diff options
Diffstat (limited to 'pkgs')
382 files changed, 11615 insertions, 4639 deletions
diff --git a/pkgs/applications/audio/bitwig-studio/bitwig-studio5.nix b/pkgs/applications/audio/bitwig-studio/bitwig-studio5.nix index 9591cc6137d08..d1540fd1cea04 100644 --- a/pkgs/applications/audio/bitwig-studio/bitwig-studio5.nix +++ b/pkgs/applications/audio/bitwig-studio/bitwig-studio5.nix @@ -27,11 +27,11 @@ stdenv.mkDerivation rec { pname = "bitwig-studio"; - version = "5.0.9"; + version = "5.0.11"; src = fetchurl { url = "https://downloads.bitwig.com/stable/${version}/${pname}-${version}.deb"; - sha256 = "sha256-B6s8FuNvJ3NdU7uZ+AsZkiFf9p6WcLzoZPsfzors1kk="; + sha256 = "sha256-c9bRWVWCC9hLxmko6EHgxgmghrxskJP4PQf3ld2BHoY="; }; nativeBuildInputs = [ dpkg makeWrapper wrapGAppsHook ]; diff --git a/pkgs/applications/audio/cmus/default.nix b/pkgs/applications/audio/cmus/default.nix index a3f859ca0ea4b..88d0931ca1045 100644 --- a/pkgs/applications/audio/cmus/default.nix +++ b/pkgs/applications/audio/cmus/default.nix @@ -1,4 +1,4 @@ -{ config, lib, stdenv, fetchFromGitHub, runCommand, ncurses, pkg-config +{ config, lib, stdenv, fetchFromGitHub, fetchpatch, ncurses, pkg-config , libiconv, CoreAudio, AudioUnit, VideoToolbox , alsaSupport ? stdenv.isLinux, alsa-lib ? null @@ -101,7 +101,11 @@ stdenv.mkDerivation rec { sha256 = "sha256-Ha0bIh3SYMhA28YXQ//Loaz9J1lTJAzjTx8eK3AqUjM="; }; - patches = [ ./option-debugging.patch ]; + patches = [ + ./option-debugging.patch + # ffmpeg 6 fix https://github.com/cmus/cmus/pull/1254/ + (fetchpatch { url = "https://github.com/cmus/cmus/commit/07b368ff1500e1d2957cad61ced982fa10243fbc.patch"; hash = "sha256-5gsz3q8R9FPobHoLj8BQPsa9s4ULEA9w2VQR+gmpmgA="; }) + ]; nativeBuildInputs = [ pkg-config ]; buildInputs = [ ncurses ] diff --git a/pkgs/applications/audio/guitarix/default.nix b/pkgs/applications/audio/guitarix/default.nix index 3033888996a19..3a650646a8ae7 100644 --- a/pkgs/applications/audio/guitarix/default.nix +++ b/pkgs/applications/audio/guitarix/default.nix @@ -1,4 +1,5 @@ -{ lib, stdenv +{ lib +, stdenv , fetchurl , fetchpatch , avahi @@ -50,6 +51,12 @@ stdenv.mkDerivation rec { sha256 = "d+g9dU9RrDjFQj847rVd5bPiYSjmC1EbAtLe/PNubBg="; }; + # doesnt apply cleanly, so doing with substituteInPlace + # https://github.com/brummer10/guitarix/commit/39d7c21c4173eb0f121b1bbff439d9cf43331a00.patch + postPatch = '' + substituteInPlace wscript --replace "open(src_fname, 'rU')" "open(src_fname, 'r')" + ''; + nativeBuildInputs = [ gettext hicolor-icon-theme diff --git a/pkgs/applications/audio/mus/Cargo.lock b/pkgs/applications/audio/mus/Cargo.lock deleted file mode 100644 index c9d036eea308b..0000000000000 --- a/pkgs/applications/audio/mus/Cargo.lock +++ /dev/null @@ -1,382 +0,0 @@ -# This file is automatically @generated by Cargo. -# It is not intended for manual editing. -version = 3 - -[[package]] -name = "atty" -version = "0.2.14" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d9b39be18770d11421cdb1b9947a45dd3f37e93092cbf377614828a319d5fee8" -dependencies = [ - "hermit-abi 0.1.19", - "libc", - "winapi", -] - -[[package]] -name = "bitflags" -version = "1.3.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a" - -[[package]] -name = "bufstream" -version = "0.1.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "40e38929add23cdf8a366df9b0e088953150724bcbe5fc330b0d8eb3b328eec8" - -[[package]] -name = "cc" -version = "1.0.79" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "50d30906286121d95be3d479533b458f87493b30a4b5f79a607db8f5d11aa91f" - -[[package]] -name = "clap" -version = "4.1.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ec0b0588d44d4d63a87dbd75c136c166bbfd9a86a31cb89e09906521c7d3f5e3" -dependencies = [ - "bitflags", - "clap_derive", - "clap_lex", - "is-terminal", - "once_cell", - "strsim", - "termcolor", -] - -[[package]] -name = "clap_derive" -version = "4.1.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "684a277d672e91966334af371f1a7b5833f9aa00b07c84e92fbce95e00208ce8" -dependencies = [ - "heck", - "proc-macro-error", - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "clap_lex" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "783fe232adfca04f90f56201b26d79682d4cd2625e0bc7290b95123afe558ade" -dependencies = [ - "os_str_bytes", -] - -[[package]] -name = "colored" -version = "2.0.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b3616f750b84d8f0de8a58bda93e08e2a81ad3f523089b05f1dffecab48c6cbd" -dependencies = [ - "atty", - "lazy_static", - "winapi", -] - -[[package]] -name = "errno" -version = "0.2.8" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f639046355ee4f37944e44f60642c6f3a7efa3cf6b78c78a0d989a8ce6c396a1" -dependencies = [ - "errno-dragonfly", - "libc", - "winapi", -] - -[[package]] -name = "errno-dragonfly" -version = "0.1.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "aa68f1b12764fab894d2755d2518754e71b4fd80ecfb822714a1206c2aab39bf" -dependencies = [ - "cc", - "libc", -] - -[[package]] -name = "heck" -version = "0.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8" - -[[package]] -name = "hermit-abi" -version = "0.1.19" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "62b467343b94ba476dcb2500d242dadbb39557df889310ac77c5d99100aaac33" -dependencies = [ - "libc", -] - -[[package]] -name = "hermit-abi" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fed44880c466736ef9a5c5b5facefb5ed0785676d0c02d612db14e54f0d84286" - -[[package]] -name = "io-lifetimes" -version = "1.0.5" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1abeb7a0dd0f8181267ff8adc397075586500b81b28a73e8a0208b00fc170fb3" -dependencies = [ - "libc", - "windows-sys", -] - -[[package]] -name = "is-terminal" -version = "0.4.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "22e18b0a45d56fe973d6db23972bf5bc46f988a4a2385deac9cc29572f09daef" -dependencies = [ - "hermit-abi 0.3.1", - "io-lifetimes", - "rustix", - "windows-sys", -] - -[[package]] -name = "lazy_static" -version = "1.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646" - -[[package]] -name = "libc" -version = "0.2.139" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "201de327520df007757c1f0adce6e827fe8562fbc28bfd9c15571c66ca1f5f79" - -[[package]] -name = "linux-raw-sys" -version = "0.1.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f051f77a7c8e6957c0696eac88f26b0117e54f52d3fc682ab19397a8812846a4" - -[[package]] -name = "mpd" -version = "0.1.0" -source = "git+https://github.com/kstep/rust-mpd?rev=e8b5c3d#e8b5c3d67bb602960aa21910430380d6626b3be7" -dependencies = [ - "bufstream", -] - -[[package]] -name = "mus" -version = "0.1.0" -dependencies = [ - "clap", - "colored", - "mpd", -] - -[[package]] -name = "once_cell" -version = "1.17.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b7e5500299e16ebb147ae15a00a942af264cf3688f47923b8fc2cd5858f23ad3" - -[[package]] -name = "os_str_bytes" -version = "6.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9b7820b9daea5457c9f21c69448905d723fbd21136ccf521748f23fd49e723ee" - -[[package]] -name = "proc-macro-error" -version = "1.0.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "da25490ff9892aab3fcf7c36f08cfb902dd3e71ca0f9f9517bea02a73a5ce38c" -dependencies = [ - "proc-macro-error-attr", - "proc-macro2", - "quote", - "syn", - "version_check", -] - -[[package]] -name = "proc-macro-error-attr" -version = "1.0.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a1be40180e52ecc98ad80b184934baf3d0d29f979574e439af5a55274b35f869" -dependencies = [ - "proc-macro2", - "quote", - "version_check", -] - -[[package]] -name = "proc-macro2" -version = "1.0.51" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5d727cae5b39d21da60fa540906919ad737832fe0b1c165da3a34d6548c849d6" -dependencies = [ - "unicode-ident", -] - -[[package]] -name = "quote" -version = "1.0.23" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8856d8364d252a14d474036ea1358d63c9e6965c8e5c1885c18f73d70bff9c7b" -dependencies = [ - "proc-macro2", -] - -[[package]] -name = "rustix" -version = "0.36.8" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f43abb88211988493c1abb44a70efa56ff0ce98f233b7b276146f1f3f7ba9644" -dependencies = [ - "bitflags", - "errno", - "io-lifetimes", - "libc", - "linux-raw-sys", - "windows-sys", -] - -[[package]] -name = "strsim" -version = "0.10.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "73473c0e59e6d5812c5dfe2a064a6444949f089e20eec9a2e5506596494e4623" - -[[package]] -name = "syn" -version = "1.0.107" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1f4064b5b16e03ae50984a5a8ed5d4f8803e6bc1fd170a3cda91a1be4b18e3f5" -dependencies = [ - "proc-macro2", - "quote", - "unicode-ident", -] - -[[package]] -name = "termcolor" -version = "1.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "be55cf8942feac5c765c2c993422806843c9a9a45d4d5c407ad6dd2ea95eb9b6" -dependencies = [ - "winapi-util", -] - -[[package]] -name = "unicode-ident" -version = "1.0.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "84a22b9f218b40614adcb3f4ff08b703773ad44fa9423e4e0d346d5db86e4ebc" - -[[package]] -name = "version_check" -version = "0.9.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "49874b5167b65d7193b8aba1567f5c7d93d001cafc34600cee003eda787e483f" - -[[package]] -name = "winapi" -version = "0.3.9" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419" -dependencies = [ - "winapi-i686-pc-windows-gnu", - "winapi-x86_64-pc-windows-gnu", -] - -[[package]] -name = "winapi-i686-pc-windows-gnu" -version = "0.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" - -[[package]] -name = "winapi-util" -version = "0.1.5" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "70ec6ce85bb158151cae5e5c87f95a8e97d2c0c4b001223f33a334e3ce5de178" -dependencies = [ - "winapi", -] - -[[package]] -name = "winapi-x86_64-pc-windows-gnu" -version = "0.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" - -[[package]] -name = "windows-sys" -version = "0.45.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "75283be5efb2831d37ea142365f009c02ec203cd29a3ebecbc093d52315b66d0" -dependencies = [ - "windows-targets", -] - -[[package]] -name = "windows-targets" -version = "0.42.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8e2522491fbfcd58cc84d47aeb2958948c4b8982e9a2d8a2a35bbaed431390e7" -dependencies = [ - "windows_aarch64_gnullvm", - "windows_aarch64_msvc", - "windows_i686_gnu", - "windows_i686_msvc", - "windows_x86_64_gnu", - "windows_x86_64_gnullvm", - "windows_x86_64_msvc", -] - -[[package]] -name = "windows_aarch64_gnullvm" -version = "0.42.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8c9864e83243fdec7fc9c5444389dcbbfd258f745e7853198f365e3c4968a608" - -[[package]] -name = "windows_aarch64_msvc" -version = "0.42.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4c8b1b673ffc16c47a9ff48570a9d85e25d265735c503681332589af6253c6c7" - -[[package]] -name = "windows_i686_gnu" -version = "0.42.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "de3887528ad530ba7bdbb1faa8275ec7a1155a45ffa57c37993960277145d640" - -[[package]] -name = "windows_i686_msvc" -version = "0.42.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bf4d1122317eddd6ff351aa852118a2418ad4214e6613a50e0191f7004372605" - -[[package]] -name = "windows_x86_64_gnu" -version = "0.42.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c1040f221285e17ebccbc2591ffdc2d44ee1f9186324dd3e84e99ac68d699c45" - -[[package]] -name = "windows_x86_64_gnullvm" -version = "0.42.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "628bfdf232daa22b0d64fdb62b09fcc36bb01f05a3939e20ab73aaf9470d0463" - -[[package]] -name = "windows_x86_64_msvc" -version = "0.42.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "447660ad36a13288b1db4d4248e857b510e8c3a225c822ba4fb748c0aafecffd" diff --git a/pkgs/applications/audio/mus/default.nix b/pkgs/applications/audio/mus/default.nix index 402b0b70c1edb..1235486ab554e 100644 --- a/pkgs/applications/audio/mus/default.nix +++ b/pkgs/applications/audio/mus/default.nix @@ -2,21 +2,16 @@ rustPlatform.buildRustPackage rec { pname = "mus"; - version = "0.1.0"; + version = "0.2.0"; src = fetchFromSourcehut { owner = "~sfr"; repo = pname; rev = version; - hash = "sha256-s7rizOieOmzK0Stkk1SWe9h/5DoaH6MMmL/5QFeezt0="; + hash = "sha256-yvMV+lhU9Wtwrhw0RKRUNFNznvZP0zcnT6jqPaqzhUs="; }; - cargoLock = { - lockFile = ./Cargo.lock; - outputHashes = { - "mpd-0.1.0" = "sha256-5UC6aFNJU9B5AlgJ7uPO+W7e2MHpvTu2OpktjiIXMfc="; - }; - }; + cargoHash = "sha256-K9B8y9pOHcAOrUCmCB0zW2wy81DTF3K97gPYmAiKwAM="; meta = with lib; { description = "a pretty good mpd client"; diff --git a/pkgs/applications/audio/pipecontrol/default.nix b/pkgs/applications/audio/pipecontrol/default.nix index 60226952820dc..0f302bc72e5da 100644 --- a/pkgs/applications/audio/pipecontrol/default.nix +++ b/pkgs/applications/audio/pipecontrol/default.nix @@ -16,13 +16,13 @@ stdenv.mkDerivation rec { pname = "pipecontrol"; - version = "0.2.10"; + version = "0.2.11"; src = fetchFromGitHub { owner = "portaloffreedom"; repo = pname; rev = "v${version}"; - sha256 = "sha256-MSm9rW41x8qvPuDermOPIYpxgblk5hlKIQsUEAvCzMo="; + sha256 = "sha256-jMP8hPv0Rv/OIVIzR/5R8LmEcyzwtcof9Ire86WtISc="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/audio/vgmstream/default.nix b/pkgs/applications/audio/vgmstream/default.nix index f696c50618641..6b5e6460172dd 100644 --- a/pkgs/applications/audio/vgmstream/default.nix +++ b/pkgs/applications/audio/vgmstream/default.nix @@ -1,21 +1,23 @@ { stdenv, lib, fetchFromGitHub, cmake, pkg-config , mpg123, ffmpeg, libvorbis, libao, jansson, speex +, nix-update-script }: -let - vgmstreamVersion = "r1702-5596-00bdb165b"; -in + stdenv.mkDerivation rec { pname = "vgmstream"; - version = "unstable-2022-02-21"; + version = "1879"; src = fetchFromGitHub { owner = "vgmstream"; repo = "vgmstream"; - rev = "00bdb165ba6b55420bbd5b21f54c4f7a825d15a0"; - sha256 = "18g1yqlnf48hi2xn2z2wajnjljpdbfdqmcmi7y8hi1r964ypmfcr"; + rev = "refs/tags/r${version}"; + sha256 = "sha256-m7M9oIEym/jzuw2HAbjdF6fZsfTew1KK0g1D4SePiiE="; }; - passthru.updateScript = ./update.sh; + passthru.updateScript = nix-update-script { + attrPath = "vgmstream"; + extraArgs = [ "--version-regex" "r(.*)" ]; + }; nativeBuildInputs = [ cmake pkg-config ]; @@ -28,10 +30,6 @@ stdenv.mkDerivation rec { "-DUSE_CELT=OFF" ]; - postConfigure = '' - echo "#define VGMSTREAM_VERSION \"${vgmstreamVersion}\"" > ../version.h - ''; - meta = with lib; { description = "A library for playback of various streamed audio formats used in video games"; homepage = "https://vgmstream.org"; diff --git a/pkgs/applications/audio/vgmstream/update.sh b/pkgs/applications/audio/vgmstream/update.sh deleted file mode 100755 index 5353480dd335c..0000000000000 --- a/pkgs/applications/audio/vgmstream/update.sh +++ /dev/null @@ -1,77 +0,0 @@ -#!/usr/bin/env nix-shell -#!nix-shell -i bash --pure --keep GITHUB_TOKEN -p gnused jq nix-prefetch-git curl cacert - -set -euo pipefail - -ROOT="$(dirname "$(readlink -f "$0")")" -if [[ ! "$(basename $ROOT)" == "vgmstream" || ! -f "$ROOT/default.nix" ]]; then - echo "ERROR: Not in the vgmstream folder" - exit 1 -fi - -if [[ ! -v GITHUB_TOKEN ]]; then - echo "ERROR: \$GITHUB_TOKEN not set" - exit 1 -fi - - -payload=$(jq -cn --rawfile query /dev/stdin '{"query": $query}' <<EOF | curl -s -H "Authorization: bearer $GITHUB_TOKEN" -d '@-' https://api.github.com/graphql -{ - repository(owner: "vgmstream", name: "vgmstream") { - branch: ref(qualifiedName: "refs/heads/master") { - target { - oid - ... on Commit { - committedDate - history { - totalCount - } - } - } - } - - tag: refs(refPrefix: "refs/tags/", first: 1, orderBy: {field: TAG_COMMIT_DATE, direction: DESC}) { - nodes { - name - } - } - } -} -EOF -) - -committed_full_date=$(jq -r .data.repository.branch.target.committedDate <<< "$payload") -committed_date=$(sed -nE 's/^([0-9]{4}-[0-9]{2}-[0-9]{2}).+$/\1/p' <<< $committed_full_date) -commit_unix=$(date --utc --date="$committed_date" +%s) -last_updated_unix=$(date --utc --date=$(sed -nE 's/^\s*version\s*=\s*\"unstable-([0-9]{4}-[0-9]{2}-[0-9]{2})\";$/\1/p' default.nix) +%s) - -commit_sha=$(jq -r .data.repository.branch.target.oid <<< "$payload") -major_ver=$(jq -r .data.repository.tag.nodes[0].name <<< "$payload" | sed 's/^v//g') -commit_count=$(jq -r .data.repository.branch.target.history.totalCount <<< "$payload") -final_ver="$major_ver-$commit_count-${commit_sha::9}" - - -echo "INFO: Latest commit is $commit_sha" -echo "INFO: Latest commit date is $committed_full_date" -echo "INFO: Latest version is $final_ver" - -## -# VGMStream has no stable releases, so only update if there's been at -# least a week between commits to reduce maintainer pressure. -## -time_diff=$(( $commit_unix - $last_updated_unix )) -if [[ $time_diff -lt 604800 ]]; then - echo "INFO: Not updating, less than a week between commits." - echo "INFO: $time_diff < 604800" - exit 0 -fi - -nix_sha256=$(nix-prefetch-git --quiet https://github.com/vgmstream/vgmstream.git "$commit_sha" | jq -r .sha256) -echo "INFO: SHA256 is $nix_sha256" - -sed -i -E \ - -e "s/vgmstreamVersion\s*=\s*\"[a-z0-9-]+\";$/vgmstreamVersion = \"${final_ver}\";/g" \ - -e "s/version\s*=\s*\"[a-z0-9-]+\";$/version = \"unstable-${committed_date}\";/g" \ - -e "s/rev\s*=\s*\"[a-z0-9]+\";$/rev = \"${commit_sha}\";/g" \ - -e "s/sha256\s*=\s*\"[a-z0-9]+\";$/sha256 = \"${nix_sha256}\";/g" \ - "$ROOT/default.nix" diff --git a/pkgs/applications/blockchains/erigon/default.nix b/pkgs/applications/blockchains/erigon/default.nix index 23a6373a2a718..86c0d53fcf82e 100644 --- a/pkgs/applications/blockchains/erigon/default.nix +++ b/pkgs/applications/blockchains/erigon/default.nix @@ -22,6 +22,11 @@ buildGoModule { # cc1: error: '-Wformat-security' ignored without '-Wformat' [-Werror=format-security] hardeningDisable = [ "format" ]; + # Fix error: 'Caught SIGILL in blst_cgo_init' + # https://github.com/bnb-chain/bsc/issues/1521 + CGO_CFLAGS = "-O -D__BLST_PORTABLE__"; + CGO_CFLAGS_ALLOW = "-O -D__BLST_PORTABLE__"; + subPackages = [ "cmd/erigon" "cmd/evm" diff --git a/pkgs/applications/editors/codux/default.nix b/pkgs/applications/editors/codux/default.nix index 207c3cf0bbc66..3df06b23ff080 100644 --- a/pkgs/applications/editors/codux/default.nix +++ b/pkgs/applications/editors/codux/default.nix @@ -5,11 +5,11 @@ let pname = "codux"; - version = "15.10.0"; + version = "15.13.0"; src = fetchurl { url = "https://github.com/wixplosives/codux-versions/releases/download/${version}/Codux-${version}.x86_64.AppImage"; - sha256 = "sha256-lz1dDbYq7aTGQoED07K8I9E0/XsnSlPL81/4W8Vix3E="; + sha256 = "sha256-63t3v6abr9cZ0mKSPogevKwcFsvGh2udBPRn4k4XAd4="; }; appimageContents = appimageTools.extractType2 { inherit pname version src; }; diff --git a/pkgs/applications/editors/emacs/default.nix b/pkgs/applications/editors/emacs/default.nix index a6c446ba5e462..29e2c2d85f495 100644 --- a/pkgs/applications/editors/emacs/default.nix +++ b/pkgs/applications/editors/emacs/default.nix @@ -4,7 +4,9 @@ lib.makeScope pkgs.newScope (self: let gconf = pkgs.gnome2.GConf; inherit (self) callPackage; - stdenv = if pkgs.stdenv.isDarwin then pkgs.darwin.apple_sdk_11_0.stdenv else pkgs.stdenv; + stdenv = if pkgs.stdenv.isDarwin + then pkgs.darwin.apple_sdk_11_0.stdenv + else pkgs.stdenv; inheritedArgs = { inherit gconf; inherit stdenv; @@ -16,7 +18,10 @@ lib.makeScope pkgs.newScope (self: Quartz QuartzCore UniformTypeIdentifiers WebKit; gnutls = if pkgs.stdenv.isDarwin - then pkgs.gnutls.override { inherit stdenv; inherit (pkgs.darwin.apple_sdk_11_0.frameworks) Security; } + then pkgs.gnutls.override { + inherit stdenv; + inherit (pkgs.darwin.apple_sdk_11_0.frameworks) Security; + } else pkgs.gnutls; }; in { diff --git a/pkgs/applications/editors/emacs/elisp-packages/elpa-devel-generated.nix b/pkgs/applications/editors/emacs/elisp-packages/elpa-devel-generated.nix index 467d51df9d427..eba4586a107ab 100644 --- a/pkgs/applications/editors/emacs/elisp-packages/elpa-devel-generated.nix +++ b/pkgs/applications/editors/emacs/elisp-packages/elpa-devel-generated.nix @@ -43,10 +43,10 @@ elpaBuild { pname = "ada-mode"; ename = "ada-mode"; - version = "8.0.5.0.20230208.70712"; + version = "8.1.0.0.20231018.91522"; src = fetchurl { - url = "https://elpa.gnu.org/devel/ada-mode-8.0.5.0.20230208.70712.tar"; - sha256 = "1957w6fynk345iwhgc4iq7zlda3fi211r7vi5420g761568wp4ca"; + url = "https://elpa.gnu.org/devel/ada-mode-8.1.0.0.20231018.91522.tar"; + sha256 = "00ywqyvqvynrskyg0wh2acl6a68f0s2r83w3cmsgxd569phlsrqp"; }; packageRequires = [ emacs gnat-compiler uniquify-files wisi ]; meta = { @@ -427,10 +427,10 @@ elpaBuild { pname = "bbdb"; ename = "bbdb"; - version = "3.2.2.2.0.20220705.233849"; + version = "3.2.2.4.0.20231023.5901"; src = fetchurl { - url = "https://elpa.gnu.org/devel/bbdb-3.2.2.2.0.20220705.233849.tar"; - sha256 = "1041nqxs8sp34zvpahn6x603hx8i2zc65jp6ygd611z7rb2mwd5x"; + url = "https://elpa.gnu.org/devel/bbdb-3.2.2.4.0.20231023.5901.tar"; + sha256 = "1hvhrbnnhc5hy4szkhsl5fvqlm13kzn5cx4l5sm5pr75xnmcvm08"; }; packageRequires = [ cl-lib emacs ]; meta = { @@ -453,17 +453,14 @@ license = lib.licenses.free; }; }) {}; - beframe = callPackage ({ elpaBuild - , emacs - , fetchurl - , lib }: + beframe = callPackage ({ elpaBuild, emacs, fetchurl, lib }: elpaBuild { pname = "beframe"; ename = "beframe"; - version = "0.3.0.0.20231017.145435"; + version = "0.3.0.0.20231027.55708"; src = fetchurl { - url = "https://elpa.gnu.org/devel/beframe-0.3.0.0.20231017.145435.tar"; - sha256 = "1fnflpbnnjzfyccq6jcpwsq9byn7jda8mjhjynjk3l27jmzqd2g2"; + url = "https://elpa.gnu.org/devel/beframe-0.3.0.0.20231027.55708.tar"; + sha256 = "0hmls2l6wy14hv3sghdha7h9gmqrany77cfiam5j2hqjhy0g6vns"; }; packageRequires = [ emacs ]; meta = { @@ -546,10 +543,10 @@ elpaBuild { pname = "boxy"; ename = "boxy"; - version = "1.1.3.0.20230408.95238"; + version = "1.1.3.0.20231024.113314"; src = fetchurl { - url = "https://elpa.gnu.org/devel/boxy-1.1.3.0.20230408.95238.tar"; - sha256 = "0hzfrbc20qn9ld51ivkvclphsvc2qqq4ir056d2d9bjxq56zndl6"; + url = "https://elpa.gnu.org/devel/boxy-1.1.3.0.20231024.113314.tar"; + sha256 = "1b5dkjic7spzbkj78m03z00gh8a9f8yv1kkyhnr4gks81jdr1gsn"; }; packageRequires = [ emacs ]; meta = { @@ -566,10 +563,10 @@ elpaBuild { pname = "boxy-headings"; ename = "boxy-headings"; - version = "2.1.4.0.20221114.84552"; + version = "2.1.4.0.20231024.114002"; src = fetchurl { - url = "https://elpa.gnu.org/devel/boxy-headings-2.1.4.0.20221114.84552.tar"; - sha256 = "1ximn07ri3wga73alglzlfmqly52v2dbr3y1hp6syv5m3mxk248f"; + url = "https://elpa.gnu.org/devel/boxy-headings-2.1.4.0.20231024.114002.tar"; + sha256 = "1fan3pdslmwxkdc8lj7svcjllzjqhnhsma1yjpfhi99dv4b8fyns"; }; packageRequires = [ boxy emacs org ]; meta = { @@ -713,10 +710,10 @@ elpaBuild { pname = "cape"; ename = "cape"; - version = "0.17.0.20230930.53703"; + version = "0.17.0.20231022.115714"; src = fetchurl { - url = "https://elpa.gnu.org/devel/cape-0.17.0.20230930.53703.tar"; - sha256 = "1jfba9fm075bj9si4mn5c63yzc15a6qm5c4swm6bvz1rlcmyq7cz"; + url = "https://elpa.gnu.org/devel/cape-0.17.0.20231022.115714.tar"; + sha256 = "0bvmrxjd054f14qap6w5052900k4pn33vb7cbc87rvrgdyhh5ixa"; }; packageRequires = [ compat emacs ]; meta = { @@ -915,10 +912,10 @@ elpaBuild { pname = "company"; ename = "company"; - version = "0.10.2.0.20231016.232437"; + version = "0.10.2.0.20231023.103313"; src = fetchurl { - url = "https://elpa.gnu.org/devel/company-0.10.2.0.20231016.232437.tar"; - sha256 = "16q3wlc1df8rlg67yihn33sshhg0c7lyvsajawf9xq92wqf2f5ik"; + url = "https://elpa.gnu.org/devel/company-0.10.2.0.20231023.103313.tar"; + sha256 = "1zcap5mv6cn9a2j8axg4yw4iprxkwwyjmw7qahijlk02ycwmwwfn"; }; packageRequires = [ emacs ]; meta = { @@ -1006,10 +1003,10 @@ elpaBuild { pname = "consult"; ename = "consult"; - version = "0.35.0.20231020.193229"; + version = "0.35.0.20231023.154305"; src = fetchurl { - url = "https://elpa.gnu.org/devel/consult-0.35.0.20231020.193229.tar"; - sha256 = "1k96wpiyyylcmyd7hyi8yv0s5qrzipnkz9jpdwh0j53vy6yd7a7i"; + url = "https://elpa.gnu.org/devel/consult-0.35.0.20231023.154305.tar"; + sha256 = "1cx8m0llk76z1kawkqg9dq7aws2i2bsgnhr3xvw7chdwvjywghs6"; }; packageRequires = [ compat emacs ]; meta = { @@ -1093,10 +1090,10 @@ elpaBuild { pname = "counsel"; ename = "counsel"; - version = "0.14.0.0.20230619.162538"; + version = "0.14.2.0.20231025.232958"; src = fetchurl { - url = "https://elpa.gnu.org/devel/counsel-0.14.0.0.20230619.162538.tar"; - sha256 = "0lirnz10p9zyvdhwwqgvc7wasm31syifb2khxdwi4bqqgrmpqvix"; + url = "https://elpa.gnu.org/devel/counsel-0.14.2.0.20231025.232958.tar"; + sha256 = "0y1lxhsmjazml41sg0if7y9jv1i90ad13grafil6pb4mg4m15v70"; }; packageRequires = [ emacs ivy swiper ]; meta = { @@ -1323,10 +1320,10 @@ elpaBuild { pname = "denote"; ename = "denote"; - version = "2.0.0.0.20231020.121249"; + version = "2.0.0.0.20231027.53913"; src = fetchurl { - url = "https://elpa.gnu.org/devel/denote-2.0.0.0.20231020.121249.tar"; - sha256 = "130k9ixw0n20zvhyj1b0k1363p8wa7q2klw9g8m9p4b6sslh7w5f"; + url = "https://elpa.gnu.org/devel/denote-2.0.0.0.20231027.53913.tar"; + sha256 = "044r77y0b7b3svwjin926xkp8xcwkxjpixi0x8nrfzh2krzkkakx"; }; packageRequires = [ emacs ]; meta = { @@ -1566,10 +1563,10 @@ elpaBuild { pname = "do-at-point"; ename = "do-at-point"; - version = "0.1.1.0.20231002.131946"; + version = "0.1.1.0.20231027.63811"; src = fetchurl { - url = "https://elpa.gnu.org/devel/do-at-point-0.1.1.0.20231002.131946.tar"; - sha256 = "1bqbfb2cj4qb46lximqz3nymdyq6lc5df74cvwksng09226nk9nj"; + url = "https://elpa.gnu.org/devel/do-at-point-0.1.1.0.20231027.63811.tar"; + sha256 = "0k490g70lv89l87bn79m4bphnkv6vk578qgv1vk64z403wdgvxbv"; }; packageRequires = [ emacs ]; meta = { @@ -1662,10 +1659,10 @@ elpaBuild { pname = "ebdb"; ename = "ebdb"; - version = "0.8.18.0.20231021.161113"; + version = "0.8.18.0.20231023.175242"; src = fetchurl { - url = "https://elpa.gnu.org/devel/ebdb-0.8.18.0.20231021.161113.tar"; - sha256 = "0p6n69qzl3cpnhpyvfzn0pqmh0wjw2mrd4q4dnj4w4p9103g1z62"; + url = "https://elpa.gnu.org/devel/ebdb-0.8.18.0.20231023.175242.tar"; + sha256 = "0lxb9isbg6whwcfi8gjmggi4aa4ri6b4mx4xiljzwkmrcv3y5q76"; }; packageRequires = [ emacs seq ]; meta = { @@ -1748,10 +1745,10 @@ elpaBuild { pname = "ef-themes"; ename = "ef-themes"; - version = "1.3.0.0.20231014.41130"; + version = "1.4.0.0.20231026.80318"; src = fetchurl { - url = "https://elpa.gnu.org/devel/ef-themes-1.3.0.0.20231014.41130.tar"; - sha256 = "0sgyjwwna91mfj1knirx34hc27101lhpsnfw9ncb63790yw4sidd"; + url = "https://elpa.gnu.org/devel/ef-themes-1.4.0.0.20231026.80318.tar"; + sha256 = "02nx6p5m54gyyw2rjb0msvh3cijnqpm0p5i9l71gykg54rbabwnr"; }; packageRequires = [ emacs ]; meta = { @@ -1884,10 +1881,10 @@ elpaBuild { pname = "embark"; ename = "embark"; - version = "0.23.0.20231007.130222"; + version = "0.23.0.20231026.124244"; src = fetchurl { - url = "https://elpa.gnu.org/devel/embark-0.23.0.20231007.130222.tar"; - sha256 = "0q15m0zccz3h9w88y3pbdy7g09yn317pyhf880gqpiwpbprd831b"; + url = "https://elpa.gnu.org/devel/embark-0.23.0.20231026.124244.tar"; + sha256 = "0d73fpxqv243pbj36299nfb4j6w2aqabpn4l3z1gvcpx2x2abbrd"; }; packageRequires = [ compat emacs ]; meta = { @@ -1904,10 +1901,10 @@ elpaBuild { pname = "embark-consult"; ename = "embark-consult"; - version = "0.8.0.20231007.130222"; + version = "0.8.0.20231026.124244"; src = fetchurl { - url = "https://elpa.gnu.org/devel/embark-consult-0.8.0.20231007.130222.tar"; - sha256 = "11c5r7j7hi5f91pn4dcx8z3i7p3lhrhqpj8jd6g36mwn3scb9m1b"; + url = "https://elpa.gnu.org/devel/embark-consult-0.8.0.20231026.124244.tar"; + sha256 = "0wd3pdkh0y5x2bd8q6q7bc543s5ks7d8zlxrflk5ywlqaz8xi9g4"; }; packageRequires = [ consult emacs embark ]; meta = { @@ -2027,10 +2024,10 @@ elpaBuild { pname = "erc"; ename = "erc"; - version = "5.6snapshot0.20231020.152406"; + version = "5.6snapshot0.20231027.130929"; src = fetchurl { - url = "https://elpa.gnu.org/devel/erc-5.6snapshot0.20231020.152406.tar"; - sha256 = "18h6jkp051mmixrnfgqnkh0c21qfnpaxzhjnsxxaknp3v17rvm5d"; + url = "https://elpa.gnu.org/devel/erc-5.6snapshot0.20231027.130929.tar"; + sha256 = "1v1r86cpl4jnnds9ljwr71g3xc96b2gvjbcpcvkhjfbf8g58ky40"; }; packageRequires = [ compat emacs ]; meta = { @@ -2260,14 +2257,19 @@ license = lib.licenses.free; }; }) {}; - flymake = callPackage ({ eldoc, elpaBuild, emacs, fetchurl, lib, project }: + flymake = callPackage ({ eldoc + , elpaBuild + , emacs + , fetchurl + , lib + , project }: elpaBuild { pname = "flymake"; ename = "flymake"; - version = "1.3.6.0.20230924.80727"; + version = "1.3.7.0.20231026.132104"; src = fetchurl { - url = "https://elpa.gnu.org/devel/flymake-1.3.6.0.20230924.80727.tar"; - sha256 = "0ldy6idm6kvrpx3d08wgalrv17s5vpwxqh339mq8ijv9qz7i39w4"; + url = "https://elpa.gnu.org/devel/flymake-1.3.7.0.20231026.132104.tar"; + sha256 = "0xk42bz63156vnkwxk743ln1w0zjs7yjayy9l2a97mynnzwa0knh"; }; packageRequires = [ eldoc emacs project ]; meta = { @@ -2300,10 +2302,10 @@ elpaBuild { pname = "fontaine"; ename = "fontaine"; - version = "1.0.0.0.20230929.155942"; + version = "1.0.0.0.20231026.83630"; src = fetchurl { - url = "https://elpa.gnu.org/devel/fontaine-1.0.0.0.20230929.155942.tar"; - sha256 = "1xznn6w38p6riccwbnlqnqysaapssz18kwx0f9j4h07aam8d7kkg"; + url = "https://elpa.gnu.org/devel/fontaine-1.0.0.0.20231026.83630.tar"; + sha256 = "0y02wj5m1xj7ja57rj42jhdjvzy7rsdk3vkdmaay7y4bh4dd7vnl"; }; packageRequires = [ emacs ]; meta = { @@ -2446,10 +2448,10 @@ elpaBuild { pname = "gnat-compiler"; ename = "gnat-compiler"; - version = "1.0.2.0.20230124.51334"; + version = "1.0.3.0.20230915.165808"; src = fetchurl { - url = "https://elpa.gnu.org/devel/gnat-compiler-1.0.2.0.20230124.51334.tar"; - sha256 = "0kqzqw2dbsmcmrqkb5rsjmkpznfj1licnbfjbp1ifs0kaf2cigqy"; + url = "https://elpa.gnu.org/devel/gnat-compiler-1.0.3.0.20230915.165808.tar"; + sha256 = "1za3ihjbramms85r35kz1d3gyyr3kyimd5m7xsmqnrpj3wsrjika"; }; packageRequires = [ emacs wisi ]; meta = { @@ -2585,10 +2587,10 @@ elpaBuild { pname = "gpr-mode"; ename = "gpr-mode"; - version = "1.0.3.0.20230119.135149"; + version = "1.0.4.0.20231015.114428"; src = fetchurl { - url = "https://elpa.gnu.org/devel/gpr-mode-1.0.3.0.20230119.135149.tar"; - sha256 = "1qd4wdmjlhj325q5qjhdx2l4z1bqpv4giwvsgd29s9k3sh7n8m2h"; + url = "https://elpa.gnu.org/devel/gpr-mode-1.0.4.0.20231015.114428.tar"; + sha256 = "1y3571ymlrgiq5jxbwlyw43pmfxgq776pajb9hlvyz9l3w195c8g"; }; packageRequires = [ emacs gnat-compiler wisi ]; meta = { @@ -2605,10 +2607,10 @@ elpaBuild { pname = "gpr-query"; ename = "gpr-query"; - version = "1.0.3.0.20230128.112055"; + version = "1.0.4.0.20231018.92052"; src = fetchurl { - url = "https://elpa.gnu.org/devel/gpr-query-1.0.3.0.20230128.112055.tar"; - sha256 = "0fnq3zdzlcfc54m5ix01ix78drfmzvfiicjp9cvsw78s0sd05p9x"; + url = "https://elpa.gnu.org/devel/gpr-query-1.0.4.0.20231018.92052.tar"; + sha256 = "1pk14d88vy0ylgcdymp9pclygpn06n25yhy0hsjs0lrd8zr56a49"; }; packageRequires = [ emacs gnat-compiler wisi ]; meta = { @@ -2631,17 +2633,14 @@ license = lib.licenses.free; }; }) {}; - greader = callPackage ({ elpaBuild - , emacs - , fetchurl - , lib }: + greader = callPackage ({ elpaBuild, emacs, fetchurl, lib }: elpaBuild { pname = "greader"; ename = "greader"; - version = "0.5.0.0.20230927.204955"; + version = "0.5.0.0.20231026.5322"; src = fetchurl { - url = "https://elpa.gnu.org/devel/greader-0.5.0.0.20230927.204955.tar"; - sha256 = "02kq8r2grdg8y2bjcw01d5wm5mkv4wir4yggs41cmgcwnk3gm1d1"; + url = "https://elpa.gnu.org/devel/greader-0.5.0.0.20231026.5322.tar"; + sha256 = "0m4d1cr637jsy75ax6y2aqhzjwax7qkidm25k4qiqa69lzbkckid"; }; packageRequires = [ emacs ]; meta = { @@ -2824,10 +2823,10 @@ elpaBuild { pname = "hyperbole"; ename = "hyperbole"; - version = "8.0.1pre0.20231009.215811"; + version = "8.0.1pre0.20231022.151646"; src = fetchurl { - url = "https://elpa.gnu.org/devel/hyperbole-8.0.1pre0.20231009.215811.tar"; - sha256 = "0dhrjdk3llxv5s5xfd849vqwr6f1fk411klgjn44szkgi9anbqdv"; + url = "https://elpa.gnu.org/devel/hyperbole-8.0.1pre0.20231022.151646.tar"; + sha256 = "1kr6ayfnq9ah8n8b6k4lxh5napghb90y5sz0g3fs5qjbszcbvxc9"; }; packageRequires = [ emacs ]; meta = { @@ -2923,10 +2922,10 @@ elpaBuild { pname = "ivy"; ename = "ivy"; - version = "0.14.0.0.20230714.75746"; + version = "0.14.2.0.20231025.231958"; src = fetchurl { - url = "https://elpa.gnu.org/devel/ivy-0.14.0.0.20230714.75746.tar"; - sha256 = "166nysfapnz1b15dmag9hlfx26j0k882k5wmx7fpbm4mdj20y6q0"; + url = "https://elpa.gnu.org/devel/ivy-0.14.2.0.20231025.231958.tar"; + sha256 = "0r6dyq350djn5vprk0cvj7vh3l0j2vadsxaiq35yv9gjqh20ca88"; }; packageRequires = [ emacs ]; meta = { @@ -2943,10 +2942,10 @@ elpaBuild { pname = "ivy-avy"; ename = "ivy-avy"; - version = "0.14.0.0.20230410.182616"; + version = "0.14.2.0.20231025.232243"; src = fetchurl { - url = "https://elpa.gnu.org/devel/ivy-avy-0.14.0.0.20230410.182616.tar"; - sha256 = "1s749025jyd5qy5yhxnnd71bj1qcwa6ah0ddl2cs16h9mdbf87qy"; + url = "https://elpa.gnu.org/devel/ivy-avy-0.14.2.0.20231025.232243.tar"; + sha256 = "1y9v3iv7zj7zc526k336rjq04vlisx8giyax5h0as97r8zc4rpzc"; }; packageRequires = [ avy emacs ivy ]; meta = { @@ -2982,10 +2981,10 @@ elpaBuild { pname = "ivy-hydra"; ename = "ivy-hydra"; - version = "0.14.0.0.20230410.182324"; + version = "0.14.2.0.20231025.232457"; src = fetchurl { - url = "https://elpa.gnu.org/devel/ivy-hydra-0.14.0.0.20230410.182324.tar"; - sha256 = "10sd554k3qb81am3jvg7l084i031c133a24cgh0g44vjj2s76nra"; + url = "https://elpa.gnu.org/devel/ivy-hydra-0.14.2.0.20231025.232457.tar"; + sha256 = "15az95s0bv0wc33kqh2h5n92hhn54mhy4lx9m2mm2x83jggdw4yy"; }; packageRequires = [ emacs hydra ivy ]; meta = { @@ -3068,10 +3067,10 @@ elpaBuild { pname = "jinx"; ename = "jinx"; - version = "0.9.0.20231019.170830"; + version = "0.9.0.20231026.154650"; src = fetchurl { - url = "https://elpa.gnu.org/devel/jinx-0.9.0.20231019.170830.tar"; - sha256 = "13wd7xaa3grslycvykx4yglh669fqrrfpqz6715zifkd3mnl0ik3"; + url = "https://elpa.gnu.org/devel/jinx-0.9.0.20231026.154650.tar"; + sha256 = "1fck948ay9n64mxqmx7j6fn6hzfn858l0s0gw544in2y617niyh6"; }; packageRequires = [ compat emacs ]; meta = { @@ -3316,10 +3315,10 @@ elpaBuild { pname = "llm"; ename = "llm"; - version = "0.4.0.0.20231018.234129"; + version = "0.5.0.0.20231026.5843"; src = fetchurl { - url = "https://elpa.gnu.org/devel/llm-0.4.0.0.20231018.234129.tar"; - sha256 = "1zfqyqga38j319hy85pq7fqmma1x2p716z6zvydrnn0npnfnggry"; + url = "https://elpa.gnu.org/devel/llm-0.5.0.0.20231026.5843.tar"; + sha256 = "0ywmfbis4jrqjg2gc3khgwc9kdbhjh99syag2bk1vzjmwfd2cq89"; }; packageRequires = [ emacs ]; meta = { @@ -3477,10 +3476,10 @@ elpaBuild { pname = "marginalia"; ename = "marginalia"; - version = "1.3.0.20230925.162757"; + version = "1.3.0.20231026.181335"; src = fetchurl { - url = "https://elpa.gnu.org/devel/marginalia-1.3.0.20230925.162757.tar"; - sha256 = "0g0ccxd2ks2av5lxbz5c3hi86jf10dizvm8ziday1v34lbp4f6hw"; + url = "https://elpa.gnu.org/devel/marginalia-1.3.0.20231026.181335.tar"; + sha256 = "1q7dbzrdzjwiyq09zbq8wbj673vaj5ss3xyrz3y226wb6jpmzr74"; }; packageRequires = [ compat emacs ]; meta = { @@ -4094,10 +4093,10 @@ elpaBuild { pname = "orderless"; ename = "orderless"; - version = "1.0.0.20230919.235319"; + version = "1.0.0.20231025.204425"; src = fetchurl { - url = "https://elpa.gnu.org/devel/orderless-1.0.0.20230919.235319.tar"; - sha256 = "0j26253q0f6h016xpgxx6jy36mdi9sm5bvyki7i2374hmcp5lxd8"; + url = "https://elpa.gnu.org/devel/orderless-1.0.0.20231025.204425.tar"; + sha256 = "1lsfa62hpq6zmk49mnf1434lqv3p472la3aky003xplkvl0xbw7l"; }; packageRequires = [ emacs ]; meta = { @@ -4109,10 +4108,10 @@ elpaBuild { pname = "org"; ename = "org"; - version = "9.7pre0.20231021.130825"; + version = "9.7pre0.20231027.91944"; src = fetchurl { - url = "https://elpa.gnu.org/devel/org-9.7pre0.20231021.130825.tar"; - sha256 = "1vfgzgd7zwcnv55n7v542zn90irwjwsgn7z8kmxqg5cpyw0r2x06"; + url = "https://elpa.gnu.org/devel/org-9.7pre0.20231027.91944.tar"; + sha256 = "0af65mm22bl6c38abqn39s5rz6i67pbcmhfq6n2hn0a8jgmmppwc"; }; packageRequires = [ emacs ]; meta = { @@ -4205,10 +4204,10 @@ elpaBuild { pname = "org-real"; ename = "org-real"; - version = "1.0.6.0.20221114.84409"; + version = "1.0.7.0.20231024.111108"; src = fetchurl { - url = "https://elpa.gnu.org/devel/org-real-1.0.6.0.20221114.84409.tar"; - sha256 = "1xmix5ldxxkh249fgyqlp31yndl14gz3ylpcsh6l9hmwqagzg20x"; + url = "https://elpa.gnu.org/devel/org-real-1.0.7.0.20231024.111108.tar"; + sha256 = "199900lvg5jxfspp1papx0aj88vm6addlyv7zhp8bc2f5a9igg21"; }; packageRequires = [ boxy emacs org ]; meta = { @@ -5072,10 +5071,10 @@ elpaBuild { pname = "relint"; ename = "relint"; - version = "1.24.0.20231005.122642"; + version = "1.24.0.20231026.84057"; src = fetchurl { - url = "https://elpa.gnu.org/devel/relint-1.24.0.20231005.122642.tar"; - sha256 = "0xlb4i0zj225q8l4a9riagc7qv795bigygmqrlm81ypxqvbm3r5n"; + url = "https://elpa.gnu.org/devel/relint-1.24.0.20231026.84057.tar"; + sha256 = "0s0gz6w6b04sif8yf83hb7y61jmjvksmslznmzlf8x3rq9p7kwyd"; }; packageRequires = [ emacs xr ]; meta = { @@ -5814,10 +5813,10 @@ elpaBuild { pname = "swiper"; ename = "swiper"; - version = "0.14.0.0.20230410.182739"; + version = "0.14.2.0.20231025.232825"; src = fetchurl { - url = "https://elpa.gnu.org/devel/swiper-0.14.0.0.20230410.182739.tar"; - sha256 = "10vqxmqdzvr7rg6wg5whzl4w9y4j47m330fx7qgvzi5zw28b69f3"; + url = "https://elpa.gnu.org/devel/swiper-0.14.2.0.20231025.232825.tar"; + sha256 = "13jvr9xv1i44ky906m4awkakvhrmpxg7x5f9hzbwnfz52wcxx8ix"; }; packageRequires = [ emacs ivy ]; meta = { @@ -6165,16 +6164,17 @@ , elpaBuild , emacs , fetchurl - , lib }: + , lib + , seq }: elpaBuild { pname = "transient"; ename = "transient"; - version = "0.4.3.0.20230919.214625"; + version = "0.4.3.0.20231024.181508"; src = fetchurl { - url = "https://elpa.gnu.org/devel/transient-0.4.3.0.20230919.214625.tar"; - sha256 = "1b4dlgk6x22mpacd4wiinlh5sjgprhabha7wq7dfcsgv7mqhk5z2"; + url = "https://elpa.gnu.org/devel/transient-0.4.3.0.20231024.181508.tar"; + sha256 = "0b092m462gndqlyv8lvfikkdqmly2w5dkbbkn405rbmki2r4bggk"; }; - packageRequires = [ compat emacs ]; + packageRequires = [ compat emacs seq ]; meta = { homepage = "https://elpa.gnu.org/packages/transient.html"; license = lib.licenses.free; @@ -6347,10 +6347,10 @@ elpaBuild { pname = "urgrep"; ename = "urgrep"; - version = "0.3.0snapshot0.20230831.195518"; + version = "0.3.0snapshot0.20231026.224925"; src = fetchurl { - url = "https://elpa.gnu.org/devel/urgrep-0.3.0snapshot0.20230831.195518.tar"; - sha256 = "1qhvspbzbnl1jcqhixfbrqg9jxmc495gv95vhiadm3dpqhxfcn81"; + url = "https://elpa.gnu.org/devel/urgrep-0.3.0snapshot0.20231026.224925.tar"; + sha256 = "07akrg4z177xjway75bl7281ic78j8sl818jd52nmxhx4wxys9mv"; }; packageRequires = [ compat emacs project ]; meta = { @@ -6367,10 +6367,10 @@ elpaBuild { pname = "url-http-ntlm"; ename = "url-http-ntlm"; - version = "2.0.4.0.20231015.130736"; + version = "2.0.5.0.20231024.31412"; src = fetchurl { - url = "https://elpa.gnu.org/devel/url-http-ntlm-2.0.4.0.20231015.130736.tar"; - sha256 = "0gpkr7m2kwnz7pmj6y4xn41175jy9vaxsj5f7glzd3w1xklr4hg0"; + url = "https://elpa.gnu.org/devel/url-http-ntlm-2.0.5.0.20231024.31412.tar"; + sha256 = "0vr04yr4ywxvh7c6s447bsa5v148ny3lvx54bpd60qf5cp92z1zw"; }; packageRequires = [ cl-lib nadvice ntlm ]; meta = { @@ -6418,10 +6418,10 @@ elpaBuild { pname = "use-package"; ename = "use-package"; - version = "2.4.5.0.20231022.75512"; + version = "2.4.5.0.20231026.114632"; src = fetchurl { - url = "https://elpa.gnu.org/devel/use-package-2.4.5.0.20231022.75512.tar"; - sha256 = "0cvsqrbamg9nxcjxqiq6avjyk027dxxzskgnvv0drrlsgcvb3yai"; + url = "https://elpa.gnu.org/devel/use-package-2.4.5.0.20231026.114632.tar"; + sha256 = "0sfs6030s6zngxgsv9wj181brsk6f8avfvl53vr0yspry53z2vpz"; }; packageRequires = [ bind-key emacs ]; meta = { @@ -6855,10 +6855,10 @@ elpaBuild { pname = "wisi"; ename = "wisi"; - version = "4.2.2.0.20230126.2042"; + version = "4.3.2.0.20231026.105332"; src = fetchurl { - url = "https://elpa.gnu.org/devel/wisi-4.2.2.0.20230126.2042.tar"; - sha256 = "0b70yipm6wmz5034f5l7f78c2bgscm2c8lph75jgd5x1qwzngw47"; + url = "https://elpa.gnu.org/devel/wisi-4.3.2.0.20231026.105332.tar"; + sha256 = "1jlqvimnjsdvaylfj2hq9k9bllvl74j1g4pd8w4kf3c30n7jyiql"; }; packageRequires = [ emacs seq ]; meta = { @@ -6875,10 +6875,10 @@ elpaBuild { pname = "wisitoken-grammar-mode"; ename = "wisitoken-grammar-mode"; - version = "1.3.0.0.20230125.102656"; + version = "1.3.0.0.20231023.83923"; src = fetchurl { - url = "https://elpa.gnu.org/devel/wisitoken-grammar-mode-1.3.0.0.20230125.102656.tar"; - sha256 = "1h5pnghxg01f0hgxw7284b4rm5c43r48nbsxj19dcypxrzz3w1qw"; + url = "https://elpa.gnu.org/devel/wisitoken-grammar-mode-1.3.0.0.20231023.83923.tar"; + sha256 = "17kgrwm1jr1dxaprgay60jmgg5bfhmyrngzy0qfia6zs7w43bscx"; }; packageRequires = [ emacs mmm-mode wisi ]; meta = { @@ -6982,10 +6982,10 @@ elpaBuild { pname = "xr"; ename = "xr"; - version = "1.25.0.20231005.122612"; + version = "1.25.0.20231026.84432"; src = fetchurl { - url = "https://elpa.gnu.org/devel/xr-1.25.0.20231005.122612.tar"; - sha256 = "0sj2cyxdfykk3gfw3v9d93mzssxiassj5vhzl76sm8dy59z93z4y"; + url = "https://elpa.gnu.org/devel/xr-1.25.0.20231026.84432.tar"; + sha256 = "0kvkz24z0cb32igj1hv09j0cg2xhwrkafi7zhfb85vwj4kgcd6pj"; }; packageRequires = [ emacs ]; meta = { @@ -6997,10 +6997,10 @@ elpaBuild { pname = "xref"; ename = "xref"; - version = "1.6.3.0.20231009.180303"; + version = "1.6.3.0.20231023.205120"; src = fetchurl { - url = "https://elpa.gnu.org/devel/xref-1.6.3.0.20231009.180303.tar"; - sha256 = "146bvnaxzfqjbpib8cm7mlq4j2695wh9czwi9lfbx5k8npakjrih"; + url = "https://elpa.gnu.org/devel/xref-1.6.3.0.20231023.205120.tar"; + sha256 = "1qszzbnn3pdpy7q7i9ir04dnp15rgkm7xnl73pp3wpvbqjwwgmd3"; }; packageRequires = [ emacs ]; meta = { @@ -7028,17 +7028,18 @@ }) {}; yasnippet = callPackage ({ cl-lib ? null , elpaBuild + , emacs , fetchurl , lib }: elpaBuild { pname = "yasnippet"; ename = "yasnippet"; - version = "0.14.0.0.20230912.111325"; + version = "0.14.0.0.20230914.100037"; src = fetchurl { - url = "https://elpa.gnu.org/devel/yasnippet-0.14.0.0.20230912.111325.tar"; - sha256 = "0k9h33dgxhg20cg2wwxmhxl5yzyh2g4kims15l0rgs2ag496qn5a"; + url = "https://elpa.gnu.org/devel/yasnippet-0.14.0.0.20230914.100037.tar"; + sha256 = "0kqv0scxkxxczxc1fxmpv0lgddp92j600s972xwb681a0vq2ssz6"; }; - packageRequires = [ cl-lib ]; + packageRequires = [ cl-lib emacs ]; meta = { homepage = "https://elpa.gnu.org/packages/yasnippet.html"; license = lib.licenses.free; diff --git a/pkgs/applications/editors/emacs/elisp-packages/elpa-generated.nix b/pkgs/applications/editors/emacs/elisp-packages/elpa-generated.nix index 2e3016f1a73fc..6116f851fbfff 100644 --- a/pkgs/applications/editors/emacs/elisp-packages/elpa-generated.nix +++ b/pkgs/applications/editors/emacs/elisp-packages/elpa-generated.nix @@ -40,10 +40,10 @@ elpaBuild { pname = "ada-mode"; ename = "ada-mode"; - version = "8.0.5"; + version = "8.1.0"; src = fetchurl { - url = "https://elpa.gnu.org/packages/ada-mode-8.0.5.tar"; - sha256 = "00baypl9bv2z42d6z2k531ai25yw2aj1dcv4pi1jhcp19c9kjg4l"; + url = "https://elpa.gnu.org/packages/ada-mode-8.1.0.tar"; + sha256 = "1nfqm173gbk6483xgdkmxp5nb8biihq1623058gbl0dfwn0p9njh"; }; packageRequires = [ emacs gnat-compiler uniquify-files wisi ]; meta = { @@ -370,10 +370,10 @@ elpaBuild { pname = "bbdb"; ename = "bbdb"; - version = "3.2.2.2"; + version = "3.2.2.4"; src = fetchurl { - url = "https://elpa.gnu.org/packages/bbdb-3.2.2.2.tar"; - sha256 = "0bf20r5xhxln6z4qp8zrlln0303dkci2ydsr74pxcj08aqgk5xxf"; + url = "https://elpa.gnu.org/packages/bbdb-3.2.2.4.tar"; + sha256 = "13i8ggknc29sny16rq126q0ssz26m3fam0zpdhlsm05pa8dydd7p"; }; packageRequires = [ cl-lib emacs ]; meta = { @@ -952,10 +952,10 @@ elpaBuild { pname = "counsel"; ename = "counsel"; - version = "0.14.0"; + version = "0.14.2"; src = fetchurl { - url = "https://elpa.gnu.org/packages/counsel-0.14.0.tar"; - sha256 = "03n1qk66dcbh9xlnlzpwkb441c2xdpfc7bzx4i2szw0xh4a6g5sj"; + url = "https://elpa.gnu.org/packages/counsel-0.14.2.tar"; + sha256 = "13119alyzr2xipk3jra3iawplqkqgvv0gdcm4yd527z592b0s7f0"; }; packageRequires = [ emacs ivy swiper ]; meta = { @@ -1543,10 +1543,10 @@ elpaBuild { pname = "ef-themes"; ename = "ef-themes"; - version = "1.3.0"; + version = "1.4.0"; src = fetchurl { - url = "https://elpa.gnu.org/packages/ef-themes-1.3.0.tar"; - sha256 = "1cchc1cfp2y32d736r4523gjzvg4rd1nqddxsjsk5kialz06alms"; + url = "https://elpa.gnu.org/packages/ef-themes-1.4.0.tar"; + sha256 = "0pp72bi9s7vyxyyy7dc0vql4k6hqzd1gg3a2i4wi09awdak85gi6"; }; packageRequires = [ emacs ]; meta = { @@ -2011,10 +2011,10 @@ elpaBuild { pname = "flymake"; ename = "flymake"; - version = "1.3.6"; + version = "1.3.7"; src = fetchurl { - url = "https://elpa.gnu.org/packages/flymake-1.3.6.tar"; - sha256 = "1ihv8gh77849rrdc6qpbpjdw7ikr4biaibw6aggv3hzjf508dzi8"; + url = "https://elpa.gnu.org/packages/flymake-1.3.7.tar"; + sha256 = "07n72y77q1vqvz1rv36jq1cxdp1brp572plvsi2g6mizif5y531z"; }; packageRequires = [ eldoc emacs project ]; meta = { @@ -2176,10 +2176,10 @@ elpaBuild { pname = "gnat-compiler"; ename = "gnat-compiler"; - version = "1.0.2"; + version = "1.0.3"; src = fetchurl { - url = "https://elpa.gnu.org/packages/gnat-compiler-1.0.2.tar"; - sha256 = "1cwjv1ziw5hjnk493vwwg25bnvy98wcryy0c4gknl1xp5qr2qxdg"; + url = "https://elpa.gnu.org/packages/gnat-compiler-1.0.3.tar"; + sha256 = "1l5j3br5yrhp3ic0va666ar636hywfd8vssxma3gc858zb9qbzw2"; }; packageRequires = [ emacs wisi ]; meta = { @@ -2308,10 +2308,10 @@ elpaBuild { pname = "gpr-mode"; ename = "gpr-mode"; - version = "1.0.3"; + version = "1.0.4"; src = fetchurl { - url = "https://elpa.gnu.org/packages/gpr-mode-1.0.3.tar"; - sha256 = "0m93szqyh9dd73z2pygvacg42n3siiy8pji3yzg1ynji859bc3b8"; + url = "https://elpa.gnu.org/packages/gpr-mode-1.0.4.tar"; + sha256 = "1c97m28i6lym07kb05jgssjxj6p9v3v56qrn48xwv55sriqrha4l"; }; packageRequires = [ emacs gnat-compiler wisi ]; meta = { @@ -2328,10 +2328,10 @@ elpaBuild { pname = "gpr-query"; ename = "gpr-query"; - version = "1.0.3"; + version = "1.0.4"; src = fetchurl { - url = "https://elpa.gnu.org/packages/gpr-query-1.0.3.tar"; - sha256 = "13h8hl2g55mbaz95k9jfcvz718rv4vli9wccr3rr7cb7yfvn4c5j"; + url = "https://elpa.gnu.org/packages/gpr-query-1.0.4.tar"; + sha256 = "0a6wrkjqszqq4d0a1amrp7yx4w2hwjbyy7qxd40k9n1vdp7jbzri"; }; packageRequires = [ emacs gnat-compiler wisi ]; meta = { @@ -2620,10 +2620,10 @@ elpaBuild { pname = "ivy"; ename = "ivy"; - version = "0.14.0"; + version = "0.14.2"; src = fetchurl { - url = "https://elpa.gnu.org/packages/ivy-0.14.0.tar"; - sha256 = "1fzl7xcmxjg005g4676ac3jcshgmcmdr81ywmxvjcs8wj71v56jv"; + url = "https://elpa.gnu.org/packages/ivy-0.14.2.tar"; + sha256 = "1zjksh0jvxyqhzgwmh9i26gaip6c04q400xckh730r2gjs287pjj"; }; packageRequires = [ emacs ]; meta = { @@ -2635,10 +2635,10 @@ elpaBuild { pname = "ivy-avy"; ename = "ivy-avy"; - version = "0.14.0"; + version = "0.14.2"; src = fetchurl { - url = "https://elpa.gnu.org/packages/ivy-avy-0.14.0.tar"; - sha256 = "0gjpvjahhkxsakqrcni78v71fsrh3f0jrs55a4kqc5hv6qyn8hk9"; + url = "https://elpa.gnu.org/packages/ivy-avy-0.14.2.tar"; + sha256 = "0vdrfn2i078567lklhxfhzq2cjplfpawyq2rzpdpww0fzz6fi426"; }; packageRequires = [ avy emacs ivy ]; meta = { @@ -2665,10 +2665,10 @@ elpaBuild { pname = "ivy-hydra"; ename = "ivy-hydra"; - version = "0.14.0"; + version = "0.14.2"; src = fetchurl { - url = "https://elpa.gnu.org/packages/ivy-hydra-0.14.0.tar"; - sha256 = "1gsjr2yny9qcj56cb4xy47la11z0lszq0f2qws0yzyh02ng30k1n"; + url = "https://elpa.gnu.org/packages/ivy-hydra-0.14.2.tar"; + sha256 = "10qav0rvgc5bnlazjiwnv9dlk6hivl4acif0zq2f0qqgld9nh528"; }; packageRequires = [ emacs hydra ivy ]; meta = { @@ -2975,10 +2975,10 @@ elpaBuild { pname = "llm"; ename = "llm"; - version = "0.4.0"; + version = "0.5.0"; src = fetchurl { - url = "https://elpa.gnu.org/packages/llm-0.4.0.tar"; - sha256 = "0jq1q9gmm3nbdsycca2qkjpf04qpp9j615z6l41plmfv7bc0p0x6"; + url = "https://elpa.gnu.org/packages/llm-0.5.0.tar"; + sha256 = "07n32hfzyjzj7vjy5l7rxaldpa4hyjwharkizs2gzz66lg83wix8"; }; packageRequires = [ emacs ]; meta = { @@ -3779,10 +3779,10 @@ elpaBuild { pname = "org-real"; ename = "org-real"; - version = "1.0.6"; + version = "1.0.7"; src = fetchurl { - url = "https://elpa.gnu.org/packages/org-real-1.0.6.tar"; - sha256 = "1qfzmmv3c1yc14v502x0438pxh2bcwli1r3xmcxibhb7h6p9mr3k"; + url = "https://elpa.gnu.org/packages/org-real-1.0.7.tar"; + sha256 = "16isfsaxmgxiqfqx4lcsqlxazxjgxakr0k9pgpam13bqqqkq3cmp"; }; packageRequires = [ boxy emacs org ]; meta = { @@ -5169,10 +5169,10 @@ elpaBuild { pname = "swiper"; ename = "swiper"; - version = "0.14.0"; + version = "0.14.2"; src = fetchurl { - url = "https://elpa.gnu.org/packages/swiper-0.14.0.tar"; - sha256 = "1p2qil6gj4y8y3ydqs8pbxn8j16q9r42nnc2f61c30hws504pkms"; + url = "https://elpa.gnu.org/packages/swiper-0.14.2.tar"; + sha256 = "1x6jnc0nrk68kww12gq6w8nss6ny76xz0fgxf57550bbipx9pa8m"; }; packageRequires = [ emacs ivy ]; meta = { @@ -5643,16 +5643,17 @@ , elpaBuild , fetchurl , lib + , nadvice , ntlm ? null }: elpaBuild { pname = "url-http-ntlm"; ename = "url-http-ntlm"; - version = "2.0.4"; + version = "2.0.5"; src = fetchurl { - url = "https://elpa.gnu.org/packages/url-http-ntlm-2.0.4.el"; - sha256 = "1cakq2ykraci7d1gl8rnpv4f2f5ffyaidhqb1282g7i72adwmb98"; + url = "https://elpa.gnu.org/packages/url-http-ntlm-2.0.5.tar"; + sha256 = "0bpjif0c4yzz75v59wsv7hilkpj2gv4kyc0rdk8h3d9hvmlq7791"; }; - packageRequires = [ cl-lib ntlm ]; + packageRequires = [ cl-lib nadvice ntlm ]; meta = { homepage = "https://elpa.gnu.org/packages/url-http-ntlm.html"; license = lib.licenses.free; @@ -6097,10 +6098,10 @@ elpaBuild { pname = "wisi"; ename = "wisi"; - version = "4.2.2"; + version = "4.3.2"; src = fetchurl { - url = "https://elpa.gnu.org/packages/wisi-4.2.2.tar"; - sha256 = "041np2xssm4iv75wmwds25fwx0p2y3j6ph0j0pxmgcj9p028mbka"; + url = "https://elpa.gnu.org/packages/wisi-4.3.2.tar"; + sha256 = "0y3wh0wvxqw7ig2bfrha4zs03993aqcpdp9pald20nady6sqri37"; }; packageRequires = [ emacs seq ]; meta = { diff --git a/pkgs/applications/editors/emacs/elisp-packages/nongnu-generated.nix b/pkgs/applications/editors/emacs/elisp-packages/nongnu-generated.nix index 063e4cac1f561..d0499184b785c 100644 --- a/pkgs/applications/editors/emacs/elisp-packages/nongnu-generated.nix +++ b/pkgs/applications/editors/emacs/elisp-packages/nongnu-generated.nix @@ -361,10 +361,10 @@ elpaBuild { pname = "cider"; ename = "cider"; - version = "1.8.3"; + version = "1.9.0"; src = fetchurl { - url = "https://elpa.nongnu.org/nongnu/cider-1.8.3.tar"; - sha256 = "0c77rlpyda4x05fj3d10cpww0pkbsjcbrvwcwy4gh74c9m9xmq1d"; + url = "https://elpa.nongnu.org/nongnu/cider-1.9.0.tar"; + sha256 = "08vc1v4gzh1njvqhg10c07wq28r2s9qq3y7i4b5clrzgy9l872cw"; }; packageRequires = [ clojure-mode @@ -3001,10 +3001,10 @@ elpaBuild { pname = "sweeprolog"; ename = "sweeprolog"; - version = "0.25.5"; + version = "0.26.0"; src = fetchurl { - url = "https://elpa.nongnu.org/nongnu/sweeprolog-0.25.5.tar"; - sha256 = "1gxy68a26h65rzf8815iifcnr67rpw69ll14d4cbq9qsxvrmy50h"; + url = "https://elpa.nongnu.org/nongnu/sweeprolog-0.26.0.tar"; + sha256 = "0pgxz3ckw3qjzqyn6vr8k8y1gdiybsm47ik8j62ybsnqs7ivs208"; }; packageRequires = [ compat emacs ]; meta = { @@ -3307,10 +3307,10 @@ elpaBuild { pname = "web-mode"; ename = "web-mode"; - version = "17.3.14"; + version = "17.3.15"; src = fetchurl { - url = "https://elpa.nongnu.org/nongnu/web-mode-17.3.14.tar"; - sha256 = "1a13lra62vqcxr31ivx1r68wj1d59hkbrfxxmy8f7afm1v4aqbz2"; + url = "https://elpa.nongnu.org/nongnu/web-mode-17.3.15.tar"; + sha256 = "028p034793pkkwgaqgc3zw23ji39ss5gma5g8fhml6v8pc4ri2w8"; }; packageRequires = [ emacs ]; meta = { @@ -3470,10 +3470,10 @@ elpaBuild { pname = "xah-fly-keys"; ename = "xah-fly-keys"; - version = "24.13.20231009115302"; + version = "24.13.20231025112537"; src = fetchurl { - url = "https://elpa.nongnu.org/nongnu/xah-fly-keys-24.13.20231009115302.tar"; - sha256 = "0k530ihjjwcvl24f815nk9jqfnbhzb95xlfm8721dlsbrsmsaiwc"; + url = "https://elpa.nongnu.org/nongnu/xah-fly-keys-24.13.20231025112537.tar"; + sha256 = "1h7z9g3307w0cg361md8mbhsia2534ncqihdfsasg5qhw9184sib"; }; packageRequires = [ emacs ]; meta = { diff --git a/pkgs/applications/editors/emacs/elisp-packages/recipes-archive-melpa.json b/pkgs/applications/editors/emacs/elisp-packages/recipes-archive-melpa.json index 955c3a07519cb..dfdd517b600d8 100644 --- a/pkgs/applications/editors/emacs/elisp-packages/recipes-archive-melpa.json +++ b/pkgs/applications/editors/emacs/elisp-packages/recipes-archive-melpa.json @@ -2803,15 +2803,15 @@ "repo": "mohkale/all-the-icons-nerd-fonts", "unstable": { "version": [ - 20230904, - 1718 + 20231022, + 1956 ], "deps": [ "all-the-icons", "nerd-icons" ], - "commit": "db513dafaa8b73b5abcf9737939863d0e5b2f03d", - "sha256": "0rrghm38brj209imi221lvclxf7fda7vzla0xmdipz2zbvcvcr66" + "commit": "9ac476b1a82199cfa770f214b6d53776cd276bd9", + "sha256": "0f76l7g1gwji3wy3gxir989b8p3lmfn9q5m5p76p0qfvi9c8gz62" } }, { @@ -5472,14 +5472,14 @@ "repo": "elp-revive/auto-highlight-symbol", "unstable": { "version": [ - 20221231, - 1631 + 20231027, + 715 ], "deps": [ "ht" ], - "commit": "ece5e2c722efa5c9ea32a809b484afc222ebebe5", - "sha256": "13v21zmcvnrc5a7ig08xs6nf2irdkah3nwgfjk4933ym8rff4sy9" + "commit": "1c79083b9b6af70b0eba3d4c00cafafeb6154845", + "sha256": "1szb4namrl0415adji9042cxbh28kw8kxk756b3z45y18bscns14" }, "stable": { "version": [ @@ -6195,11 +6195,11 @@ "repo": "nverno/awk-ts-mode", "unstable": { "version": [ - 20231001, - 2221 + 20231022, + 1757 ], - "commit": "d142f0ab61da89d3bf311194f69b655b0b7855a9", - "sha256": "0d6wwx47c1z7vs2ql1497041fawya1xpbgzys5n4j2vqhl07lali" + "commit": "a32d83a2c8714c5f2fdb8cc8cb6733a2eb1a4e87", + "sha256": "1k3nyp4h9iqz6cx90g469jf2j7kvr4q8mqn2i0han2a406izk9n5" } }, { @@ -6951,14 +6951,14 @@ "url": "https://git.savannah.nongnu.org/git/bbdb.git", "unstable": { "version": [ - 20220706, - 433 + 20231023, + 544 ], "deps": [ "cl-lib" ], - "commit": "1b121e94871f5d931c75793257db732ba82fdddb", - "sha256": "1mak78xg46hz5l00xqy5g8d6mrfs5z36nb0arjmpam2gvi6mzcz2" + "commit": "14ed4d1048c41c813f601bbf0f4c8d0d5b9489d8", + "sha256": "00qjrzfn0lmj5dr54s6sm10kfjqs815ak2hhgi875rhv5p30smh7" }, "stable": { "version": [ @@ -7983,20 +7983,20 @@ "repo": "liuyinz/binky.el", "unstable": { "version": [ - 20231020, - 2113 + 20231023, + 2145 ], - "commit": "0078a4b0bab190e27cf011b6d1f685ae953fcc82", - "sha256": "0nnn17rjnmzkryckahzpsicy11shbzbrdjwgwnqxigy7bp39smd2" + "commit": "bf9bd87c44cd5ca5ede0f080fa510240d948a644", + "sha256": "0m0xzcrb0yiddbr2vvnnv0vz4wb6smb3lmk4hij2hdhawf22vm1h" }, "stable": { "version": [ 1, 4, - 0 + 1 ], - "commit": "4285ecaf03f821892a83c2deebb9bc2ecad2995f", - "sha256": "0iy5xq5jyjcgqj6slklv0ywpqb4b5ln11xv5q1gj757ach2nmfiy" + "commit": "38e26cb3408a38d749645ee3f2ea9fc1a3cf2a3e", + "sha256": "0d6wyvmbqvzsasldzfv9fwb7iwxdh214xjzq7jqy5xc5k25p0x60" } }, { @@ -9668,8 +9668,8 @@ "repo": "alphapapa/bufler.el", "unstable": { "version": [ - 20230925, - 118 + 20231027, + 1517 ], "deps": [ "burly", @@ -9679,8 +9679,8 @@ "map", "pretty-hydra" ], - "commit": "8bfbcd54127f01f812d6e13fa11f55566034fa19", - "sha256": "0p6b6wjcsg2ls7jwgyf8k04jz57y6sw85hz1cky1v7hl2kdl5371" + "commit": "d8d52767b3e0afe00a5166f00897c6d7baea1f90", + "sha256": "0xgw4bhp3gd9acjwd1f00g84hj7wlsvh8m2ll1cc2gjhsywl5kxh" }, "stable": { "version": [ @@ -10756,14 +10756,14 @@ "repo": "minad/cape", "unstable": { "version": [ - 20230930, - 537 + 20231022, + 1157 ], "deps": [ "compat" ], - "commit": "116063b9ee912cbaa7318dbe6597ade4a62b3f59", - "sha256": "0p6waivxyg6mdr6xikv41j19ybbjwn7pmvbjxf309q42qgsvb4jp" + "commit": "bee13e568d42ffec9010fbf795e8f942973da174", + "sha256": "1hxlb2rbbjvfaq858v9cia7msmmpzm3nl5vygaxc1rqyyw6b7wn4" }, "stable": { "version": [ @@ -11931,14 +11931,14 @@ "repo": "xenodium/chatgpt-shell", "unstable": { "version": [ - 20230911, - 2017 + 20231027, + 1804 ], "deps": [ "shell-maker" ], - "commit": "8da666560551d6f8bd2f871c48e84b552836a023", - "sha256": "0xfzzqh7dyzk43jfxfn50r8pykaxprs1qnw290s0g22ka0mj64gi" + "commit": "7f11d4a8d979473ea7390cfcbed1ba1ab0fb6732", + "sha256": "0p5lf0r8ldqq8khcarih7msz3pwlzsmzgs2im4dp4akskjqqzbqq" } }, { @@ -12555,8 +12555,8 @@ "repo": "clojure-emacs/cider", "unstable": { "version": [ - 20231021, - 1221 + 20231025, + 508 ], "deps": [ "clojure-mode", @@ -12567,14 +12567,14 @@ "spinner", "transient" ], - "commit": "4c99c02b5762c107cdf771a771a1216b040ba53e", - "sha256": "1nyrlbkqbn7bqj39xdzk6mgrhl4bg3ddhna4f3kggk2rhjlv7yx7" + "commit": "6437f8fe053ada1f5839ff749c3d1b3cfcfd4edd", + "sha256": "072qw9gk11nmgpzgccq01pc32figb547kgw1lxq0m0fkwl1al2k9" }, "stable": { "version": [ 1, - 8, - 3 + 9, + 0 ], "deps": [ "clojure-mode", @@ -12585,8 +12585,8 @@ "spinner", "transient" ], - "commit": "944d6773ac254d9fcac55c05489bff3d91d91402", - "sha256": "12505hbyiqlf4m0mhnkf5r1yaa11rqw4786qxzw56641msv8fxfi" + "commit": "65ab78c7321f1084922653c33b5085ba6633a100", + "sha256": "0sjscbi3qgwn3wcpq5lz7k4gam69h0svh8wbhxcbskr9ys1rmysp" } }, { @@ -12765,11 +12765,11 @@ "repo": "guidoschmidt/circadian.el", "unstable": { "version": [ - 20221223, - 1734 + 20231027, + 744 ], - "commit": "9959e4b9d2ed9920b668fc229aab1f5fa5bd8584", - "sha256": "1hydxhmcchaprfmp08xr6nlksz6y97jbf4mswj69bgdfjfbf22km" + "commit": "b3bb94040080ac18aab04b010752d4984feee37b", + "sha256": "062mci931fwaf12cyw0kidavasdkfcd415iiwizdvlb2dmr3qmsk" }, "stable": { "version": [ @@ -15250,11 +15250,11 @@ "repo": "company-mode/company-mode", "unstable": { "version": [ - 20231016, - 2324 + 20231023, + 1033 ], - "commit": "a0c7c1775ab15d5d7df57a2126b6b9699049b7f0", - "sha256": "09m5y7n8lvfyrvhlnx3yjqlaw28lsdxljald1kqj4r0pvb1kqwk6" + "commit": "66201465a962ac003f320a1df612641b2b276ab5", + "sha256": "0cia8xic3a1z83mwqnjsfa3nz396zzjwpp8vb0784kk3n7964is6" }, "stable": { "version": [ @@ -16591,15 +16591,15 @@ "repo": "company-mode/company-quickhelp", "unstable": { "version": [ - 20221212, - 534 + 20231026, + 1714 ], "deps": [ "company", "pos-tip" ], - "commit": "9505fb09d064581da142d75c139d48b5cf695bd5", - "sha256": "14sm431636k72pc9iz2kmxxrk0q0ijbwy4gnl0qxqh41p9pqm148" + "commit": "5bda859577582cc42d16fc0eaf5f7c8bedfd9e69", + "sha256": "1i3qysgmyzw66hgw9w9yzvdrx9rbis88byi3aidswnxdj3lvrfgk" }, "stable": { "version": [ @@ -17384,6 +17384,25 @@ } }, { + "ename": "conan", + "commit": "7eebc91812072c0f65c95ab9829f31505f880331", + "sha256": "0n829m79pr85s2c7h582bpv040bx9n9pqwni8ascxdnn8rlm8dzf", + "fetcher": "github", + "repo": "carl2/conan-elisp", + "unstable": { + "version": [ + 20231016, + 830 + ], + "deps": [ + "f", + "s" + ], + "commit": "80d17373cb6c3dc7952c538efd9f94a7f564ffec", + "sha256": "1zn9jvdnrs6brgrsmzkmnmlcvvsdyf1in2jrrx6yzz953i7dnz11" + } + }, + { "ename": "concurrent", "commit": "8bc29a8d518ce7a584277089bd4654f52ac0f358", "sha256": "09wjw69bqrr3424h0mpb2kr5ixh96syjjsqrcyd7z2lsas5ldpnf", @@ -17585,14 +17604,14 @@ "repo": "minad/consult", "unstable": { "version": [ - 20231020, - 1932 + 20231023, + 1543 ], "deps": [ "compat" ], - "commit": "8f22fbce8d645b9ed45c9ca62c4151644f338a22", - "sha256": "0s6gb6j7y1i1kv8gbhswqbys4pgs2b6g0maspa8dd8f9v96rgh2h" + "commit": "fa249d5dd7212e5ae1fa51c086d8f1197d738ef4", + "sha256": "12h79lc9r5rgmivr2v8ilk4fw9lw8yh0jv4hc7jksc9dgriwxx9k" }, "stable": { "version": [ @@ -17988,16 +18007,16 @@ "repo": "mclear-tools/consult-notes", "unstable": { "version": [ - 20230706, - 2018 + 20231027, + 1436 ], "deps": [ "consult", "dash", "s" ], - "commit": "4d905df3b74a5a46ebf27ce601846e3adc6b8144", - "sha256": "17lz4bsp8vv9ksfg4a8d3kz2lz7qdpi81gfc0y4jvd9zllcafhnb" + "commit": "eb4c59b8a43c5b74250f92cf8eb05c659efb04d0", + "sha256": "01cs1w126r0czqszwrmfjx31drzq9rlmgfqi5swwvvsz1jcgp2pm" } }, { @@ -18156,14 +18175,14 @@ "repo": "titus.pinta/consult-tex", "unstable": { "version": [ - 20231012, - 1121 + 20231027, + 1150 ], "deps": [ "consult" ], - "commit": "81cf7d7e2ef52c01c291c4ec7215020cbce29085", - "sha256": "1wb8sfmx0y5xwk2yx5alqspm9ddq9mzxfwwcccw8267kqkm3gs3j" + "commit": "a799f1a548e71151b5c0f625c9a532b670c07eb9", + "sha256": "143ihhan50nyfqznw6b331ms5776hq187q3k2i0ha8fcqasycxic" }, "stable": { "version": [ @@ -18179,6 +18198,38 @@ } }, { + "ename": "consult-todo", + "commit": "8445e8dae6f552ea479e2f64961a8e776104570e", + "sha256": "1izplpc6mmn0r9yrfngmwnhprq7lpwdg2dabhlj4170y5xp9y03i", + "fetcher": "github", + "repo": "liuyinz/consult-todo", + "unstable": { + "version": [ + 20231022, + 2059 + ], + "deps": [ + "consult", + "hl-todo" + ], + "commit": "84f3c9876a285f733d75053076a97cc30f7d8eb9", + "sha256": "0v336l9dary68i910yvpk9c24b9vrc1cx615hiv9dz8zi1khz8rr" + }, + "stable": { + "version": [ + 0, + 4, + 1 + ], + "deps": [ + "consult", + "hl-todo" + ], + "commit": "84f3c9876a285f733d75053076a97cc30f7d8eb9", + "sha256": "0v336l9dary68i910yvpk9c24b9vrc1cx615hiv9dz8zi1khz8rr" + } + }, + { "ename": "consult-yasnippet", "commit": "da399d9149261f6fded5a465ba1b6f2353abfa5a", "sha256": "08piq6zfj8ixp8shyc69hmmxqqci0xp5mmg51ajddvz8k0sndgn1", @@ -18324,11 +18375,11 @@ "repo": "nverno/cool-mode", "unstable": { "version": [ - 20220612, - 1904 + 20231026, + 456 ], - "commit": "961e66956412a1dd63f79473a8273da8853f7179", - "sha256": "07dbw0yvk3ijibhghzgaik3cfrv56dr8ax7dyy0kryvjairmhwjc" + "commit": "46b6a38a99a954c5e77e90506eafec4092690692", + "sha256": "1vf4rr97y326lq76q57i2f7j3s264gqz36dnhaav0ivrzx8zwnyl" } }, { @@ -18639,28 +18690,28 @@ "repo": "abo-abo/swiper", "unstable": { "version": [ - 20230619, - 1623 + 20231025, + 2311 ], "deps": [ "ivy", "swiper" ], - "commit": "aa18c1f4861cef2ddcf0c70b6fd7edd93ae9c627", - "sha256": "11c8874amlgfch2m993qyn4lrj05z3ij4dk2a4wvhj93x8hr0dr8" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" }, "stable": { "version": [ 0, 14, - 0 + 2 ], "deps": [ "ivy", "swiper" ], - "commit": "d28225e86f8dfb3825809ad287f759f95ee9e479", - "sha256": "16j5k96wllfjgcb1bn0rfm7x67yhr3kh5601b8rydlk768zjpq5v" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" } }, { @@ -19895,8 +19946,8 @@ "repo": "hlolli/csound-mode", "unstable": { "version": [ - 20230825, - 946 + 20231024, + 1442 ], "deps": [ "dash", @@ -19904,8 +19955,8 @@ "multi", "shut-up" ], - "commit": "21b2841696fed1b3d8103ad58202d5604326fcc1", - "sha256": "1kwn0hrcl23icq5phz5h6y9likpcnm54mkqrwcvsnzwvdz0jl5xd" + "commit": "2c9107a78048f16c4e274390eb3021e974372d64", + "sha256": "1sfmvqmgvvff56s39jb51sp9b5sz308y99b0xp4galw51s0vm4vq" }, "stable": { "version": [ @@ -21464,14 +21515,14 @@ "repo": "doublep/datetime", "unstable": { "version": [ - 20230925, - 2038 + 20231025, + 1805 ], "deps": [ "extmap" ], - "commit": "3def4bf0d1ed58cdd424980dd01a4b2e056a86ad", - "sha256": "0q4w76b5ay21k011kmsmqcqgibn79j26a593kyj2bqs9fwvsxc5g" + "commit": "0ec8ecf25e857638ead944eeb3e7d68c6f16f2de", + "sha256": "1n10qyhhyxh4g5pizrj2hlffqd0zx5ym8wsbvwk3z3s6949rjniy" }, "stable": { "version": [ @@ -21682,16 +21733,16 @@ "repo": "Wilfred/deadgrep", "unstable": { "version": [ - 20230914, - 206 + 20231028, + 506 ], "deps": [ "dash", "s", "spinner" ], - "commit": "415b69394960677a8a013d32a3cf67cb9956eef6", - "sha256": "07360pdbsj5dzwwfdbj4yfxpakmmyy17373wh79z0k954wnj5knc" + "commit": "960b61f4d9bcf75fa0f19c3abb447c63c7d886cf", + "sha256": "1791i7jxpmqvs3xmyk0c12dmx1cjni6gk6z6f0s4h0fhp6g99zas" }, "stable": { "version": [ @@ -25392,16 +25443,16 @@ "repo": "seagle0128/doom-modeline", "unstable": { "version": [ - 20230930, - 2212 + 20231027, + 619 ], "deps": [ "compat", "nerd-icons", "shrink-path" ], - "commit": "d739ab51d58b76c1d9cc29e7a0e4abe9c30370dc", - "sha256": "0l6w019gngrqb0scign188pyx06yvfiqanjvvl64yjgl5fryr1k2" + "commit": "1df1a7e49015004a7fb54f7baa8fb1767b3960ec", + "sha256": "0zgwdryws6817pj4jldxas9khfzc57hp0cc0vmgbr8izsqqkidhr" }, "stable": { "version": [ @@ -26280,11 +26331,11 @@ "repo": "xenodium/dwim-shell-command", "unstable": { "version": [ - 20231010, - 2046 + 20231024, + 1346 ], - "commit": "1f865701105de5bbc62d88071a05381c14026732", - "sha256": "17gb87av3zflgi9nzm2igfcgby9m9s9lay16w6j2hx6kbwzqdngf" + "commit": "19be1c2f3792c95f04fd369cb931a52f7df9cfd5", + "sha256": "0fc43n3958b5ix304zigsyz5d5i0gx35lq58lfg40qmc9lhm5hym" } }, { @@ -27045,11 +27096,11 @@ "repo": "nverno/ebnf-mode", "unstable": { "version": [ - 20220606, - 1846 + 20231022, + 1759 ], - "commit": "9bc7242557dcef797afdcb4a50c70bf153aa221d", - "sha256": "1zzn9zivg242m5k5hk94fnp0d1vvbhx00jpf14hb7mr0n7qfdgan" + "commit": "61486b1c9d4746249640410e58087e318f801ed8", + "sha256": "17dmi5gpbp4m4c9xbppar3gc67q6s4p4w9q4phzr1ng4xblwkcjj" } }, { @@ -28768,11 +28819,11 @@ "repo": "emacs-eldev/eldev", "unstable": { "version": [ - 20231011, - 1840 + 20231027, + 1758 ], - "commit": "ed9828d074f53a135c62e989b90c3320642ded5a", - "sha256": "0b6mxz5r830gd14j4jbyifg3k8cqhdl97xxfbgplgj4xxirmpn96" + "commit": "108bccfab4e566c72d16401a675a5fee7ebbb3d8", + "sha256": "16f5ynyvphp58g1fgzqdicd7cj0xc12mx7mi3wzhr6gy9ll510mz" }, "stable": { "version": [ @@ -29388,15 +29439,15 @@ "repo": "karthink/elfeed-tube", "unstable": { "version": [ - 20231021, - 605 + 20231022, + 1733 ], "deps": [ "aio", "elfeed" ], - "commit": "1e61ba02afa7e4258e63b5243e2efebe93f28ae4", - "sha256": "1h5841lkcf9029q4zb6cr4z5zgn1x7n17r0jdddd00dwcf5pclrf" + "commit": "0291038a00c17d780aded05b1e90860a2d586546", + "sha256": "0pza83vfih4gmqmf3mvpp9nxvhd9rsvszh71r9vfmdafzwqkc31p" }, "stable": { "version": [ @@ -29560,11 +29611,11 @@ "repo": "ideasman42/emacs-elisp-autofmt", "unstable": { "version": [ - 20230929, - 17 + 20231026, + 2028 ], - "commit": "9263ed12f653872c70dfef537848e4b3e4a1c4a6", - "sha256": "00l52q82xg3rpbyylbnv8kaynsm7i0z6r9db1css7vzqlk7nbzlf" + "commit": "d5d6010a1bc1b1f5a2422474f701d4573a95aa5b", + "sha256": "055k3za0c5jpa5lgqic9749zsf7vrfzfhcinhhpkrw95amyhpy76" } }, { @@ -29826,14 +29877,14 @@ "repo": "wkirschbaum/elixir-ts-mode", "unstable": { "version": [ - 20231007, - 1031 + 20231025, + 640 ], "deps": [ "heex-ts-mode" ], - "commit": "411ab0a8594040573a2b6bc30f35fa4eea02ba02", - "sha256": "0ws6l9pz3l1wzn71nb49prav5ffskv9c4q6mcgn8y8pkiczir1pj" + "commit": "cb536ff3e70b70004687bbf583757f6929ce0238", + "sha256": "1x55zig1jj8qiarhv6hzmam96jzafwlnsanjq3jqnl5rybr8nsxy" } }, { @@ -29874,14 +29925,15 @@ "repo": "s-kostyaev/ellama", "unstable": { "version": [ - 20231019, - 905 + 20231027, + 1759 ], "deps": [ + "llm", "spinner" ], - "commit": "f9e0de5af6a48659dc39914e61964231fe75ca69", - "sha256": "1826m9nhyn67dsj8gmvff3nps1d4ldxrcdr3kxhdb88wmnwm7z7b" + "commit": "2e5219afbef9ae0c9adc288d3d13b21e49c847d1", + "sha256": "1l551x979914nznczi2n697ykwcpcr40w61c0ivq46fnvzg9sdl8" } }, { @@ -30988,14 +31040,14 @@ "repo": "oantolin/embark", "unstable": { "version": [ - 20231007, - 1902 + 20231026, + 1842 ], "deps": [ "compat" ], - "commit": "b22bcc42c70e75e5c7cb479eb830ecebda0b8cc3", - "sha256": "16vgg0xfv1xpkkwizcim1xp3ns9dzs4cln2d2lir4lyid8hp4x2p" + "commit": "99cb35d7d228f57ce8e096f0c3afbf4335aa307b", + "sha256": "0r9y6c0hgd8qsv05w21g8h575b7m8hn4xi8zhmjhs1vswxgwidmx" }, "stable": { "version": [ @@ -31104,15 +31156,15 @@ "repo": "cute-jumper/embrace.el", "unstable": { "version": [ - 20171031, - 1833 + 20231027, + 419 ], "deps": [ "cl-lib", "expand-region" ], - "commit": "dd5da196e5bcc5e6d87e1937eca0c21da4334ef2", - "sha256": "1m0qyipkp5ydgcav8d0m58fbj1gilipbj7g8mg40iajr8wfqcjdc" + "commit": "c7e748603151d7d91c237fd2d9cdf56e9f3b1ea8", + "sha256": "1c6fbkw1hl9bhdy62g782js8i9kgjr0pr132mpga12jd4cwf8mmz" }, "stable": { "version": [ @@ -31193,16 +31245,16 @@ "url": "https://git.savannah.gnu.org/git/emms.git", "unstable": { "version": [ - 20231017, - 1937 + 20231027, + 2131 ], "deps": [ "cl-lib", "nadvice", "seq" ], - "commit": "b1c1c2ef579b1737a86b9d9550261c77afb93992", - "sha256": "0d9frqn01hnqq4gr7i158mh5nlx94myqb2js9xbzncaavxja1r5d" + "commit": "cdea73e122e07c39678606bf876be925589a51f9", + "sha256": "0k8c2c2aaa7byzf8bm5iayfz1h58igsy2mic7ibbm180m69yl1rm" }, "stable": { "version": [ @@ -31873,15 +31925,15 @@ "repo": "purcell/envrc", "unstable": { "version": [ - 20230831, - 1730 + 20231023, + 1521 ], "deps": [ "inheritenv", "seq" ], - "commit": "7effcda0c9870247da72e7bc56bcac2ca12fcbde", - "sha256": "09azbskv3k2dmfk5xq1rrxxjc47h2sdkn3hbqj7icsz2gfynbn6s" + "commit": "4f9ae5d4d1fcb32c844b50ccda34305884d68be3", + "sha256": "1jsxdyl5sjwc2rwwg2j6ggxs7bvgsifsclqylv1lj3hjl8nhrjzj" }, "stable": { "version": [ @@ -32699,28 +32751,30 @@ "repo": "positron-solutions/elisp-repo-kit", "unstable": { "version": [ - 20230511, - 251 + 20231025, + 252 ], "deps": [ "auto-compile", - "dash" + "dash", + "license-templates" ], - "commit": "f6cca4647538c4dc659f07669938f7e795dba4ee", - "sha256": "10827cn3gxlwxdx7a00ayxjhgmfm184v24fidmdz0z17r6sfccjs" + "commit": "f664196ad5736ec03ff04b4566a363309b8ceda4", + "sha256": "01hx2s9x4zz1d33br6hxc2x9wdf09fcn0rq09fmy96gq74cbjf5n" }, "stable": { "version": [ 0, - 3, - 2 + 4, + 0 ], "deps": [ "auto-compile", - "dash" + "dash", + "license-templates" ], - "commit": "008494af28ef37ecc60571e7b2212e44767db862", - "sha256": "0z5h709w01sss69g97608hrjf5zkqvijqafgq8v2p6a9nf6k3ymc" + "commit": "6e5eaa8b6317d596d0721a3d7656bfb89ff2f847", + "sha256": "09gy3p94cpb2ray4jvpxf1cyjzylvxczhn7m76wx8ppfsg221say" } }, { @@ -36049,11 +36103,11 @@ "repo": "meain/evil-textobj-tree-sitter", "unstable": { "version": [ - 20231013, - 1706 + 20231026, + 1357 ], - "commit": "db6ab405980dc350b7db411cc25e4bba1be0c092", - "sha256": "1xgzcv6bhnw4dl5c21f54lrhpsl12g9bn18mhjknfyh2cqsaypva" + "commit": "b98c1c6d0b08317c9094bb222739ee037afbe7cd", + "sha256": "05y2sy9kbxk81pg6s45n9d1pymfm7zd0bz5zp6b240hyqc5qx8m8" } }, { @@ -36918,16 +36972,16 @@ "repo": "walseb/exwm-firefox-evil", "unstable": { "version": [ - 20231002, - 1316 + 20231026, + 309 ], "deps": [ "evil", "exwm", "exwm-firefox-core" ], - "commit": "fe1e30029b7e44eae2a2b0bbab8719dd8a9457db", - "sha256": "1kyyf2g0ichi9y6hza3wam91x43bz1aj6njfnlk2kz90dg5kbpiq" + "commit": "ec9e14eca25aea9b7c7169be23843898f46696e7", + "sha256": "1fbxll1ylkrkk6jm4mwcdvpix23dxvfsgl2zs10lr823ndydk1b6" } }, { @@ -37895,11 +37949,11 @@ "repo": "technomancy/fennel-mode", "unstable": { "version": [ - 20230904, - 1952 + 20231022, + 1926 ], - "commit": "ec4b0cf13fd374d5de8992eca6adc4db69dbb5ba", - "sha256": "15098ljnanbwfi3va99xy1asagg7df3q0d8kdhx47frld3wlmvcc" + "commit": "5965c8fc693a49e65237a087e693690cf8c9fcb3", + "sha256": "1qxrhrnnxjmw6a1q0v12h2ix5l3d5rp2knf4ppg808mx8b8dcm5w" } }, { @@ -39029,11 +39083,11 @@ "repo": "crmsnbleyd/flexoki-emacs-theme", "unstable": { "version": [ - 20231020, - 623 + 20231026, + 905 ], - "commit": "262db9e912c9cde370f1981121778e9f3bf2beee", - "sha256": "0czcy6v5fsvkbx4hc2ssbhi029jl8dzxi1jfw73pa17779x92a8h" + "commit": "149d00ee4cd17ab465db004910b67456db142802", + "sha256": "056hzf4r8bzzmmhlrgh6f0pppsr3spbrpiwb2kpkdbg1fwi9bjkf" } }, { @@ -40145,6 +40199,36 @@ } }, { + "ename": "flycheck-eask", + "commit": "0ba6c82245d1faaa1280385fe90f8a3144a1c968", + "sha256": "0czmvcb3xg9k9501zr9vym6qg90d89f16pjgkrdfqzdn9v8gpml6", + "fetcher": "github", + "repo": "flycheck/flycheck-eask", + "unstable": { + "version": [ + 20230212, + 1748 + ], + "deps": [ + "flycheck" + ], + "commit": "93cf80d60a8d7080f380e16443e0882ac4656ff1", + "sha256": "0q45h7yyqldj8kxzqb51x7zq98v4f9izwcj1hhgifk8ni1xzr1x5" + }, + "stable": { + "version": [ + 0, + 1, + 0 + ], + "deps": [ + "flycheck" + ], + "commit": "ca1de9d55c99c91971857f0c37abfb3da90dd012", + "sha256": "11minw60sp2jg4p3k25cndx5m8ikl44m11ksnhcvqr891z1r8ny4" + } + }, + { "ename": "flycheck-eglot", "commit": "ead6dfff6183385b6792bae4637bcaec76d87428", "sha256": "0awm312r8my2fy7b2zchhfsf12mv7ad24d4wx85f9p5dalgi2340", @@ -44425,14 +44509,14 @@ "repo": "rnkn/fountain-mode", "unstable": { "version": [ - 20231021, - 1102 + 20231027, + 359 ], "deps": [ "seq" ], - "commit": "0717a12ef3a1c5b847f961a4ae944cd0198805c6", - "sha256": "1jnb0l4sc9w0yh0mf1z4jz3lvpj7rpfq1m2am3ddipfj9zyipv59" + "commit": "a9c521590e720ab151ed601baf924928bce40bd7", + "sha256": "1ja13x0pqwni367y2vzjl2py4q8v0q5a2f8m5ngps6fppn6hbxjz" }, "stable": { "version": [ @@ -45641,11 +45725,11 @@ "repo": "godotengine/emacs-gdscript-mode", "unstable": { "version": [ - 20230527, - 2344 + 20231024, + 1150 ], - "commit": "3e2ae19f036fedc4cc1c1382cd6bb4f12b1aeb76", - "sha256": "0pj9jc0kvbyk5hpila79ipxqyq1zh1w96qyaks4i0530iqci41y8" + "commit": "8a28276daaa23f10e986367b80dc751c5d26829e", + "sha256": "1hwagkbfrrd5bgwykl6hq56jmg0264hd6iz1nljl3n06k1gm3p90" }, "stable": { "version": [ @@ -46545,16 +46629,16 @@ "repo": "magit/ghub", "unstable": { "version": [ - 20231012, - 2152 + 20231026, + 1306 ], "deps": [ "compat", "let-alist", "treepy" ], - "commit": "636a46327384780dc2e4f5ab081bf6046a29af87", - "sha256": "0i2p12ff55wx8pkm44yhfgkggwrj67l113zla2l2sz1vdlzvjs24" + "commit": "0d7c81eee3ba0c6e029605e545173721c39947d7", + "sha256": "1mz4kkrs8b3n7gra3j5gy74awbwnk91nph33r2wql7a7zpz3qizc" }, "stable": { "version": [ @@ -46880,14 +46964,14 @@ "repo": "liuyinz/git-cliff.el", "unstable": { "version": [ - 20231016, - 915 + 20231020, + 1845 ], "deps": [ "transient" ], - "commit": "60db3f5a9350865ec78c652ef53a1335c6534239", - "sha256": "0jislk9rnnx0zbx5jik9w8hqrb3i3pd3rmhvk1i7rjfps0rxf7ps" + "commit": "d675d2ec3f6fb10a07fc3632bb7034a74f92cf8b", + "sha256": "0c07hv3ca8pch9cxqr97m4szksk6m21ipy0a0kimqnavivcgwii5" }, "stable": { "version": [ @@ -46943,16 +47027,16 @@ "repo": "magit/magit", "unstable": { "version": [ - 20231015, - 2008 + 20231027, + 2058 ], "deps": [ "compat", "transient", "with-editor" ], - "commit": "dd14e0c3c6604f97a447967f0c1ace9947a09e66", - "sha256": "1mfhqgk8ag6pwnim9xvw1jpqd3jndqckhf7zix2j3qjj1qhyjzqw" + "commit": "16ddcd7cc8eced7c242389a8ec51ce52f3b28425", + "sha256": "0c7zsya1v7hkbn316zkky4j9nzkrfavr9xspwrm40mv6z9vdan69" }, "stable": { "version": [ @@ -49385,11 +49469,20 @@ "repo": "M1ndo/gofmt-tag", "unstable": { "version": [ - 20231008, - 2315 + 20231024, + 2333 + ], + "commit": "93d746bda753f892c547d4c366d175c5b972fdd2", + "sha256": "1q0whcp1r3lrkim6dnllxdw59qlqz47rkgsmvwh9dq2jaqiid0pd" + }, + "stable": { + "version": [ + 1, + 0, + 1 ], - "commit": "45295db2106140cde6099b15847de79076468405", - "sha256": "0hdkrj9g8is58l2afb7v11mj911ns6mj3yal7rlganggbb6zkk0v" + "commit": "17db364ebf76548b37222b3a0e38c7cb4b5c95fb", + "sha256": "1rkr3bwwsv35bm65j468pf7dmdz0n8glz83wly8q3rpxliyrw4v7" } }, { @@ -49918,7 +50011,7 @@ "stable": { "version": [ 0, - 32, + 33, 0 ], "deps": [ @@ -49927,8 +50020,8 @@ "magit-popup", "s" ], - "commit": "a8d705a003ec4a4316a38af03bcca56e5e4eedd1", - "sha256": "04x73r6dnzagf67vixxd5c36rykj6s4kqh6lzsa13iwrvs01cwqs" + "commit": "f3c1fca929db8a8289c27533de1fdffaf72cfba3", + "sha256": "098f5rj6x6w6pdl2jz0yabrsq7gyhrncz676j5clik7sn97fp3v1" } }, { @@ -50082,14 +50175,14 @@ "repo": "karthink/gptel", "unstable": { "version": [ - 20231003, - 2147 + 20231024, + 2326 ], "deps": [ "transient" ], - "commit": "648fa228a1ccb3ba399a511db8d154fa9fa95b4b", - "sha256": "0g0ryxb2z72f7mwwannqan3w388rcxvkaq0sbnp8inmpdfbd7ki9" + "commit": "644fc1de2f1934f2db1e448de1edae065e848b77", + "sha256": "1jr65afr7nk3qmc7qjb4xslaz3438j46vl4wavx8is3n41621sd3" }, "stable": { "version": [ @@ -50803,11 +50896,11 @@ "repo": "rexim/gruber-darker-theme", "unstable": { "version": [ - 20221122, - 1143 + 20231026, + 2031 ], - "commit": "6de7a37d7b18cf3f0ec51db799f4f2aa6e3e89ff", - "sha256": "1bqjn67s0kcnf86qjxz0ayaash4rbwfwqsppqyy7p9qfc00cjix2" + "commit": "2e9f99c41fe8ef0557e9ea0f3b94ef50c68b5557", + "sha256": "07076fwxqi04ri8hmxjpf348lc4ms2lgjdzk8009sliixhh0mdzl" }, "stable": { "version": [ @@ -51421,11 +51514,11 @@ "repo": "idlip/haki", "unstable": { "version": [ - 20230918, - 1541 + 20231028, + 643 ], - "commit": "3726a2884fa02fdb83c8a4f43acd11d4b0883c1d", - "sha256": "0fpzfgbi3kybz649x2mzfbx6sqqz1y6672244q0xd4iz28zqln4p" + "commit": "6badf26c40463155d15d196ebb1ee8d69e6b384b", + "sha256": "0bgbb8s26ll1qmvfvkaj1cxynpxljkbr4wm4hfnvmkbby7c0356j" } }, { @@ -51888,11 +51981,11 @@ "repo": "haskell/haskell-mode", "unstable": { "version": [ - 20231010, - 819 + 20231026, + 1602 ], - "commit": "167421abf1db7dd4d297392b58b89bd72e2a9a63", - "sha256": "14196d4jbfwa44z0xhfdgzpga5v6n3c1b366cf7vn1c3qcxk1wmp" + "commit": "ef3fe51f7c207db3c55b9a3a720b3af665d2e606", + "sha256": "15d4wkpv35bbzskiwia0jzl9m5pvs5pl70qs6np6yz7hwq4c524r" }, "stable": { "version": [ @@ -52215,16 +52308,16 @@ "repo": "emacs-helm/helm", "unstable": { "version": [ - 20231017, - 449 + 20231027, + 1921 ], "deps": [ "helm-core", "popup", "wfnames" ], - "commit": "372167f13f496242263c7014a555e40db12627fb", - "sha256": "1gi1bx64lskmk0b9n2qmcva9005cjxv21fvqs4p4h8scb51l3bj2" + "commit": "4ea8631540ceed540c6242309c5778b3b976d12a", + "sha256": "0w2ynkm256sw25m8yzj5zgqjhhfa1zaqj7a47c81isjdqxfbv7v6" }, "stable": { "version": [ @@ -53108,14 +53201,14 @@ "repo": "emacs-helm/helm", "unstable": { "version": [ - 20231017, - 449 + 20231022, + 1046 ], "deps": [ "async" ], - "commit": "372167f13f496242263c7014a555e40db12627fb", - "sha256": "1gi1bx64lskmk0b9n2qmcva9005cjxv21fvqs4p4h8scb51l3bj2" + "commit": "a4380caef3a9e4b1e8d11458852ab67ba9b4cf58", + "sha256": "1q6v5zf5wfvg6krj8xfc4g33ja68r8abw5ymy3cmbyvnmxj9dwyb" }, "stable": { "version": [ @@ -54399,16 +54492,16 @@ "repo": "yyoncho/helm-icons", "unstable": { "version": [ - 20230506, - 432 + 20231027, + 616 ], "deps": [ "dash", "f", "treemacs" ], - "commit": "dfefdb41c63217a1d6f57d4c8761b68f3def1a31", - "sha256": "0xd81q5xv05kgh85ah66409nr79ivkib7ff5ygj7h05g1b59lnvk" + "commit": "0d113719ee72cb7b6bb7db29f7200d667bd86607", + "sha256": "1rnw3vkxrsx8xvvi43anvmljw22av072wyda9jlxflk8agbhpdw6" } }, { @@ -55127,14 +55220,14 @@ "repo": "emacs-helm/helm-org", "unstable": { "version": [ - 20210324, - 1927 + 20231022, + 620 ], "deps": [ "helm" ], - "commit": "d67186d3a64e610c03a5f3d583488f018fb032e4", - "sha256": "07wsz9hbv83m3k03cxvlr2hxd2lkxx9qpphn9j6axmysi9i5bc8q" + "commit": "c80e53315ce6b096e2d0e630702df924bf00bf6a", + "sha256": "1nlqlaxxs5zk2ara3k2986jjfsj1zbknwx40jliqq39dky0ksblh" }, "stable": { "version": [ @@ -55193,8 +55286,8 @@ "repo": "alphapapa/org-ql", "unstable": { "version": [ - 20230927, - 521 + 20231023, + 2352 ], "deps": [ "dash", @@ -55202,14 +55295,14 @@ "org-ql", "s" ], - "commit": "f9d4f6241546166f98b5b3b74db4f4532620235a", - "sha256": "1nxjhk0yd0njlscnxvsxnlf1wy6027spcaks64qgvnrzzq9vnzrj" + "commit": "28c4215704031e05190c17932b5e683bb462d9e5", + "sha256": "1jdkk837z8fw2dff5v8fh2dhx7rz348sf5jqpj2aja5ji48p0fs9" }, "stable": { "version": [ 0, 7, - 2 + 3 ], "deps": [ "dash", @@ -55217,8 +55310,8 @@ "org-ql", "s" ], - "commit": "f9d4f6241546166f98b5b3b74db4f4532620235a", - "sha256": "1nxjhk0yd0njlscnxvsxnlf1wy6027spcaks64qgvnrzzq9vnzrj" + "commit": "28c4215704031e05190c17932b5e683bb462d9e5", + "sha256": "1jdkk837z8fw2dff5v8fh2dhx7rz348sf5jqpj2aja5ji48p0fs9" } }, { @@ -55581,16 +55674,16 @@ "repo": "bbatsov/helm-projectile", "unstable": { "version": [ - 20221215, - 613 + 20231023, + 1425 ], "deps": [ "cl-lib", "helm", "projectile" ], - "commit": "35a2111d00c0c0c9d8743280d3f1243bb217118a", - "sha256": "0gd170h3v5i1886f7pvb5h5licy797djhjrigwfj2wa7i5q1avxv" + "commit": "e2e38825c975269a4971df25e79b2ae98929624e", + "sha256": "1q1699qqalgd3pkdhl4bijn9zv2l2bsazjgaiyi2yzmk9ksjwiiq" }, "stable": { "version": [ @@ -56959,8 +57052,8 @@ "repo": "Wilfred/helpful", "unstable": { "version": [ - 20231007, - 2141 + 20231028, + 516 ], "deps": [ "dash", @@ -56968,8 +57061,8 @@ "f", "s" ], - "commit": "737ff828d763e156a6072a532f2c3d2d0c26178e", - "sha256": "1d46rscvjhpdn1nlydgcsxhk670dabwckdk9jljyblnzh4mn5g5k" + "commit": "a32a5b3d959a7fccf09a71d97b3d7c888ac31c69", + "sha256": "1shv5v0rls38znv64g8h80541qyjqk39fpr7wkq5vis8xpfvvpp5" }, "stable": { "version": [ @@ -59116,8 +59209,8 @@ "repo": "ushin/hyperdrive.el", "unstable": { "version": [ - 20231021, - 15 + 20231027, + 1458 ], "deps": [ "compat", @@ -59126,8 +59219,8 @@ "plz", "transient" ], - "commit": "dbf3d5063f7a6c95ac27dff23eb4456ce9a270b5", - "sha256": "0c65f8kvz08997mx5jz03hw7ggyvs368fb98x9ziandq61vhhhwc" + "commit": "f37b757087a882d1736af3f06374bf81da940f06", + "sha256": "0l7gbqa8q5vkw2ydqgl5indf806shhi37pd2ihcr15g3az7indw3" }, "stable": { "version": [ @@ -62504,20 +62597,20 @@ "repo": "abo-abo/swiper", "unstable": { "version": [ - 20230714, - 751 + 20231025, + 2311 ], - "commit": "9d630d800e856a2c984c5a62a6f0ad313a9d2228", - "sha256": "0a2z9ca2m3f3wk4al60psdxnc3lyalh8h2vv6dr5l2xx5ahhb9ja" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" }, "stable": { "version": [ 0, 14, - 0 + 2 ], - "commit": "d28225e86f8dfb3825809ad287f759f95ee9e479", - "sha256": "16j5k96wllfjgcb1bn0rfm7x67yhr3kh5601b8rydlk768zjpq5v" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" } }, { @@ -62528,28 +62621,28 @@ "repo": "abo-abo/swiper", "unstable": { "version": [ - 20230410, - 1815 + 20231025, + 2311 ], "deps": [ "avy", "ivy" ], - "commit": "d28225e86f8dfb3825809ad287f759f95ee9e479", - "sha256": "16j5k96wllfjgcb1bn0rfm7x67yhr3kh5601b8rydlk768zjpq5v" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" }, "stable": { "version": [ 0, 14, - 0 + 2 ], "deps": [ "avy", "ivy" ], - "commit": "d28225e86f8dfb3825809ad287f759f95ee9e479", - "sha256": "16j5k96wllfjgcb1bn0rfm7x67yhr3kh5601b8rydlk768zjpq5v" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" } }, { @@ -62896,28 +62989,28 @@ "repo": "abo-abo/swiper", "unstable": { "version": [ - 20230410, - 1815 + 20231025, + 2311 ], "deps": [ "hydra", "ivy" ], - "commit": "d28225e86f8dfb3825809ad287f759f95ee9e479", - "sha256": "16j5k96wllfjgcb1bn0rfm7x67yhr3kh5601b8rydlk768zjpq5v" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" }, "stable": { "version": [ 0, 14, - 0 + 2 ], "deps": [ "hydra", "ivy" ], - "commit": "d28225e86f8dfb3825809ad287f759f95ee9e479", - "sha256": "16j5k96wllfjgcb1bn0rfm7x67yhr3kh5601b8rydlk768zjpq5v" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" } }, { @@ -64475,11 +64568,11 @@ "repo": "nverno/jq-ts-mode", "unstable": { "version": [ - 20231018, - 1047 + 20231025, + 2319 ], - "commit": "14a4df0ed089bc9d322b9846d1b87f603c241161", - "sha256": "19rvid30zc561v88d45q51q1xrgs28m6s0njiph0rkfw4ffkcg5l" + "commit": "b1abef71843dd99349133a75245804aee503c05d", + "sha256": "0xjmpk33rhqlw5f9qjhmyc057l8rbrrzhz460zsljx2wm11cvp6d" } }, { @@ -65280,14 +65373,14 @@ "repo": "tpapp/julia-repl", "unstable": { "version": [ - 20230529, - 943 + 20231026, + 1005 ], "deps": [ "s" ], - "commit": "9503ef7110732e444e686e815c5b2ae8228d274d", - "sha256": "0kw7228qfk1gamrjh8sddpslrb74a37zxadk22v4x16lm6f1cz27" + "commit": "4947319bc948b3f80d61b0d65a719737275949b8", + "sha256": "0vfpc4glkbl4ccz34i6fx9ny6zl9h69lw0sbv2rr526y7rr1cr7a" }, "stable": { "version": [ @@ -65328,8 +65421,8 @@ "repo": "gcv/julia-snail", "unstable": { "version": [ - 20231019, - 455 + 20231026, + 2200 ], "deps": [ "dash", @@ -65338,8 +65431,8 @@ "s", "spinner" ], - "commit": "249dd96cd112f4a2f9a15555aeed5a315cee8cb5", - "sha256": "1k34gn05rqlnmrvw8x0z0lq3zjdd10w8s7hkgy11yzfsks9r8fr3" + "commit": "97ca00411e16a2c1815090ca5aa05b3a36776a75", + "sha256": "168x8g2m30ci2msjfk09bbczpa33h4ax57b23hcwy5czk9511w70" }, "stable": { "version": [ @@ -66388,14 +66481,14 @@ "repo": "tarsius/keycast", "unstable": { "version": [ - 20230901, - 1234 + 20231027, + 2204 ], "deps": [ "compat" ], - "commit": "481a1620cac3118aff4b2db027acde7d3834b153", - "sha256": "1gry1mzz5mxbi40xlnrl3ks8778lx963k68zwff0iry4xcbsss42" + "commit": "0a1cd94dfe047e60912791439e03caed0fdcaa0b", + "sha256": "13m07ik30li3jm9sa5js61i6kvjdhvqdy1yzj94i4qrr7mm67zk5" }, "stable": { "version": [ @@ -67194,11 +67287,11 @@ "repo": "bricka/emacs-kotlin-ts-mode", "unstable": { "version": [ - 20231018, - 1342 + 20231026, + 958 ], - "commit": "6c2568693cd80b1cf57c7950d9458bca5af371ce", - "sha256": "1v51n5vb5gmx01vxqkwdwawcjp0g92316273v4qx3w3k7dr0k85h" + "commit": "0472c9346e30f8499c87938a323c733628a0dd26", + "sha256": "1gnlrbzj1z4028mm2c6bn7bf38vbs90z88i63f428hvjvimg0pw1" } }, { @@ -68070,6 +68163,7 @@ "stable": { "version": [ 1, + 0, 0 ], "commit": "d45dedbc74887c59f15c5a3dcd7546d2c29c30a4", @@ -68748,15 +68842,27 @@ "repo": "martianh/lem.el", "unstable": { "version": [ - 20231017, - 1432 + 20231022, + 1416 ], "deps": [ "fedi", "markdown-mode" ], - "commit": "44b9535698384851f93257fd132319fb62c13c9e", - "sha256": "1ww05yqdrkgxnv37q2wa0al4k25cz1nwyygvycbcbawisqk3pmbk" + "commit": "7f4184f51001c6df218d318b2f938cbb631541e9", + "sha256": "0ggm8y8a0gn5cj6m34fvkymfxc0agfr7cvr7wnysfzwdc0iwgwdz" + }, + "stable": { + "version": [ + 0, + 3 + ], + "deps": [ + "fedi", + "markdown-mode" + ], + "commit": "7f4184f51001c6df218d318b2f938cbb631541e9", + "sha256": "0ggm8y8a0gn5cj6m34fvkymfxc0agfr7cvr7wnysfzwdc0iwgwdz" } }, { @@ -69329,30 +69435,6 @@ } }, { - "ename": "ligo-mode", - "commit": "c8a86d223f5e764419aaf964d69a30350f74f904", - "sha256": "1289n7xbpx6ppil6rixck81xw3x0acrpcnxchml5yrwqrbr8czli", - "fetcher": "gitlab", - "repo": "ligolang/ligo", - "unstable": { - "version": [ - 20230927, - 1841 - ], - "commit": "a392154388b1abe974f424b71a66d618010f9e95", - "sha256": "0qd8ziv9j59s4q61bs1qdm5cvsd396pp3g2ymb1kxzpmbblaf0nc" - }, - "stable": { - "version": [ - 1, - 0, - 0 - ], - "commit": "a392154388b1abe974f424b71a66d618010f9e95", - "sha256": "0qd8ziv9j59s4q61bs1qdm5cvsd396pp3g2ymb1kxzpmbblaf0nc" - } - }, - { "ename": "line-reminder", "commit": "eb151125750b06c2cf6fcc5d762c980fdc89b0dc", "sha256": "1l7bf0lvncn645v7c3rr5gxd9jkz5jfyaps864mzwvmasbx6d3p4", @@ -69360,31 +69442,31 @@ "repo": "emacs-vs/line-reminder", "unstable": { "version": [ - 20230420, - 142 + 20231028, + 359 ], "deps": [ "fringe-helper", "ht", - "indicators", "ov" ], - "commit": "583bff387b361e1fe442f57e9ad1f6f8e87dedf4", - "sha256": "16shzyvvqwr83qdpwzwnyxabmgk4kz6jc4gk4yjs0mnakrgx6c0c" + "commit": "9e60c92b2495737d25407d79fb3a0e3d9909d5c9", + "sha256": "128icdyrfcj9p6yg98bpgmm72qi71hb51bv042549qwgdfbx7is6" }, "stable": { "version": [ 0, 5, - 1 + 2 ], "deps": [ "fringe-helper", "ht", - "indicators" + "indicators", + "ov" ], - "commit": "8bf9e6d70347a99528bab56f90e0210f9a88dad8", - "sha256": "0f78dnz0qmmq2g4xsm3a9kqg4864lghv1nbz0hj2c8mz2c58laqs" + "commit": "8b63b6ad6733363b24a8f5472f71eab301044b43", + "sha256": "1m8mshggyyv7wqjydjnx0jzyxxqpq4r1v0hwyrmcv9a7rngh7dzr" } }, { @@ -70904,16 +70986,16 @@ "repo": "okamsn/loopy", "unstable": { "version": [ - 20231015, - 1458 + 20231023, + 219 ], "deps": [ "compat", "map", "seq" ], - "commit": "0780e281e12742803f5aac8f2126156d4271d567", - "sha256": "1vv9gsswb03hmfxw7d517nx1qncax7mdgx1dfsqp9hcg3s3nwycs" + "commit": "3819e0f74dbde83822fb1d5d26444c3a5c63f408", + "sha256": "0w1gffzg2rjimwfwz6wrgskadjsd8cz7hnaqy6da022mskifzh1n" }, "stable": { "version": [ @@ -71007,14 +71089,14 @@ "repo": "abo-abo/lpy", "unstable": { "version": [ - 20221106, - 1310 + 20231026, + 1525 ], "deps": [ "lispy" ], - "commit": "fa95b11e1023704510cc7dd2897bf8bcc3027cbb", - "sha256": "18kx2mfmxy8s8csnp0iaiirl2z9baicq9f2w7rxlgkxww5511v7d" + "commit": "2c086ec162d4456b99a6095c3c335382a8304734", + "sha256": "0vrc7q7b872mm5shi6s7x5wx2d8znnmjd1adsjdxwnaqap4x98gd" } }, { @@ -71485,8 +71567,8 @@ "repo": "emacs-lsp/lsp-mode", "unstable": { "version": [ - 20231021, - 455 + 20231027, + 613 ], "deps": [ "dash", @@ -71497,8 +71579,8 @@ "markdown-mode", "spinner" ], - "commit": "2134ca09245815487f395a4c53000da1082e8823", - "sha256": "0721z42hfh768b0cr57i7cr212962hx5k1fjsy9b6z19rvhr4ddy" + "commit": "0f5723f9ae5d7fe2a82ad45e4505710b6a13be41", + "sha256": "0zxsvz73whc44xgsvcfikdbb5d5f762r7ys6zpik07n7ry98qq85" }, "stable": { "version": [ @@ -71913,11 +71995,11 @@ "repo": "immerrr/lua-mode", "unstable": { "version": [ - 20230810, - 931 + 20231023, + 947 ], - "commit": "7eb8eaa420c25477c830623b830fd18dc350cdfb", - "sha256": "12bv7rlhz8gncg142780ri4mhzrzd06xjrg8i0mwxb2rn8i0nidc" + "commit": "d074e4134b1beae9ed4c9b512af741ca0d852ba3", + "sha256": "1n1k55xy9zaknb9hfv7qlxi3ij1dvspldzzn6vc68c7yzskn88zv" }, "stable": { "version": [ @@ -72436,8 +72518,8 @@ "repo": "magit/magit", "unstable": { "version": [ - 20231014, - 1408 + 20231027, + 1202 ], "deps": [ "compat", @@ -72448,8 +72530,8 @@ "transient", "with-editor" ], - "commit": "c6a62accc5ed4bbdae4e1dc2060210ecfc4cdb8a", - "sha256": "1m1ip8ly0gjs3brmgkijb2vmyfrr489src9zgpn6whl1l10d7wa6" + "commit": "2ca552e3c4c0086f1097c2c7098888425ec6bdee", + "sha256": "0fpifvbnddx61y88ndr3sdx69knj50hvqd5bcapa8r1r3dic64dg" }, "stable": { "version": [ @@ -73079,8 +73161,8 @@ "repo": "alphapapa/magit-todos", "unstable": { "version": [ - 20230826, - 1832 + 20231027, + 1452 ], "deps": [ "async", @@ -73092,8 +73174,8 @@ "s", "transient" ], - "commit": "d85518d45d329cc0b465cc3b84910b7c66b3fc42", - "sha256": "1zjlf3bhz0a7r9sa5ic22vwr2w1zxbfk9z545pdd1fvp00c2kzd0" + "commit": "a197a04da1620ee7d41f3aa4f846a479760e2273", + "sha256": "16xdf60mw6lwklw2p2cv081c728d4qfrazrb36nq8pxxzz56bxas" }, "stable": { "version": [ @@ -73766,14 +73848,14 @@ "repo": "minad/marginalia", "unstable": { "version": [ - 20230925, - 1627 + 20231028, + 907 ], "deps": [ "compat" ], - "commit": "4e14bc0fa05ae8c35e019721d19acdec8b51248c", - "sha256": "0mv54hgb8cadwdhmn20d30fairhvvrvlvvp9awfi32dw91hma8gv" + "commit": "e4ff0838da33bf5102ee009ff28d541f0b51c9a3", + "sha256": "0q83ia4dh0jj17m8s66ps7nfzib8656w2ig6w2jnmv63qfzfyx3d" }, "stable": { "version": [ @@ -73893,11 +73975,11 @@ "repo": "jrblevin/markdown-mode", "unstable": { "version": [ - 20231021, - 738 + 20231028, + 853 ], - "commit": "2a0556c5b7dbf29ce437eac6ee9b6636e1b95234", - "sha256": "1mkwqprh09328hqk1f40i8l09ksmphz7nyn3fzhghalgr40b1ij8" + "commit": "b1a862f0165b7bafe0f874738a55be1b1720dd7d", + "sha256": "0r9z4vlan1255118kdand9mr9rkdr8kmvrxr9q8bclyz8dk6fr54" }, "stable": { "version": [ @@ -76418,20 +76500,20 @@ "repo": "DCsunset/modaled", "unstable": { "version": [ - 20231014, - 255 + 20231026, + 247 ], - "commit": "ace80c0bd5d37803fdd1cbcb3ddb8a5e3b0cce98", - "sha256": "0ksl9jz4620myzhr2bfnw30ljni3bxn1drcydqnbs3ii94ysjm3d" + "commit": "0a8471752f89d07b439680212dceda2e69b63457", + "sha256": "0sgxsknrq65hijrlvzd14j78vfd6wfah7qg57rcbjxw00hs9nxf3" }, "stable": { "version": [ 0, - 7, + 8, 0 ], - "commit": "ace80c0bd5d37803fdd1cbcb3ddb8a5e3b0cce98", - "sha256": "0ksl9jz4620myzhr2bfnw30ljni3bxn1drcydqnbs3ii94ysjm3d" + "commit": "0a8471752f89d07b439680212dceda2e69b63457", + "sha256": "0sgxsknrq65hijrlvzd14j78vfd6wfah7qg57rcbjxw00hs9nxf3" } }, { @@ -77986,20 +78068,20 @@ "repo": "mkcms/mu4e-overview", "unstable": { "version": [ - 20231021, - 46 + 20231027, + 1038 ], - "commit": "18b74e26616f7fe4d2db13d9def4b5a0fa44ddcd", - "sha256": "0ly0fcffdb73923hr1m5s1zfl9c7m9wh0khsn1zxj6bw7azjqk6i" + "commit": "0e711f47f9bab8bea9fe4f8e857920b879e70dcd", + "sha256": "0zh4pi4d74cs9p8ll7fzq8chxk84safvb7svxcss692jjsqvj89y" }, "stable": { "version": [ 0, - 2, + 3, 0 ], - "commit": "467a7dfda4e534783469a137545193ded8a66723", - "sha256": "08lwvgwfsxmvm5bnw0sl96dry57h4wcjsi2fr2mmfq190kdjrizy" + "commit": "0e711f47f9bab8bea9fe4f8e857920b879e70dcd", + "sha256": "0zh4pi4d74cs9p8ll7fzq8chxk84safvb7svxcss692jjsqvj89y" } }, { @@ -78107,8 +78189,8 @@ "repo": "mihaiolteanu/mugur", "unstable": { "version": [ - 20210719, - 722 + 20231024, + 755 ], "deps": [ "anaphora", @@ -78116,8 +78198,8 @@ "dash", "s" ], - "commit": "63a0377ac1ad48171621c9f0c719b62ec9395d35", - "sha256": "180i7igzqv5l22vk6n96g196mnd50lgwcmjkmzwlwdxn4jsgvjbv" + "commit": "9d55e6eac893abfc0a2622d6ac2a791ce5b23fbb", + "sha256": "1571bxz6jjdpxdcmv3aisd87pwrr46z0pljql45n9lsvs01liyr3" }, "stable": { "version": [ @@ -78640,10 +78722,10 @@ }, { "ename": "my-repo-pins", - "commit": "71668cffda630ca39d6f606ee61fc1dc47d70978", - "sha256": "10kapw38sq850599axqpmkvr4cn6pmqy2r1cw07ks6f423bxrlh9", + "commit": "761dcdc06682d1511e07142fbbb48749ef22a859", + "sha256": "0ppnxz6b0gyxp9462bkq70p4drs5qshxa3n059brx0bcd14g20z6", "fetcher": "github", - "repo": "NinjaTrappeur/my-repo-pins", + "repo": "picnoir/my-repo-pins", "unstable": { "version": [ 20230120, @@ -80654,14 +80736,14 @@ "repo": "emacscollective/no-littering", "unstable": { "version": [ - 20230801, - 1005 + 20231024, + 854 ], "deps": [ "compat" ], - "commit": "fcfd51fbdf08469e6d1b59bc4bd2d75aa708c791", - "sha256": "190lhzqdn4681frk0ih519c3riwxc6mz16q3bisl3l7brsp1rgwj" + "commit": "1fb3271e991fb941e8cc480beff74000e3a08a3a", + "sha256": "0ahlri3hlkrlmm6bh094ays6qrw9yd02rghq0hgin006817r8pqz" }, "stable": { "version": [ @@ -81109,10 +81191,11 @@ "stable": { "version": [ 0, - 38 + 38, + 1 ], - "commit": "60b5ea319a45900b1e610715481faaa339ea3a4c", - "sha256": "1x0h5z2476qsfi1qfywlfdn68gydlyqfmvpjr92yw3pmp28ilrl3" + "commit": "356ad392716d2a775e58d766c1fec9047cc84163", + "sha256": "01h8handfqhps79gyx579b70sfigyxdlk3qgqv413ahvinw5h47b" } }, { @@ -82928,14 +83011,14 @@ "repo": "alf/ob-restclient.el", "unstable": { "version": [ - 20231021, - 1002 + 20231027, + 518 ], "deps": [ "restclient" ], - "commit": "3fb2c99c37c9972ecda143c826725819357e0de9", - "sha256": "15dcl1js20d9csmsj7xn4y0nzr6b0q1p1vfa5kl103i4l2v6cj62" + "commit": "1a127eb0165f10bb9d33606aa8529051118805e7", + "sha256": "0fk0ly8hyhlq4vyndkmv22cx0p7cknf56j6djika1c9d4hl75ff2" } }, { @@ -84518,11 +84601,11 @@ "repo": "oantolin/orderless", "unstable": { "version": [ - 20230920, - 553 + 20231025, + 2044 ], - "commit": "d6b402a89e234d0e6166247ed6025f9acc8b4d9a", - "sha256": "00233wp3dlzxbnxbxq1ph9j93d25mnqn6iagr7rfp83b7d9s9gbb" + "commit": "89eb3775daa53cfb52ad03015410c23f28c72d30", + "sha256": "0gpnfxh8kps0szd5lmpy4zvqxgzmazspgg5wfdd0c1ywszz5lczh" }, "stable": { "version": [ @@ -85219,14 +85302,14 @@ "repo": "drghirlanda/org-change", "unstable": { "version": [ - 20230505, - 150 + 20231026, + 2216 ], "deps": [ "org" ], - "commit": "45898a67701ade93f310db8e5820b8bfc4a28846", - "sha256": "10ryk3p8nz8pqck310m1zrkam9p6wb3lf46wcgwhqsri9aa780vj" + "commit": "c74662112e8a857bd87c54128baba9307a393974", + "sha256": "0mpsghnzgyhxzjdsnj57sizv0dny75hm0kj61q13ckrc26bjlhg7" } }, { @@ -86411,14 +86494,14 @@ "repo": "bastibe/org-journal", "unstable": { "version": [ - 20231013, - 1147 + 20231022, + 829 ], "deps": [ "org" ], - "commit": "ac0832f02a1259c10d3691b35496a01b54f0a3b9", - "sha256": "02ax78319p8iy8qqxrlcc32a3mkmawybb1qv37m34g1f49wlx0d7" + "commit": "a306f76ee2b0292946a20530bd9114aefc85a263", + "sha256": "0bym8v8hwwhshk65hpfg7dnyzyym0g0hz6h692jpiqrp0mcvnilc" }, "stable": { "version": [ @@ -86684,16 +86767,16 @@ "repo": "alphapapa/org-make-toc", "unstable": { "version": [ - 20230904, - 911 + 20231025, + 2326 ], "deps": [ "dash", "org", "s" ], - "commit": "e6da481729a103a081b1b6bbca7202a21cb7321a", - "sha256": "009sim07f0dyxdpcr5fqbqla5s5i1sc8z008h85v957wbhw6dmhi" + "commit": "df29826107ad12fd1d5f173a9a8e070b84f21a68", + "sha256": "1bsn8z7nc2qngjdkd7sq14f53i8pgjchka1s3l6cqxbjv9gvm0q5" }, "stable": { "version": [ @@ -87537,8 +87620,8 @@ "repo": "alphapapa/org-ql", "unstable": { "version": [ - 20231020, - 244 + 20231025, + 830 ], "deps": [ "dash", @@ -87552,14 +87635,14 @@ "transient", "ts" ], - "commit": "ac2d43588aa96f0b7fe88f518d6fca4fd65b5aa0", - "sha256": "098x2vv7w7s4i9kic7q8jcnixm517247i31a2ng06jkad7q7gx5d" + "commit": "bd2dd12a417df5403954576756d9c24273d94379", + "sha256": "1rmf5jg1jgfhyaarfmrmha7vhzc3v45zqccn44sihrhxpp1b8www" }, "stable": { "version": [ 0, 7, - 2 + 3 ], "deps": [ "dash", @@ -87573,8 +87656,8 @@ "transient", "ts" ], - "commit": "f9d4f6241546166f98b5b3b74db4f4532620235a", - "sha256": "1nxjhk0yd0njlscnxvsxnlf1wy6027spcaks64qgvnrzzq9vnzrj" + "commit": "28c4215704031e05190c17932b5e683bb462d9e5", + "sha256": "1jdkk837z8fw2dff5v8fh2dhx7rz348sf5jqpj2aja5ji48p0fs9" } }, { @@ -87847,8 +87930,8 @@ "repo": "jkitchin/org-ref", "unstable": { "version": [ - 20231021, - 1453 + 20231027, + 1224 ], "deps": [ "avy", @@ -87863,8 +87946,8 @@ "parsebib", "s" ], - "commit": "b2eaf51c0082fab335475ef3e9761ec5a3858f79", - "sha256": "0w359ijj3qzp180wnialrjmgxfrygp9i3jjyhwyil6ka5gnbyycj" + "commit": "1773de623017e177e79b17ed6a5ee6f7162fd9e5", + "sha256": "0c2p68nhxf8abpnp28zskpqnnp13x5vb47pdzymad4zjc4zrdf3y" }, "stable": { "version": [ @@ -91648,26 +91731,26 @@ "repo": "ox-tufte/ox-tufte", "unstable": { "version": [ - 20230910, - 2353 + 20231022, + 2117 ], "deps": [ "org" ], - "commit": "88e0cd130c7db748855e7f083d7f623692ef8239", - "sha256": "18b5ch69db4kavz18pg2kyf8fy0yi28176bal5drxwdffsyw7p4f" + "commit": "58422fb109f2b2a997f9c773b5436e7b62182e12", + "sha256": "14i1pliifj5p0i1bgsdgph32ilj7snrh8gnhk59f1f4ngh3kw3zg" }, "stable": { "version": [ 3, 0, - 2 + 3 ], "deps": [ "org" ], - "commit": "88e0cd130c7db748855e7f083d7f623692ef8239", - "sha256": "18b5ch69db4kavz18pg2kyf8fy0yi28176bal5drxwdffsyw7p4f" + "commit": "58422fb109f2b2a997f9c773b5436e7b62182e12", + "sha256": "14i1pliifj5p0i1bgsdgph32ilj7snrh8gnhk59f1f4ngh3kw3zg" } }, { @@ -93327,10 +93410,10 @@ }, { "ename": "pcap-mode", - "commit": "44f4cb526556a4b58b7e67314002e73413a59a76", - "sha256": "1p6lnr7yr8i3yp63xc8r1hnx8a4v0mz1s7q89zxx7aprk7i9kpv6", + "commit": "ee84077d859aa8f941bc2749c2fc02ada6e608cd", + "sha256": "1k1vbvx3g9g5bn6vfijaffacn7lf2gl67b7f3kh3fq12jxp1swvp", "fetcher": "github", - "repo": "orgcandman/pcap-mode", + "repo": "apconole/pcap-mode", "unstable": { "version": [ 20161025, @@ -97667,11 +97750,11 @@ "repo": "nverno/prisma-ts-mode", "unstable": { "version": [ - 20231007, - 904 + 20231022, + 1802 ], - "commit": "b597a437a96c0f03cf2bc038794d6a98ba1bd48b", - "sha256": "1m4lv4isfd0szyy6dj75kpid6qs6zvj2jx80glndm0qqyznrkl94" + "commit": "a7029980140ae60612ef876efa17ab81bf4b3add", + "sha256": "0isym89c4432qrdzpbmg85pw97jw6lvbz9sdv1xy08c448dydg79" } }, { @@ -98932,15 +99015,15 @@ "repo": "thierryvolpiatto/psession", "unstable": { "version": [ - 20231001, - 432 + 20231023, + 1749 ], "deps": [ "async", "cl-lib" ], - "commit": "fc60f1253aeb9c38a08dc74f9c7dbfe0d535a19b", - "sha256": "15x1h104krici21ipsn6jr1y3yhyif5mkw38s3bwd5xhmsa3lazz" + "commit": "1f74eecb5375fa94eb8d809f8e27caa48ed2323d", + "sha256": "1aa5g9082s8dvd0hd1n4yjlcnpd64l1przmmvjr4vgyaix42rg9z" }, "stable": { "version": [ @@ -99444,11 +99527,11 @@ "repo": "ideasman42/emacs-py-autopep8", "unstable": { "version": [ - 20230115, - 633 + 20231025, + 2256 ], - "commit": "d0486c22c0a92ad7911714026021fe4ad276b7c9", - "sha256": "1xa25sfdmc6srys0ymhdj07kss4ixnw3sqq5grjix7acifdmrbj9" + "commit": "3e3f6c182455bf85284cda7f4ffe639444b84940", + "sha256": "05xqdja61p3c3sx836z3c1jjbm0ih2mrw13qnkp2hhh3ahyz2qql" }, "stable": { "version": [ @@ -102958,8 +103041,8 @@ "repo": "alhassy/repl-driven-development", "unstable": { "version": [ - 20231020, - 1039 + 20231023, + 1120 ], "deps": [ "bind-key", @@ -102974,8 +103057,8 @@ "pulsar", "s" ], - "commit": "106712f43d4cb8d891837a670dabad08a7629528", - "sha256": "0xad9xksjgiw02rw1174adgaqjpvyqx0hp61qd4r44y40rzns5kp" + "commit": "8877f692112459095649735ac4d023248b3905ae", + "sha256": "19zj743ayv322cz13kilkkl4djpzs9q22z6qhk0ipasy1kdijh57" } }, { @@ -103878,8 +103961,8 @@ "repo": "DogLooksGood/emacs-rime", "unstable": { "version": [ - 20230212, - 1425 + 20231025, + 1220 ], "deps": [ "cl-lib", @@ -103887,8 +103970,8 @@ "popup", "posframe" ], - "commit": "6438abacace7d94f05fabc45b82d619677fc5fca", - "sha256": "0fyv92lfz7c98l79valrh9wr78b4303bhnqjgycbz33p9m2hply0" + "commit": "0de3250fd1005878dd7a06a8fef7324a878f17b3", + "sha256": "0yfv3pw82953l77lz1jj5pscjra1ha157pzlhhykmn3sfvn0s45r" }, "stable": { "version": [ @@ -104093,11 +104176,11 @@ "repo": "jgkamat/rmsbolt", "unstable": { "version": [ - 20231011, - 525 + 20231024, + 221 ], - "commit": "f693bb31605d6e8a0b98f74d35e2a728e33f0af7", - "sha256": "1pvmcxdv9lw6gzgx5wgpbvws6z9lwxh8vrf4vykqdym5g9wdk3hb" + "commit": "86c6e12a85db472e6660ef7fef12a4e719ef3c66", + "sha256": "1kvl8syz700vl2dbva4k1vdzxd67sjby4w4zsl62njvbvwzvcj0r" } }, { @@ -104108,14 +104191,14 @@ "repo": "dgutov/robe", "unstable": { "version": [ - 20231021, - 48 + 20231023, + 2046 ], "deps": [ "inf-ruby" ], - "commit": "0095a48075f366e195d4861c3a91467bcf423c73", - "sha256": "1qa3w3g5ayrxh20l0948sr7yhz480qc8q1r34iv50jv8i6flsb5w" + "commit": "021a7bc34848ef77eaeaa41d7899c6cab873cb0e", + "sha256": "0s0cmj1vmfa9gwn388ll3fpsv25q3v6vvj6k4xlcn75kdfzsbx59" }, "stable": { "version": [ @@ -105846,11 +105929,11 @@ "repo": "meain/scopeline.el", "unstable": { "version": [ - 20230622, - 829 + 20231027, + 1524 ], - "commit": "254d300aee0a22349b07fbe542fbec81547bae75", - "sha256": "1q4x5fmx95isiq47nk7r3q0n3q9dvbl855yph0p6wy7rr999v3jb" + "commit": "58d6ef20b6cf398c48571239311d812a2f926ecb", + "sha256": "0p10mpn9bbd6cccafw0h296xhavq8x46mn3292iks10v553b0li6" } }, { @@ -107688,11 +107771,11 @@ "repo": "emacs-w3m/emacs-w3m", "unstable": { "version": [ - 20231020, - 743 + 20231026, + 455 ], - "commit": "622038d8e24c542f29bccde2db84a6a6d6af19a2", - "sha256": "0yi9dmayyr8di6kczbya37zym32cxwzcwkkac2fw5jwsm63kyzan" + "commit": "e3b87d61dfef3a9d44872c50db360732ba949d57", + "sha256": "06rqxib501xn2xlc4pqdh06zw0wrkg70sxr2fqv7i2fpl9qxwriv" } }, { @@ -108729,14 +108812,14 @@ "repo": "laishulu/emacs-smart-input-source", "unstable": { "version": [ - 20230305, - 1006 + 20231024, + 1738 ], "deps": [ "terminal-focus-reporting" ], - "commit": "e4142baa470e5f33dd508bce0264359dc5204b6f", - "sha256": "1yhlc8wpnay8fj9m5n9sy1mzdqs2sq7bkdabbc2cv5pczj88ndbv" + "commit": "80b2e7c3be365c7685cc4070294359341799cd47", + "sha256": "1qa0dzy8qjdyd1m0bxwx269lrvqxz7hmyl95c55rr9pj928a3v12" } }, { @@ -109852,15 +109935,15 @@ "repo": "Fuco1/smartparens", "unstable": { "version": [ - 20231021, - 1239 + 20231024, + 1804 ], "deps": [ "cl-lib", "dash" ], - "commit": "e3e563b20e405d87e3f1b3792174803bb8de2b7b", - "sha256": "1vkxskgh1qbr4l2k6ghvpyws3192gay0shsj5vds6432q7ckyr5v" + "commit": "0778a8a84064cf2bc3a9857bd0e7a4619cc1e5c3", + "sha256": "1svi5zfrg2ygsjb247y02c9i0cqmc5lqa7sq999niriblj5plr60" }, "stable": { "version": [ @@ -110422,15 +110505,15 @@ "repo": "SpringHan/sniem", "unstable": { "version": [ - 20231020, - 614 + 20231028, + 558 ], "deps": [ "dash", "s" ], - "commit": "cf1e6ae475c053ec18c3722b4591b863a788adce", - "sha256": "043p574fqfjbh1yqgxnihrjf2mmqra4s4wabb64y6acc9jpbpavw" + "commit": "dd092660aa7204060223377ba07e5d6c8b766d41", + "sha256": "0ssbwygc5c9jmd4vmj4y2pn9fpk2zd0m7qpkq2c6wnsl7z9g07rg" } }, { @@ -112459,8 +112542,8 @@ "repo": "daanturo/starhugger.el", "unstable": { "version": [ - 20230901, - 1922 + 20231023, + 1523 ], "deps": [ "compat", @@ -112468,14 +112551,14 @@ "s", "spinner" ], - "commit": "32c362a31fab1deedd37d787812e399fbee0d870", - "sha256": "1a08a7nxldxyprpq3ywydfvhaglcap7a1rh0x057zy8qaka86x05" + "commit": "8e1bc1167a64cc421ce3d1368a9c0e5da89bf687", + "sha256": "0wpxicq7yh99qx6vwvjgbwwghx1bqyx972zymzhq3m89wnliqlx3" }, "stable": { "version": [ 0, 4, - 0 + 1 ], "deps": [ "compat", @@ -112483,8 +112566,8 @@ "s", "spinner" ], - "commit": "aa8ac995e48b2e810ca11ddd04f68178a819fb5a", - "sha256": "1lw7djgz10n7mg5k32jfvrkabdmhddf2bfvdjp9wgfw65mpy1xly" + "commit": "8e1bc1167a64cc421ce3d1368a9c0e5da89bf687", + "sha256": "0wpxicq7yh99qx6vwvjgbwwghx1bqyx972zymzhq3m89wnliqlx3" } }, { @@ -113904,26 +113987,26 @@ "repo": "abo-abo/swiper", "unstable": { "version": [ - 20230410, - 1815 + 20231025, + 2311 ], "deps": [ "ivy" ], - "commit": "d28225e86f8dfb3825809ad287f759f95ee9e479", - "sha256": "16j5k96wllfjgcb1bn0rfm7x67yhr3kh5601b8rydlk768zjpq5v" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" }, "stable": { "version": [ 0, 14, - 0 + 2 ], "deps": [ "ivy" ], - "commit": "d28225e86f8dfb3825809ad287f759f95ee9e479", - "sha256": "16j5k96wllfjgcb1bn0rfm7x67yhr3kh5601b8rydlk768zjpq5v" + "commit": "8c30f4cab5948aa8d942a3b2bbf5fb6a94d9441d", + "sha256": "1iqj27pc2iivmwfh329v0d9g0z1y0whlnamrl7g2bi374h41m368" } }, { @@ -114892,14 +114975,14 @@ "repo": "mclear-tools/tabspaces", "unstable": { "version": [ - 20231018, - 1932 + 20231026, + 1454 ], "deps": [ "project" ], - "commit": "a971a63ae4bca93f2faa963d6a71eed413f0e37b", - "sha256": "00r7v97ndvs7szcv7yfym3qzi859kryjj2sr2yfkrzygp336v88l" + "commit": "3ff927ffc427d2debca56bc6ec2cbad37d85dd61", + "sha256": "1a11bbsckfn341xd0yw1jaalqn7w178fwxc2l8ag766bk878fmwr" } }, { @@ -116098,15 +116181,15 @@ "repo": "johannes-mueller/test-cockpit.el", "unstable": { "version": [ - 20231021, - 2149 + 20231027, + 1842 ], "deps": [ "projectile", "toml" ], - "commit": "98a15ab65d45e2053c587b2f2fde37d16fd45a21", - "sha256": "16296dhqbprsbvq7ld2c806qw6ivj7p14y5djpxj0li7m8wr7v5s" + "commit": "911e42d1b71e844b9821a4561154734adaa0f1e0", + "sha256": "1y1qdsm0rdjmxa4pgf1fhkim3ahkn70601l8d8snq5gdcfkx30s1" } }, { @@ -116527,6 +116610,30 @@ } }, { + "ename": "third-time", + "commit": "f73607e0ca3d2533a5c46daae76d1b4c49d2134e", + "sha256": "0fsfyfcmhr9m9nmc82lxbxiji3d80m9q4b6bp6nkyhavwqqznbm3", + "fetcher": "sourcehut", + "repo": "swflint/third-time", + "unstable": { + "version": [ + 20231023, + 316 + ], + "commit": "05bed0c25ce5def3db6b885ffcee74a705dc0dfb", + "sha256": "1jcbkbc31cshayvgq835sv89jhsbd9w0820872wccs09jkkzfrzf" + }, + "stable": { + "version": [ + 1, + 3, + 0 + ], + "commit": "d1e0e146c298de0114035b19c9c4f990db7f1ae5", + "sha256": "0l0d35rwrm2l8smywdy20fy7vvw50pxs08w0mfjqzsfxh5piy1wh" + } + }, + { "ename": "thread-dump", "commit": "091dcc3775ec2137cb61d66df4e72aca4900897a", "sha256": "0dzr86jyf2j49gq40q6qd6lppa57n65n94xzpdjjbs182hxzavp2", @@ -116567,21 +116674,21 @@ "repo": "facebook/fbthrift", "unstable": { "version": [ - 20231014, - 28 + 20231021, + 1233 ], - "commit": "aed0ba17906360dd1ec566a6184ef02f96c919cd", - "sha256": "1ckp7alxng8r505zggqp82v3w4mlfpgixsl1v36gzgqlcb6hqzs9" + "commit": "72cc23eeb9d696a22c6054d4de0a75a9c18fe46b", + "sha256": "05a64c2wmvky5m1vb9072scix2a6q7na448hf96aj40q3qbkh0ga" }, "stable": { "version": [ 2023, 10, - 16, + 23, 0 ], - "commit": "aed0ba17906360dd1ec566a6184ef02f96c919cd", - "sha256": "1ckp7alxng8r505zggqp82v3w4mlfpgixsl1v36gzgqlcb6hqzs9" + "commit": "72cc23eeb9d696a22c6054d4de0a75a9c18fe46b", + "sha256": "05a64c2wmvky5m1vb9072scix2a6q7na448hf96aj40q3qbkh0ga" } }, { @@ -116957,11 +117064,11 @@ "repo": "aimebertrand/timu-caribbean-theme", "unstable": { "version": [ - 20230911, - 2112 + 20231022, + 1816 ], - "commit": "ab1c4d0df4f4a8fcb4eaa78dbf9d6f6f3e834462", - "sha256": "0kyqnsdgj4wdfc3qnkjnncs6jnbjza398krbmcsqlvqg1c23ilgd" + "commit": "5fc2cad6c91748afa98d1df2b65b3b5329d21b03", + "sha256": "0hsn3q36pdgg4w2nxmszsr7d3n0wkc291i1v04nakknhw8fx6b0m" }, "stable": { "version": [ @@ -117009,11 +117116,11 @@ "repo": "aimebertrand/timu-macos-theme", "unstable": { "version": [ - 20230911, - 2059 + 20231022, + 1832 ], - "commit": "bbd88a1460f184cc8701a361e0eeea34f71accaa", - "sha256": "0s25b24mbrbkfvybjzx4015z2sw159va8hyd530f7q5wny532yd9" + "commit": "f1ecdf8415e4cb3d35019af5b2ad0d6bea96e610", + "sha256": "0w1xh0i8q2d84f9d5gw61nn7a8xqyllm427qnnjsa5wjlhgvilfl" }, "stable": { "version": [ @@ -117055,11 +117162,11 @@ "repo": "aimebertrand/timu-spacegrey-theme", "unstable": { "version": [ - 20231002, - 1522 + 20231010, + 2137 ], - "commit": "145ee85b9d65bbef32687681d65f72e227e52225", - "sha256": "1li13z0202qrjzipw9azy9yp028rrzyjkb9538cnf297caqdmqcl" + "commit": "fbe0aacc0d1010631ba8b2848b78e26514ce60c6", + "sha256": "0h8kkzgfz5hkynlynml0pgkq9j6fzzq33hl9ww8mq1gzzq6n62db" }, "stable": { "version": [ @@ -117236,6 +117343,21 @@ } }, { + "ename": "tmux-mode", + "commit": "382cb915901971ff5e9b32156cbeb5639c3bf20f", + "sha256": "0k6hdhyc5w2axmik49dp5hfk1c5hprdyam02v4cm4nhdwbv1ma01", + "fetcher": "github", + "repo": "nverno/tmux-mode", + "unstable": { + "version": [ + 20231026, + 2118 + ], + "commit": "632fc7981ceaea19ab2af0e47acae926354ab453", + "sha256": "1j4gr3wmh6wrr6lj9bjx7gg34qqywb54309vq28x6y4k9ng966zb" + } + }, + { "ename": "tmux-pane", "commit": "8bc165e115a2c457e44ac2762cf6a9f07f1b99c4", "sha256": "0mv5y367i1wmk5kp8ms09xhrwvb4cwa08p39qy6mkakdhiby5m9q", @@ -117928,14 +118050,15 @@ "repo": "magit/transient", "unstable": { "version": [ - 20231019, - 1421 + 20231027, + 2121 ], "deps": [ - "compat" + "compat", + "seq" ], - "commit": "a81eff942bb2cd5bb5b6450dcf7db78c876abd1f", - "sha256": "05y7qppq0ldmsmy61vc9zfnqgsijjsjv9q3gi2dsx37rm3jy9r7g" + "commit": "a8829875b25c0dc8cbd7163b6617c436365897b5", + "sha256": "0adk7fmz2ina9wkq8qbjc5jd677khy4f0mbzj4qfa7wsrwnxh69s" }, "stable": { "version": [ @@ -118498,8 +118621,8 @@ "repo": "Alexander-Miller/treemacs", "unstable": { "version": [ - 20231016, - 2107 + 20231024, + 1919 ], "deps": [ "ace-window", @@ -118511,8 +118634,8 @@ "pfuture", "s" ], - "commit": "474febd6c3f2d5059ed26c13277b9a3a8a5a8a82", - "sha256": "0kzaf06aszv1gcmaszv31kxj1sz20x0ilkzgpi3sxqavcb03mad9" + "commit": "95c07470b281a1eaa3ce88290748bcb2045a163a", + "sha256": "01d3kw4hl0vkqfw08nb9ldbhsd6s7shrmaxgjiahwxfkr63gvdjn" }, "stable": { "version": [ @@ -119092,11 +119215,14 @@ "repo": "ehawkvu/tsort.el", "unstable": { "version": [ - 20231015, - 2136 + 20231027, + 334 ], - "commit": "844a983841798a5e9de4a442674d691fea6d09ff", - "sha256": "06kz39dflgzpx4afb3qwgx2gyahahhwqsdabxip99wfllhsqwa32" + "deps": [ + "compat" + ], + "commit": "3f9cffdbd4ac83a6a69dd4ccbb135e95950494ad", + "sha256": "0zssgrkzsn3q2g8ayhs31c408yhsggmyrzfscklvvdhmgg5qcabj" } }, { @@ -120457,26 +120583,26 @@ "repo": "swflint/emacs-universal-sidecar", "unstable": { "version": [ - 20230923, - 31 + 20231023, + 219 ], "deps": [ "magit-section" ], - "commit": "0cec1fa196df55cfb13c1e2ee226b55ff740e7f2", - "sha256": "04fvzla00lbbz94ihi9vn5cwxpj4ivfcxifjr19h8nycm7h2xs8n" + "commit": "85dd85d1f5167d9aca17e4a537dd699ea52d3864", + "sha256": "039g112wj3aj5fldlxs6wbni8gfxb1qp0qai8ix305afjkkz9022" }, "stable": { "version": [ 1, 4, - 0 + 1 ], "deps": [ "magit-section" ], - "commit": "0cec1fa196df55cfb13c1e2ee226b55ff740e7f2", - "sha256": "04fvzla00lbbz94ihi9vn5cwxpj4ivfcxifjr19h8nycm7h2xs8n" + "commit": "85dd85d1f5167d9aca17e4a537dd699ea52d3864", + "sha256": "039g112wj3aj5fldlxs6wbni8gfxb1qp0qai8ix305afjkkz9022" } }, { @@ -120487,30 +120613,30 @@ "repo": "swflint/emacs-universal-sidecar", "unstable": { "version": [ - 20231002, - 22 + 20231023, + 219 ], "deps": [ "bibtex-completion", "elfeed", "universal-sidecar" ], - "commit": "8e9b4ce2faf304aedc485e7bedb6f0e460d9ea09", - "sha256": "1f2km4v4pvjmlr4fp5q51x0ycq0na8b6yd3las50slrf01wd3f48" + "commit": "85dd85d1f5167d9aca17e4a537dd699ea52d3864", + "sha256": "039g112wj3aj5fldlxs6wbni8gfxb1qp0qai8ix305afjkkz9022" }, "stable": { "version": [ 1, 4, - 0 + 1 ], "deps": [ "bibtex-completion", "elfeed", "universal-sidecar" ], - "commit": "0cec1fa196df55cfb13c1e2ee226b55ff740e7f2", - "sha256": "04fvzla00lbbz94ihi9vn5cwxpj4ivfcxifjr19h8nycm7h2xs8n" + "commit": "85dd85d1f5167d9aca17e4a537dd699ea52d3864", + "sha256": "039g112wj3aj5fldlxs6wbni8gfxb1qp0qai8ix305afjkkz9022" } }, { @@ -120521,31 +120647,30 @@ "repo": "swflint/emacs-universal-sidecar", "unstable": { "version": [ - 20230925, - 9 + 20231023, + 219 ], "deps": [ "elfeed", "elfeed-score", "universal-sidecar" ], - "commit": "dfcd0cd9d8f1e7fc3d8d4d1ed1da32d657acb088", - "sha256": "1mjkdzczkzpplfa23kwyk8iy57khzpxbclfbgyijf9i8i1cpnc53" + "commit": "85dd85d1f5167d9aca17e4a537dd699ea52d3864", + "sha256": "039g112wj3aj5fldlxs6wbni8gfxb1qp0qai8ix305afjkkz9022" }, "stable": { "version": [ 1, 4, - 0 + 1 ], "deps": [ - "bibtex-completion", "elfeed", "elfeed-score", "universal-sidecar" ], - "commit": "0cec1fa196df55cfb13c1e2ee226b55ff740e7f2", - "sha256": "04fvzla00lbbz94ihi9vn5cwxpj4ivfcxifjr19h8nycm7h2xs8n" + "commit": "85dd85d1f5167d9aca17e4a537dd699ea52d3864", + "sha256": "039g112wj3aj5fldlxs6wbni8gfxb1qp0qai8ix305afjkkz9022" } }, { @@ -120556,28 +120681,28 @@ "repo": "swflint/emacs-universal-sidecar", "unstable": { "version": [ - 20231008, - 1742 + 20231023, + 219 ], "deps": [ "org-roam", "universal-sidecar" ], - "commit": "d8311910fae3ea65fb4153e3872ec24b64d5d8aa", - "sha256": "0ckm8a0ihj4ds3w6ls8yzq5z6qy24ck3gdyd3ii3zz5rh01galf8" + "commit": "85dd85d1f5167d9aca17e4a537dd699ea52d3864", + "sha256": "039g112wj3aj5fldlxs6wbni8gfxb1qp0qai8ix305afjkkz9022" }, "stable": { "version": [ 1, 4, - 0 + 1 ], "deps": [ "org-roam", "universal-sidecar" ], - "commit": "0cec1fa196df55cfb13c1e2ee226b55ff740e7f2", - "sha256": "04fvzla00lbbz94ihi9vn5cwxpj4ivfcxifjr19h8nycm7h2xs8n" + "commit": "85dd85d1f5167d9aca17e4a537dd699ea52d3864", + "sha256": "039g112wj3aj5fldlxs6wbni8gfxb1qp0qai8ix305afjkkz9022" } }, { @@ -122433,11 +122558,11 @@ "repo": "nverno/vimscript-ts-mode", "unstable": { "version": [ - 20231020, - 1008 + 20231022, + 1758 ], - "commit": "84c061f4f80f0768fbe2a8e4b7fb337da83bd150", - "sha256": "1w648mk17ysvcx70nawdp83df15q52qwq9nk5hyamn00ldw6wl0s" + "commit": "20aea980ef94d643100638f2528aafc4b136e20c", + "sha256": "141mhzqv0fchcp6r6r3w8nismxa6a455d4z0ap6hcla2mxvszrwh" } }, { @@ -122788,11 +122913,11 @@ "repo": "emacs-vs/vs-dark-theme", "unstable": { "version": [ - 20231020, - 542 + 20231028, + 356 ], - "commit": "2ec99feff875e0e8a850cb423c798da0315f1bd1", - "sha256": "0a03xg4dg07wxmdxsq2173zn27zs63h5gvfqx9f4cysxxkzc4277" + "commit": "1f6f0afecc4576cc1cee573f82efe465042507f3", + "sha256": "0yv1gs6prj4qkwav6yjfxrck8y29pbsnidfhnap2vx2rfb94q1k8" }, "stable": { "version": [ @@ -122811,11 +122936,11 @@ "repo": "emacs-vs/vs-light-theme", "unstable": { "version": [ - 20231020, - 542 + 20231028, + 356 ], - "commit": "6d64f04575d9629ecf240f73fd8e051cae7f0127", - "sha256": "1knkajh1zlhvc1q3ljcjp5ib1p6dx9f7crvvdx75yi2gii6q09ah" + "commit": "174e1dffc26998d8bc074f1f78068a8e612d4be3", + "sha256": "01h55rw65wk630l868lm3s1zkggksmvf1c0ywhnz0l4a570f859h" }, "stable": { "version": [ @@ -123146,11 +123271,11 @@ "repo": "emacs-w3m/emacs-w3m", "unstable": { "version": [ - 20231003, - 113 + 20231023, + 653 ], - "commit": "3aa5d009f57a4d416127080938c846f4234d3619", - "sha256": "1c4i7ghap5qrgh1qc1szg374vwjqpla7zhi5dyrjn4yqz68vfv3m" + "commit": "55baf2bcb1a583d3baae1d37ad0e17b0480ffd02", + "sha256": "1vqr7bmairp70lrx9gm80w7qr2jxiijg5w1na36k7if4wikfg4kl" } }, { @@ -123711,11 +123836,11 @@ "repo": "fxbois/web-mode", "unstable": { "version": [ - 20230911, - 1817 + 20231025, + 1927 ], - "commit": "44c6bfa3626f476750ed3c1c0d253607c1606716", - "sha256": "14gmmsrqdhhvn7m9467phm4dr4c0jr7lfqpdmxj0rs85p2fsspmd" + "commit": "848fce94de202541cd3fcd35e9c9d22783e9e828", + "sha256": "1yypnb36hr04sgwn486j18a2z5i3i5fbwnjdw6yn2v59mbgqfdfz" }, "stable": { "version": [ @@ -124719,11 +124844,11 @@ "repo": "habamax/wildcharm-theme", "unstable": { "version": [ - 20231015, - 30 + 20231024, + 2323 ], - "commit": "14f29cfa8d185b544a481012e3bc33cbe5338dd4", - "sha256": "1z4rj4bryfs8x0wyg0bk27pxykaszkrlhjs7cgg99s9ihs963zqf" + "commit": "83e902cfd9526cdefc973ce9b3f3d7415beb59f5", + "sha256": "1yjfywf8spi23zdcdj412msgyannwinvfgdarwbmiwpj9h8ll6qh" }, "stable": { "version": [ @@ -124742,11 +124867,11 @@ "repo": "habamax/wildcharm-theme", "unstable": { "version": [ - 20231015, - 30 + 20231024, + 2311 ], - "commit": "14f29cfa8d185b544a481012e3bc33cbe5338dd4", - "sha256": "1z4rj4bryfs8x0wyg0bk27pxykaszkrlhjs7cgg99s9ihs963zqf" + "commit": "cd887cf61f73a4cf044bd01cec60be7324660f9b", + "sha256": "15ngcigdx6yayg93kiiraqq2rng0zx54kbni5cgh0gnf673yqzwy" }, "stable": { "version": [ @@ -127034,14 +127159,14 @@ "repo": "joaotavora/yasnippet", "unstable": { "version": [ - 20200604, - 246 + 20230914, + 1400 ], "deps": [ "cl-lib" ], - "commit": "5cbdbf0d2015540c59ed8ee0fcf4788effdf75b6", - "sha256": "1cp1sgmfc8pgcy24l77aam833710mjp2y3m8l8c90677wxqr44vl" + "commit": "52a1c5031912243c791c55e0fe345d04f219b507", + "sha256": "0gmkhv8slzshgn9bcamp49szf24nflqcfn8c1f9iff36vviyibgf" }, "stable": { "version": [ @@ -127064,14 +127189,14 @@ "repo": "elken/yasnippet-capf", "unstable": { "version": [ - 20230813, - 1906 + 20231024, + 1604 ], "deps": [ "yasnippet" ], - "commit": "40654214db7a44db3a99321447632b43a10fae57", - "sha256": "1kywl7jblrmixr0vwycpil5hyk4p5qlc3gxg9w25xga4jj91r663" + "commit": "a0a6b1c2bb6decdad5cf9b74202f0042f494a6ab", + "sha256": "0fzkdl32cblv8rc25d76hq90m40kbkkswz6m8f4fx2m8rw2ysfr8" } }, { diff --git a/pkgs/applications/editors/emacs/generic.nix b/pkgs/applications/editors/emacs/make-emacs.nix index d3aabb739ec81..d3aabb739ec81 100644 --- a/pkgs/applications/editors/emacs/generic.nix +++ b/pkgs/applications/editors/emacs/make-emacs.nix diff --git a/pkgs/applications/editors/emacs/sources.nix b/pkgs/applications/editors/emacs/sources.nix index 318e633d6ebbc..37bab4923bfc3 100644 --- a/pkgs/applications/editors/emacs/sources.nix +++ b/pkgs/applications/editors/emacs/sources.nix @@ -67,7 +67,7 @@ let }; in { - emacs28 = import ./generic.nix (mkArgs { + emacs28 = import ./make-emacs.nix (mkArgs { pname = "emacs"; version = "28.2"; variant = "mainline"; @@ -75,7 +75,7 @@ in hash = "sha256-4oSLcUDR0MOEt53QOiZSVU8kPJ67GwugmBxdX3F15Ag="; }); - emacs29 = import ./generic.nix (mkArgs { + emacs29 = import ./make-emacs.nix (mkArgs { pname = "emacs"; version = "29.1"; variant = "mainline"; @@ -83,7 +83,7 @@ in hash = "sha256-3HDCwtOKvkXwSULf3W7YgTz4GV8zvYnh2RrL28qzGKg="; }); - emacs28-macport = import ./generic.nix (mkArgs { + emacs28-macport = import ./make-emacs.nix (mkArgs { pname = "emacs-mac"; version = "28.2"; variant = "macport"; @@ -91,7 +91,7 @@ in hash = "sha256-Ne2jQ2nVLNiQmnkkOXVc5AkLVkTpm8pFC7VNY2gQjPE="; }); - emacs29-macport = import ./generic.nix (mkArgs { + emacs29-macport = import ./make-emacs.nix (mkArgs { pname = "emacs-mac"; version = "29.1"; variant = "macport"; diff --git a/pkgs/applications/emulators/mame/default.nix b/pkgs/applications/emulators/mame/default.nix index 730ed7b7ac0af..0688947f6ba19 100644 --- a/pkgs/applications/emulators/mame/default.nix +++ b/pkgs/applications/emulators/mame/default.nix @@ -38,14 +38,14 @@ let in stdenv.mkDerivation rec { pname = "mame"; - version = "0.259"; + version = "0.260"; srcVersion = builtins.replaceStrings [ "." ] [ "" ] version; src = fetchFromGitHub { owner = "mamedev"; repo = "mame"; rev = "mame${srcVersion}"; - hash = "sha256-F8psPvwuaILXZF7dCStJApVTD9zzzBwjf1CKGelHlqE="; + hash = "sha256-spWnaf7xXK2xzgdUagsgN5doVrpJk7EA6fzYd9FlFm0="; }; outputs = [ "out" "tools" ]; diff --git a/pkgs/applications/file-managers/walk/default.nix b/pkgs/applications/file-managers/walk/default.nix index 2a15b12a9f30b..d6273cf07ed55 100644 --- a/pkgs/applications/file-managers/walk/default.nix +++ b/pkgs/applications/file-managers/walk/default.nix @@ -2,16 +2,16 @@ buildGoModule rec { pname = "walk"; - version = "1.6.2"; + version = "1.7.0"; src = fetchFromGitHub { owner = "antonmedv"; repo = "walk"; rev = "v${version}"; - hash = "sha256-Wo8i0nPAuzADLXlsEho9TSSbNh3d13iNsXXx5onPnIs="; + hash = "sha256-hif62WAyJyFHpJoP3ph7gJk1QkEL7qkcv/BJuoXkwFU="; }; - vendorHash = "sha256-AmgCyq+N+EMdpIUCe6Lzd8bDXHsbOzclsHPp+H5ROMc="; + vendorHash = "sha256-e292ke0JiFEopLSozb+FkpwzSuhpIs/PdWOYuNI2M2o="; meta = with lib; { description = "Terminal file manager"; diff --git a/pkgs/applications/graphics/drawio/default.nix b/pkgs/applications/graphics/drawio/default.nix index d0fb1280c3428..fdf571b026a35 100644 --- a/pkgs/applications/graphics/drawio/default.nix +++ b/pkgs/applications/graphics/drawio/default.nix @@ -13,19 +13,19 @@ stdenv.mkDerivation rec { pname = "drawio"; - version = "22.0.2"; + version = "22.0.3"; src = fetchFromGitHub { owner = "jgraph"; repo = "drawio-desktop"; rev = "v${version}"; fetchSubmodules = true; - hash = "sha256-L+tbNCokVoiS2KkaPVBjG7H/8cqz1e8dlXC5H8BkPvU="; + hash = "sha256-Im0T+1jm1IZT3UILsOJ4Rp5P5IiBUKcJJ+cqv3WsqXw="; }; offlineCache = fetchYarnDeps { yarnLock = src + "/yarn.lock"; - hash = "sha256-d8AquOKdrPQHBhRG9o1GB18LpwlwQK6ZaM1gLAcjilM="; + hash = "sha256-Abyu/WoNOPAIfRIThG7vKFECW9NQMgcBAkLgEPwdJDQ="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/graphics/hydrus/0001-inform-nixpkgs.patch b/pkgs/applications/graphics/hydrus/0001-inform-nixpkgs.patch deleted file mode 100644 index e7200814eb059..0000000000000 --- a/pkgs/applications/graphics/hydrus/0001-inform-nixpkgs.patch +++ /dev/null @@ -1,18 +0,0 @@ -diff --git a/hydrus/core/HydrusConstants.py b/hydrus/core/HydrusConstants.py -index 809338ef..9125928f 100644 ---- a/hydrus/core/HydrusConstants.py -+++ b/hydrus/core/HydrusConstants.py -@@ -59,12 +59,7 @@ elif PLATFORM_HAIKU: - RUNNING_FROM_SOURCE = sys.argv[0].endswith( '.py' ) or sys.argv[0].endswith( '.pyw' ) - RUNNING_FROM_MACOS_APP = os.path.exists( os.path.join( BASE_DIR, 'running_from_app' ) ) - --if RUNNING_FROM_SOURCE: -- NICE_RUNNING_AS_STRING = 'from source' --elif RUNNING_FROM_FROZEN_BUILD: -- NICE_RUNNING_AS_STRING = 'from frozen build' --elif RUNNING_FROM_MACOS_APP: -- NICE_RUNNING_AS_STRING = 'from App' -+NICE_RUNNING_AS_STRING = "from nixpkgs (source)" - - BIN_DIR = os.path.join( BASE_DIR, 'bin' ) - HELP_DIR = os.path.join( BASE_DIR, 'help' ) diff --git a/pkgs/applications/graphics/hydrus/default.nix b/pkgs/applications/graphics/hydrus/default.nix index 968f60ba80965..91f38633e6ddf 100644 --- a/pkgs/applications/graphics/hydrus/default.nix +++ b/pkgs/applications/graphics/hydrus/default.nix @@ -12,21 +12,16 @@ python3Packages.buildPythonPackage rec { pname = "hydrus"; - version = "544"; + version = "549"; format = "other"; src = fetchFromGitHub { owner = "hydrusnetwork"; repo = "hydrus"; rev = "refs/tags/v${version}"; - hash = "sha256-e3VvkdJAQx5heKDJ1Ms6XpXrXWdzv48f8yu0DHfPy1A="; + hash = "sha256-y3WFQhPE8H0198Xu3Dn9YAqaX8YvFJcdt90tebTg7qw="; }; - patches = [ - # Nixpkgs specific, can be removed if upstream makes a more reasonable check - ./0001-inform-nixpkgs.patch - ]; - nativeBuildInputs = [ wrapQtAppsHook python3Packages.mkdocs-material @@ -75,31 +70,35 @@ python3Packages.buildPythonPackage rec { # most tests are failing, presumably because we are not using test.py checkPhase = '' + runHook preCheck + nosetests $src/hydrus/test \ - -e TestClientAPI \ - -e TestClientConstants \ - -e TestClientDaemons \ - -e TestClientData \ - -e TestClientDB \ - -e TestClientDBDuplicates \ - -e TestClientDBTags \ - -e TestClientImageHandling \ - -e TestClientImportOptions \ - -e TestClientListBoxes \ - -e TestClientMigration \ - -e TestClientNetworking \ - -e TestClientTags \ - -e TestClientThreading \ - -e TestDialogs \ - -e TestFunctions \ - -e TestHydrusNetwork \ - -e TestHydrusNATPunch \ - -e TestHydrusSerialisable \ - -e TestHydrusServer \ - -e TestHydrusSessions \ - -e TestServer \ - -e TestClientMetadataMigration \ - -e TestClientFileStorage \ + -e TestClientAPI \ + -e TestClientConstants \ + -e TestClientDaemons \ + -e TestClientData \ + -e TestClientDB \ + -e TestClientDBDuplicates \ + -e TestClientDBTags \ + -e TestClientImageHandling \ + -e TestClientImportOptions \ + -e TestClientListBoxes \ + -e TestClientMigration \ + -e TestClientNetworking \ + -e TestClientTags \ + -e TestClientThreading \ + -e TestDialogs \ + -e TestFunctions \ + -e TestHydrusNetwork \ + -e TestHydrusNATPunch \ + -e TestHydrusSerialisable \ + -e TestHydrusServer \ + -e TestHydrusSessions \ + -e TestServer \ + -e TestClientMetadataMigration \ + -e TestClientFileStorage \ + + runHook postCheck ''; outputs = [ "out" "doc" ]; @@ -112,7 +111,8 @@ python3Packages.buildPythonPackage rec { chmod -x $out/${python3Packages.python.sitePackages}/static/*.{png,svg,ico} # Build docs mkdocs build -d help - mv help $out/doc/ + mkdir -p $doc/share/doc + mv help $doc/share/doc/hydrus # install the hydrus binaries mkdir -p $out/bin diff --git a/pkgs/applications/misc/ddcui/default.nix b/pkgs/applications/misc/ddcui/default.nix index 020373da38f34..ffcd26afc9e5d 100644 --- a/pkgs/applications/misc/ddcui/default.nix +++ b/pkgs/applications/misc/ddcui/default.nix @@ -10,13 +10,13 @@ mkDerivation rec { pname = "ddcui"; - version = "0.3.0"; + version = "0.4.2"; src = fetchFromGitHub { owner = "rockowitz"; repo = "ddcui"; rev = "v${version}"; - sha256 = "sha256-P8dh6k8lht1/JNILzNZEyYD8loNoJjG5869K2Hl11z8="; + sha256 = "sha256-T4/c8K1P/o91DWJik/9HtHav948vbVa40qPdy7nKmos="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/misc/gimoji/default.nix b/pkgs/applications/misc/gimoji/default.nix index 24fd6cf2ea18c..63223755e01b7 100644 --- a/pkgs/applications/misc/gimoji/default.nix +++ b/pkgs/applications/misc/gimoji/default.nix @@ -26,6 +26,7 @@ rustPlatform.buildRustPackage rec { description = "Easily add emojis to your git commit messages"; homepage = "https://github.com/zeenix/gimoji"; license = licenses.mit; + mainProgram = "gimoji"; maintainers = with maintainers; [ a-kenji ]; }; } diff --git a/pkgs/applications/misc/glom/default.nix b/pkgs/applications/misc/glom/default.nix index 363e6fadee41a..5c8eb94712a68 100644 --- a/pkgs/applications/misc/glom/default.nix +++ b/pkgs/applications/misc/glom/default.nix @@ -28,7 +28,7 @@ , isocodes , gtksourceview , gtksourceviewmm -, postgresql_11 +, postgresql_15 , gobject-introspection , yelp-tools , wrapGAppsHook @@ -93,7 +93,7 @@ in stdenv.mkDerivation rec { python3.pkgs.pygobject3 gtksourceview gtksourceviewmm - postgresql_11 # for pg_config + postgresql_15 # for postgresql utils ]; enableParallelBuilding = true; @@ -102,6 +102,7 @@ in stdenv.mkDerivation rec { configureFlags = [ "--with-boost-python=boost_python${lib.versions.major python3.version}${lib.versions.minor python3.version}" + "--with-postgres-utils=${lib.getBin postgresql_15}/bin" ]; makeFlags = [ diff --git a/pkgs/applications/misc/gpxsee/default.nix b/pkgs/applications/misc/gpxsee/default.nix index 99fc367835664..72acbe02bbaef 100644 --- a/pkgs/applications/misc/gpxsee/default.nix +++ b/pkgs/applications/misc/gpxsee/default.nix @@ -18,13 +18,13 @@ let in stdenv.mkDerivation (finalAttrs: { pname = "gpxsee"; - version = "13.9"; + version = "13.10"; src = fetchFromGitHub { owner = "tumic0"; repo = "GPXSee"; rev = finalAttrs.version; - hash = "sha256-vzbZN+0lDSmvZnQCuvNJCYHTYKqErFhW4RI5Mfbgr6o="; + hash = "sha256-84F4B2yQREPosH1bK74nOby3o/C0isKq4t2CJprsblU="; }; buildInputs = [ diff --git a/pkgs/applications/misc/hyprdim/default.nix b/pkgs/applications/misc/hyprdim/default.nix index f7cf680ad0d1b..c59277a154f92 100644 --- a/pkgs/applications/misc/hyprdim/default.nix +++ b/pkgs/applications/misc/hyprdim/default.nix @@ -2,38 +2,41 @@ , rustPlatform , fetchFromGitHub , installShellFiles +, nix-update-script }: rustPlatform.buildRustPackage rec { pname = "hyprdim"; - version = "2.2.1"; + version = "2.2.2"; src = fetchFromGitHub { owner = "donovanglover"; - repo = pname; + repo = "hyprdim"; rev = version; - hash = "sha256-6HeVLgEJDPy4cWL5td3Xl7+a6WUFZWUFynvBzPhItcg="; + hash = "sha256-b2T/ueinKiheuK+siV29vJfEsEodq6qT2J3XxvoD/14="; }; - cargoHash = "sha256-qYX5o64X8PsFcTYuZ82lIShyUN69oTzQIHrQH4B7iIw="; + cargoHash = "sha256-Sf32vaqcxVdg6/kDidxBSr5XDWg3aNEBpEl31do2ZJ8="; nativeBuildInputs = [ installShellFiles ]; postInstall = '' - installManPage man/hyprdim.1 + installManPage target/man/hyprdim.1 installShellCompletion --cmd hyprdim \ - --bash <(cat completions/hyprdim.bash) \ - --fish <(cat completions/hyprdim.fish) \ - --zsh <(cat completions/_hyprdim) + --bash <(cat target/completions/hyprdim.bash) \ + --fish <(cat target/completions/hyprdim.fish) \ + --zsh <(cat target/completions/_hyprdim) ''; + passthru.updateScript = nix-update-script { }; + meta = with lib; { description = "Automatically dim windows in Hyprland when switching between them"; homepage = "https://github.com/donovanglover/hyprdim"; - license = licenses.mit; + license = licenses.gpl3Plus; platforms = platforms.linux; maintainers = with maintainers; [ donovanglover ]; mainProgram = "hyprdim"; diff --git a/pkgs/applications/misc/lutris/default.nix b/pkgs/applications/misc/lutris/default.nix index 730737a8bbb6f..044553bbaba8c 100644 --- a/pkgs/applications/misc/lutris/default.nix +++ b/pkgs/applications/misc/lutris/default.nix @@ -1,6 +1,7 @@ { buildPythonApplication , lib , fetchFromGitHub +, fetchpatch # build inputs , atk @@ -75,15 +76,24 @@ let in buildPythonApplication rec { pname = "lutris-unwrapped"; - version = "0.5.13"; + version = "0.5.14"; src = fetchFromGitHub { owner = "lutris"; repo = "lutris"; rev = "v${version}"; - hash = "sha256-ectrfbIkPhIqfhkavDpBCNdLPnGQhCnfFYwTf2IxB50="; + hash = "sha256-h7oHFVqMJU1HuuUgh5oKXxr9uaIPHz7Q4gf8ONLzric="; }; + # Backport patch to fix a failing test + # FIXME: remove in next release + patches = [ + (fetchpatch { + url = "https://github.com/lutris/lutris/commit/1f1d554df3b38da64fc65557ad619e55e050641e.patch"; + hash = "sha256-kVK1RX6T1ijffWVU7VEt2fR62QpvI6VZebiKPgEE/N8="; + }) + ]; + nativeBuildInputs = [ wrapGAppsHook gobject-introspection ]; buildInputs = [ atk diff --git a/pkgs/applications/misc/moolticute/default.nix b/pkgs/applications/misc/moolticute/default.nix index faa6c2180fc6f..fbdbe92ff6341 100644 --- a/pkgs/applications/misc/moolticute/default.nix +++ b/pkgs/applications/misc/moolticute/default.nix @@ -9,13 +9,13 @@ mkDerivation rec { pname = "moolticute"; - version = "1.02.0"; + version = "1.03.0"; src = fetchFromGitHub { owner = "mooltipass"; repo = pname; rev = "v${version}"; - sha256 = "sha256-URGAhd7u1DrGReQAwsX9LMj7Jq1GsILzP8fVFnA74O4="; + sha256 = "sha256-S2Pnueo3opP1k6XBBHGAyRJpkNuI1Hotz7ypXa/96eQ="; }; outputs = [ "out" "udev" ]; diff --git a/pkgs/applications/misc/prusa-slicer/default.nix b/pkgs/applications/misc/prusa-slicer/default.nix index fb796eb95de3e..0c9907764f225 100644 --- a/pkgs/applications/misc/prusa-slicer/default.nix +++ b/pkgs/applications/misc/prusa-slicer/default.nix @@ -18,7 +18,6 @@ , glew , glib , gmp -, gtest , gtk3 , hicolor-icon-theme , ilmbase @@ -105,10 +104,7 @@ stdenv.mkDerivation (finalAttrs: { xorg.libX11 ] ++ lib.optionals withSystemd [ systemd - ] ++ finalAttrs.nativeCheckInputs; - - doCheck = true; - nativeCheckInputs = [ gtest ]; + ]; separateDebugInfo = true; @@ -118,11 +114,6 @@ stdenv.mkDerivation (finalAttrs: { # additionally need to set the path via the NLOPT environment variable. NLOPT = nlopt; - # Disable compiler warnings that clutter the build log. - # It seems to be a known issue for Eigen: - # http://eigen.tuxfamily.org/bz/show_bug.cgi?id=1221 - env.NIX_CFLAGS_COMPILE = "-Wno-ignored-attributes"; - # prusa-slicer uses dlopen on `libudev.so` at runtime NIX_LDFLAGS = lib.optionalString withSystemd "-ludev"; @@ -150,9 +141,6 @@ stdenv.mkDerivation (finalAttrs: { # Fix resources folder location on macOS substituteInPlace src/PrusaSlicer.cpp \ --replace "#ifdef __APPLE__" "#if 0" - '' + lib.optionalString (stdenv.isDarwin && stdenv.isx86_64) '' - # Disable segfault tests - sed -i '/libslic3r/d' tests/CMakeLists.txt ''; patches = [ @@ -193,11 +181,23 @@ stdenv.mkDerivation (finalAttrs: { ) ''; + doCheck = true; + + checkPhase = '' + runHook preCheck + + ctest \ + --force-new-ctest-process \ + -E 'libslic3r_tests|sla_print_tests' + + runHook postCheck + ''; + meta = with lib; { description = "G-code generator for 3D printer"; homepage = "https://github.com/prusa3d/PrusaSlicer"; license = licenses.agpl3; - maintainers = with maintainers; [ moredread tweber ]; + maintainers = with maintainers; [ moredread tweber tmarkus ]; } // lib.optionalAttrs (stdenv.isDarwin) { mainProgram = "PrusaSlicer"; }; diff --git a/pkgs/applications/misc/prusa-slicer/super-slicer.nix b/pkgs/applications/misc/prusa-slicer/super-slicer.nix index 6f071521d9bfc..308c0949f134b 100644 --- a/pkgs/applications/misc/prusa-slicer/super-slicer.nix +++ b/pkgs/applications/misc/prusa-slicer/super-slicer.nix @@ -1,9 +1,23 @@ -{ lib, fetchFromGitHub, fetchpatch, makeDesktopItem, wxGTK31, prusa-slicer }: +{ lib, fetchFromGitHub, fetchpatch, makeDesktopItem, wxGTK31, prusa-slicer, libspnav }: let appname = "SuperSlicer"; pname = "super-slicer"; description = "PrusaSlicer fork with more features and faster development cycle"; + patches = [ + # Fix compile error with boost 1.79. See https://github.com/supermerill/SuperSlicer/issues/2823 + (fetchpatch { + url = "https://raw.githubusercontent.com/gentoo/gentoo/81e3ca3b7c131e8345aede89e3bbcd700e1ad567/media-gfx/superslicer/files/superslicer-2.4.58.3-boost-1.79-port-v2.patch"; + # Excludes Linux-only patches + excludes = [ + "src/slic3r/GUI/FreeCADDialog.cpp" + "src/slic3r/GUI/Tab.cpp" + "src/slic3r/Utils/Http.cpp" + ]; + sha256 = "sha256-v0q2MhySayij7+qBTE5q01IOq/DyUcWnjpbzB/AV34c="; + }) + ]; + versions = { stable = { version = "2.3.57.12"; @@ -11,26 +25,14 @@ let patches = null; }; latest = { - version = "2.4.58.3"; - sha256 = "sha256-pEZcBEvK4Mq8nytiXLJvta7Bk6qZRJfTNrYz7N/aUAE="; - patches = [ - # Fix detection of TBB, see https://github.com/prusa3d/PrusaSlicer/issues/6355 - (fetchpatch { - url = "https://github.com/prusa3d/PrusaSlicer/commit/76f4d6fa98bda633694b30a6e16d58665a634680.patch"; - sha256 = "1r806ycp704ckwzgrw1940hh1l6fpz0k1ww3p37jdk6mygv53nv6"; - }) - # Fix compile error with boost 1.79. See https://github.com/supermerill/SuperSlicer/issues/2823 - (fetchpatch { - url = "https://raw.githubusercontent.com/gentoo/gentoo/81e3ca3b7c131e8345aede89e3bbcd700e1ad567/media-gfx/superslicer/files/superslicer-2.4.58.3-boost-1.79-port-v2.patch"; - # Excludes Linux-only patches - excludes = [ - "src/slic3r/GUI/FreeCADDialog.cpp" - "src/slic3r/GUI/Tab.cpp" - "src/slic3r/Utils/Http.cpp" - ]; - sha256 = "sha256-v0q2MhySayij7+qBTE5q01IOq/DyUcWnjpbzB/AV34c="; - }) - ]; + version = "2.4.58.5"; + sha256 = "sha256-UywxEGedXaBUTKojEkbkuejI6SdPSkPxTJMwUDNW6W0="; + inherit patches; + }; + beta = { + version = "2.5.59.2"; + sha256 = "sha256-IgE+NWy2DUrPR2ROfK1F67e8B3eoM9yRVQ0GZTxJ42I="; + inherit patches; }; }; @@ -45,19 +47,23 @@ let fetchSubmodules = true; }; - # wxScintilla is not used on macOS + # - wxScintilla is not used on macOS + # - Partially applied upstream changes cause a bug when trying to link against a nonexistent libexpat prePatch = super.prePatch + '' substituteInPlace src/CMakeLists.txt \ - --replace "scintilla" "" + --replace "scintilla" "" \ + --replace "list(APPEND wxWidgets_LIBRARIES libexpat)" "list(APPEND wxWidgets_LIBRARIES EXPAT::EXPAT)" + + substituteInPlace src/libslic3r/CMakeLists.txt \ + --replace "libexpat" "EXPAT::EXPAT" ''; # We don't need PS overrides anymore, and gcode-viewer is embedded in the binary. postInstall = null; separateDebugInfo = true; - # See https://github.com/supermerill/SuperSlicer/issues/432 - cmakeFlags = super.cmakeFlags ++ [ - "-DSLIC3R_BUILD_TESTS=0" + buildInputs = super.buildInputs ++ [ + libspnav ]; desktopItems = [ @@ -76,7 +82,7 @@ let inherit description; homepage = "https://github.com/supermerill/SuperSlicer"; license = licenses.agpl3; - maintainers = with maintainers; [ cab404 moredread ]; + maintainers = with maintainers; [ cab404 moredread tmarkus ]; mainProgram = "superslicer"; }; diff --git a/pkgs/applications/misc/pueue/default.nix b/pkgs/applications/misc/pueue/default.nix index b670bcabf6106..e644f44f59517 100644 --- a/pkgs/applications/misc/pueue/default.nix +++ b/pkgs/applications/misc/pueue/default.nix @@ -10,16 +10,16 @@ rustPlatform.buildRustPackage rec { pname = "pueue"; - version = "3.3.0"; + version = "3.3.1"; src = fetchFromGitHub { owner = "Nukesor"; repo = "pueue"; rev = "v${version}"; - hash = "sha256-X6q8ePaADv1+n/WmCp4SOhVm9lnc14qGhLSCxtc/ONw="; + hash = "sha256-EDd8SChQ8Vh2uNSZq5mrWdsLNT0KC4IMA7e3BPk6p04="; }; - cargoHash = "sha256-lfWuOkKNNDQ0b6oncuCC3KOAgtQGvLptIbmdyY8vy6o="; + cargoHash = "sha256-H4Oyn2cLyj/RNkiMQMzbHjhs1AJIcmSkZOO83ETByWk="; nativeBuildInputs = [ installShellFiles @@ -60,7 +60,7 @@ rustPlatform.buildRustPackage rec { any terminal on the same machine. The queue will be continuously processed, even if you no longer have any active ssh sessions. ''; - changelog = "https://github.com/Nukesor/pueue/raw/v${version}/CHANGELOG.md"; + changelog = "https://github.com/Nukesor/pueue/blob/v${version}/CHANGELOG.md"; license = licenses.mit; maintainers = with maintainers; [ marsam ]; }; diff --git a/pkgs/applications/misc/spicetify-cli/default.nix b/pkgs/applications/misc/spicetify-cli/default.nix index 8e6e293aee526..ee7d7974fb64c 100644 --- a/pkgs/applications/misc/spicetify-cli/default.nix +++ b/pkgs/applications/misc/spicetify-cli/default.nix @@ -2,13 +2,13 @@ buildGoModule rec { pname = "spicetify-cli"; - version = "2.25.1"; + version = "2.25.2"; src = fetchFromGitHub { owner = "spicetify"; repo = "spicetify-cli"; rev = "v${version}"; - hash = "sha256-81dfAekWvMcp1Jar+jlXRiJr6UmHCdJZ0ML/6fFnvRs="; + hash = "sha256-llPxR4awKBBv0jiLr5MbE33D5KZx3LmBo5BDwZI8ZM0="; }; vendorHash = "sha256-VktAO3yKCdm5yz/RRLeLv6zzyGrwuHC/i8WdJtqZoYc="; diff --git a/pkgs/applications/misc/xmrig/default.nix b/pkgs/applications/misc/xmrig/default.nix index 2a6ac97c9c31e..d93108bdf5846 100644 --- a/pkgs/applications/misc/xmrig/default.nix +++ b/pkgs/applications/misc/xmrig/default.nix @@ -66,6 +66,7 @@ stdenv.mkDerivation rec { description = "Monero (XMR) CPU miner"; homepage = "https://github.com/xmrig/xmrig"; license = licenses.gpl3Plus; + mainProgram = "xmrig"; platforms = platforms.unix; maintainers = with maintainers; [ kim0 ]; }; diff --git a/pkgs/applications/misc/xmrig/moneroocean.nix b/pkgs/applications/misc/xmrig/moneroocean.nix index 99d8225f264a0..ba643eb77b453 100644 --- a/pkgs/applications/misc/xmrig/moneroocean.nix +++ b/pkgs/applications/misc/xmrig/moneroocean.nix @@ -15,6 +15,7 @@ xmrig.overrideAttrs (oldAttrs: rec { description = "A fork of the XMRig CPU miner with support for algorithm switching"; homepage = "https://github.com/MoneroOcean/xmrig"; license = licenses.gpl3Plus; + mainProgram = "xmrig"; platforms = platforms.unix; maintainers = with maintainers; [ j0hax ]; }; diff --git a/pkgs/applications/misc/zettlr/default.nix b/pkgs/applications/misc/zettlr/default.nix index 79d386e349c05..88f3cd5540a02 100644 --- a/pkgs/applications/misc/zettlr/default.nix +++ b/pkgs/applications/misc/zettlr/default.nix @@ -2,11 +2,7 @@ builtins.mapAttrs (pname: attrs: callPackage ./generic.nix (attrs // { inherit pname; inherit texlive; })) { zettlr = { - version = "2.3.0"; - hash = "sha256-3p9RO6hpioYF6kdGV+/9guoqxaPCJG73OsrN69SHQHk="; - }; - zettlr-beta = { - version = "3.0.0-beta.7"; - hash = "sha256-zIZaINE27bcjbs8yCGQ3UKAwStFdvhHD3Q1F93LrG4U="; + version = "3.0.2"; + hash = "sha256-xwBq+kLmTth15uLiYWJOhi/YSPZVJNO6JTrKFojSDXA="; }; } diff --git a/pkgs/applications/networking/browsers/brave/default.nix b/pkgs/applications/networking/browsers/brave/default.nix index c3495160029f2..17492b5a1c78d 100644 --- a/pkgs/applications/networking/browsers/brave/default.nix +++ b/pkgs/applications/networking/browsers/brave/default.nix @@ -92,11 +92,11 @@ in stdenv.mkDerivation rec { pname = "brave"; - version = "1.59.120"; + version = "1.59.124"; src = fetchurl { url = "https://github.com/brave/brave-browser/releases/download/v${version}/brave-browser_${version}_amd64.deb"; - sha256 = "sha256-fkIU6XuydF6Bo8V0uS4NObh2fRuKxOWMqVft81uUs9Q="; + sha256 = "sha256-uY9i0TxTsSvOfMA98amxwWpQh1nsRVEgxeSZ2sv8NEU="; }; dontConfigure = true; diff --git a/pkgs/applications/networking/browsers/chromium/update.py b/pkgs/applications/networking/browsers/chromium/update.py index 60267331cc275..a241ee0dd7cff 100755 --- a/pkgs/applications/networking/browsers/chromium/update.py +++ b/pkgs/applications/networking/browsers/chromium/update.py @@ -151,10 +151,6 @@ def channel_name_to_attr_name(channel_name): """Maps a channel name to the corresponding main Nixpkgs attribute name.""" if channel_name == 'stable': return 'chromium' - if channel_name == 'beta': - return 'chromiumBeta' - if channel_name == 'dev': - return 'chromiumDev' if channel_name == 'ungoogled-chromium': return 'ungoogled-chromium' print(f'Error: Unexpected channel: {channel_name}', file=sys.stderr) @@ -206,6 +202,10 @@ with urlopen(RELEASES_URL) as resp: if channel_name in channels: continue + # We only look for channels that are listed in our version pin file. + if channel_name not in last_channels: + continue + # If we're back at the last release we used, we don't need to # keep going -- there's no new version available, and we can # just reuse the info from last time. diff --git a/pkgs/applications/networking/browsers/chromium/upstream-info.nix b/pkgs/applications/networking/browsers/chromium/upstream-info.nix index 32fb0ecb48338..e6a7e3f6c7adf 100644 --- a/pkgs/applications/networking/browsers/chromium/upstream-info.nix +++ b/pkgs/applications/networking/browsers/chromium/upstream-info.nix @@ -1,30 +1,4 @@ { - beta = { - deps = { - gn = { - rev = "811d332bd90551342c5cbd39e133aa276022d7f8"; - hash = "sha256-WCq+PNkWxWpssUOQyQbAZ5l6k+hg+qGMsoaMG0Ybj0o="; - url = "https://gn.googlesource.com/gn"; - version = "2023-08-01"; - }; - }; - hash = "sha256-spzY2u5Wk52BrKCk9aQOEp/gbppaGVLCQxXa+3JuajA="; - hash_deb_amd64 = "sha256-eTeEeNa4JuCW81+SUAyrKi3S0/TJNTAoTktWQ0JsgYc="; - version = "117.0.5938.22"; - }; - dev = { - deps = { - gn = { - rev = "cc56a0f98bb34accd5323316e0292575ff17a5d4"; - hash = "sha256-SwlET5h5xtDlQvlt8wbG73ZfUWJr4hlWc+uQsBH5x9M="; - url = "https://gn.googlesource.com/gn"; - version = "2023-08-10"; - }; - }; - hash = "sha256-W0fZuvv9jz03ibQqB6MG45aw2zPklfxoFzZzr+kRuJk="; - hash_deb_amd64 = "sha256-XWxRFLFxBqnvKcoB5HErwVbtHCGYRteLeTv44zVMwIc="; - version = "118.0.5966.0"; - }; stable = { chromedriver = { hash_darwin = "sha256-ugsxRhIPtDD7Y4/PsIc8Apqrtyo4uiVKoLmtRvQaJ3k="; diff --git a/pkgs/applications/networking/browsers/firefox/wrapper.nix b/pkgs/applications/networking/browsers/firefox/wrapper.nix index ed1ec5692a0c5..68f547d1f95a3 100644 --- a/pkgs/applications/networking/browsers/firefox/wrapper.nix +++ b/pkgs/applications/networking/browsers/firefox/wrapper.nix @@ -46,7 +46,7 @@ let , extraPrefs ? "" , extraPrefsFiles ? [] # For more information about policies visit - # https://github.com/mozilla/policy-templates#enterprisepoliciesenabled + # https://mozilla.github.io/policy-templates/ , extraPolicies ? {} , extraPoliciesFiles ? [] , libName ? browser.libName or "firefox" # Important for tor package or the like diff --git a/pkgs/applications/networking/browsers/lagrange/default.nix b/pkgs/applications/networking/browsers/lagrange/default.nix index 342396c6a5aac..e1d79afac0441 100644 --- a/pkgs/applications/networking/browsers/lagrange/default.nix +++ b/pkgs/applications/networking/browsers/lagrange/default.nix @@ -1,6 +1,7 @@ { stdenv , lib , fetchFromGitHub +, fetchpatch , nix-update-script , cmake , pkg-config @@ -17,15 +18,23 @@ stdenv.mkDerivation (finalAttrs: { pname = "lagrange"; - version = "1.17.0"; + version = "1.17.2"; src = fetchFromGitHub { owner = "skyjake"; repo = "lagrange"; rev = "v${finalAttrs.version}"; - hash = "sha256-UoyCsmZKpRkO4bQt6RwRAceu3+JPD8I8qSf9/uU5Vm4="; + hash = "sha256-x80le9/mkL57NQGgmqAdbixYGxcoKKO3Rl+BlpOzTwc="; }; + patches = [ + # Remove on next release + (fetchpatch { + url = "https://github.com/skyjake/lagrange/commit/e8295f0065e8ecddab2e291e420098ac7981e0a9.patch"; + hash = "sha256-s8Ryace6DOjw4C4h1Kb2ti5oygvsAAs/MF9pC3eQbAM="; + }) + ]; + nativeBuildInputs = [ cmake pkg-config zip ]; buildInputs = [ the-foundation ] diff --git a/pkgs/applications/networking/browsers/librewolf/src.json b/pkgs/applications/networking/browsers/librewolf/src.json index e4516cb42428d..7810db67afb30 100644 --- a/pkgs/applications/networking/browsers/librewolf/src.json +++ b/pkgs/applications/networking/browsers/librewolf/src.json @@ -1,15 +1,15 @@ { - "packageVersion": "118.0.1-1", + "packageVersion": "119.0-5", "source": { - "rev": "118.0.1-1", - "sha256": "1wdqiif1la97w9b3xsz20xrcg2d1c0j13pdfcj7z23jz8846iqk4" + "rev": "119.0-5", + "sha256": "0ql4i6b4fvydiyscj8ki2pnzr67bmb3azpdm6kk5y8yyw2697230" }, "settings": { "rev": "9c862f06f970d69e00c1035e0d4774fb44fd84a6", "sha256": "0ay58wrhfn0b56748phpn0ahz11ls9y8d2fd1z4zrj6dv398vlmb" }, "firefox": { - "version": "118.0.1", - "sha512": "b1efa1afea70434dc2a18d335bb8b526883cde200f1503b8c5fd2e7db8285e6a999cfa3aac354ea1c15a91d13a46d68db37023235314240b59eb8f55e01554ad" + "version": "119.0", + "sha512": "4b555c444add36567fd538752b122f227cf78bb70b72c79e6d8ae8d9c2e61c3cdacfae79c37970753b8b5c7716b28c686071eb7b551773c30a76852f3550676c" } } diff --git a/pkgs/applications/networking/browsers/microsoft-edge/default.nix b/pkgs/applications/networking/browsers/microsoft-edge/default.nix index 47163c0aa8be6..1c2ac1f8d5fe2 100644 --- a/pkgs/applications/networking/browsers/microsoft-edge/default.nix +++ b/pkgs/applications/networking/browsers/microsoft-edge/default.nix @@ -1,20 +1,20 @@ { stable = import ./browser.nix { channel = "stable"; - version = "118.0.2088.46"; + version = "118.0.2088.76"; revision = "1"; - sha256 = "sha256-/3lo/y/LhAmGqiOhZgDoJVS+c2631NB/Z/lBNFunU30="; + sha256 = "sha256-cd8W/0UZi+NhPSILR8e8aOLxy6ra+0DVwRowo2jG8DA="; }; beta = import ./browser.nix { channel = "beta"; - version = "118.0.2088.46"; + version = "119.0.2151.32"; revision = "1"; - sha256 = "sha256-u0w7COYoAgcpqVEsB0t27iMD2AGVYFCJyE72uWKIY70="; + sha256 = "sha256-tsDFUKZDiusr/fGO5NMRqzTDIF+MTgC/1gJu95wXwAw="; }; dev = import ./browser.nix { channel = "dev"; - version = "119.0.2151.2"; + version = "120.0.2172.1"; revision = "1"; - sha256 = "sha256-42wbnA9i1FdBq14Y+xxstAe9ciWDzEBVMULCSURQzj0="; + sha256 = "sha256-EvTS0AO3/A8Ut9H36mMOnS9PRR062WAoas9/Pd90NBM="; }; } diff --git a/pkgs/applications/networking/cluster/bosh-cli/default.nix b/pkgs/applications/networking/cluster/bosh-cli/default.nix index 98a051cb7c3b5..4abcb0321d8cf 100644 --- a/pkgs/applications/networking/cluster/bosh-cli/default.nix +++ b/pkgs/applications/networking/cluster/bosh-cli/default.nix @@ -8,13 +8,13 @@ buildGoModule rec { pname = "bosh-cli"; - version = "7.4.0"; + version = "7.4.1"; src = fetchFromGitHub { owner = "cloudfoundry"; repo = pname; rev = "v${version}"; - sha256 = "sha256-Hxak76S3+i5G81Xv4wdFvR/+vg5Eh86YjeqRzNUmfh4="; + sha256 = "sha256-T8fPD0i15U/PzDOAVP0sifLYFHr76jD1o7q+nn+N0cY="; }; vendorHash = null; diff --git a/pkgs/applications/networking/cluster/civo/default.nix b/pkgs/applications/networking/cluster/civo/default.nix index f145b306d8868..f33d11a4c9a4f 100644 --- a/pkgs/applications/networking/cluster/civo/default.nix +++ b/pkgs/applications/networking/cluster/civo/default.nix @@ -2,16 +2,16 @@ buildGoModule rec { pname = "civo"; - version = "1.0.67"; + version = "1.0.68"; src = fetchFromGitHub { owner = "civo"; repo = "cli"; rev = "v${version}"; - sha256 = "sha256-EBpKJrQ+zdoMlTbOsWCAj2Hfu8OqQTFb0l+i2UdkNSs="; + sha256 = "sha256-qvcMA8oPDyi8WoIzr/3mu+2cHDXn5rgLUmnsGdOQXVM="; }; - vendorHash = "sha256-AvAS3S7bepaTFPelE+Bj5/UuQIXEDvSAtDuFaPRC9sk="; + vendorHash = "sha256-C+XaX78iGKw6Ll7PMPFWWAy6fRwjrmbLhFdmqJPMrxc="; nativeBuildInputs = [ installShellFiles ]; diff --git a/pkgs/applications/networking/cluster/gatekeeper/default.nix b/pkgs/applications/networking/cluster/gatekeeper/default.nix index 70c464bb7c9b3..00816c0203ee8 100644 --- a/pkgs/applications/networking/cluster/gatekeeper/default.nix +++ b/pkgs/applications/networking/cluster/gatekeeper/default.nix @@ -6,13 +6,13 @@ buildGoModule rec { pname = "gatekeeper"; - version = "3.13.2"; + version = "3.13.3"; src = fetchFromGitHub { owner = "open-policy-agent"; repo = "gatekeeper"; rev = "v${version}"; - hash = "sha256-4d0AZknOPQR84HbZiYgXAR/HA82cYes+gzoLWw4SVgA="; + hash = "sha256-kLDriWkzOX4mC4VTpkyEtMTpOSoR0BsCwVeWLCfaY5w="; }; vendorHash = null; diff --git a/pkgs/applications/networking/cluster/k3s/default.nix b/pkgs/applications/networking/cluster/k3s/default.nix index 503a4ff0c0d13..e2ba162b75812 100644 --- a/pkgs/applications/networking/cluster/k3s/default.nix +++ b/pkgs/applications/networking/cluster/k3s/default.nix @@ -1,16 +1,23 @@ -{ lib, stdenv, callPackage }: +{ lib, callPackage, ... }@args: let k3s_builder = import ./builder.nix lib; common = opts: callPackage (k3s_builder opts); + # extraArgs is the extra arguments passed in by the caller to propogate downward. + # This is to allow all-packages.nix to do: + # + # let k3s_1_23 = (callPackage ./path/to/k3s { + # commonK3sArg = .... + # }).k3s_1_23; + extraArgs = builtins.removeAttrs args [ "callPackage" ]; in { k3s_1_26 = common ((import ./1_26/versions.nix) // { updateScript = [ ./update-script.sh "26" ]; - }) { }; + }) extraArgs; # 1_27 can be built with the same builder as 1_26 k3s_1_27 = common ((import ./1_27/versions.nix) // { updateScript = [ ./update-script.sh "27" ]; - }) { }; + }) extraArgs; } diff --git a/pkgs/applications/networking/cluster/karmor/default.nix b/pkgs/applications/networking/cluster/karmor/default.nix index ae15ac80259e4..e4bd3be1e78ef 100644 --- a/pkgs/applications/networking/cluster/karmor/default.nix +++ b/pkgs/applications/networking/cluster/karmor/default.nix @@ -8,16 +8,16 @@ buildGoModule rec { pname = "karmor"; - version = "0.14"; + version = "0.14.2"; src = fetchFromGitHub { owner = "kubearmor"; repo = "kubearmor-client"; rev = "v${version}"; - hash = "sha256-5o2bIjO9eF+NDAAhVssHJXmKE/eTHMuEwz4F48OBKaE="; + hash = "sha256-SHijhYZyvaBkRVt0BO37OXEjaDGUIeO+PfrmUqPJf/M="; }; - vendorHash = "sha256-e7VLDipadGa/Zzss2jgj0fyCKr92Sq2urshnFob4SSE="; + vendorHash = "sha256-fxbyAd2NaU1WQCPE+Feb1mrz6dzwCyZqanm+wfBL/IE="; nativeBuildInputs = [ installShellFiles ]; diff --git a/pkgs/applications/networking/cluster/kubecfg/default.nix b/pkgs/applications/networking/cluster/kubecfg/default.nix index fe3732152d215..7197a695e826f 100644 --- a/pkgs/applications/networking/cluster/kubecfg/default.nix +++ b/pkgs/applications/networking/cluster/kubecfg/default.nix @@ -6,16 +6,16 @@ buildGoModule rec { pname = "kubecfg"; - version = "0.34.1"; + version = "0.34.2"; src = fetchFromGitHub { owner = "kubecfg"; repo = "kubecfg"; rev = "v${version}"; - hash = "sha256-UGxtL8X1wEyo7jYmPw0GTvuzzQCBA3WTIowMnYSyfvM="; + hash = "sha256-+qQ/80wXSKvPg2nRuvkYZe0+fwnxKsegR0IjsxBKDNQ="; }; - vendorHash = "sha256-AbEEHG+LJB5fOm8koVQllKohtb0lqD6Kln3GCwlkb/0="; + vendorHash = "sha256-X+EvvrAnqMw/jpVdF/UJq9zFH+1NLFLYOu5RsxykynY="; ldflags = [ "-s" diff --git a/pkgs/applications/networking/cluster/kubeseal/default.nix b/pkgs/applications/networking/cluster/kubeseal/default.nix index ab02dff316031..ae514e2b9226a 100644 --- a/pkgs/applications/networking/cluster/kubeseal/default.nix +++ b/pkgs/applications/networking/cluster/kubeseal/default.nix @@ -2,16 +2,16 @@ buildGoModule rec { pname = "kubeseal"; - version = "0.24.1"; + version = "0.24.2"; src = fetchFromGitHub { owner = "bitnami-labs"; repo = "sealed-secrets"; rev = "v${version}"; - sha256 = "sha256-L5j7+2m2zKRQ/zpmwq1OimPM6I1KmmPBzNcK+s1NIDs="; + sha256 = "sha256-vKAKDQrQ7FmCnJwo8ItwpiayrHa9bhMognYZMlpZAlM="; }; - vendorHash = "sha256-+x5wohzPYzff3jpqsvnDqElrBW867WLrl4RaLlRjkUk="; + vendorHash = "sha256-LPxU6qvpUb0ZjzjqGeTywOluwWbsi1YmiYYWJfaMWvg="; subPackages = [ "cmd/kubeseal" ]; diff --git a/pkgs/applications/networking/cluster/terragrunt/default.nix b/pkgs/applications/networking/cluster/terragrunt/default.nix index 65cddcbc34d4b..1cf21e63a1342 100644 --- a/pkgs/applications/networking/cluster/terragrunt/default.nix +++ b/pkgs/applications/networking/cluster/terragrunt/default.nix @@ -5,16 +5,16 @@ buildGoModule rec { pname = "terragrunt"; - version = "0.52.3"; + version = "0.53.0"; src = fetchFromGitHub { owner = "gruntwork-io"; repo = pname; rev = "refs/tags/v${version}"; - hash = "sha256-o/4L7TBdFFHuPOKAO/wP0IBixQtZHGr1GSNlsEpq710="; + hash = "sha256-Y3the1+p+ZAkPxKnScNIup7cfyTtE2LU3IdghA0mOY8="; }; - vendorHash = "sha256-RmzSKt5qt9Qb4GDrfs4dJEhGQW/jFbXPn+AOLzEyo6c="; + vendorHash = "sha256-5O3souGEosqLFxZpGbak4r57V39lR6X8mEPgfad3X5Q="; doCheck = false; diff --git a/pkgs/applications/networking/cluster/zarf/default.nix b/pkgs/applications/networking/cluster/zarf/default.nix index eeb97e1b0f01b..3099df6e9f12b 100644 --- a/pkgs/applications/networking/cluster/zarf/default.nix +++ b/pkgs/applications/networking/cluster/zarf/default.nix @@ -5,16 +5,16 @@ buildGoModule rec { pname = "zarf"; - version = "0.29.2"; + version = "0.30.0"; src = fetchFromGitHub { owner = "defenseunicorns"; repo = "zarf"; rev = "v${version}"; - hash = "sha256-eSKoh1Ab2rzpOOHRi+FZ92ic92Q6bFpu1jYIPhmoqQc="; + hash = "sha256-bsUnwciJ+s3lkiVXD09xQx8EAhE964/JBeggVprwkTc="; }; - vendorHash = "sha256-p1QLNbkNlIwqHzLjGX5YGC2Xxu0nAjmMfGwKXhi9XkU="; + vendorHash = "sha256-Uu7U8tjpHe/OzbQREty0X6ik6JafzYdax2762BkGacw="; proxyVendor = true; preBuild = '' diff --git a/pkgs/applications/networking/ids/zeek/default.nix b/pkgs/applications/networking/ids/zeek/default.nix index e4440b483595a..3922b95fbac2c 100644 --- a/pkgs/applications/networking/ids/zeek/default.nix +++ b/pkgs/applications/networking/ids/zeek/default.nix @@ -26,11 +26,11 @@ let in stdenv.mkDerivation rec { pname = "zeek"; - version = "6.0.1"; + version = "6.0.2"; src = fetchurl { url = "https://download.zeek.org/zeek-${version}.tar.gz"; - sha256 = "sha256-z8MpoXBDkZXXBw7FOH2Vzdp+trhqyF7HB7ntDp1Xaik="; + sha256 = "sha256-JCGYmtzuain0io9ycvcZ7b6VTWbC6G46Uuecrhd/iHw="; }; strictDeps = true; diff --git a/pkgs/applications/networking/instant-messengers/beeper/default.nix b/pkgs/applications/networking/instant-messengers/beeper/default.nix index bd5b0d904cc75..2f00e4de0c834 100644 --- a/pkgs/applications/networking/instant-messengers/beeper/default.nix +++ b/pkgs/applications/networking/instant-messengers/beeper/default.nix @@ -11,11 +11,11 @@ }: let pname = "beeper"; - version = "3.82.8"; + version = "3.83.13"; name = "${pname}-${version}"; src = fetchurl { - url = "https://download.todesktop.com/2003241lzgn20jd/beeper-3.82.8-build-231019pq0po3woq.AppImage"; - hash = "sha256-tXPmTpbzWU+sUJHhyP2lexcAb33YmJnRaxX08G4CTaE="; + url = "https://download.todesktop.com/2003241lzgn20jd/beeper-3.83.13-build-231024j9x7ova5e.AppImage"; + hash = "sha256-ZuwPLYcVcjCCLdWSarY0oq0GUDiOrvNBgK/7ETb8OLg="; }; appimage = appimageTools.wrapType2 { inherit version pname src; diff --git a/pkgs/applications/networking/instant-messengers/ferdium/default.nix b/pkgs/applications/networking/instant-messengers/ferdium/default.nix index 2dd3f62cba6ac..61a85ae4f7c3d 100644 --- a/pkgs/applications/networking/instant-messengers/ferdium/default.nix +++ b/pkgs/applications/networking/instant-messengers/ferdium/default.nix @@ -6,13 +6,13 @@ let aarch64-linux = "arm64"; }."${stdenv.hostPlatform.system}" or (throw "Unsupported system: ${stdenv.hostPlatform.system}"); hash = { - amd64-linux_hash = "sha256-MmDU6Hn/s4IuTYBLYbz5okzHbx+dPOoKDtMXlLmZjQw="; - arm64-linux_hash = "sha256-m8sygpqWiwWzbHe+n8hfVdYr0YpZNfg1B+/nf5QXoyg="; + amd64-linux_hash = "sha256-ZCyAz+XVp2NJVUuMWyv5ubjMaoYBsjPAye/1vO2jv/w="; + arm64-linux_hash = "sha256-prdVwEn6eynzjLQ+aw2CS4PJ/JgG4QFKs9WDbzjV5oo="; }."${arch}-linux_hash"; in mkFranzDerivation rec { pname = "ferdium"; name = "Ferdium"; - version = "6.5.2"; + version = "6.6.0"; src = fetchurl { url = "https://github.com/ferdium/ferdium-app/releases/download/v${version}/Ferdium-linux-${version}-${arch}.deb"; inherit hash; diff --git a/pkgs/applications/networking/instant-messengers/telegram/telegram-desktop/default.nix b/pkgs/applications/networking/instant-messengers/telegram/telegram-desktop/default.nix index edf88f542ad03..cbfcad3ed4db2 100644 --- a/pkgs/applications/networking/instant-messengers/telegram/telegram-desktop/default.nix +++ b/pkgs/applications/networking/instant-messengers/telegram/telegram-desktop/default.nix @@ -1,6 +1,8 @@ { lib , fetchFromGitHub +, fetchurl , fetchpatch +, fetchpatch2 , callPackage , pkg-config , cmake @@ -26,6 +28,7 @@ , libopus , alsa-lib , libpulseaudio +, perlPackages , pipewire , range-v3 , tl-expected @@ -55,6 +58,7 @@ , libpsl , brotli , microsoft-gsl +, mm-common , rlottie , stdenv , nix-update-script @@ -73,17 +77,41 @@ let cxxStandard = "20"; }; }; + glibmm = glibmm_2_68.overrideAttrs (attrs: { + version = "2.78.0"; + src = fetchurl { + url = "mirror://gnome/sources/glibmm/2.78/glibmm-2.78.0.tar.xz"; + hash = "sha256-XS6HJWSZbwKgbYu6w2d+fDlK+LAN0VJq69R6+EKj71A="; + }; + patches = [ + # Revert "Glib, Gio: Add new API from glib 2.77.0" + (fetchpatch2 { + url = "https://github.com/GNOME/glibmm/commit/5b9032c0298cbb49c3ed90d5f71f2636751fa638.patch"; + revert = true; + hash = "sha256-UzrzIOnXh9pxuTDQsp6mnunDNNtc86hE9tCe1NgKsyo="; + }) + ]; + mesonFlags = [ + "-Dmaintainer-mode=true" + "-Dbuild-documentation=false" + ]; + nativeBuildInputs = attrs.nativeBuildInputs ++ [ + mm-common + perlPackages.perl + perlPackages.XMLParser + ]; + }); in stdenv.mkDerivation rec { pname = "telegram-desktop"; - version = "4.8.4"; + version = "4.11.1"; src = fetchFromGitHub { owner = "telegramdesktop"; repo = "tdesktop"; rev = "v${version}"; fetchSubmodules = true; - hash = "sha256-DRVFngQ4geJx2/7pT1VJzkcBZnVGgDvcGGUr9r38gSU="; + hash = "sha256-tWUdSFr93plCuQkA8SE+GZeAyZcYPUoFd0sIOyEuobs="; }; patches = [ @@ -94,13 +122,6 @@ stdenv.mkDerivation rec { url = "https://salsa.debian.org/debian/telegram-desktop/-/raw/09b363ed5a4fcd8ecc3282b9bfede5fbb83f97ef/debian/patches/Disable-register-custom-scheme.patch"; hash = "sha256-B8X5lnSpwwdp1HlvyXJWQPybEN+plOwimdV5gW6aY2Y="; }) - # lib_base: Add missing include for Qt 6.6 - (fetchpatch { - url = "https://github.com/desktop-app/lib_base/commit/5ca91dbb811c84591780236abc31431e313faf39.patch"; - stripLen = 1; - extraPrefix = "Telegram/lib_base/"; - hash = "sha256-eZkyMnPaAmUFYXiCmPhLRTw2Xdx0lylY+UVOckCsiaA="; - }) ]; postPatch = '' @@ -150,7 +171,7 @@ stdenv.mkDerivation rec { range-v3 tl-expected hunspell - glibmm_2_68 + glibmm webkitgtk_6_0 jemalloc rnnoise diff --git a/pkgs/applications/networking/instant-messengers/telegram/telegram-desktop/tg_owt.nix b/pkgs/applications/networking/instant-messengers/telegram/telegram-desktop/tg_owt.nix index 73437d73015f1..4853dc8b2cf2e 100644 --- a/pkgs/applications/networking/instant-messengers/telegram/telegram-desktop/tg_owt.nix +++ b/pkgs/applications/networking/instant-messengers/telegram/telegram-desktop/tg_owt.nix @@ -9,13 +9,13 @@ stdenv.mkDerivation { pname = "tg_owt"; - version = "unstable-2023-08-15"; + version = "unstable-2023-10-17"; src = fetchFromGitHub { owner = "desktop-app"; repo = "tg_owt"; - rev = "0532942ac6176a66ef184fb728a4cbb02958fc0b"; - sha256 = "sha256-FcRXxu0Nc8qHQl8PoA92MeuhpV+vgl658uILEpmDy3A="; + rev = "be153adaa363b2b13242466ad5b7b87f61301639"; + sha256 = "sha256-/hZNMV+IG00YzxH66Gh/BW9JdGFfsfnM93eD6oB3tlI="; fetchSubmodules = true; }; diff --git a/pkgs/applications/networking/seaweedfs/default.nix b/pkgs/applications/networking/seaweedfs/default.nix index e6e97bd0abeec..fe06e6a09a447 100644 --- a/pkgs/applications/networking/seaweedfs/default.nix +++ b/pkgs/applications/networking/seaweedfs/default.nix @@ -7,16 +7,16 @@ buildGoModule rec { pname = "seaweedfs"; - version = "3.55"; + version = "3.58"; src = fetchFromGitHub { owner = "seaweedfs"; repo = "seaweedfs"; rev = version; - hash = "sha256-qAyvGisj6GOjyRmqpTsxX/Zy8bx6+cAtmEId5us70+k="; + hash = "sha256-4USDCss2KYjyuwH55ZqMwBWsf7iDcjN7qxTSXvKDkus="; }; - vendorHash = "sha256-F6Fqv5tUsty/uGwBnKM4r671Gh2T1+9Z2LRGAMF+M2g="; + vendorHash = "sha256-cbc6xKAneBCWpc4kUQUtgV5rrsggCGvVkt9tkypeCiE="; subPackages = [ "weed" ]; diff --git a/pkgs/applications/networking/sync/rclone/default.nix b/pkgs/applications/networking/sync/rclone/default.nix index a86d80d9ae672..26343f6a76efc 100644 --- a/pkgs/applications/networking/sync/rclone/default.nix +++ b/pkgs/applications/networking/sync/rclone/default.nix @@ -63,6 +63,7 @@ buildGoModule rec { homepage = "https://rclone.org"; changelog = "https://github.com/rclone/rclone/blob/v${version}/docs/content/changelog.md"; license = licenses.mit; + mainProgram = "rclone"; maintainers = with maintainers; [ marsam SuperSandro2000 ]; }; } diff --git a/pkgs/applications/office/todoman/default.nix b/pkgs/applications/office/todoman/default.nix index 56c2219af67d0..f2940b1e3fb9b 100644 --- a/pkgs/applications/office/todoman/default.nix +++ b/pkgs/applications/office/todoman/default.nix @@ -5,29 +5,20 @@ , installShellFiles , jq , python3 -, fetchpatch }: python3.pkgs.buildPythonApplication rec { pname = "todoman"; - version = "4.3.2"; + version = "4.4.0"; format = "pyproject"; src = fetchFromGitHub { owner = "pimutils"; repo = pname; rev = "refs/tags/v${version}"; - hash = "sha256-dxyI9ypZZBouTUF72wzvi7j+CeoQ9JNSiXrVeV7ForY="; + hash = "sha256-5tQaNT6QVN9mxa9t6OvMux4ZGy4flUqszTAwet2QL0w="; }; - patches = [ - (fetchpatch { - name = "disable-broken-urwid-test.patch"; - url = "https://github.com/pimutils/todoman/commit/7ff0d2e2e69e24df5d66fecc58f8cd0b4e5ced6d.patch"; - hash = "sha256-MMNnnIthNqobexd8GaA6lYxzv5gr1l0e9YK+Ygeje2w="; - }) - ]; - SETUPTOOLS_SCM_PRETEND_VERSION = version; nativeBuildInputs = [ @@ -64,7 +55,7 @@ python3.pkgs.buildPythonApplication rec { postInstall = '' installShellCompletion --bash contrib/completion/bash/_todo - substituteInPlace contrib/completion/zsh/_todo --replace "jq " "${jq}/bin/jq " + substituteInPlace contrib/completion/zsh/_todo --replace "jq " "${lib.getExe jq} " installShellCompletion --zsh contrib/completion/zsh/_todo ''; @@ -85,7 +76,7 @@ python3.pkgs.buildPythonApplication rec { "todoman" ]; - meta = with lib; { + meta = { homepage = "https://github.com/pimutils/todoman"; description = "Standards-based task manager based on iCalendar"; longDescription = '' @@ -99,9 +90,9 @@ python3.pkgs.buildPythonApplication rec { now. Unsupported fields may not be shown but are never deleted or altered. ''; - changelog = "https://github.com/pimutils/todoman/raw/v${version}/CHANGELOG.rst"; - license = licenses.isc; - maintainers = with maintainers; [ leenaars antonmosich ]; + changelog = "https://todoman.readthedocs.io/en/stable/changelog.html#v${builtins.replaceStrings ["."] ["-"] version}"; + license = lib.licenses.isc; + maintainers = with lib.maintainers; [ leenaars antonmosich ]; mainProgram = "todo"; }; } diff --git a/pkgs/applications/radio/direwolf/default.nix b/pkgs/applications/radio/direwolf/default.nix index 321e78ce9138d..00b47c43eb039 100644 --- a/pkgs/applications/radio/direwolf/default.nix +++ b/pkgs/applications/radio/direwolf/default.nix @@ -17,13 +17,13 @@ stdenv.mkDerivation rec { pname = "direwolf"; - version = "1.6"; + version = "1.7"; src = fetchFromGitHub { owner = "wb2osz"; repo = "direwolf"; rev = version; - sha256 = "0xmz64m02knbrpasfij4rrq53ksxna5idxwgabcw4n2b1ig7pyx5"; + hash = "sha256-Vbxc6a6CK+wrBfs15dtjfRa1LJDKKyHMrg8tqsF7EX4="; }; patches = [ ./fix-strlcpy-usage.patch ]; diff --git a/pkgs/applications/radio/direwolf/fix-strlcpy-usage.patch b/pkgs/applications/radio/direwolf/fix-strlcpy-usage.patch index 9f43415114cbe..e4061b6287f9e 100644 --- a/pkgs/applications/radio/direwolf/fix-strlcpy-usage.patch +++ b/pkgs/applications/radio/direwolf/fix-strlcpy-usage.patch @@ -75,15 +75,15 @@ index ff18800..b1cb443 100644 -} - diff --git a/src/direwolf.h b/src/direwolf.h -index efc329b..22eb748 100644 +index 69b0952..6f9ec1a 100644 --- a/src/direwolf.h +++ b/src/direwolf.h -@@ -294,7 +294,7 @@ char *strcasestr(const char *S, const char *FIND); - #define HAVE_STRLCPY 1 +@@ -328,7 +328,7 @@ char *strcasestr(const char *S, const char *FIND); + #endif + #endif +-#define DEBUG_STRL 1 // Extra Debug version when using our own strlcpy, strlcat. ++#define DEBUG_STRL 0 // Extra Debug version when using our own strlcpy, strlcat. + // Should be ignored if not supplying our own. --#define DEBUG_STRL 1 -+#define DEBUG_STRL 0 - - #if DEBUG_STRL - + #ifndef HAVE_STRLCPY // Need to supply our own. diff --git a/pkgs/applications/radio/gqrx/default.nix b/pkgs/applications/radio/gqrx/default.nix index 5d47712f4426b..dc8df16838456 100644 --- a/pkgs/applications/radio/gqrx/default.nix +++ b/pkgs/applications/radio/gqrx/default.nix @@ -27,13 +27,13 @@ assert !