "$selector" in + githubId) + select="select(.${selector} == $value)" + ;; + *) + select="select(.${selector} == \"$value\")" + esac + + echo "$explode | $select" +} + +parseArgs "$@" +listAsJSON | jq -e "$(query)" diff --git a/maintainers/scripts/haskell/hydra-report.hs b/maintainers/scripts/haskell/hydra-report.hs index 5573e5e5afc6e..8b4f798cc5434 100755 --- a/maintainers/scripts/haskell/hydra-report.hs +++ b/maintainers/scripts/haskell/hydra-report.hs @@ -187,7 +187,7 @@ getBuildReports opt = runReq defaultHttpConfig do getEvalBuilds :: HydraSlownessWorkaroundFlag -> Int -> Req (Seq Build) getEvalBuilds NoHydraSlownessWorkaround id = - hydraJSONQuery (responseTimeout 900000000) ["eval", showT id, "builds"] + hydraJSONQuery mempty ["eval", showT id, "builds"] getEvalBuilds HydraSlownessWorkaround id = do Eval{builds} <- hydraJSONQuery mempty [ "eval", showT id ] forM builds $ \buildId -> do @@ -195,14 +195,15 @@ getEvalBuilds HydraSlownessWorkaround id = do hydraJSONQuery mempty [ "build", showT buildId ] hydraQuery :: HttpResponse a => Proxy a -> Option 'Https -> [Text] -> Req (HttpResponseBody a) -hydraQuery responseType option query = - responseBody - <$> req - GET - (foldl' (/:) (https "hydra.nixos.org") query) - NoReqBody - responseType - (header "User-Agent" "hydra-report.hs/v1 (nixpkgs;maintainers/scripts/haskell) pls fix https://github.com/NixOS/nixos-org-configurations/issues/270" <> option) +hydraQuery responseType option query = do + let customHeaderOpt = + header + "User-Agent" + "hydra-report.hs/v1 (nixpkgs;maintainers/scripts/haskell) pls fix https://github.com/NixOS/nixos-org-configurations/issues/270" + customTimeoutOpt = responseTimeout 900_000_000 -- 15 minutes + opts = customHeaderOpt <> customTimeoutOpt <> option + url = foldl' (/:) (https "hydra.nixos.org") query + responseBody <$> req GET url NoReqBody responseType opts hydraJSONQuery :: FromJSON a => Option 'Https -> [Text] -> Req a hydraJSONQuery = hydraQuery jsonResponse @@ -381,22 +382,22 @@ data BuildState icon :: BuildState -> Text icon = \case - Failed -> ":x:" - DependencyFailed -> ":heavy_exclamation_mark:" - OutputLimitExceeded -> ":warning:" + Failed -> "❌" + DependencyFailed -> "❗" + OutputLimitExceeded -> "⚠️" Unknown x -> "unknown code " <> showT x - TimedOut -> ":hourglass::no_entry_sign:" - Canceled -> ":no_entry_sign:" - Unfinished -> ":hourglass_flowing_sand:" - HydraFailure -> ":construction:" - Success -> ":heavy_check_mark:" + TimedOut -> "⌛🚫" + Canceled -> "🚫" + Unfinished -> "⏳" + HydraFailure -> "🚧" + Success -> "✅" platformIcon :: Platform -> Text platformIcon (Platform x) = case x of - "x86_64-linux" -> ":penguin:" - "aarch64-linux" -> ":iphone:" - "x86_64-darwin" -> ":apple:" - "aarch64-darwin" -> ":green_apple:" + "x86_64-linux" -> "🐧" + "aarch64-linux" -> "📱" + "x86_64-darwin" -> "🍎" + "aarch64-darwin" -> "🍏" _ -> x platformIsOS :: OS -> Platform -> Bool @@ -625,7 +626,7 @@ printBuildSummary eval@Eval{id} fetchTime summary topBrokenRdeps = <> optionalHideableList "#### Unmaintained packages with failed dependency" (unmaintainedList (failedDeps summary)) <> optionalHideableList "#### Unmaintained packages with unknown error" (unmaintainedList (unknownErr summary)) <> optionalHideableList "#### Top 50 broken packages, sorted by number of reverse dependencies" (brokenLine <$> topBrokenRdeps) - <> ["","*:arrow_heading_up:: The number of packages that depend (directly or indirectly) on this package (if any). If two numbers are shown the first (lower) number considers only packages which currently have enabled hydra jobs, i.e. are not marked broken. The second (higher) number considers all packages.