(pulseaudioSupport && portaudioSupport); gnuradioMinimal.pkgs.mkDerivation rec { pname = "gqrx"; - version = "2.17.2"; + version = "2.17.3"; src = fetchFromGitHub { owner = "gqrx-sdr"; repo = "gqrx"; rev = "v${version}"; - hash = "sha256-dwqb/TYNkaXSLXQ0QJEQpy1es0hgNrkNnZww9RpfTt8="; + hash = "sha256-dHbDy/aIsqBQG1raeN9nM/QtiFgy+Qhoj/ThN8LV6gI="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/radio/sdrangel/default.nix b/pkgs/applications/radio/sdrangel/default.nix index f55371fd689ae..1a986b6b0d188 100644 --- a/pkgs/applications/radio/sdrangel/default.nix +++ b/pkgs/applications/radio/sdrangel/default.nix @@ -24,7 +24,7 @@ , libbladeRF , mbelib , ninja -, opencv3 +, opencv4 , pkg-config , qtcharts , qtdeclarative @@ -52,13 +52,13 @@ stdenv.mkDerivation (finalAttrs: { pname = "sdrangel"; - version = "7.16.0"; + version = "7.17.0"; src = fetchFromGitHub { owner = "f4exb"; repo = "sdrangel"; rev = "v${finalAttrs.version}"; - hash = "sha256-k35TZ2H8GX3gSYyb27hTY6gHHnxPkFwp1v4OJXhvV7A="; + hash = "sha256-v2ESMFAbsYbZVVIHlGCU01QPDorUZyLiUEhexr6zF5o="; }; nativeBuildInputs = [ @@ -90,7 +90,7 @@ stdenv.mkDerivation (finalAttrs: { libusb1 limesuite mbelib - opencv3 + opencv4 qtcharts qtdeclarative qtgamepad diff --git a/pkgs/applications/science/electronics/qucs-s/default.nix b/pkgs/applications/science/electronics/qucs-s/default.nix index 0ce67ec4dbb1c..593e9d9187b74 100644 --- a/pkgs/applications/science/electronics/qucs-s/default.nix +++ b/pkgs/applications/science/electronics/qucs-s/default.nix @@ -18,13 +18,13 @@ stdenv.mkDerivation rec { pname = "qucs-s"; - version = "2.0.0"; + version = "2.1.0"; src = fetchFromGitHub { owner = "ra3xdh"; repo = "qucs_s"; rev = version; - sha256 = "sha256-9/1sgxFqn9d9zlwrzjQosFO3m+2lC83qVcCtzfqY5XY="; + sha256 = "sha256-C7TLOuC0CHredDiWFIAFmOlV8ivX0j4bs3b8IB8FsqE="; }; nativeBuildInputs = [ flex bison wrapQtAppsHook cmake ]; diff --git a/pkgs/applications/science/logic/lean4/default.nix b/pkgs/applications/science/logic/lean4/default.nix index 12465ad9087f0..ecc929cb5f0e9 100644 --- a/pkgs/applications/science/logic/lean4/default.nix +++ b/pkgs/applications/science/logic/lean4/default.nix @@ -9,13 +9,13 @@ stdenv.mkDerivation rec { pname = "lean4"; - version = "4.1.0"; + version = "4.2.0"; src = fetchFromGitHub { owner = "leanprover"; repo = "lean4"; rev = "v${version}"; - hash = "sha256-6qbCafG0bL5KxQt2gL6hV4PFDsEMM0UXfldeOOqxsaE="; + hash = "sha256-56YtHCiNMP5fJoddSokEl0ws06IwetYLer4aLCnujZA="; }; postPatch = '' diff --git a/pkgs/applications/science/math/caffe/default.nix b/pkgs/applications/science/math/caffe/default.nix index 5af927294d6ca..42c160393595b 100644 --- a/pkgs/applications/science/math/caffe/default.nix +++ b/pkgs/applications/science/math/caffe/default.nix @@ -1,12 +1,13 @@ { config, stdenv, lib , fetchFromGitHub , fetchurl +, fetchpatch , cmake , boost , gflags , glog , hdf5-cpp -, opencv3 +, opencv4 , protobuf , doxygen , blas @@ -71,7 +72,7 @@ stdenv.mkDerivation rec { ++ ["-DUSE_LEVELDB=${toggle leveldbSupport}"] ++ ["-DUSE_LMDB=${toggle lmdbSupport}"]; - buildInputs = [ boost gflags glog protobuf hdf5-cpp opencv3 blas ] + buildInputs = [ boost gflags glog protobuf hdf5-cpp opencv4 blas ] ++ lib.optional cudaSupport cudatoolkit ++ lib.optional cudnnSupport cudnn ++ lib.optional lmdbSupport lmdb @@ -96,6 +97,11 @@ stdenv.mkDerivation rec { patches = [ ./darwin.patch + (fetchpatch { + name = "support-opencv4"; + url = "https://github.com/BVLC/caffe/pull/6638/commits/0a04cc2ccd37ba36843c18fea2d5cbae6e7dd2b5.patch"; + hash = "sha256-ZegTvp0tTHlopQv+UzHDigs6XLkP2VfqLCWXl6aKJSI="; + }) ] ++ lib.optional pythonSupport (substituteAll { src = ./python.patch; inherit (python.sourceVersion) major minor; # Should be changed in case of PyPy @@ -148,7 +154,7 @@ stdenv.mkDerivation rec { ''; homepage = "http://caffe.berkeleyvision.org/"; maintainers = with maintainers; [ ]; - broken = pythonSupport && (python.isPy310); + broken = (pythonSupport && (python.isPy310)) || cudaSupport; license = licenses.bsd2; platforms = platforms.linux ++ platforms.darwin; }; diff --git a/pkgs/applications/science/math/clp/default.nix b/pkgs/applications/science/math/clp/default.nix index c7d19f044d650..52a74ff3979c4 100644 --- a/pkgs/applications/science/math/clp/default.nix +++ b/pkgs/applications/science/math/clp/default.nix @@ -1,13 +1,13 @@ { lib, stdenv, fetchFromGitHub, pkg-config, coin-utils, zlib, osi }: stdenv.mkDerivation rec { - version = "1.17.8"; + version = "1.17.9"; pname = "clp"; src = fetchFromGitHub { owner = "coin-or"; repo = "Clp"; rev = "releases/${version}"; - hash = "sha256-3Z6ysoCcDVB8UePiwbZNqvO/o/jgPcv6XFkpJZBK+Os="; + hash = "sha256-kHCDji+yIf5mCoxKB2b/HaATGmwwIAPEV74tthIMeMY="; }; nativeBuildInputs = [ pkg-config ]; diff --git a/pkgs/applications/science/math/mxnet/default.nix b/pkgs/applications/science/math/mxnet/default.nix index d65de87d8eb9a..993da2b898981 100644 --- a/pkgs/applications/science/math/mxnet/default.nix +++ b/pkgs/applications/science/math/mxnet/default.nix @@ -1,5 +1,5 @@ { config, stdenv, lib, fetchurl, fetchpatch, bash, cmake -, opencv3, gtest, blas, gomp, llvmPackages, perl +, opencv4, gtest, blas, gomp, llvmPackages, perl , cudaSupport ? config.cudaSupport, cudaPackages ? { }, nvidia_x11 , cudnnSupport ? cudaSupport }: @@ -37,7 +37,7 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ cmake perl ]; - buildInputs = [ opencv3 gtest blas.provider ] + buildInputs = [ opencv4 gtest blas.provider ] ++ lib.optional stdenv.cc.isGNU gomp ++ lib.optional stdenv.cc.isClang llvmPackages.openmp # FIXME: when cuda build is fixed, remove nvidia_x11, and use /run/opengl-driver/lib diff --git a/pkgs/applications/version-management/git-cliff/default.nix b/pkgs/applications/version-management/git-cliff/default.nix index 5e82daa496fd3..7a1179dba3015 100644 --- a/pkgs/applications/version-management/git-cliff/default.nix +++ b/pkgs/applications/version-management/git-cliff/default.nix @@ -7,16 +7,16 @@ rustPlatform.buildRustPackage rec { pname = "git-cliff"; - version = "1.3.1"; + version = "1.4.0"; src = fetchFromGitHub { owner = "orhun"; repo = "git-cliff"; rev = "v${version}"; - hash = "sha256-DzlCy8Y3OW3FiXO45wuUh3t87Za2jWQ4rnztZGRySYA="; + hash = "sha256-OK2eoWlqlpf/X8EGMnWTv9Gs5FkYvW5rmQDB/Mkbp60="; }; - cargoHash = "sha256-+XyZqxjiOAIyc+FmnexIdV1RMzc+iqmo8nPahzUo43E="; + cargoHash = "sha256-gtkpZKOaG5p79uJ9cbbGdiOX57bDFTf2/Bd8+WToJrw="; # attempts to run the program on .git in src which is not deterministic doCheck = false; diff --git a/pkgs/applications/version-management/git-mit/default.nix b/pkgs/applications/version-management/git-mit/default.nix index ad9ae30cda5ae..a7ab4f7e9900b 100644 --- a/pkgs/applications/version-management/git-mit/default.nix +++ b/pkgs/applications/version-management/git-mit/default.nix @@ -10,7 +10,7 @@ }: let - version = "5.12.167"; + version = "5.12.169"; in rustPlatform.buildRustPackage { pname = "git-mit"; @@ -20,10 +20,10 @@ rustPlatform.buildRustPackage { owner = "PurpleBooth"; repo = "git-mit"; rev = "v${version}"; - hash = "sha256-tselj673Zkur0IAuOt0l/RffJiA6x2PYkdV+dCrNx+M="; + hash = "sha256-+PBZZhWTm+as6eZjPq+dsUVBOIPN2qvj3zoqN2+xEmA="; }; - cargoHash = "sha256-t2u8umPy8fJLjbUEpkufE96n+FXcV0ZCVYrK0lNBhHA="; + cargoHash = "sha256-TQR9yAV4aYuMH36hvx7y47403V7h54yCed44heSkMd8="; nativeBuildInputs = [ pkg-config ]; diff --git a/pkgs/applications/video/freetube/default.nix b/pkgs/applications/video/freetube/default.nix index 75f3cc910953a..a3fd87e6142ea 100644 --- a/pkgs/applications/video/freetube/default.nix +++ b/pkgs/applications/video/freetube/default.nix @@ -1,4 +1,4 @@ -{ stdenv, lib, fetchurl, appimageTools, makeWrapper, electron_22 }: +{ stdenv, lib, fetchurl, appimageTools, makeWrapper, electron, nixosTests }: stdenv.mkDerivation rec { pname = "freetube"; @@ -9,6 +9,8 @@ stdenv.mkDerivation rec { sha256 = "add96ad3509d4d5c6d8658b005dfd046963cd6bb0a4e1f3e88f726a86c05810f"; }; + passthru.tests = nixosTests.freetube; + appimageContents = appimageTools.extractType2 { name = "${pname}-${version}"; inherit src; @@ -35,9 +37,8 @@ stdenv.mkDerivation rec { runHook postInstall ''; - # Electron version is set to 22 in order to match upstream postFixup = '' - makeWrapper ${electron_22}/bin/electron $out/bin/${pname} \ + makeWrapper ${electron}/bin/electron $out/bin/${pname} \ --add-flags $out/share/${pname}/resources/app.asar ''; @@ -46,6 +47,6 @@ stdenv.mkDerivation rec { homepage = "https://freetubeapp.io/"; license = licenses.agpl3Only; maintainers = with maintainers; [ ryneeverett alyaeanyx ]; - inherit (electron_22.meta) platforms; + inherit (electron.meta) platforms; }; } diff --git a/pkgs/applications/video/kodi/addons/arteplussept/default.nix b/pkgs/applications/video/kodi/addons/arteplussept/default.nix index 9334dbfa28324..1bc68436decc3 100644 --- a/pkgs/applications/video/kodi/addons/arteplussept/default.nix +++ b/pkgs/applications/video/kodi/addons/arteplussept/default.nix @@ -3,11 +3,11 @@ buildKodiAddon rec { pname = "arteplussept"; namespace = "plugin.video.arteplussept"; - version = "1.4.0"; + version = "1.4.1"; src = fetchzip { url = "https://mirrors.kodi.tv/addons/nexus/${namespace}/${namespace}-${version}.zip"; - hash = "sha256-m7DHQVg0pcLGCHTdecCTGfanUWhuPMHdllbg+47hxEI="; + hash = "sha256-4lPJIFBF4zXr1bEyv9tVUPXw9JFt2by/tcOwihib6aQ="; }; propagatedBuildInputs = [ diff --git a/pkgs/applications/video/kodi/addons/radioparadise/default.nix b/pkgs/applications/video/kodi/addons/radioparadise/default.nix new file mode 100644 index 0000000000000..3100325ddd20c --- /dev/null +++ b/pkgs/applications/video/kodi/addons/radioparadise/default.nix @@ -0,0 +1,30 @@ +{ lib, buildKodiAddon, fetchzip, addonUpdateScript, requests }: + +buildKodiAddon rec { + pname = "radioparadise"; + namespace = "script.radioparadise"; + version = "1.0.5"; + + src = fetchzip { + url = "https://mirrors.kodi.tv/addons/nexus/script.radioparadise/script.radioparadise-${version}.zip"; + sha256 = "sha256-/X/8Q741piNHue5i/kgV+UYpBECyGzkFuN+PUzdeQnA="; + }; + + propagatedBuildInputs = [ + requests + ]; + + passthru = { + pythonPath = "resources/lib"; + updateScript = addonUpdateScript { + attrPath = "kodi.packages.radioparadise"; + }; + }; + + meta = with lib; { + homepage = "https://github.com/alxndr42/script.radioparadise"; + description = "Radio Paradise addon for Kodi"; + license = licenses.gpl3Plus; + maintainers = teams.kodi.members; + }; +} diff --git a/pkgs/applications/video/kodi/addons/somafm/default.nix b/pkgs/applications/video/kodi/addons/somafm/default.nix new file mode 100644 index 0000000000000..4ffc69791298b --- /dev/null +++ b/pkgs/applications/video/kodi/addons/somafm/default.nix @@ -0,0 +1,26 @@ +{ lib, buildKodiAddon, fetchzip, addonUpdateScript }: + +buildKodiAddon rec { + pname = "somafm"; + namespace = "plugin.audio.somafm"; + version = "2.0.1"; + + src = fetchzip { + url = "https://mirrors.kodi.tv/addons/nexus/plugin.audio.somafm/plugin.audio.somafm-${version}.zip"; + sha256 = "sha256-auPLm7QFabU4tXJPjTl17KpE+lqWM2Edbd2HrXPRx40="; + }; + + passthru = { + pythonPath = "resources/lib"; + updateScript = addonUpdateScript { + attrPath = "kodi.packages.somafm"; + }; + }; + + meta = with lib; { + homepage = "https://github.com/Soma-FM-Kodi-Add-On/plugin.audio.somafm"; + description = "SomaFM addon for Kodi"; + license = licenses.gpl3Plus; + maintainers = teams.kodi.members; + }; +} diff --git a/pkgs/applications/video/qmplay2/default.nix b/pkgs/applications/video/qmplay2/default.nix index e78472ee29c15..b6b577790cfb6 100644 --- a/pkgs/applications/video/qmplay2/default.nix +++ b/pkgs/applications/video/qmplay2/default.nix @@ -26,14 +26,14 @@ stdenv.mkDerivation (finalAttrs: { pname = "qmplay2"; - version = "23.08.22"; + version = "23.10.22"; src = fetchFromGitHub { owner = "zaps166"; repo = "QMPlay2"; rev = finalAttrs.version; fetchSubmodules = true; - hash = "sha256-Ug7WAqZ+BxspQUXweL/OnVBGCsU60DOWNexbi0GpDo0="; + hash = "sha256-yDymUXuILgT4AFTt302GniPi/WNwrTCOuOfdUiKOIyk="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/video/smplayer/default.nix b/pkgs/applications/video/smplayer/default.nix index ba7992b974683..8cd967606041e 100644 --- a/pkgs/applications/video/smplayer/default.nix +++ b/pkgs/applications/video/smplayer/default.nix @@ -8,13 +8,13 @@ stdenv.mkDerivation (finalAttrs: { pname = "smplayer"; - version = "23.6.0"; + version = "23.6.0.10170"; src = fetchFromGitHub { owner = "smplayer-dev"; repo = "smplayer"; rev = "v${finalAttrs.version}"; - hash = "sha256-xGy6/9aUftBTSo9HJ3zyuRSagqimP9XvXKP/4oBQTo4="; + hash = "sha256-ByheWIXvCw9jL3lY63oRzRZhl0jZz4jr+rw5Wi7Mm8w="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/virtualization/crun/default.nix b/pkgs/applications/virtualization/crun/default.nix index 74fa6e225638a..f5f10c6825063 100644 --- a/pkgs/applications/virtualization/crun/default.nix +++ b/pkgs/applications/virtualization/crun/default.nix @@ -39,13 +39,13 @@ let in stdenv.mkDerivation rec { pname = "crun"; - version = "1.10"; + version = "1.11"; src = fetchFromGitHub { owner = "containers"; repo = pname; rev = version; - hash = "sha256-deva/IPyjcGGAnUIofev3RV2ia7uI+OgSiUz/GtHhxE="; + hash = "sha256-38IqVt/XZeZQRXjiPNz4qDibBHMBVZwzAcxrobzEWdI="; fetchSubmodules = true; }; diff --git a/pkgs/applications/window-managers/hyprwm/hyprpicker/default.nix b/pkgs/applications/window-managers/hyprwm/hyprpicker/default.nix index 17f53883424c5..8761d615c0306 100644 --- a/pkgs/applications/window-managers/hyprwm/hyprpicker/default.nix +++ b/pkgs/applications/window-managers/hyprwm/hyprpicker/default.nix @@ -91,5 +91,6 @@ stdenv.mkDerivation (finalAttrs: { license = licenses.bsd3; maintainers = with maintainers; [ fufexan ]; platforms = wayland.meta.platforms; + mainProgram = "hyprpicker"; }; }) diff --git a/pkgs/build-support/rust/build-rust-crate/build-crate.nix b/pkgs/build-support/rust/build-rust-crate/build-crate.nix index 37bf3ec26f770..944434472b0b8 100644 --- a/pkgs/build-support/rust/build-rust-crate/build-crate.nix +++ b/pkgs/build-support/rust/build-rust-crate/build-crate.nix @@ -41,6 +41,7 @@ ); binRustcOpts = lib.concatStringsSep " " ( + [ "-C linker=${stdenv.cc}/bin/${stdenv.cc.targetPrefix}cc" ] ++ baseRustcOpts ); diff --git a/pkgs/by-name/ce/certspotter/package.nix b/pkgs/by-name/ce/certspotter/package.nix new file mode 100644 index 0000000000000..53909d61786fa --- /dev/null +++ b/pkgs/by-name/ce/certspotter/package.nix @@ -0,0 +1,39 @@ +{ lib +, fetchFromGitHub +, buildGoModule +, lowdown +}: + +buildGoModule rec { + pname = "certspotter"; + version = "0.17.0"; + + src = fetchFromGitHub { + owner = "SSLMate"; + repo = "certspotter"; + rev = "v${version}"; + hash = "sha256-6ghS+9b8FZiYdiTk54XRHP46lOq98sN1RDYvRYTt6eU="; + }; + + vendorHash = "sha256-6dV9FoPV8UfS0z5RuuopE99fHcT3RAWCdDi7jpHzVRE="; + + ldflags = [ "-s" "-w" ]; + + nativeBuildInputs = [ lowdown ]; + + postInstall = '' + cd man + make + mkdir -p $out/share/man/man8 + mv *.8 $out/share/man/man8 + ''; + + meta = with lib; { + description = "Certificate Transparency Log Monitor"; + homepage = "https://github.com/SSLMate/certspotter"; + changelog = "https://github.com/SSLMate/certspotter/blob/${src.rev}/CHANGELOG.md"; + license = licenses.mpl20; + mainProgram = "certspotter"; + maintainers = with maintainers; [ chayleaf ]; + }; +} diff --git a/pkgs/by-name/gu/guile-disarchive/package.nix b/pkgs/by-name/di/disarchive/package.nix index f01047db34c52..9bc24e531552d 100644 --- a/pkgs/by-name/gu/guile-disarchive/package.nix +++ b/pkgs/by-name/di/disarchive/package.nix @@ -6,12 +6,13 @@ , guile-gcrypt , guile-lzma , guile-quickcheck +, makeWrapper , pkg-config , zlib }: stdenv.mkDerivation rec { - pname = "guile-disarchive"; + pname = "disarchive"; version = "0.5.0"; src = fetchurl { @@ -24,7 +25,9 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ autoreconfHook guile + guile-gcrypt guile-lzma + makeWrapper pkg-config ]; @@ -38,14 +41,23 @@ stdenv.mkDerivation rec { guile-lzma ]; - nativeCheckInputs = [ guile-quickcheck ]; - doCheck = !stdenv.isDarwin; + nativeCheckInputs = [ + guile-quickcheck + ]; + + postInstall = '' + wrapProgram $out/bin/disarchive \ + --prefix GUILE_LOAD_PATH : "$out/${guile.siteDir}:$GUILE_LOAD_PATH" \ + --prefix GUILE_LOAD_COMPILED_PATH : "$out/${guile.siteCcacheDir}:$GUILE_LOAD_COMPILED_PATH" + ''; + meta = with lib; { description = "Disassemble software into data and metadata"; homepage = "https://ngyro.com/software/disarchive.html"; license = licenses.gpl3Plus; + mainProgram = "disarchive"; maintainers = with maintainers; [ foo-dogsquared ]; platforms = guile.meta.platforms; }; diff --git a/pkgs/by-name/fc/fcitx5-material-color/package.nix b/pkgs/by-name/fc/fcitx5-material-color/package.nix new file mode 100644 index 0000000000000..0385c33e7045d --- /dev/null +++ b/pkgs/by-name/fc/fcitx5-material-color/package.nix @@ -0,0 +1,41 @@ +{ stdenvNoCC +, fetchFromGitHub +, lib +}: + +stdenvNoCC.mkDerivation (finalAttrs: { + pname = "fcitx5-material-color"; + version = "0.2.1"; + + src = fetchFromGitHub { + owner = "hosxy"; + repo = "Fcitx5-Material-Color"; + rev = finalAttrs.version; + hash = "sha256-i9JHIJ+cHLTBZUNzj9Ujl3LIdkCllTWpO1Ta4OT1LTc="; + }; + + installPhase = '' + runHook preInstall + + # https://gitlab.archlinux.org/archlinux/packaging/packages/fcitx5-material-color/-/blob/main/PKGBUILD?ref_type=heads#L16 + install -Dm644 arrow.png radio.png -t $out/share/${finalAttrs.pname}/ + for _variant in black blue brown deepPurple indigo orange pink red sakuraPink teal; do + _variant_name=Material-Color-$_variant + install -dm755 $_variant_name $out/share/fcitx5/themes/$_variant_name + ln -sv ../../../$pname/arrow.png $out/share/fcitx5/themes/$_variant_name/ + ln -sv ../../../$pname/radio.png $out/share/fcitx5/themes/$_variant_name/ + install -Dm644 theme-$_variant.conf $out/share/fcitx5/themes/$_variant_name/theme.conf + sed -i "s/^Name=.*/Name=$_variant_name/" $out/share/fcitx5/themes/$_variant_name/theme.conf + done + + runHook postInstall + ''; + + meta = with lib; { + description = "Fcitx5 themes based on Material color"; + homepage = "https://github.com/hosxy/Fcitx5-Material-Color"; + license = licenses.asl20; + maintainers = with maintainers; [ Cryolitia h7x4 ]; + platforms = platforms.all; + }; +}) diff --git a/pkgs/by-name/fc/fcitx5-nord/package.nix b/pkgs/by-name/fc/fcitx5-nord/package.nix new file mode 100644 index 0000000000000..6ab7fc15f0a20 --- /dev/null +++ b/pkgs/by-name/fc/fcitx5-nord/package.nix @@ -0,0 +1,33 @@ +{ stdenvNoCC +, fetchFromGitHub +, lib +}: + +stdenvNoCC.mkDerivation { + pname = "fcitx5-nord"; + version = "unstable-2021-07-27"; + + src = fetchFromGitHub { + owner = "tonyfettes"; + repo = "fcitx5-nord"; + rev = "bdaa8fb723b8d0b22f237c9a60195c5f9c9d74d1"; + hash = "sha256-qVo/0ivZ5gfUP17G29CAW0MrRFUO0KN1ADl1I/rvchE="; + }; + + installPhase = '' + runHook preInstall + + mkdir -pv $out/share/fcitx5/themes/ + cp -rv Nord* $out/share/fcitx5/themes/ + + runHook postInstall + ''; + + meta = with lib; { + description = "Fcitx5 theme based on Nord color"; + homepage = "https://github.com/tonyfettes/fcitx5-nord"; + license = licenses.mit; + maintainers = with maintainers; [ Cryolitia ]; + platforms = platforms.all; + }; +} diff --git a/pkgs/by-name/gu/guix/package.nix b/pkgs/by-name/gu/guix/package.nix index 5d45033b72fcd..e20a969f8347d 100644 --- a/pkgs/by-name/gu/guix/package.nix +++ b/pkgs/by-name/gu/guix/package.nix @@ -2,11 +2,11 @@ , stdenv , fetchurl , autoreconfHook +, disarchive , git , glibcLocales , guile , guile-avahi -, guile-disarchive , guile-gcrypt , guile-git , guile-gnutls @@ -49,11 +49,11 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ autoreconfHook + disarchive git glibcLocales guile guile-avahi - guile-disarchive guile-gcrypt guile-git guile-gnutls @@ -82,8 +82,8 @@ stdenv.mkDerivation rec { ]; propagatedBuildInputs = [ + disarchive guile-avahi - guile-disarchive guile-gcrypt guile-git guile-gnutls diff --git a/pkgs/development/libraries/jasper/default.nix b/pkgs/by-name/ja/jasper/package.nix index 2df3e554c9b61..4e10eaa80ad83 100644 --- a/pkgs/development/libraries/jasper/default.nix +++ b/pkgs/by-name/ja/jasper/package.nix @@ -5,15 +5,15 @@ , pkg-config }: -stdenv.mkDerivation rec { +stdenv.mkDerivation (finalAttrs: { pname = "jasper"; - version = "2.0.32"; + version = "4.0.0"; src = fetchFromGitHub { owner = "jasper-software"; - repo = pname; - rev = "version-${version}"; - hash = "sha256-Uwgtex0MWC/pOmEr8itHMIa4wxd97c/tsTzcLgV8D0I="; + repo = "jasper"; + rev = "version-${finalAttrs.version}"; + hash = "sha256-v/AFx40JWdbTCa008tDz/n9cXgpAkKv4rSiGJ8yx1YQ="; }; nativeBuildInputs = [ @@ -21,7 +21,11 @@ stdenv.mkDerivation rec { pkg-config ]; - meta = with lib; { + cmakeBuildDir = "build-directory"; + + strictDeps = true; + + meta = { homepage = "https://jasper-software.github.io/jasper/"; description = "Image processing/coding toolkit"; longDescription = '' @@ -41,8 +45,8 @@ stdenv.mkDerivation rec { was chosen primarily due to the availability of C development environments for most computing platforms when JasPer was first developed, circa 1999. ''; - license = licenses.free; # MIT-like - maintainers = with maintainers; [ AndersonTorres ]; - platforms = platforms.unix; + license = lib.licenses.mit; + maintainers = with lib.maintainers; [ AndersonTorres ]; + platforms = lib.platforms.unix; }; -} +}) diff --git a/pkgs/by-name/la/lanzaboote-tool/package.nix b/pkgs/by-name/la/lanzaboote-tool/package.nix new file mode 100644 index 0000000000000..919ab7d68f2ce --- /dev/null +++ b/pkgs/by-name/la/lanzaboote-tool/package.nix @@ -0,0 +1,55 @@ +{ systemd +, stdenv +, makeWrapper +, binutils-unwrapped +, sbsigntool +, rustPlatform +, fetchFromGitHub +, lib +}: +rustPlatform.buildRustPackage rec { + pname = "lanzaboote-tool"; + version = "0.3.0"; + + src = fetchFromGitHub { + owner = "nix-community"; + repo = "lanzaboote"; + rev = "v${version}"; + hash = "sha256-Fb5TeRTdvUlo/5Yi2d+FC8a6KoRLk2h1VE0/peMhWPs="; + }; + + sourceRoot = "source/rust/tool"; + cargoHash = "sha256-g4WzqfH6DZVUuNb0jV3MFdm3h7zy2bQ6d3agrXesWgc="; + + env.TEST_SYSTEMD = systemd; + doCheck = lib.meta.availableOn stdenv.hostPlatform systemd; + + nativeBuildInputs = [ + makeWrapper + ]; + + postInstall = '' + # Clean PATH to only contain what we need to do objcopy. + # This is still an unwrapped lanzaboote tool lacking of the + # UEFI stub location. + mv $out/bin/lzbt $out/bin/lzbt-unwrapped + wrapProgram $out/bin/lzbt-unwrapped \ + --set PATH ${lib.makeBinPath [ binutils-unwrapped sbsigntool ]} + ''; + + nativeCheckInputs = [ + binutils-unwrapped + sbsigntool + ]; + + meta = with lib; { + description = "Lanzaboote UEFI tooling for SecureBoot enablement on NixOS systems"; + homepage = "https://github.com/nix-community/lanzaboote"; + license = licenses.gpl3Only; + mainProgram = "lzbt"; + maintainers = with maintainers; [ raitobezarius nikstur ]; + # Broken on aarch64-linux and any other architecture for now. + # Wait for 0.4.0. + platforms = [ "x86_64-linux" "i686-linux" ]; + }; +} diff --git a/pkgs/by-name/mo/monophony/package.nix b/pkgs/by-name/mo/monophony/package.nix new file mode 100644 index 0000000000000..eecbbca3b3f20 --- /dev/null +++ b/pkgs/by-name/mo/monophony/package.nix @@ -0,0 +1,71 @@ +{ lib +, fetchFromGitLab +, python3Packages +, wrapGAppsHook4 +, gst_all_1 +, gobject-introspection +, yt-dlp +, libadwaita +, libsoup_3 +, glib-networking +}: +python3Packages.buildPythonApplication rec { + pname = "monophony"; + version = "2.3.1"; + format = "other"; + + sourceRoot = "source/source"; + src = fetchFromGitLab { + owner = "zehkira"; + repo = "monophony"; + rev = "v${version}"; + hash = "sha256-dpRTHsujaIwzgr+qY5LC9xtXz40g3akdpEiHuxiilZM="; + }; + + pythonPath = with python3Packages; [ + mpris-server + pygobject3 + ytmusicapi + ]; + + nativeBuildInputs = [ + python3Packages.nuitka + gobject-introspection + wrapGAppsHook4 + ]; + + buildInputs = + [ + libadwaita + # needed for gstreamer https + libsoup_3 + glib-networking + ] + ++ (with gst_all_1; [ + gst-plugins-base + gst-plugins-good + gstreamer + ]); + + installFlags = [ "prefix=$(out)" ]; + + preFixup = '' + buildPythonPath "$pythonPath" + gappsWrapperArgs+=( + --prefix PYTHONPATH : "$program_PYTHONPATH" + --prefix PATH : "${lib.makeBinPath [yt-dlp]}" + # needed for gstreamer https + --prefix LD_LIBRARY_PATH : "${libsoup_3.out}/lib" + ) + ''; + + meta = with lib; { + homepage = "https://gitlab.com/zehkira/monophony"; + description = "Linux app for streaming music from YouTube"; + longDescription = "Monophony is a free and open source Linux app for streaming music from YouTube. It has no ads and does not require an account."; + license = licenses.agpl3Plus; + mainProgram = "monophony"; + platforms = platforms.linux; + maintainers = with maintainers; [ quadradical ]; + }; +} diff --git a/pkgs/by-name/my/mystmd/package.nix b/pkgs/by-name/my/mystmd/package.nix index 5bf90c7d90cd7..85810054da076 100644 --- a/pkgs/by-name/my/mystmd/package.nix +++ b/pkgs/by-name/my/mystmd/package.nix @@ -1,17 +1,17 @@ -{ lib, buildNpmPackage, fetchFromGitHub }: +{ lib, buildNpmPackage, fetchFromGitHub, mystmd, testers }: buildNpmPackage rec { pname = "mystmd"; - version = "1.1.22"; + version = "1.1.23"; src = fetchFromGitHub { owner = "executablebooks"; repo = "mystmd"; rev = "mystmd@${version}"; - hash = "sha256-jx/UCC/Cl5kqAbMzeikTmrx9xWS02OCp3rn0pvtIAPY="; + hash = "sha256-+zgAm3v7XcNhhVOFueRqJijteQqMCZmE33hDyR4d5bA="; }; - npmDepsHash = "sha256-1qQ19iB7N+KvO1uUdEMU1iN91FMQs4wzfTCdv6wfn30="; + npmDepsHash = "sha256-8brgDSV0BBggYUnizV+24RQMXxPd6HUBDYrw9fJtL+M="; dontNpmInstall = true; @@ -23,6 +23,11 @@ buildNpmPackage rec { runHook postInstall ''; + passthru.tests.version = testers.testVersion { + package = mystmd; + version = "v${version}"; + }; + meta = with lib; { description = "Command line tools for working with MyST Markdown"; homepage = "https://github.com/executablebooks/mystmd"; diff --git a/pkgs/applications/office/pyspread/default.nix b/pkgs/by-name/py/pyspread/package.nix index 61a4c7694b754..43aa9b304f036 100644 --- a/pkgs/applications/office/pyspread/default.nix +++ b/pkgs/by-name/py/pyspread/package.nix @@ -2,19 +2,24 @@ , python3 , fetchPypi , copyDesktopItems -, wrapQtAppsHook -, qtsvg +, libsForQt5 , makeDesktopItem }: -python3.pkgs.buildPythonApplication rec { +let + # get rid of rec pname = "pyspread"; - version = "2.0.2"; - + version = "2.2.2"; src = fetchPypi { inherit pname version; - hash = "sha256-rg2T9Y9FU2a+aWg0XM8jyQB9t8zDVlpad3TjUcx4//8="; + hash = "sha256-vbBu/dMXQf14F7qWvyHX5T8/AkjeZhaQt1eQ6Nidpsc="; }; + inherit (libsForQt5) + qtsvg + wrapQtAppsHook; +in +python3.pkgs.buildPythonApplication { + inherit pname version src; nativeBuildInputs = [ copyDesktopItems @@ -35,18 +40,20 @@ python3.pkgs.buildPythonApplication rec { setuptools ]; + strictDeps = true; + doCheck = false; # it fails miserably with a core dump pythonImportsCheck = [ "pyspread" ]; desktopItems = [ - (makeDesktopItem rec { - name = pname; - exec = name; - icon = name; + (makeDesktopItem { + name = "pyspread"; + exec = "pyspread"; + icon = "pyspread"; desktopName = "Pyspread"; genericName = "Spreadsheet"; - comment = meta.description; + comment = "A Python-oriented spreadsheet application"; categories = [ "Office" "Development" "Spreadsheet" ]; }) ]; @@ -55,7 +62,7 @@ python3.pkgs.buildPythonApplication rec { makeWrapperArgs+=("''${qtWrapperArgs[@]}") ''; - meta = with lib; { + meta = { homepage = "https://pyspread.gitlab.io/"; description = "A Python-oriented spreadsheet application"; longDescription = '' @@ -68,8 +75,8 @@ python3.pkgs.buildPythonApplication rec { that can be accessed from other cells. These objects can represent anything including lists or matrices. ''; - license = with licenses; gpl3Plus; - maintainers = with maintainers; [ AndersonTorres ]; - platforms = with platforms; all; + license = with lib.licenses; [ gpl3Plus ]; + mainProgram = "pyspread"; + maintainers = with lib.maintainers; [ AndersonTorres ]; }; } diff --git a/pkgs/by-name/sv/svix-server/Cargo.lock b/pkgs/by-name/sv/svix-server/Cargo.lock new file mode 100644 index 0000000000000..2510e29c9d44f --- /dev/null +++ b/pkgs/by-name/sv/svix-server/Cargo.lock @@ -0,0 +1,5198 @@ +# This file is automatically @generated by Cargo. +# It is not intended for manual editing. +version = 3 + +[[package]] +name = "addr2line" +version = "0.20.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f4fa78e18c64fce05e902adecd7a5eed15a5e0a3439f7b0e169f0252214865e3" +dependencies = [ + "gimli", +] + +[[package]] +name = "adler" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f26201604c87b1e01bd3d98f8d5d9a8fcbb815e8cedb41ffccbeb4bf593a35fe" + +[[package]] +name = "aead" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0b613b8e1e3cf911a086f53f03bf286f52fd7a7258e4fa606f0ef220d39d8877" +dependencies = [ + "generic-array", +] + +[[package]] +name = "ahash" +version = "0.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2c99f64d1e06488f620f932677e24bc6e2897582980441ae90a671415bd7ec2f" +dependencies = [ + "cfg-if", + "getrandom", + "once_cell", + "serde", + "version_check", +] + +[[package]] +name = "aho-corasick" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "43f6cb1bf222025340178f382c426f13757b2960e89779dfcb319c32542a5a41" +dependencies = [ + "memchr", +] + +[[package]] +name = "aide" +version = "0.10.0" +source = "git+https://github.com/svix/aide?rev=e6e9af3#e6e9af320757130074ca9cd537d342b5496d527d" +dependencies = [ + "aide-macros", + "axum", + "bytes", + "cfg-if", + "http", + "indexmap 1.9.3", + "schemars", + "serde", + "serde_json", + "serde_qs", + "thiserror", + "tower-layer", + "tower-service", + "tracing", +] + +[[package]] +name = "aide-macros" +version = "0.6.0" +source = "git+https://github.com/svix/aide?rev=e6e9af3#e6e9af320757130074ca9cd537d342b5496d527d" +dependencies = [ + "darling", + "proc-macro2", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "aliasable" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "250f629c0161ad8107cf89319e990051fae62832fd343083bea452d93e2205fd" + +[[package]] +name = "allocator-api2" +version = "0.2.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0942ffc6dcaadf03badf6e6a2d0228460359d5e34b57ccdc720b7382dfbd5ec5" + +[[package]] +name = "amq-protocol" +version = "7.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d40d8b2465c7959dd40cee32ba6ac334b5de57e9fca0cc756759894a4152a5d" +dependencies = [ + "amq-protocol-tcp", + "amq-protocol-types", + "amq-protocol-uri", + "cookie-factory", + "nom", + "serde", +] + +[[package]] +name = "amq-protocol-tcp" +version = "7.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9cb2100adae7da61953a2c3a01935d86caae13329fadce3333f524d6d6ce12e2" +dependencies = [ + "amq-protocol-uri", + "tcp-stream", + "tracing", +] + +[[package]] +name = "amq-protocol-types" +version = "7.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "156ff13c8a3ced600b4e54ed826a2ae6242b6069d00dd98466827cef07d3daff" +dependencies = [ + "cookie-factory", + "nom", + "serde", + "serde_json", +] + +[[package]] +name = "amq-protocol-uri" +version = "7.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "751bbd7d440576066233e740576f1b31fdc6ab86cfabfbd48c548de77eca73e4" +dependencies = [ + "amq-protocol-types", + "percent-encoding", + "url", +] + +[[package]] +name = "android-tzdata" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e999941b234f3131b00bc13c22d06e8c5ff726d1b6318ac7eb276997bbb4fef0" + +[[package]] +name = "android_system_properties" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "819e7219dbd41043ac279b19830f2efc897156490d7fd6ea916720117ee66311" +dependencies = [ + "libc", +] + +[[package]] +name = "anstream" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0ca84f3628370c59db74ee214b3263d58f9aadd9b4fe7e711fd87dc452b7f163" +dependencies = [ + "anstyle", + "anstyle-parse", + "anstyle-query", + "anstyle-wincon", + "colorchoice", + "is-terminal", + "utf8parse", +] + +[[package]] +name = "anstyle" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3a30da5c5f2d5e72842e00bcb57657162cdabef0931f40e2deb9b4140440cecd" + +[[package]] +name = "anstyle-parse" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "938874ff5980b03a87c5524b3ae5b59cf99b1d6bc836848df7bc5ada9643c333" +dependencies = [ + "utf8parse", +] + +[[package]] +name = "anstyle-query" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5ca11d4be1bab0c8bc8734a9aa7bf4ee8316d462a08c6ac5052f888fef5b494b" +dependencies = [ + "windows-sys", +] + +[[package]] +name = "anstyle-wincon" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "180abfa45703aebe0093f79badacc01b8fd4ea2e35118747e5811127f926e188" +dependencies = [ + "anstyle", + "windows-sys", +] + +[[package]] +name = "anyhow" +version = "1.0.72" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3b13c32d80ecc7ab747b80c3784bce54ee8a7a0cc4fbda9bf4cda2cf6fe90854" + +[[package]] +name = "async-channel" +version = "1.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "81953c529336010edd6d8e358f886d9581267795c61b19475b71314bffa46d35" +dependencies = [ + "concurrent-queue", + "event-listener", + "futures-core", +] + +[[package]] +name = "async-executor" +version = "1.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6fa3dc5f2a8564f07759c008b9109dc0d39de92a88d5588b8a5036d286383afb" +dependencies = [ + "async-lock", + "async-task", + "concurrent-queue", + "fastrand 1.9.0", + "futures-lite", + "slab", +] + +[[package]] +name = "async-global-executor" +version = "2.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f1b6f5d7df27bd294849f8eec66ecfc63d11814df7a4f5d74168a2394467b776" +dependencies = [ + "async-channel", + "async-executor", + "async-io", + "async-lock", + "blocking", + "futures-lite", + "once_cell", +] + +[[package]] +name = "async-global-executor-trait" +version = "2.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "33dd14c5a15affd2abcff50d84efd4009ada28a860f01c14f9d654f3e81b3f75" +dependencies = [ + "async-global-executor", + "async-trait", + "executor-trait", +] + +[[package]] +name = "async-io" +version = "1.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0fc5b45d93ef0529756f812ca52e44c221b35341892d3dcc34132ac02f3dd2af" +dependencies = [ + "async-lock", + "autocfg", + "cfg-if", + "concurrent-queue", + "futures-lite", + "log", + "parking", + "polling", + "rustix 0.37.23", + "slab", + "socket2 0.4.9", + "waker-fn", +] + +[[package]] +name = "async-lock" +version = "2.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fa24f727524730b077666307f2734b4a1a1c57acb79193127dcc8914d5242dd7" +dependencies = [ + "event-listener", +] + +[[package]] +name = "async-reactor-trait" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7a6012d170ad00de56c9ee354aef2e358359deb1ec504254e0e5a3774771de0e" +dependencies = [ + "async-io", + "async-trait", + "futures-core", + "reactor-trait", +] + +[[package]] +name = "async-stream" +version = "0.3.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cd56dd203fef61ac097dd65721a419ddccb106b2d2b70ba60a6b529f03961a51" +dependencies = [ + "async-stream-impl", + "futures-core", + "pin-project-lite", +] + +[[package]] +name = "async-stream-impl" +version = "0.3.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "16e62a023e7c117e27523144c5d2459f4397fcc3cab0085af8e2224f643a0193" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "async-task" +version = "4.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ecc7ab41815b3c653ccd2978ec3255c81349336702dfdf62ee6f7069b12a3aae" + +[[package]] +name = "async-trait" +version = "0.1.72" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cc6dde6e4ed435a4c1ee4e73592f5ba9da2151af10076cc04858746af9352d09" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "atoi" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f28d99ec8bfea296261ca1af174f24225171fea9664ba9003cbebee704810528" +dependencies = [ + "num-traits", +] + +[[package]] +name = "atomic" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c59bdb34bc650a32731b31bd8f0829cc15d24a708ee31559e0bb34f2bc320cba" + +[[package]] +name = "atomic-waker" +version = "1.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1181e1e0d1fce796a03db1ae795d67167da795f9cf4a39c37589e85ef57f26d3" + +[[package]] +name = "autocfg" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d468802bab17cbc0cc575e9b053f41e72aa36bfa6b7f55e3529ffa43161b97fa" + +[[package]] +name = "axum" +version = "0.6.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2fb79c228270dcf2426e74864cabc94babb5dbab01a4314e702d2f16540e1591" +dependencies = [ + "async-trait", + "axum-core", + "bitflags 1.3.2", + "bytes", + "futures-util", + "headers", + "http", + "http-body", + "hyper", + "itoa", + "matchit", + "memchr", + "mime", + "percent-encoding", + "pin-project-lite", + "rustversion", + "serde", + "serde_json", + "serde_path_to_error", + "serde_urlencoded", + "sync_wrapper", + "tokio", + "tower", + "tower-http 0.3.5", + "tower-layer", + "tower-service", +] + +[[package]] +name = "axum-core" +version = "0.3.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "759fa577a247914fd3f7f76d62972792636412fbfd634cd452f6a385a74d2d2c" +dependencies = [ + "async-trait", + "bytes", + "futures-util", + "http", + "http-body", + "mime", + "rustversion", + "tower-layer", + "tower-service", +] + +[[package]] +name = "axum-server" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "197b070de3ae5fc503d531d4dc7680e016438c2ffc848a1fefebc5c53f35cc17" +dependencies = [ + "bytes", + "futures-util", + "http", + "http-body", + "hyper", + "openssl", + "pin-project-lite", + "tokio", + "tokio-openssl", + "tower-service", +] + +[[package]] +name = "backtrace" +version = "0.3.68" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4319208da049c43661739c5fade2ba182f09d1dc2299b32298d3a31692b17e12" +dependencies = [ + "addr2line", + "cc", + "cfg-if", + "libc", + "miniz_oxide", + "object", + "rustc-demangle", +] + +[[package]] +name = "base-encode" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a17bd29f7c70f32e9387f4d4acfa5ea7b7749ef784fb78cf382df97069337b8c" + +[[package]] +name = "base16ct" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4c7f02d4ea65f2c1853089ffd8d2787bdbc63de2f0d29dedbcf8ccdfa0ccd4cf" + +[[package]] +name = "base64" +version = "0.13.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9e1b586273c5702936fe7b7d6896644d8be71e6314cfe09d3167c95f712589e8" + +[[package]] +name = "base64" +version = "0.21.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "604178f6c5c21f02dc555784810edfb88d34ac2c73b2eae109655649ee73ce3d" + +[[package]] +name = "base64ct" +version = "1.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8c3c1a368f70d6cf7302d78f8f7093da241fb8e8807c05cc9e51a125895a6d5b" + +[[package]] +name = "bb8" +version = "0.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "98b4b0f25f18bcdc3ac72bdb486ed0acf7e185221fd4dc985bc15db5800b0ba2" +dependencies = [ + "async-trait", + "futures-channel", + "futures-util", + "parking_lot", + "tokio", +] + +[[package]] +name = "bb8-redis" +version = "0.13.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cd456361ba8e4e7f5fe58e1697ce078a149c85ebce13bf9c6b483d3f566fc9c3" +dependencies = [ + "async-trait", + "bb8", + "redis", +] + +[[package]] +name = "binstring" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7e0d60973d9320722cb1206f412740e162a33b8547ea8d6be75d7cff237c7a85" + +[[package]] +name = "bit-set" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0700ddab506f33b20a03b13996eccd309a48e5ff77d0d95926aa0210fb4e95f1" +dependencies = [ + "bit-vec", +] + +[[package]] +name = "bit-vec" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "349f9b6a179ed607305526ca489b34ad0a41aed5f7980fa90eb03160b69598fb" + +[[package]] +name = "bitflags" +version = "1.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a" + +[[package]] +name = "bitflags" +version = "2.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "630be753d4e58660abd17930c71b647fe46c27ea6b63cc59e1e3851406972e42" +dependencies = [ + "serde", +] + +[[package]] +name = "blake2" +version = "0.10.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "46502ad458c9a52b69d4d4d32775c788b7a1b85e8bc9d482d92250fc0e3f8efe" +dependencies = [ + "digest", +] + +[[package]] +name = "block-buffer" +version = "0.10.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3078c7629b62d3f0439517fa394996acacc5cbc91c5a20d8c658e77abd503a71" +dependencies = [ + "generic-array", +] + +[[package]] +name = "block-padding" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a8894febbff9f758034a5b8e12d87918f56dfc64a8e1fe757d65e29041538d93" +dependencies = [ + "generic-array", +] + +[[package]] +name = "blocking" +version = "1.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "77231a1c8f801696fc0123ec6150ce92cffb8e164a02afb9c8ddee0e9b65ad65" +dependencies = [ + "async-channel", + "async-lock", + "async-task", + "atomic-waker", + "fastrand 1.9.0", + "futures-lite", + "log", +] + +[[package]] +name = "bumpalo" +version = "3.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a3e2c3daef883ecc1b5d58c15adae93470a91d425f3532ba1695849656af3fc1" + +[[package]] +name = "bytecount" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2c676a478f63e9fa2dd5368a42f28bba0d6c560b775f38583c8bbaa7fcd67c9c" + +[[package]] +name = "byteorder" +version = "1.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610" + +[[package]] +name = "bytes" +version = "1.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "89b2fd2a0dcf38d7971e2194b6b6eebab45ae01067456a7fd93d5547a61b70be" + +[[package]] +name = "cbc" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "26b52a9543ae338f279b96b0b9fed9c8093744685043739079ce85cd58f289a6" +dependencies = [ + "cipher 0.4.4", +] + +[[package]] +name = "cc" +version = "1.0.79" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50d30906286121d95be3d479533b458f87493b30a4b5f79a607db8f5d11aa91f" + +[[package]] +name = "cfg-if" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd" + +[[package]] +name = "chacha20" +version = "0.8.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5c80e5460aa66fe3b91d40bcbdab953a597b60053e34d684ac6903f863b680a6" +dependencies = [ + "cfg-if", + "cipher 0.3.0", + "cpufeatures", + "zeroize", +] + +[[package]] +name = "chacha20poly1305" +version = "0.9.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a18446b09be63d457bbec447509e85f662f32952b035ce892290396bc0b0cff5" +dependencies = [ + "aead", + "chacha20", + "cipher 0.3.0", + "poly1305", + "zeroize", +] + +[[package]] +name = "chrono" +version = "0.4.26" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ec837a71355b28f6556dbd569b37b3f363091c0bd4b2e735674521b4c5fd9bc5" +dependencies = [ + "android-tzdata", + "iana-time-zone", + "js-sys", + "num-traits", + "serde", + "time 0.1.45", + "wasm-bindgen", + "winapi", +] + +[[package]] +name = "cipher" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7ee52072ec15386f770805afd189a01c8841be8696bed250fa2f13c4c0d6dfb7" +dependencies = [ + "generic-array", +] + +[[package]] +name = "cipher" +version = "0.4.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "773f3b9af64447d2ce9850330c473515014aa235e6a783b02db81ff39e4a3dad" +dependencies = [ + "crypto-common", + "inout", +] + +[[package]] +name = "clap" +version = "4.3.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5fd304a20bff958a57f04c4e96a2e7594cc4490a0e809cbd48bb6437edaa452d" +dependencies = [ + "clap_builder", + "clap_derive", + "once_cell", +] + +[[package]] +name = "clap_builder" +version = "4.3.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "01c6a3f08f1fe5662a35cfe393aec09c4df95f60ee93b7556505260f75eee9e1" +dependencies = [ + "anstream", + "anstyle", + "clap_lex", + "strsim", +] + +[[package]] +name = "clap_derive" +version = "4.3.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "54a9bb5758fc5dfe728d1019941681eccaf0cf8a4189b692a0ee2f2ecf90a050" +dependencies = [ + "heck 0.4.1", + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "clap_lex" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2da6da31387c7e4ef160ffab6d5e7f00c42626fe39aea70a7b0f1773f7dd6c1b" + +[[package]] +name = "coarsetime" +version = "0.1.23" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a90d114103adbc625300f346d4d09dfb4ab1c4a8df6868435dd903392ecf4354" +dependencies = [ + "libc", + "once_cell", + "wasi 0.11.0+wasi-snapshot-preview1", + "wasm-bindgen", +] + +[[package]] +name = "colorchoice" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "acbf1af155f9b9ef647e42cdc158db4b64a1b61f743629225fde6f3e0be2a7c7" + +[[package]] +name = "combine" +version = "4.6.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "35ed6e9d84f0b51a7f52daf1c7d71dd136fd7a3f41a8462b8cdb8c78d920fad4" +dependencies = [ + "bytes", + "futures-core", + "memchr", + "pin-project-lite", + "tokio", + "tokio-util 0.7.8", +] + +[[package]] +name = "concurrent-queue" +version = "2.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "62ec6771ecfa0762d24683ee5a32ad78487a3d3afdc0fb8cae19d2c5deb50b7c" +dependencies = [ + "crossbeam-utils", +] + +[[package]] +name = "const-oid" +version = "0.9.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "28c122c3980598d243d63d9a704629a2d748d101f278052ff068be5a4423ab6f" + +[[package]] +name = "cookie-factory" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "396de984970346b0d9e93d1415082923c679e5ae5c3ee3dcbd104f5610af126b" + +[[package]] +name = "core-foundation" +version = "0.9.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "194a7a9e6de53fa55116934067c844d9d749312f75c6f6d0980e8c252f8c2146" +dependencies = [ + "core-foundation-sys", + "libc", +] + +[[package]] +name = "core-foundation-sys" +version = "0.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e496a50fda8aacccc86d7529e2c1e0892dbd0f898a6b5645b5561b89c3210efa" + +[[package]] +name = "cpufeatures" +version = "0.2.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a17b76ff3a4162b0b27f354a0c87015ddad39d35f9c0c36607a3bdd175dde1f1" +dependencies = [ + "libc", +] + +[[package]] +name = "crc" +version = "3.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "86ec7a15cbe22e59248fc7eadb1907dab5ba09372595da4d73dd805ed4417dfe" +dependencies = [ + "crc-catalog", +] + +[[package]] +name = "crc-catalog" +version = "2.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9cace84e55f07e7301bae1c519df89cdad8cc3cd868413d3fdbdeca9ff3db484" + +[[package]] +name = "crc16" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "338089f42c427b86394a5ee60ff321da23a5c89c9d89514c829687b26359fcff" + +[[package]] +name = "crossbeam-channel" +version = "0.5.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a33c2bf77f2df06183c3aa30d1e96c0695a313d4f9c453cc3762a6db39f99200" +dependencies = [ + "cfg-if", + "crossbeam-utils", +] + +[[package]] +name = "crossbeam-queue" +version = "0.3.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d1cfb3ea8a53f37c40dea2c7bedcbd88bdfae54f5e2175d6ecaff1c988353add" +dependencies = [ + "cfg-if", + "crossbeam-utils", +] + +[[package]] +name = "crossbeam-utils" +version = "0.8.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5a22b2d63d4d1dc0b7f1b6b2747dd0088008a9be28b6ddf0b1e7d335e3037294" +dependencies = [ + "cfg-if", +] + +[[package]] +name = "crypto-bigint" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cf4c2f4e1afd912bc40bfd6fed5d9dc1f288e0ba01bfcc835cc5bc3eb13efe15" +dependencies = [ + "generic-array", + "rand_core", + "subtle", + "zeroize", +] + +[[package]] +name = "crypto-common" +version = "0.1.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1bfb12502f3fc46cca1bb51ac28df9d618d813cdc3d2f25b9fe775a34af26bb3" +dependencies = [ + "generic-array", + "typenum", +] + +[[package]] +name = "ct-codecs" +version = "1.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f3b7eb4404b8195a9abb6356f4ac07d8ba267045c8d6d220ac4dc992e6cc75df" + +[[package]] +name = "darling" +version = "0.14.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7b750cb3417fd1b327431a470f388520309479ab0bf5e323505daf0290cd3850" +dependencies = [ + "darling_core", + "darling_macro", +] + +[[package]] +name = "darling_core" +version = "0.14.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "109c1ca6e6b7f82cc233a97004ea8ed7ca123a9af07a8230878fcfda9b158bf0" +dependencies = [ + "fnv", + "ident_case", + "proc-macro2", + "quote", + "strsim", + "syn 1.0.109", +] + +[[package]] +name = "darling_macro" +version = "0.14.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a4aab4dbc9f7611d8b55048a3a16d2d010c2c8334e46304b40ac1cc14bf3b48e" +dependencies = [ + "darling_core", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "data-encoding" +version = "2.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c2e66c9d817f1720209181c316d28635c050fa304f9c79e47a520882661b7308" + +[[package]] +name = "debugid" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bef552e6f588e446098f6ba40d89ac146c8c7b64aade83c051ee00bb5d2bc18d" +dependencies = [ + "serde", + "uuid", +] + +[[package]] +name = "der" +version = "0.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f1a467a65c5e759bce6e65eaf91cc29f466cdc57cb65777bd646872a8a1fd4de" +dependencies = [ + "const-oid", + "pem-rfc7468 0.6.0", + "zeroize", +] + +[[package]] +name = "der" +version = "0.7.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fffa369a668c8af7dbf8b5e56c9f744fbd399949ed171606040001947de40b1c" +dependencies = [ + "const-oid", + "pem-rfc7468 0.7.0", + "zeroize", +] + +[[package]] +name = "derivative" +version = "2.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fcc3dd5e9e9c0b295d6e1e4d811fb6f157d5ffd784b8d202fc62eac8035a770b" +dependencies = [ + "proc-macro2", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "des" +version = "0.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ffdd80ce8ce993de27e9f063a444a4d53ce8e8db4c1f00cc03af5ad5a9867a1e" +dependencies = [ + "cipher 0.4.4", +] + +[[package]] +name = "digest" +version = "0.10.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9ed9a281f7bc9b7576e61468ba615a66a5c8cfdff42420a70aa82701a3b1e292" +dependencies = [ + "block-buffer", + "const-oid", + "crypto-common", + "subtle", +] + +[[package]] +name = "doc-comment" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fea41bba32d969b513997752735605054bc0dfa92b4c56bf1189f2e174be7a10" + +[[package]] +name = "dotenv" +version = "0.15.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "77c90badedccf4105eca100756a0b1289e191f6fcbdadd3cee1d2f614f97da8f" + +[[package]] +name = "dotenvy" +version = "0.15.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1aaf95b3e5c8f23aa320147307562d361db0ae0d51242340f558153b4eb2439b" + +[[package]] +name = "dyn-clone" +version = "1.0.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "304e6508efa593091e97a9abbc10f90aa7ca635b6d2784feff3c89d41dd12272" + +[[package]] +name = "ecdsa" +version = "0.16.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a4b1e0c257a9e9f25f90ff76d7a68360ed497ee519c8e428d1825ef0000799d4" +dependencies = [ + "der 0.7.8", + "digest", + "elliptic-curve", + "rfc6979", + "signature 2.1.0", + "spki 0.7.2", +] + +[[package]] +name = "ed25519-compact" +version = "1.0.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e18997d4604542d0736fae2c5ad6de987f0a50530cbcc14a7ce5a685328a252d" +dependencies = [ + "ct-codecs", + "getrandom", +] + +[[package]] +name = "ed25519-compact" +version = "2.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6a3d382e8464107391c8706b4c14b087808ecb909f6c15c34114bc42e53a9e4c" +dependencies = [ + "ct-codecs", + "getrandom", +] + +[[package]] +name = "either" +version = "1.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a26ae43d7bcc3b814de94796a5e736d4029efb0ee900c12e2d54c993ad1a1e07" +dependencies = [ + "serde", +] + +[[package]] +name = "elliptic-curve" +version = "0.13.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "968405c8fdc9b3bf4df0a6638858cc0b52462836ab6b1c87377785dd09cf1c0b" +dependencies = [ + "base16ct", + "crypto-bigint", + "digest", + "ff", + "generic-array", + "group", + "hkdf", + "pem-rfc7468 0.7.0", + "pkcs8 0.10.2", + "rand_core", + "sec1", + "subtle", + "zeroize", +] + +[[package]] +name = "encoding_rs" +version = "0.8.32" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "071a31f4ee85403370b58aca746f01041ede6f0da2730960ad001edc2b71b394" +dependencies = [ + "cfg-if", +] + +[[package]] +name = "enum-as-inner" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c9720bba047d567ffc8a3cba48bf19126600e249ab7f128e9233e6376976a116" +dependencies = [ + "heck 0.4.1", + "proc-macro2", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "enum_dispatch" +version = "0.3.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8f33313078bb8d4d05a2733a94ac4c2d8a0df9a2b84424ebf4f33bfc224a890e" +dependencies = [ + "once_cell", + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "equivalent" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5443807d6dff69373d433ab9ef5378ad8df50ca6298caf15de6e52e24aaf54d5" + +[[package]] +name = "errno" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4bcfec3a70f97c962c307b2d2c56e358cf1d00b558d74262b5f929ee8cc7e73a" +dependencies = [ + "errno-dragonfly", + "libc", + "windows-sys", +] + +[[package]] +name = "errno-dragonfly" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aa68f1b12764fab894d2755d2518754e71b4fd80ecfb822714a1206c2aab39bf" +dependencies = [ + "cc", + "libc", +] + +[[package]] +name = "etcetera" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "136d1b5283a1ab77bd9257427ffd09d8667ced0570b6f938942bc7568ed5b943" +dependencies = [ + "cfg-if", + "home", + "windows-sys", +] + +[[package]] +name = "event-listener" +version = "2.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0206175f82b8d6bf6652ff7d71a1e27fd2e4efde587fd368662814d6ec1d9ce0" + +[[package]] +name = "executor-trait" +version = "2.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1a1052dd43212a7777ec6a69b117da52f5e52f07aec47d00c1a2b33b85d06b08" +dependencies = [ + "async-trait", +] + +[[package]] +name = "fancy-regex" +version = "0.10.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0678ab2d46fa5195aaf59ad034c083d351377d4af57f3e073c074d0da3e3c766" +dependencies = [ + "bit-set", + "regex", +] + +[[package]] +name = "fastrand" +version = "1.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e51093e27b0797c359783294ca4f0a911c270184cb10f85783b118614a1501be" +dependencies = [ + "instant", +] + +[[package]] +name = "fastrand" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6999dc1837253364c2ebb0704ba97994bd874e8f195d665c50b7548f6ea92764" + +[[package]] +name = "ff" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ded41244b729663b1e574f1b4fb731469f69f79c17667b5d776b16cda0479449" +dependencies = [ + "rand_core", + "subtle", +] + +[[package]] +name = "figment" +version = "0.10.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4547e226f4c9ab860571e070a9034192b3175580ecea38da34fcdb53a018c9a5" +dependencies = [ + "atomic", + "parking_lot", + "pear", + "serde", + "tempfile", + "toml", + "uncased", + "version_check", +] + +[[package]] +name = "findshlibs" +version = "0.10.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "40b9e59cd0f7e0806cca4be089683ecb6434e602038df21fe6bf6711b2f07f64" +dependencies = [ + "cc", + "lazy_static", + "libc", + "winapi", +] + +[[package]] +name = "fixedbitset" +version = "0.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0ce7134b9999ecaf8bcd65542e436736ef32ddca1b3e06094cb6ec5755203b80" + +[[package]] +name = "flume" +version = "0.10.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1657b4441c3403d9f7b3409e47575237dac27b1b5726df654a6ecbf92f0f7577" +dependencies = [ + "futures-core", + "futures-sink", + "pin-project", + "spin 0.9.8", +] + +[[package]] +name = "fnv" +version = "1.0.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1" + +[[package]] +name = "foreign-types" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f6f339eb8adc052cd2ca78910fda869aefa38d22d5cb648e6485e4d3fc06f3b1" +dependencies = [ + "foreign-types-shared", +] + +[[package]] +name = "foreign-types-shared" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "00b0228411908ca8685dba7fc2cdd70ec9990a6e753e89b6ac91a84c40fbaf4b" + +[[package]] +name = "form_urlencoded" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a62bc1cf6f830c2ec14a513a9fb124d0a213a629668a4186f329db21fe045652" +dependencies = [ + "percent-encoding", +] + +[[package]] +name = "fraction" +version = "0.12.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7aa5de57a62c2440ece64342ea59efb7171aa7d016faf8dfcb8795066a17146b" +dependencies = [ + "lazy_static", + "num", +] + +[[package]] +name = "futures" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "23342abe12aba583913b2e62f22225ff9c950774065e4bfb61a19cd9770fec40" +dependencies = [ + "futures-channel", + "futures-core", + "futures-executor", + "futures-io", + "futures-sink", + "futures-task", + "futures-util", +] + +[[package]] +name = "futures-channel" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "955518d47e09b25bbebc7a18df10b81f0c766eaf4c4f1cccef2fca5f2a4fb5f2" +dependencies = [ + "futures-core", + "futures-sink", +] + +[[package]] +name = "futures-core" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4bca583b7e26f571124fe5b7561d49cb2868d79116cfa0eefce955557c6fee8c" + +[[package]] +name = "futures-executor" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ccecee823288125bd88b4d7f565c9e58e41858e47ab72e8ea2d64e93624386e0" +dependencies = [ + "futures-core", + "futures-task", + "futures-util", +] + +[[package]] +name = "futures-intrusive" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d930c203dd0b6ff06e0201a4a2fe9149b43c684fd4420555b26d21b1a02956f" +dependencies = [ + "futures-core", + "lock_api", + "parking_lot", +] + +[[package]] +name = "futures-io" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4fff74096e71ed47f8e023204cfd0aa1289cd54ae5430a9523be060cdb849964" + +[[package]] +name = "futures-lite" +version = "1.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "49a9d51ce47660b1e808d3c990b4709f2f415d928835a17dfd16991515c46bce" +dependencies = [ + "fastrand 1.9.0", + "futures-core", + "futures-io", + "memchr", + "parking", + "pin-project-lite", + "waker-fn", +] + +[[package]] +name = "futures-macro" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "89ca545a94061b6365f2c7355b4b32bd20df3ff95f02da9329b34ccc3bd6ee72" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "futures-sink" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f43be4fe21a13b9781a69afa4985b0f6ee0e1afab2c6f454a8cf30e2b2237b6e" + +[[package]] +name = "futures-task" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "76d3d132be6c0e6aa1534069c705a74a5997a356c0dc2f86a47765e5617c5b65" + +[[package]] +name = "futures-util" +version = "0.3.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "26b01e40b772d54cf6c6d721c1d1abd0647a0106a12ecaa1c186273392a69533" +dependencies = [ + "futures-channel", + "futures-core", + "futures-io", + "futures-macro", + "futures-sink", + "futures-task", + "memchr", + "pin-project-lite", + "pin-utils", + "slab", +] + +[[package]] +name = "generic-array" +version = "0.14.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "85649ca51fd72272d7821adaf274ad91c288277713d9c18820d8499a7ff69e9a" +dependencies = [ + "typenum", + "version_check", + "zeroize", +] + +[[package]] +name = "getrandom" +version = "0.2.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "be4136b2a15dd319360be1c07d9933517ccf0be8f16bf62a3bee4f0d618df427" +dependencies = [ + "cfg-if", + "libc", + "wasi 0.11.0+wasi-snapshot-preview1", +] + +[[package]] +name = "gimli" +version = "0.27.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b6c80984affa11d98d1b88b66ac8853f143217b399d3c74116778ff8fdb4ed2e" + +[[package]] +name = "group" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f0f9ef7462f7c099f518d754361858f86d8a07af53ba9af0fe635bbccb151a63" +dependencies = [ + "ff", + "rand_core", + "subtle", +] + +[[package]] +name = "h2" +version = "0.3.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "97ec8491ebaf99c8eaa73058b045fe58073cd6be7f596ac993ced0b0a0c01049" +dependencies = [ + "bytes", + "fnv", + "futures-core", + "futures-sink", + "futures-util", + "http", + "indexmap 1.9.3", + "slab", + "tokio", + "tokio-util 0.7.8", + "tracing", +] + +[[package]] +name = "hashbrown" +version = "0.12.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888" + +[[package]] +name = "hashbrown" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2c6201b9ff9fd90a5a3bac2e56a830d0caa509576f0e503818ee82c181b3437a" +dependencies = [ + "ahash", + "allocator-api2", +] + +[[package]] +name = "hashlink" +version = "0.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "312f66718a2d7789ffef4f4b7b213138ed9f1eb3aa1d0d82fc99f88fb3ffd26f" +dependencies = [ + "hashbrown 0.14.0", +] + +[[package]] +name = "headers" +version = "0.3.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f3e372db8e5c0d213e0cd0b9be18be2aca3d44cf2fe30a9d46a65581cd454584" +dependencies = [ + "base64 0.13.1", + "bitflags 1.3.2", + "bytes", + "headers-core", + "http", + "httpdate", + "mime", + "sha1", +] + +[[package]] +name = "headers-core" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e7f66481bfee273957b1f20485a4ff3362987f85b2c236580d81b4eb7a326429" +dependencies = [ + "http", +] + +[[package]] +name = "heck" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6d621efb26863f0e9924c6ac577e8275e5e6b77455db64ffa6c65c904e9e132c" +dependencies = [ + "unicode-segmentation", +] + +[[package]] +name = "heck" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8" +dependencies = [ + "unicode-segmentation", +] + +[[package]] +name = "hermit-abi" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "443144c8cdadd93ebf52ddb4056d257f5b52c04d3c804e657d19eb73fc33668b" + +[[package]] +name = "hex" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f24254aa9a54b5c858eaee2f5bccdb46aaf0e486a595ed5fd8f86ba55232a70" + +[[package]] +name = "hkdf" +version = "0.12.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "791a029f6b9fc27657f6f188ec6e5e43f6911f6f878e0dc5501396e09809d437" +dependencies = [ + "hmac", +] + +[[package]] +name = "hmac" +version = "0.12.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6c49c37c09c17a53d937dfbb742eb3a961d65a994e6bcdcf37e7399d0cc8ab5e" +dependencies = [ + "digest", +] + +[[package]] +name = "hmac-sha1-compact" +version = "1.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dff9d405ec732fa3fcde87264e54a32a84956a377b3e3107de96e59b798c84a7" + +[[package]] +name = "hmac-sha256" +version = "1.1.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3688e69b38018fec1557254f64c8dc2cc8ec502890182f395dbb0aa997aa5735" +dependencies = [ + "digest", +] + +[[package]] +name = "hmac-sha512" +version = "1.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e4ce1f4656bae589a3fab938f9f09bf58645b7ed01a2c5f8a3c238e01a4ef78a" +dependencies = [ + "digest", +] + +[[package]] +name = "home" +version = "0.5.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5444c27eef6923071f7ebcc33e3444508466a76f7a2b93da00ed6e19f30c1ddb" +dependencies = [ + "windows-sys", +] + +[[package]] +name = "hostname" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3c731c3e10504cc8ed35cfe2f1db4c9274c3d35fa486e3b31df46f068ef3e867" +dependencies = [ + "libc", + "match_cfg", + "winapi", +] + +[[package]] +name = "http" +version = "0.2.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bd6effc99afb63425aff9b05836f029929e345a6148a14b7ecd5ab67af944482" +dependencies = [ + "bytes", + "fnv", + "itoa", +] + +[[package]] +name = "http-body" +version = "0.4.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d5f38f16d184e36f2408a55281cd658ecbd3ca05cce6d6510a176eca393e26d1" +dependencies = [ + "bytes", + "http", + "pin-project-lite", +] + +[[package]] +name = "http-range-header" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "add0ab9360ddbd88cfeb3bd9574a1d85cfdfa14db10b3e21d3700dbc4328758f" + +[[package]] +name = "httparse" +version = "1.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d897f394bad6a705d5f4104762e116a75639e470d80901eed05a860a95cb1904" + +[[package]] +name = "httpdate" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c4a1e36c821dbe04574f602848a19f742f4fb3c98d40449f11bcad18d6b17421" + +[[package]] +name = "hyper" +version = "0.14.23" +source = "git+https://github.com/svix/hyper/?rev=b901ca7c#b901ca7c7772c427d63d150e1bf1c2ce7ce0d733" +dependencies = [ + "bytes", + "futures-channel", + "futures-core", + "futures-util", + "h2", + "http", + "http-body", + "httparse", + "httpdate", + "itoa", + "pin-project-lite", + "socket2 0.4.9", + "tokio", + "tower-service", + "tracing", + "want", +] + +[[package]] +name = "hyper-openssl" +version = "0.9.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d6ee5d7a8f718585d1c3c61dfde28ef5b0bb14734b4db13f5ada856cdc6c612b" +dependencies = [ + "http", + "hyper", + "linked_hash_set", + "once_cell", + "openssl", + "openssl-sys", + "parking_lot", + "tokio", + "tokio-openssl", + "tower-layer", +] + +[[package]] +name = "hyper-rustls" +version = "0.24.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8d78e1e73ec14cf7375674f74d7dde185c8206fd9dea6fb6295e8a98098aaa97" +dependencies = [ + "futures-util", + "http", + "hyper", + "rustls", + "tokio", + "tokio-rustls", +] + +[[package]] +name = "hyper-timeout" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bbb958482e8c7be4bc3cf272a766a2b0bf1a6755e7a6ae777f017a31d11b13b1" +dependencies = [ + "hyper", + "pin-project-lite", + "tokio", + "tokio-io-timeout", +] + +[[package]] +name = "hyper-tls" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d6183ddfa99b85da61a140bea0efc93fdf56ceaa041b37d553518030827f9905" +dependencies = [ + "bytes", + "hyper", + "native-tls", + "tokio", + "tokio-native-tls", +] + +[[package]] +name = "iana-time-zone" +version = "0.1.57" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2fad5b825842d2b38bd206f3e81d6957625fd7f0a361e345c30e01a0ae2dd613" +dependencies = [ + "android_system_properties", + "core-foundation-sys", + "iana-time-zone-haiku", + "js-sys", + "wasm-bindgen", + "windows", +] + +[[package]] +name = "iana-time-zone-haiku" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f31827a206f56af32e590ba56d5d2d085f558508192593743f16b2306495269f" +dependencies = [ + "cc", +] + +[[package]] +name = "ident_case" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b9e0384b61958566e926dc50660321d12159025e767c18e043daf26b70104c39" + +[[package]] +name = "idna" +version = "0.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "418a0a6fab821475f634efe3ccc45c013f742efe03d853e8d3355d5cb850ecf8" +dependencies = [ + "matches", + "unicode-bidi", + "unicode-normalization", +] + +[[package]] +name = "idna" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7d20d6b07bfbc108882d88ed8e37d39636dcc260e15e30c45e6ba089610b917c" +dependencies = [ + "unicode-bidi", + "unicode-normalization", +] + +[[package]] +name = "if_chain" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cb56e1aa765b4b4f3aadfab769793b7087bb03a4ea4920644a6d238e2df5b9ed" + +[[package]] +name = "indexmap" +version = "1.9.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bd070e393353796e801d209ad339e89596eb4c8d430d18ede6a1cced8fafbd99" +dependencies = [ + "autocfg", + "hashbrown 0.12.3", + "serde", +] + +[[package]] +name = "indexmap" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d5477fe2230a79769d8dc68e0eabf5437907c0457a5614a9e8dddb67f65eb65d" +dependencies = [ + "equivalent", + "hashbrown 0.14.0", +] + +[[package]] +name = "inherent" +version = "1.0.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ce243b1bfa62ffc028f1cc3b6034ec63d649f3031bc8a4fbbb004e1ac17d1f68" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "inlinable_string" +version = "0.1.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c8fae54786f62fb2918dcfae3d568594e50eb9b5c25bf04371af6fe7516452fb" + +[[package]] +name = "inout" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a0c10553d664a4d0bcff9f4215d0aac67a639cc68ef660840afe309b807bc9f5" +dependencies = [ + "block-padding", + "generic-array", +] + +[[package]] +name = "instant" +version = "0.1.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7a5bbe824c507c5da5956355e86a746d82e0e1464f65d862cc5e71da70e94b2c" +dependencies = [ + "cfg-if", +] + +[[package]] +name = "io-lifetimes" +version = "1.0.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "eae7b9aee968036d54dce06cebaefd919e4472e753296daccd6d344e3e2df0c2" +dependencies = [ + "hermit-abi", + "libc", + "windows-sys", +] + +[[package]] +name = "ipconfig" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b58db92f96b720de98181bbbe63c831e87005ab460c1bf306eb2622b4707997f" +dependencies = [ + "socket2 0.5.3", + "widestring", + "windows-sys", + "winreg 0.50.0", +] + +[[package]] +name = "ipnet" +version = "2.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "28b29a3cd74f0f4598934efe3aeba42bae0eb4680554128851ebbecb02af14e6" +dependencies = [ + "serde", +] + +[[package]] +name = "is-terminal" +version = "0.4.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cb0889898416213fab133e1d33a0e5858a48177452750691bde3666d0fdbaf8b" +dependencies = [ + "hermit-abi", + "rustix 0.38.4", + "windows-sys", +] + +[[package]] +name = "iso8601" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "296af15e112ec6dc38c9fd3ae027b5337a75466e8eed757bd7d5cf742ea85eb6" +dependencies = [ + "nom", +] + +[[package]] +name = "itertools" +version = "0.10.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b0fd2260e829bddf4cb6ea802289de2f86d6a7a690192fbe91b3f46e0f2c8473" +dependencies = [ + "either", +] + +[[package]] +name = "itoa" +version = "1.0.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "af150ab688ff2122fcef229be89cb50dd66af9e01a4ff320cc137eecc9bacc38" + +[[package]] +name = "js-sys" +version = "0.3.64" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c5f195fe497f702db0f318b07fdd68edb16955aed830df8363d837542f8f935a" +dependencies = [ + "wasm-bindgen", +] + +[[package]] +name = "jsonschema" +version = "0.16.