*",""] + <> ["","*⤴️: The number of packages that depend (directly or indirectly) on this package (if any). If two numbers are shown the first (lower) number considers only packages which currently have enabled hydra jobs, i.e. are not marked broken. The second (higher) number considers all packages.*",""] <> footer where footer = ["*Report generated with [maintainers/scripts/haskell/hydra-report.hs](https://github.com/NixOS/nixpkgs/blob/haskell-updates/maintainers/scripts/haskell/hydra-report.hs)*"] @@ -650,7 +651,7 @@ printBuildSummary eval@Eval{id} fetchTime summary topBrokenRdeps = brokenLine :: (PkgName, Int) -> Text brokenLine (PkgName name, rdeps) = "[" <> name <> "](https://packdeps.haskellers.com/reverse/" <> name <> - ") :arrow_heading_up: " <> Text.pack (show rdeps) <> " " + ") ⤴️ " <> Text.pack (show rdeps) <> " " numSummary = statusToNumSummary summary @@ -732,7 +733,7 @@ printBuildSummary eval@Eval{id} fetchTime summary topBrokenRdeps = , Text.pack ( if summaryReverseDeps entry > 0 then - " :arrow_heading_up: " <> show (summaryUnbrokenReverseDeps entry) <> + " ⤴️ " <> show (summaryUnbrokenReverseDeps entry) <> " | " <> show (summaryReverseDeps entry) else "" ) @@ -749,9 +750,9 @@ printBuildSummary eval@Eval{id} fetchTime summary topBrokenRdeps = ) tldr = case (errors, warnings) of - ([],[]) -> [":green_circle: **Ready to merge** (if there are no [evaluation errors](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates))"] - ([],_) -> [":yellow_circle: **Potential issues** (and possibly [evaluation errors](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates))"] - _ -> [":red_circle: **Branch not mergeable**"] + ([],[]) -> ["🟢 **Ready to merge** (if there are no [evaluation errors](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates))"] + ([],_) -> ["🟡 **Potential issues** (and possibly [evaluation errors](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates))"] + _ -> ["🔴 **Branch not mergeable**"] warnings = if' (Unfinished > maybe Success worstState maintainedJob) "`maintained` jobset failed." <> if' (Unfinished == maybe Success worstState mergeableJob) "`mergeable` jobset is not finished." <> diff --git a/maintainers/scripts/haskell/merge-and-open-pr.sh b/maintainers/scripts/haskell/merge-and-open-pr.sh index cdba24f0c2077..62565d24d6231 100755 --- a/maintainers/scripts/haskell/merge-and-open-pr.sh +++ b/maintainers/scripts/haskell/merge-and-open-pr.sh @@ -54,8 +54,8 @@ if ! gh auth status 2>/dev/null ; then fi # Make sure this is configured before we start doing anything -push_remote="$(git config branch.haskell-updates.pushRemote \ - || die 'Can'\''t determine pushRemote for haskell-updates. Please set using `git config branch.haskell-updates.pushremote <remote name>`.')" +push_remote="$(git config branch.haskell-updates.pushRemote)" \ + || die 'Can'\''t determine pushRemote for haskell-updates. Please set using `git config branch.haskell-updates.pushremote <remote name>`.' # Fetch nixpkgs to get an up-to-date origin/haskell-updates branch. echo "Fetching origin..." diff --git a/maintainers/scripts/haskell/update-stackage.sh b/maintainers/scripts/haskell/update-stackage.sh index 881cf5fd48376..5dc52abdd668b 100755 --- a/maintainers/scripts/haskell/update-stackage.sh +++ b/maintainers/scripts/haskell/update-stackage.sh @@ -7,8 +7,11 @@ set -eu -o pipefail # Stackage solver to use, LTS or Nightly # (should be capitalized like the display name) SOLVER=LTS +# Stackage solver verson, if any. Use latest if empty +VERSION=21 TMP_TEMPLATE=update-stackage.XXXXXXX readonly SOLVER +readonly VERSION readonly TMP_TEMPLATE toLower() { @@ -23,7 +26,7 @@ stackage_config="pkgs/development/haskell-modules/configuration-hackage2nix/stac trap 'rm "${tmpfile}" "${tmpfile_new}"' 0 touch "$tmpfile" "$tmpfile_new" # Creating files here so that trap creates no errors. -curl -L -s "https://stackage.org/$(toLower "$SOLVER")/cabal.config" >"$tmpfile" +curl -L -s "https://stackage.org/$(toLower "$SOLVER")${VERSION:+-$VERSION}/cabal.config" >"$tmpfile" old_version=$(grep '^# Stackage' $stackage_config | sed -e 's/.\+ \([A-Za-z]\+ [0-9.-]\+\)$/\1/g') version="$SOLVER $(sed -rn "s/^--.*http:..(www.)?stackage.org.snapshot.$(toLower "$SOLVER")-//p" "$tmpfile")" diff --git a/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh b/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh index 86fecbc3d87c9..9130941a53661 100755 --- a/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh +++ b/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh @@ -39,5 +39,5 @@ fi package_list="$(nix-build -A haskell.package-list)/nixos-hackage-packages.csv" username=$(grep "^username:" "$CABAL_DIR/config" | sed "s/^username: //") password_command=$(grep "^password-command:" "$CABAL_DIR/config" | sed "s/^password-command: //") -curl -u "$username:$($password_command | head -n1)" --digest -H "Content-type: text/csv" -T "$package_list" http://hackage.haskell.org/distro/NixOS/packages.csv +curl -u "$username:$($password_command | head -n1)" --digest -H "Content-type: text/csv" -T "$package_list" https://hackage.haskell.org/distro/NixOS/packages.csv echo diff --git a/maintainers/scripts/luarocks-packages.csv b/maintainers/scripts/luarocks-packages.csv index 3ce3f3d734337..8e1c5275401d9 100644 --- a/maintainers/scripts/luarocks-packages.csv +++ b/maintainers/scripts/luarocks-packages.csv @@ -1,30 +1,32 @@ name,src,ref,server,version,luaversion,maintainers alt-getopt,,,,,,arobyn bit32,,,,5.3.0-1,5.1,lblasc -argparse,https://github.com/luarocks/argparse.git,,,,, -basexx,https://github.com/teto/basexx.git,,,,, -binaryheap,https://github.com/Tieske/binaryheap.lua,,,,,vcunat +argparse,,,,,, +basexx,,,,,, +binaryheap,,,,,,vcunat busted,,,,,, cassowary,,,,,,marsam alerque cldr,,,,,,alerque -compat53,,,,0.7-1,,vcunat +compat53,,,,,,vcunat cosmo,,,,,,marsam coxpcall,,,,1.17.0-1,, cqueues,,,,,,vcunat cyan,,,,,, -cyrussasl,https://github.com/JorjBauer/lua-cyrussasl.git,,,,, -digestif,https://github.com/astoff/digestif.git,,,0.2-1,5.3, +digestif,https://github.com/astoff/digestif.git,,,,5.3, dkjson,,,,,, fennel,,,,,,misterio77 +fidget.nvim,,,,,,mrcjkb fifo,,,,,, fluent,,,,,,alerque +fzy,,,,,,mrcjkb gitsigns.nvim,https://github.com/lewis6991/gitsigns.nvim.git,,,,5.1, haskell-tools.nvim,,,,,, http,,,,0.3-0,,vcunat +image.nvim,,,,,,teto inspect,,,,,, jsregexp,,,,,, ldbus,,,http://luarocks.org/dev,,, -ldoc,https://github.com/stevedonovan/LDoc.git,,,,, +ldoc,,,,,, lgi,,,,,, linenoise,https://github.com/hoelzro/lua-linenoise.git,,,,, ljsyscall,,,,,5.1,lblasc @@ -34,14 +36,13 @@ loadkit,,,,,,alerque lpeg,,,,,,vyp lpeg_patterns,,,,,, lpeglabel,,,,1.6.0,, -lpty,,,,,, lrexlib-gnu,,,,,, lrexlib-pcre,,,,,,vyp lrexlib-posix,,,,,, lua-cjson,,,,,, lua-cmsgpack,,,,,, lua-curl,,,,,, -lua-iconv,,,,,, +lua-ffi-zlib,,,,,, lua-lsp,,,,,, lua-messagepack,,,,,, lua-protobuf,,,,,,lockejan @@ -50,11 +51,12 @@ lua-resty-jwt,,,,,, lua-resty-openidc,,,,,, lua-resty-openssl,,,,,, lua-resty-session,,,,,, +lua-rtoml,https://github.com/lblasc/lua-rtoml,,,,,lblasc lua-subprocess,https://github.com/0x0ade/lua-subprocess,,,,5.1,scoder12 lua-term,,,,,, lua-toml,,,,,, lua-zlib,,,,,,koral -lua_cliargs,https://github.com/amireh/lua_cliargs.git,,,,, +lua_cliargs,,,,,, luabitop,https://github.com/teto/luabitop.git,,,,, luacheck,,,,,, luacov,,,,,, @@ -72,7 +74,9 @@ lualogging,,,,,, luaossl,,,,,5.1, luaposix,,,,34.1.1-1,,vyp lblasc luarepl,,,,,, +luarocks-build-rust-mlua,,,,,,mrcjkb luasec,,,,,,flosse +luasnip,,,,,, luasocket,,,,,, luasql-sqlite3,,,,,,vyp luassert,,,,,, @@ -82,32 +86,36 @@ luaunit,,,,,,lockejan luautf8,,,,,,pstn luazip,,,,,, lua-yajl,,,,,,pstn -luuid,,,,,, +lua-iconv,,,,7.0.0,, +luuid,,,,20120509-2,, luv,,,,1.44.2-1,, lush.nvim,https://github.com/rktjmp/lush.nvim,,,,,teto lyaml,,,,,,lblasc -magick,,,,,,donovanglover +magick,,,,,5.1,donovanglover markdown,,,,,, mediator_lua,,,,,, middleclass,,,,,, mpack,,,,,, moonscript,https://github.com/leafo/moonscript.git,dev-1,,,,arobyn -nvim-client,https://github.com/neovim/lua-client.git,,,,, +nlua,,,,,,teto +nui.nvim,,,,,,mrcjkb nvim-cmp,https://github.com/hrsh7th/nvim-cmp,,,,, penlight,https://github.com/lunarmodules/Penlight.git,,,,,alerque plenary.nvim,https://github.com/nvim-lua/plenary.nvim.git,,,,5.1, rapidjson,https://github.com/xpol/lua-rapidjson.git,,,,, rest.nvim,,,,,5.1,teto -readline,,,,,, +rustaceanvim,,,,,,mrcjkb say,https://github.com/Olivine-Labs/say.git,,,,, serpent,,,,,,lockejan sqlite,,,,,, std._debug,https://github.com/lua-stdlib/_debug.git,,,,, -std.normalize,https://github.com/lua-stdlib/normalize.git,,,,, +std.normalize,,,,,, stdlib,,,,41.2.2,,vyp teal-language-server,,,http://luarocks.org/dev,,, telescope.nvim,,,,,5.1, telescope-manix,,,,,, tl,,,,,,mephistophiles +toml,,,,,,mrcjkb +toml-edit,,,,,5.1,mrcjkb vstruct,https://github.com/ToxicFrog/vstruct.git,,,,, vusted,,,,,,figsoda diff --git a/maintainers/scripts/pluginupdate.py b/maintainers/scripts/pluginupdate.py index 18b354f0be9c6..056abda85bfd7 100644 --- a/maintainers/scripts/pluginupdate.py +++ b/maintainers/scripts/pluginupdate.py @@ -17,6 +17,7 @@ import http import json import logging import os +import re import subprocess import sys import time @@ -26,7 +27,7 @@ import urllib.parse import urllib.request import xml.etree.ElementTree as ET from dataclasses import asdict, dataclass -from datetime import datetime +from datetime import UTC, datetime from functools import wraps from multiprocessing.dummy import Pool from pathlib import Path @@ -192,6 +193,11 @@ class RepoGitHub(Repo): with urllib.request.urlopen(commit_req, timeout=10) as req: self._check_for_redirect(commit_url, req) xml = req.read() + + # Filter out illegal XML characters + illegal_xml_regex = re.compile(b"[\x00-\x08\x0B-\x0C\x0E-\x1F\x7F]") + xml = illegal_xml_regex.sub(b"", xml) + root = ET.fromstring(xml) latest_entry = root.find(ATOM_ENTRY) assert latest_entry is not None, f"No commits found in repository {self}" @@ -327,7 +333,6 @@ def run_nix_expr(expr, nixpkgs: str): :param expr nix expression to fetch current plugins :param nixpkgs Path towards a nixpkgs checkout ''' - # local_pkgs = str(Path(__file__).parent.parent.parent) with CleanEnvironment(nixpkgs) as nix_path: cmd = [ "nix", @@ -341,8 +346,8 @@ def run_nix_expr(expr, nixpkgs: str): "--nix-path", nix_path, ] - log.debug("Running command %s", " ".join(cmd)) - out = subprocess.check_output(cmd) + log.debug("Running command: %s", " ".join(cmd)) + out = subprocess.check_output(cmd, timeout=90) data = json.loads(out) return data @@ -469,6 +474,7 @@ class Editor: "--input-names", "-i", dest="input_file", + type=Path, default=self.default_in, help="A list of plugins in the form owner/repo", ) @@ -477,6 +483,7 @@ class Editor: "-o", dest="outfile", default=self.default_out, + type=Path, help="Filename to save generated nix code", ) common.add_argument( @@ -572,7 +579,6 @@ class CleanEnvironment(object): self.empty_config = NamedTemporaryFile() self.empty_config.write(b"{}") self.empty_config.flush() - # os.environ["NIXPKGS_CONFIG"] = self.empty_config.name return f"localpkgs={self.local_pkgs}" def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None: @@ -788,8 +794,16 @@ def update_plugins(editor: Editor, args): autocommit = not args.no_commit if autocommit: - editor.nixpkgs_repo = git.Repo(editor.root, search_parent_directories=True) - commit(editor.nixpkgs_repo, f"{editor.attr_path}: update", [args.outfile]) + try: + repo = git.Repo(os.getcwd()) + updated = datetime.now(tz=UTC).strftime('%Y-%m-%d') + print(args.outfile) + commit(repo, + f"{editor.attr_path}: update on {updated}", [args.outfile] + ) + except git.InvalidGitRepositoryError as e: + print(f"Not in a git repository: {e}", file=sys.stderr) + sys.exit(1) if redirects: update() diff --git a/maintainers/scripts/update-luarocks-packages b/maintainers/scripts/update-luarocks-packages deleted file mode 100755 index 32c2b44260b32..0000000000000 --- a/maintainers/scripts/update-luarocks-packages +++ /dev/null @@ -1,224 +0,0 @@ -#!/usr/bin/env nix-shell -#!nix-shell update-luarocks-shell.nix -i python3 - -# format: -# $ nix run nixpkgs#python3Packages.black -- update.py -# type-check: -# $ nix run nixpkgs#python3Packages.mypy -- update.py -# linted: -# $ nix run nixpkgs#python3Packages.flake8 -- --ignore E501,E265,E402 update.py - -import inspect -import os -import tempfile -import shutil -from dataclasses import dataclass -import subprocess -import csv -import logging -import textwrap -from multiprocessing.dummy import Pool - -from typing import List, Tuple, Optional -from pathlib import Path - -log = logging.getLogger() -log.addHandler(logging.StreamHandler()) - -ROOT = Path(os.path.dirname(os.path.abspath(inspect.getfile(inspect.currentframe())))).parent.parent # type: ignore -import pluginupdate -from pluginupdate import update_plugins, FetchConfig, CleanEnvironment - -PKG_LIST = "maintainers/scripts/luarocks-packages.csv" -TMP_FILE = "$(mktemp)" -GENERATED_NIXFILE = "pkgs/development/lua-modules/generated-packages.nix" -LUAROCKS_CONFIG = "maintainers/scripts/luarocks-config.lua" - -HEADER = """/* {GENERATED_NIXFILE} is an auto-generated file -- DO NOT EDIT! -Regenerate it with: -nixpkgs$ ./maintainers/scripts/update-luarocks-packages - -You can customize the generated packages in pkgs/development/lua-modules/overrides.nix -*/ -""".format( - GENERATED_NIXFILE=GENERATED_NIXFILE -) - -FOOTER = """ -} -/* GENERATED - do not edit this file */ -""" - - -@dataclass -class LuaPlugin: - name: str - """Name of the plugin, as seen on luarocks.org""" - src: str - """address to the git repository""" - ref: Optional[str] - """git reference (branch name/tag)""" - version: Optional[str] - """Set it to pin a package """ - server: Optional[str] - """luarocks.org registers packages under different manifests. - Its value can be 'http://luarocks.org/dev' - """ - luaversion: Optional[str] - """Attribue of the lua interpreter if a package is available only for a specific lua version""" - maintainers: Optional[str] - """ Optional string listing maintainers separated by spaces""" - - @property - def normalized_name(self) -> str: - return self.name.replace(".", "-") - - -# rename Editor to LangUpdate/ EcosystemUpdater -class LuaEditor(pluginupdate.Editor): - def get_current_plugins(self): - return [] - - def load_plugin_spec(self, input_file) -> List[LuaPlugin]: - luaPackages = [] - csvfilename = input_file - log.info("Loading package descriptions from %s", csvfilename) - - with open(csvfilename, newline="") as csvfile: - reader = csv.DictReader( - csvfile, - ) - for row in reader: - # name,server,version,luaversion,maintainers - plugin = LuaPlugin(**row) - luaPackages.append(plugin) - return luaPackages - - def update(self, args): - update_plugins(self, args) - - def generate_nix(self, results: List[Tuple[LuaPlugin, str]], outfilename: str): - with tempfile.NamedTemporaryFile("w+") as f: - f.write(HEADER) - header2 = textwrap.dedent( - # header2 = inspect.cleandoc( - """ - { self, stdenv, lib, fetchurl, fetchgit, callPackage, ... } @ args: - final: prev: - { - """ - ) - f.write(header2) - for plugin, nix_expr in results: - f.write(f"{plugin.normalized_name} = {nix_expr}") - f.write(FOOTER) - f.flush() - - # if everything went fine, move the generated file to its destination - # using copy since move doesn't work across disks - shutil.copy(f.name, outfilename) - - print(f"updated {outfilename}") - - @property - def attr_path(self): - return "luaPackages" - - def get_update(self, input_file: str, outfile: str, config: FetchConfig): - _prefetch = generate_pkg_nix - - def update() -> dict: - plugin_specs = self.load_plugin_spec(input_file) - sorted_plugin_specs = sorted(plugin_specs, key=lambda v: v.name.lower()) - - try: - pool = Pool(processes=config.proc) - results = pool.map(_prefetch, sorted_plugin_specs) - finally: - pass - - self.generate_nix(results, outfile) - - redirects = {} - return redirects - - return update - - def rewrite_input(self, input_file: str, *args, **kwargs): - # vim plugin reads the file before update but that shouldn't be our case - # not implemented yet - # fieldnames = ['name', 'server', 'version', 'luaversion', 'maintainers'] - # input_file = "toto.csv" - # with open(input_file, newline='') as csvfile: - # writer = csv.DictWriter(csvfile, fieldnames=fieldnames) - # writer.writeheader() - # for row in reader: - # # name,server,version,luaversion,maintainers - # plugin = LuaPlugin(**row) - # luaPackages.append(plugin) - pass - - -def generate_pkg_nix(plug: LuaPlugin): - """ - Generate nix expression for a luarocks package - Our cache key associates "p.name-p.version" to its rockspec - """ - log.debug("Generating nix expression for %s", plug.name) - custom_env = os.environ.copy() - custom_env["LUAROCKS_CONFIG"] = LUAROCKS_CONFIG - - # we add --dev else luarocks wont find all the "scm" (=dev) versions of the - # packages - # , "--dev" - cmd = ["luarocks", "nix"] - - if plug.maintainers: - cmd.append(f"--maintainers={plug.maintainers}") - - # if plug.server == "src": - if plug.src != "": - if plug.src is None: - msg = ( - "src must be set when 'version' is set to \"src\" for package %s" - % plug.name - ) - log.error(msg) - raise RuntimeError(msg) - log.debug("Updating from source %s", plug.src) - cmd.append(plug.src) - # update the plugin from luarocks - else: - cmd.append(plug.name) - if plug.version and plug.version != "src": - cmd.append(plug.version) - - if plug.server != "src" and plug.server: - cmd.append(f"--only-server={plug.server}") - - if plug.luaversion: - cmd.append(f"--lua-version={plug.luaversion}") - - log.debug("running %s", " ".join(cmd)) - - output = subprocess.check_output(cmd, env=custom_env, text=True) - output = "callPackage(" + output.strip() + ") {};\n\n" - return (plug, output) - - -def main(): - editor = LuaEditor( - "lua", - ROOT, - "", - default_in=ROOT.joinpath(PKG_LIST), - default_out=ROOT.joinpath(GENERATED_NIXFILE), - ) - - editor.run() - - -if __name__ == "__main__": - main() - -# vim: set ft=python noet fdm=manual fenc=utf-8 ff=unix sts=0 sw=4 ts=4 : diff --git a/maintainers/scripts/update-luarocks-shell.nix b/maintainers/scripts/update-luarocks-shell.nix deleted file mode 100644 index 346b0319b08c9..0000000000000 --- a/maintainers/scripts/update-luarocks-shell.nix +++ /dev/null @@ -1,13 +0,0 @@ -{ nixpkgs ? import ../.. { } -}: -with nixpkgs; -let - pyEnv = python3.withPackages(ps: [ ps.gitpython ]); -in -mkShell { - packages = [ - pyEnv - luarocks-nix - nix-prefetch-scripts - ]; -} diff --git a/maintainers/team-list.nix b/maintainers/team-list.nix index 6b90ce30588be..c5b37437ddb23 100644 --- a/maintainers/team-list.nix +++ b/maintainers/team-list.nix @@ -96,6 +96,16 @@ with lib.maintainers; { shortName = "Blockchains"; }; + buildbot = { + members = [ + lopsided98 + mic92 + zowoq + ]; + scope = "Maintain Buildbot CI framework"; + shortName = "Buildbot"; + }; + c = { members = [ matthewbauer @@ -127,14 +137,6 @@ with lib.maintainers; { enableFeatureFreezePing = true; }; - chia = { - members = [ - lourkeur - ]; - scope = "Maintain the Chia blockchain and its dependencies"; - shortName = "Chia Blockchain"; - }; - coq = { members = [ cohencyril @@ -219,7 +221,6 @@ with lib.maintainers; { cole-h grahamc hoverbear - lheckemann ]; scope = "Group registration for packages maintained by Determinate Systems."; shortName = "Determinate Systems employees"; @@ -299,6 +300,7 @@ with lib.maintainers; { members = [ theuni dpausp + frlan leona ]; scope = "Team for Flying Circus employees who collectively maintain packages."; @@ -323,13 +325,20 @@ with lib.maintainers; { geospatial = { members = [ + das-g imincik - sikmir nh2 + nialov + r-burns + sikmir willcohen ]; + githubTeams = [ + "geospatial" + ]; scope = "Maintain geospatial packages."; shortName = "Geospatial"; + enableFeatureFreezePing = true; }; gitlab = { @@ -350,6 +359,7 @@ with lib.maintainers; { mic92 zowoq qbit + mfrw ]; githubTeams = [ "golang" @@ -393,6 +403,7 @@ with lib.maintainers; { cdepillabout expipiplus1 maralorn + ncfavier sternenseemann ]; githubTeams = [ @@ -403,10 +414,19 @@ with lib.maintainers; { enableFeatureFreezePing = true; }; + helsinki-systems = { + # Verify additions to this team with at least one already existing member of the team. + members = [ + ajs124 + das_j + ]; + scope = "Group registration for packages maintained by Helsinki Systems"; + shortName = "Helsinki Systems employees"; + }; + home-assistant = { members = [ fab - globin hexa mic92 ]; @@ -430,6 +450,8 @@ with lib.maintainers; { members = [ cleeyv ryantm + lassulus + yayayayaka ]; scope = "Maintain Jitsi."; shortName = "Jitsi"; @@ -439,6 +461,7 @@ with lib.maintainers; { members = [ GaetanLepage natsukium + thomasjm ]; scope = "Maintain Jupyter and related packages."; shortName = "Jupyter"; @@ -511,7 +534,6 @@ with lib.maintainers; { dtzWill ericson2314 lovek323 - primeos qyliss raitobezarius rrbutani @@ -562,6 +584,18 @@ with lib.maintainers; { enableFeatureFreezePing = true; }; + lxc = { + members = [ + aanderse + adamcstephens + jnsgruk + megheaiulian + mkg20001 + ]; + scope = "All things linuxcontainers. LXC, Incus, LXD and related packages."; + shortName = "lxc"; + }; + lxqt = { members = [ romildo @@ -611,6 +645,7 @@ with lib.maintainers; { minimal-bootstrap = { members = [ + alejandrosame artturin emilytrau ericson2314 @@ -670,16 +705,16 @@ with lib.maintainers; { enableFeatureFreezePing = true; }; - numtide = { + ocaml = { members = [ - mic92 - flokli - jfroche - tazjin - zimbatm + alizter + ]; + githubTeams = [ + "ocaml" ]; - scope = "Group registration for Numtide team members who collectively maintain packages."; - shortName = "Numtide team"; + scope = "Maintain the OCaml compiler and package set."; + shortName = "OCaml"; + enableFeatureFreezePing = true; }; openstack = { @@ -728,7 +763,6 @@ with lib.maintainers; { aanderse drupol etu - globin ma27 talyz ]; @@ -742,7 +776,6 @@ with lib.maintainers; { podman = { members = [ - adisbladis saschagrunert vdemeester ]; @@ -898,7 +931,6 @@ with lib.maintainers; { tts = { members = [ - hexa mic92 ]; scope = "coqui-ai TTS (formerly Mozilla TTS) and leaf packages"; @@ -919,7 +951,6 @@ with lib.maintainers; { wdz = { members = [ n0emis - netali vidister johannwagner yuka |