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6ca9e2b45609132ae2214d50482c03aeee78826cd6fd53a8940915b81acedf16" +dependencies = [ + "ahash", + "anyhow", + "base64 0.13.1", + "bytecount", + "clap", + "fancy-regex", + "fraction", + "iso8601", + "itoa", + "lazy_static", + "memchr", + "num-cmp", + "parking_lot", + "percent-encoding", + "regex", + "reqwest", + "serde", + "serde_json", + "time 0.3.23", + "url", + "uuid", +] + +[[package]] +name = "jwt-simple" +version = "0.11.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "733741e7bcd1532b56c9ba6c698c069f274f3782ad956f0d2c7f31650cedaa1b" +dependencies = [ + "anyhow", + "binstring", + "coarsetime", + "ct-codecs", + "ed25519-compact 2.0.4", + "hmac-sha1-compact", + "hmac-sha256", + "hmac-sha512", + "k256", + "p256", + "p384", + "rand", + "rsa 0.7.2", + "serde", + "serde_json", + "spki 0.6.0", + "thiserror", + "zeroize", +] + +[[package]] +name = "k256" +version = "0.13.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cadb76004ed8e97623117f3df85b17aaa6626ab0b0831e6573f104df16cd1bcc" +dependencies = [ + "cfg-if", + "ecdsa", + "elliptic-curve", + "once_cell", + "sha2", + "signature 2.1.0", +] + +[[package]] +name = "lapin" +version = "2.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5f3067a1fcfbc3fc46455809c023e69b8f6602463201010f4ae5a3b572adb9dc" +dependencies = [ + "amq-protocol", + "async-global-executor-trait", + "async-reactor-trait", + "async-trait", + "executor-trait", + "flume", + "futures-core", + "futures-io", + "parking_lot", + "pinky-swear", + "reactor-trait", + "serde", + "tracing", + "waker-fn", +] + +[[package]] +name = "lazy_static" +version = "1.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646" +dependencies = [ + "spin 0.5.2", +] + +[[package]] +name = "libc" +version = "0.2.147" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b4668fb0ea861c1df094127ac5f1da3409a82116a4ba74fca2e58ef927159bb3" + +[[package]] +name = "libm" +version = "0.2.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f7012b1bbb0719e1097c47611d3898568c546d597c2e74d66f6087edd5233ff4" + +[[package]] +name = "libsqlite3-sys" +version = "0.26.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "afc22eff61b133b115c6e8c74e818c628d6d5e7a502afea6f64dee076dd94326" +dependencies = [ + "cc", + "pkg-config", + "vcpkg", +] + +[[package]] +name = "linked-hash-map" +version = "0.5.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0717cef1bc8b636c6e1c1bbdefc09e6322da8a9321966e8928ef80d20f7f770f" + +[[package]] +name = "linked_hash_set" +version = "0.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "47186c6da4d81ca383c7c47c1bfc80f4b95f4720514d860a5407aaf4233f9588" +dependencies = [ + "linked-hash-map", +] + +[[package]] +name = "linux-raw-sys" +version = "0.3.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ef53942eb7bf7ff43a617b3e2c1c4a5ecf5944a7c1bc12d7ee39bbb15e5c1519" + +[[package]] +name = "linux-raw-sys" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09fc20d2ca12cb9f044c93e3bd6d32d523e6e2ec3db4f7b2939cd99026ecd3f0" + +[[package]] +name = "lock_api" +version = "0.4.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c1cc9717a20b1bb222f333e6a92fd32f7d8a18ddc5a3191a11af45dcbf4dcd16" +dependencies = [ + "autocfg", + "scopeguard", +] + +[[package]] +name = "log" +version = "0.4.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b06a4cde4c0f271a446782e3eff8de789548ce57dbc8eca9292c27f4a42004b4" + +[[package]] +name = "lru-cache" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "31e24f1ad8321ca0e8a1e0ac13f23cb668e6f5466c2c57319f6a5cf1cc8e3b1c" +dependencies = [ + "linked-hash-map", +] + +[[package]] +name = "match_cfg" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ffbee8634e0d45d258acb448e7eaab3fce7a0a467395d4d9f228e3c1f01fb2e4" + +[[package]] +name = "matchers" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8263075bb86c5a1b1427b5ae862e8889656f126e9f77c484496e8b47cf5c5558" +dependencies = [ + "regex-automata 0.1.10", +] + +[[package]] +name = "matches" +version = "0.1.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2532096657941c2fea9c289d370a250971c689d4f143798ff67113ec042024a5" + +[[package]] +name = "matchit" +version = "0.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b87248edafb776e59e6ee64a79086f65890d3510f2c656c000bf2a7e8a0aea40" + +[[package]] +name = "md-5" +version = "0.10.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6365506850d44bff6e2fbcb5176cf63650e48bd45ef2fe2665ae1570e0f4b9ca" +dependencies = [ + "digest", +] + +[[package]] +name = "memchr" +version = "2.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2dffe52ecf27772e601905b7522cb4ef790d2cc203488bbd0e2fe85fcb74566d" + +[[package]] +name = "mime" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6877bb514081ee2a7ff5ef9de3281f14a4dd4bceac4c09388074a6b5df8a139a" + +[[package]] +name = "mime_guess" +version = "2.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4192263c238a5f0d0c6bfd21f336a313a4ce1c450542449ca191bb657b4642ef" +dependencies = [ + "mime", + "unicase", +] + +[[package]] +name = "minimal-lexical" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "68354c5c6bd36d73ff3feceb05efa59b6acb7626617f4962be322a825e61f79a" + +[[package]] +name = "miniz_oxide" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e7810e0be55b428ada41041c41f32c9f1a42817901b4ccf45fa3d4b6561e74c7" +dependencies = [ + "adler", +] + +[[package]] +name = "mio" +version = "0.8.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "927a765cd3fc26206e66b296465fa9d3e5ab003e651c1b3c060e7956d96b19d2" +dependencies = [ + "libc", + "wasi 0.11.0+wasi-snapshot-preview1", + "windows-sys", +] + +[[package]] +name = "multimap" +version = "0.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e5ce46fe64a9d73be07dcbe690a38ce1b293be448fd8ce1e6c1b8062c9f72c6a" + +[[package]] +name = "native-tls" +version = "0.2.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "07226173c32f2926027b63cce4bcd8076c3552846cbe7925f3aaffeac0a3b92e" +dependencies = [ + "lazy_static", + "libc", + "log", + "openssl", + "openssl-probe", + "openssl-sys", + "schannel", + "security-framework", + "security-framework-sys", + "tempfile", +] + +[[package]] +name = "nom" +version = "7.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d273983c5a657a70a3e8f2a01329822f3b8c8172b73826411a55751e404a0a4a" +dependencies = [ + "memchr", + "minimal-lexical", +] + +[[package]] +name = "nu-ansi-term" +version = "0.46.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "77a8165726e8236064dbb45459242600304b42a5ea24ee2948e18e023bf7ba84" +dependencies = [ + "overload", + "winapi", +] + +[[package]] +name = "num" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b05180d69e3da0e530ba2a1dae5110317e49e3b7f3d41be227dc5f92e49ee7af" +dependencies = [ + "num-bigint", + "num-complex", + "num-integer", + "num-iter", + "num-rational", + "num-traits", +] + +[[package]] +name = "num-bigint" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f93ab6289c7b344a8a9f60f88d80aa20032336fe78da341afc91c8a2341fc75f" +dependencies = [ + "autocfg", + "num-integer", + "num-traits", +] + +[[package]] +name = "num-bigint-dig" +version = "0.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dc84195820f291c7697304f3cbdadd1cb7199c0efc917ff5eafd71225c136151" +dependencies = [ + "byteorder", + "lazy_static", + "libm", + "num-integer", + "num-iter", + "num-traits", + "rand", + "smallvec", + "zeroize", +] + +[[package]] +name = "num-cmp" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "63335b2e2c34fae2fb0aa2cecfd9f0832a1e24b3b32ecec612c3426d46dc8aaa" + +[[package]] +name = "num-complex" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "02e0d21255c828d6f128a1e41534206671e8c3ea0c62f32291e808dc82cff17d" +dependencies = [ + "num-traits", +] + +[[package]] +name = "num-integer" +version = "0.1.45" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "225d3389fb3509a24c93f5c29eb6bde2586b98d9f016636dff58d7c6f7569cd9" +dependencies = [ + "autocfg", + "num-traits", +] + +[[package]] +name = "num-iter" +version = "0.1.43" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7d03e6c028c5dc5cac6e2dec0efda81fc887605bb3d884578bb6d6bf7514e252" +dependencies = [ + "autocfg", + "num-integer", + "num-traits", +] + +[[package]] +name = "num-rational" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0638a1c9d0a3c0914158145bc76cff373a75a627e6ecbfb71cbe6f453a5a19b0" +dependencies = [ + "autocfg", + "num-bigint", + "num-integer", + "num-traits", +] + +[[package]] +name = "num-traits" +version = "0.2.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f30b0abd723be7e2ffca1272140fac1a2f084c77ec3e123c192b66af1ee9e6c2" +dependencies = [ + "autocfg", + "libm", +] + +[[package]] +name = "num_cpus" +version = "1.16.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4161fcb6d602d4d2081af7c3a45852d875a03dd337a6bfdd6e06407b61342a43" +dependencies = [ + "hermit-abi", + "libc", +] + +[[package]] +name = "num_enum" +version = "0.5.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1f646caf906c20226733ed5b1374287eb97e3c2a5c227ce668c1f2ce20ae57c9" +dependencies = [ + "num_enum_derive", +] + +[[package]] +name = "num_enum_derive" +version = "0.5.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dcbff9bc912032c62bf65ef1d5aea88983b420f4f839db1e9b0c281a25c9c799" +dependencies = [ + "proc-macro-crate", + "proc-macro2", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "object" +version = "0.31.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8bda667d9f2b5051b8833f59f3bf748b28ef54f850f4fcb389a252aa383866d1" +dependencies = [ + "memchr", +] + +[[package]] +name = "once_cell" +version = "1.18.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dd8b5dd2ae5ed71462c540258bedcb51965123ad7e7ccf4b9a8cafaa4a63576d" + +[[package]] +name = "opaque-debug" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "624a8340c38c1b80fd549087862da4ba43e08858af025b236e509b6649fc13d5" + +[[package]] +name = "openssl" +version = "0.10.55" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "345df152bc43501c5eb9e4654ff05f794effb78d4efe3d53abc158baddc0703d" +dependencies = [ + "bitflags 1.3.2", + "cfg-if", + "foreign-types", + "libc", + "once_cell", + "openssl-macros", + "openssl-sys", +] + +[[package]] +name = "openssl-macros" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a948666b637a0f465e8564c73e89d4dde00d72d4d473cc972f390fc3dcee7d9c" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "openssl-probe" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ff011a302c396a5197692431fc1948019154afc178baf7d8e37367442a4601cf" + +[[package]] +name = "openssl-sys" +version = "0.9.90" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "374533b0e45f3a7ced10fcaeccca020e66656bc03dac384f852e4e5a7a8104a6" +dependencies = [ + "cc", + "libc", + "pkg-config", + "vcpkg", +] + +[[package]] +name = "opentelemetry" +version = "0.17.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6105e89802af13fdf48c49d7646d3b533a70e536d818aae7e78ba0433d01acb8" +dependencies = [ + "async-trait", + "crossbeam-channel", + "futures-channel", + "futures-executor", + "futures-util", + "js-sys", + "lazy_static", + "percent-encoding", + "pin-project", + "rand", + "thiserror", + "tokio", + "tokio-stream", +] + +[[package]] +name = "opentelemetry-http" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "449048140ee61e28f57abe6e9975eedc1f3a29855c7407bd6c12b18578863379" +dependencies = [ + "async-trait", + "bytes", + "http", + "opentelemetry", +] + +[[package]] +name = "opentelemetry-otlp" +version = "0.10.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9d1a6ca9de4c8b00aa7f1a153bd76cb263287155cec642680d79d98706f3d28a" +dependencies = [ + "async-trait", + "futures", + "futures-util", + "http", + "opentelemetry", + "prost", + "thiserror", + "tokio", + "tonic", + "tonic-build", +] + +[[package]] +name = "ordered-float" +version = "3.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2fc2dbde8f8a79f2102cc474ceb0ad68e3b80b85289ea62389b60e66777e4213" +dependencies = [ + "num-traits", +] + +[[package]] +name = "os_info" +version = "3.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "006e42d5b888366f1880eda20371fedde764ed2213dc8496f49622fa0c99cd5e" +dependencies = [ + "log", + "serde", + "winapi", +] + +[[package]] +name = "ouroboros" +version = "0.17.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e2ba07320d39dfea882faa70554b4bd342a5f273ed59ba7c1c6b4c840492c954" +dependencies = [ + "aliasable", + "ouroboros_macro", + "static_assertions", +] + +[[package]] +name = "ouroboros_macro" +version = "0.17.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ec4c6225c69b4ca778c0aea097321a64c421cf4577b331c61b229267edabb6f8" +dependencies = [ + "heck 0.4.1", + "proc-macro-error", + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "overload" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b15813163c1d831bf4a13c3610c05c0d03b39feb07f7e09fa234dac9b15aaf39" + +[[package]] +name = "p12" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d4873306de53fe82e7e484df31e1e947d61514b6ea2ed6cd7b45d63006fd9224" +dependencies = [ + "cbc", + "cipher 0.4.4", + "des", + "getrandom", + "hmac", + "lazy_static", + "rc2", + "sha1", + "yasna", +] + +[[package]] +name = "p256" +version = "0.13.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c9863ad85fa8f4460f9c48cb909d38a0d689dba1f6f6988a5e3e0d31071bcd4b" +dependencies = [ + "ecdsa", + "elliptic-curve", + "primeorder", + "sha2", +] + +[[package]] +name = "p384" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "70786f51bcc69f6a4c0360e063a4cac5419ef7c5cd5b3c99ad70f3be5ba79209" +dependencies = [ + "ecdsa", + "elliptic-curve", + "primeorder", + "sha2", +] + +[[package]] +name = "parking" +version = "2.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "14f2252c834a40ed9bb5422029649578e63aa341ac401f74e719dd1afda8394e" + +[[package]] +name = "parking_lot" +version = "0.12.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3742b2c103b9f06bc9fff0a37ff4912935851bee6d36f3c02bcc755bcfec228f" +dependencies = [ + "lock_api", + "parking_lot_core", +] + +[[package]] +name = "parking_lot_core" +version = "0.9.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "93f00c865fe7cabf650081affecd3871070f26767e7b2070a3ffae14c654b447" +dependencies = [ + "cfg-if", + "libc", + "redox_syscall", + "smallvec", + "windows-targets", +] + +[[package]] +name = "paste" +version = "1.0.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "de3145af08024dea9fa9914f381a17b8fc6034dfb00f3a84013f7ff43f29ed4c" + +[[package]] +name = "pear" +version = "0.2.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "61a386cd715229d399604b50d1361683fe687066f42d56f54be995bc6868f71c" +dependencies = [ + "inlinable_string", + "pear_codegen", + "yansi", +] + +[[package]] +name = "pear_codegen" +version = "0.2.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "da9f0f13dac8069c139e8300a6510e3f4143ecf5259c60b116a9b271b4ca0d54" +dependencies = [ + "proc-macro2", + "proc-macro2-diagnostics", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "pem-rfc7468" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "24d159833a9105500e0398934e205e0773f0b27529557134ecfc51c27646adac" +dependencies = [ + "base64ct", +] + +[[package]] +name = "pem-rfc7468" +version = "0.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "88b39c9bfcfc231068454382784bb460aae594343fb030d46e9f50a645418412" +dependencies = [ + "base64ct", +] + +[[package]] +name = "percent-encoding" +version = "2.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9b2a4787296e9989611394c33f193f676704af1686e70b8f8033ab5ba9a35a94" + +[[package]] +name = "petgraph" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4dd7d28ee937e54fe3080c91faa1c3a46c06de6252988a7f4592ba2310ef22a4" +dependencies = [ + "fixedbitset", + "indexmap 1.9.3", +] + +[[package]] +name = "pin-project" +version = "1.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "030ad2bc4db10a8944cb0d837f158bdfec4d4a4873ab701a95046770d11f8842" +dependencies = [ + "pin-project-internal", +] + +[[package]] +name = "pin-project-internal" +version = "1.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ec2e072ecce94ec471b13398d5402c188e76ac03cf74dd1a975161b23a3f6d9c" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "pin-project-lite" +version = "0.2.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4c40d25201921e5ff0c862a505c6557ea88568a4e3ace775ab55e93f2f4f9d57" + +[[package]] +name = "pin-utils" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" + +[[package]] +name = "pinky-swear" +version = "6.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d894b67aa7a4bf295db5e85349078c604edaa6fa5c8721e8eca3c7729a27f2ac" +dependencies = [ + "doc-comment", + "flume", + "parking_lot", + "tracing", +] + +[[package]] +name = "pkcs1" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "eff33bdbdfc54cc98a2eca766ebdec3e1b8fb7387523d5c9c9a2891da856f719" +dependencies = [ + "der 0.6.1", + "pkcs8 0.9.0", + "spki 0.6.0", + "zeroize", +] + +[[package]] +name = "pkcs1" +version = "0.7.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c8ffb9f10fa047879315e6625af03c164b16962a5368d724ed16323b68ace47f" +dependencies = [ + "der 0.7.8", + "pkcs8 0.10.2", + "spki 0.7.2", +] + +[[package]] +name = "pkcs8" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9eca2c590a5f85da82668fa685c09ce2888b9430e83299debf1f34b65fd4a4ba" +dependencies = [ + "der 0.6.1", + "spki 0.6.0", +] + +[[package]] +name = "pkcs8" +version = "0.10.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f950b2377845cebe5cf8b5165cb3cc1a5e0fa5cfa3e1f7f55707d8fd82e0a7b7" +dependencies = [ + "der 0.7.8", + "spki 0.7.2", +] + +[[package]] +name = "pkg-config" +version = "0.3.27" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "26072860ba924cbfa98ea39c8c19b4dd6a4a25423dbdf219c1eca91aa0cf6964" + +[[package]] +name = "polling" +version = "2.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4b2d323e8ca7996b3e23126511a523f7e62924d93ecd5ae73b333815b0eb3dce" +dependencies = [ + "autocfg", + "bitflags 1.3.2", + "cfg-if", + "concurrent-queue", + "libc", + "log", + "pin-project-lite", + "windows-sys", +] + +[[package]] +name = "poly1305" +version = "0.7.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "048aeb476be11a4b6ca432ca569e375810de9294ae78f4774e78ea98a9246ede" +dependencies = [ + "cpufeatures", + "opaque-debug", + "universal-hash", +] + +[[package]] +name = "ppv-lite86" +version = "0.2.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5b40af805b3121feab8a3c29f04d8ad262fa8e0561883e7653e024ae4479e6de" + +[[package]] +name = "primeorder" +version = "0.13.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3c2fcef82c0ec6eefcc179b978446c399b3cdf73c392c35604e399eee6df1ee3" +dependencies = [ + "elliptic-curve", +] + +[[package]] +name = "proc-macro-crate" +version = "1.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f4c021e1093a56626774e81216a4ce732a735e5bad4868a03f3ed65ca0c3919" +dependencies = [ + "once_cell", + "toml_edit", +] + +[[package]] +name = "proc-macro-error" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "da25490ff9892aab3fcf7c36f08cfb902dd3e71ca0f9f9517bea02a73a5ce38c" +dependencies = [ + "proc-macro-error-attr", + "proc-macro2", + "quote", + "syn 1.0.109", + "version_check", +] + +[[package]] +name = "proc-macro-error-attr" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a1be40180e52ecc98ad80b184934baf3d0d29f979574e439af5a55274b35f869" +dependencies = [ + "proc-macro2", + "quote", + "version_check", +] + +[[package]] +name = "proc-macro2" +version = "1.0.66" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "18fb31db3f9bddb2ea821cde30a9f70117e3f119938b5ee630b7403aa6e2ead9" +dependencies = [ + "unicode-ident", +] + +[[package]] +name = "proc-macro2-diagnostics" +version = "0.10.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "af066a9c399a26e020ada66a034357a868728e72cd426f3adcd35f80d88d88c8" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", + "version_check", + "yansi", +] + +[[package]] +name = "prost" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "444879275cb4fd84958b1a1d5420d15e6fcf7c235fe47f053c9c2a80aceb6001" +dependencies = [ + "bytes", + "prost-derive", +] + +[[package]] +name = "prost-build" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "62941722fb675d463659e49c4f3fe1fe792ff24fe5bbaa9c08cd3b98a1c354f5" +dependencies = [ + "bytes", + "heck 0.3.3", + "itertools", + "lazy_static", + "log", + "multimap", + "petgraph", + "prost", + "prost-types", + "regex", + "tempfile", + "which", +] + +[[package]] +name = "prost-derive" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f9cc1a3263e07e0bf68e96268f37665207b49560d98739662cdfaae215c720fe" +dependencies = [ + "anyhow", + "itertools", + "proc-macro2", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "prost-types" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "534b7a0e836e3c482d2693070f982e39e7611da9695d4d1f5a4b186b51faef0a" +dependencies = [ + "bytes", + "prost", +] + +[[package]] +name = "quick-error" +version = "1.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a1d01941d82fa2ab50be1e79e6714289dd7cde78eba4c074bc5a4374f650dfe0" + +[[package]] +name = "quote" +version = "1.0.32" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50f3b39ccfb720540debaa0164757101c08ecb8d326b15358ce76a62c7e85965" +dependencies = [ + "proc-macro2", +] + +[[package]] +name = "rand" +version = "0.8.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "34af8d1a0e25924bc5b7c43c079c942339d8f0a8b57c39049bef581b46327404" +dependencies = [ + "libc", + "rand_chacha", + "rand_core", +] + +[[package]] +name = "rand_chacha" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88" +dependencies = [ + "ppv-lite86", + "rand_core", +] + +[[package]] +name = "rand_core" +version = "0.6.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ec0be4795e2f6a28069bec0b5ff3e2ac9bafc99e6a9a7dc3547996c5c816922c" +dependencies = [ + "getrandom", +] + +[[package]] +name = "rc2" +version = "0.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "62c64daa8e9438b84aaae55010a93f396f8e60e3911590fcba770d04643fc1dd" +dependencies = [ + "cipher 0.4.4", +] + +[[package]] +name = "reactor-trait" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "438a4293e4d097556730f4711998189416232f009c137389e0f961d2bc0ddc58" +dependencies = [ + "async-trait", + "futures-core", + "futures-io", +] + +[[package]] +name = "redis" +version = "0.23.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3ea8c51b5dc1d8e5fd3350ec8167f464ec0995e79f2e90a075b63371500d557f" +dependencies = [ + "async-trait", + "bytes", + "combine", + "crc16", + "futures", + "futures-util", + "itoa", + "log", + "native-tls", + "percent-encoding", + "pin-project-lite", + "rand", + "ryu", + "sha1_smol", + "tokio", + "tokio-native-tls", + "tokio-util 0.7.8", + "url", +] + +[[package]] +name = "redox_syscall" +version = "0.3.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "567664f262709473930a4bf9e51bf2ebf3348f2e748ccc50dea20646858f8f29" +dependencies = [ + "bitflags 1.3.2", +] + +[[package]] +name = "regex" +version = "1.9.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2eae68fc220f7cf2532e4494aded17545fce192d59cd996e0fe7887f4ceb575" +dependencies = [ + "aho-corasick", + "memchr", + "regex-automata 0.3.3", + "regex-syntax 0.7.4", +] + +[[package]] +name = "regex-automata" +version = "0.1.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6c230d73fb8d8c1b9c0b3135c5142a8acee3a0558fb8db5cf1cb65f8d7862132" +dependencies = [ + "regex-syntax 0.6.29", +] + +[[package]] +name = "regex-automata" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "39354c10dd07468c2e73926b23bb9c2caca74c5501e38a35da70406f1d923310" +dependencies = [ + "aho-corasick", + "memchr", + "regex-syntax 0.7.4", +] + +[[package]] +name = "regex-syntax" +version = "0.6.29" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f162c6dd7b008981e4d40210aca20b4bd0f9b60ca9271061b07f78537722f2e1" + +[[package]] +name = "regex-syntax" +version = "0.7.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e5ea92a5b6195c6ef2a0295ea818b312502c6fc94dde986c5553242e18fd4ce2" + +[[package]] +name = "reqwest" +version = "0.11.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cde824a14b7c14f85caff81225f411faacc04a2013f41670f41443742b1c1c55" +dependencies = [ + "base64 0.21.2", + "bytes", + "encoding_rs", + "futures-core", + "futures-util", + "h2", + "http", + "http-body", + "hyper", + "hyper-rustls", + "hyper-tls", + "ipnet", + "js-sys", + "log", + "mime", + "mime_guess", + "native-tls", + "once_cell", + "percent-encoding", + "pin-project-lite", + "rustls", + "rustls-pemfile", + "serde", + "serde_json", + "serde_urlencoded", + "tokio", + "tokio-native-tls", + "tokio-rustls", + "tower-service", + "trust-dns-resolver", + "url", + "wasm-bindgen", + "wasm-bindgen-futures", + "web-sys", + "webpki-roots 0.22.6", + "winreg 0.10.1", +] + +[[package]] +name = "resolv-conf" +version = "0.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "52e44394d2086d010551b14b53b1f24e31647570cd1deb0379e2c21b329aba00" +dependencies = [ + "hostname", + "quick-error", +] + +[[package]] +name = "rfc6979" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f8dd2a808d456c4a54e300a23e9f5a67e122c3024119acbfd73e3bf664491cb2" +dependencies = [ + "hmac", + "subtle", +] + +[[package]] +name = "ring" +version = "0.16.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3053cf52e236a3ed746dfc745aa9cacf1b791d846bdaf412f60a8d7d6e17c8fc" +dependencies = [ + "cc", + "libc", + "once_cell", + "spin 0.5.2", + "untrusted", + "web-sys", + "winapi", +] + +[[package]] +name = "rsa" +version = "0.7.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "094052d5470cbcef561cb848a7209968c9f12dfa6d668f4bca048ac5de51099c" +dependencies = [ + "byteorder", + "digest", + "num-bigint-dig", + "num-integer", + "num-iter", + "num-traits", + "pkcs1 0.4.1", + "pkcs8 0.9.0", + "rand_core", + "signature 1.6.4", + "smallvec", + "subtle", + "zeroize", +] + +[[package]] +name = "rsa" +version = "0.9.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6ab43bb47d23c1a631b4b680199a45255dce26fa9ab2fa902581f624ff13e6a8" +dependencies = [ + "byteorder", + "const-oid", + "digest", + "num-bigint-dig", + "num-integer", + "num-iter", + "num-traits", + "pkcs1 0.7.5", + "pkcs8 0.10.2", + "rand_core", + "signature 2.1.0", + "spki 0.7.2", + "subtle", + "zeroize", +] + +[[package]] +name = "rustc-demangle" +version = "0.1.23" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d626bb9dae77e28219937af045c257c28bfd3f69333c512553507f5f9798cb76" + +[[package]] +name = "rustc_version" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bfa0f585226d2e68097d4f95d113b15b83a82e819ab25717ec0590d9584ef366" +dependencies = [ + "semver", +] + +[[package]] +name = "rustix" +version = "0.37.23" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4d69718bf81c6127a49dc64e44a742e8bb9213c0ff8869a22c308f84c1d4ab06" +dependencies = [ + "bitflags 1.3.2", + "errno", + "io-lifetimes", + "libc", + "linux-raw-sys 0.3.8", + "windows-sys", +] + +[[package]] +name = "rustix" +version = "0.38.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0a962918ea88d644592894bc6dc55acc6c0956488adcebbfb6e273506b7fd6e5" +dependencies = [ + "bitflags 2.3.3", + "errno", + "libc", + "linux-raw-sys 0.4.3", + "windows-sys", +] + +[[package]] +name = "rustls" +version = "0.21.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "79ea77c539259495ce8ca47f53e66ae0330a8819f67e23ac96ca02f50e7b7d36" +dependencies = [ + "log", + "ring", + "rustls-webpki", + "sct", +] + +[[package]] +name = "rustls-connector" +version = "0.18.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "060bcc1795b840d0e56d78f3293be5f652aa1611d249b0e63ffe19f4a8c9ae23" +dependencies = [ + "log", + "rustls", + "rustls-native-certs", + "rustls-webpki", +] + +[[package]] +name = "rustls-native-certs" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a9aace74cb666635c918e9c12bc0d348266037aa8eb599b5cba565709a8dff00" +dependencies = [ + "openssl-probe", + "rustls-pemfile", + "schannel", + "security-framework", +] + +[[package]] +name = "rustls-pemfile" +version = "1.0.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2d3987094b1d07b653b7dfdc3f70ce9a1da9c51ac18c1b06b662e4f9a0e9f4b2" +dependencies = [ + "base64 0.21.2", +] + +[[package]] +name = "rustls-webpki" +version = "0.101.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7d93931baf2d282fff8d3a532bbfd7653f734643161b87e3e01e59a04439bf0d" +dependencies = [ + "ring", + "untrusted", +] + +[[package]] +name = "rustversion" +version = "1.0.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7ffc183a10b4478d04cbbbfc96d0873219d962dd5accaff2ffbd4ceb7df837f4" + +[[package]] +name = "ryu" +version = "1.0.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1ad4cc8da4ef723ed60bced201181d83791ad433213d8c24efffda1eec85d741" + +[[package]] +name = "schannel" +version = "0.1.22" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0c3733bf4cf7ea0880754e19cb5a462007c4a8c1914bff372ccc95b464f1df88" +dependencies = [ + "windows-sys", +] + +[[package]] +name = "schemars" +version = "0.8.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "02c613288622e5f0c3fdc5dbd4db1c5fbe752746b1d1a56a0630b78fd00de44f" +dependencies = [ + "chrono", + "dyn-clone", + "indexmap 1.9.3", + "schemars_derive", + "serde", + "serde_json", + "url", +] + +[[package]] +name = "schemars_derive" +version = "0.8.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "109da1e6b197438deb6db99952990c7f959572794b80ff93707d55a232545e7c" +dependencies = [ + "proc-macro2", + "quote", + "serde_derive_internals", + "syn 1.0.109", +] + +[[package]] +name = "scopeguard" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "94143f37725109f92c262ed2cf5e59bce7498c01bcc1502d7b9afe439a4e9f49" + +[[package]] +name = "sct" +version = "0.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d53dcdb7c9f8158937a7981b48accfd39a43af418591a5d008c7b22b5e1b7ca4" +dependencies = [ + "ring", + "untrusted", +] + +[[package]] +name = "sea-bae" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3bd3534a9978d0aa7edd2808dc1f8f31c4d0ecd31ddf71d997b3c98e9f3c9114" +dependencies = [ + "heck 0.4.1", + "proc-macro-error", + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "sea-orm" +version = "0.12.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "61f6c7daef05dde3476d97001e11fca7a52b655aa3bf4fd610ab2da1176a2ed5" +dependencies = [ + "async-stream", + "async-trait", + "chrono", + "futures", + "log", + "ouroboros", + "sea-orm-macros", + "sea-query", + "sea-query-binder", + "serde", + "serde_json", + "sqlx", + "strum 0.25.0", + "thiserror", + "time 0.3.23", + "tracing", + "url", + "uuid", +] + +[[package]] +name = "sea-orm-macros" +version = "0.12.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cd90e73d5f5b184bad525767da29fbfec132b4e62ebd6f60d2f2737ec6468f62" +dependencies = [ + "heck 0.4.1", + "proc-macro2", + "quote", + "sea-bae", + "syn 2.0.29", + "unicode-ident", +] + +[[package]] +name = "sea-query" +version = "0.30.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6aeb899964df7038e7274306b742951b82a04f835bca8a4683a4c254a6bf35fa" +dependencies = [ + "chrono", + "derivative", + "inherent", + "ordered-float", + "serde_json", +] + +[[package]] +name = "sea-query-binder" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "36bbb68df92e820e4d5aeb17b4acd5cc8b5d18b2c36a4dd6f4626aabfa7ab1b9" +dependencies = [ + "chrono", + "sea-query", + "serde_json", + "sqlx", +] + +[[package]] +name = "sec1" +version = "0.7.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d3e97a565f76233a6003f9f5c54be1d9c5bdfa3eccfb189469f11ec4901c47dc" +dependencies = [ + "base16ct", + "der 0.7.8", + "generic-array", + "pkcs8 0.10.2", + "subtle", + "zeroize", +] + +[[package]] +name = "security-framework" +version = "2.9.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "05b64fb303737d99b81884b2c63433e9ae28abebe5eb5045dcdd175dc2ecf4de" +dependencies = [ + "bitflags 1.3.2", + "core-foundation", + "core-foundation-sys", + "libc", + "security-framework-sys", +] + +[[package]] +name = "security-framework-sys" +version = "2.9.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e932934257d3b408ed8f30db49d85ea163bfe74961f017f405b025af298f0c7a" +dependencies = [ + "core-foundation-sys", + "libc", +] + +[[package]] +name = "semver" +version = "1.0.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b0293b4b29daaf487284529cc2f5675b8e57c61f70167ba415a463651fd6a918" + +[[package]] +name = "sentry" +version = "0.31.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "01b0ad16faa5d12372f914ed40d00bda21a6d1bdcc99264c5e5e1c9495cf3654" +dependencies = [ + "httpdate", + "native-tls", + "reqwest", + "sentry-backtrace", + "sentry-contexts", + "sentry-core", + "sentry-debug-images", + "sentry-panic", + "sentry-tracing", + "tokio", + "ureq", +] + +[[package]] +name = "sentry-backtrace" +version = "0.31.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "11f2ee8f147bb5f22ac59b5c35754a759b9a6f6722402e2a14750b2a63fc59bd" +dependencies = [ + "backtrace", + "once_cell", + "regex", + "sentry-core", +] + +[[package]] +name = "sentry-contexts" +version = "0.31.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dcd133362c745151eeba0ac61e3ba8350f034e9fe7509877d08059fe1d7720c6" +dependencies = [ + "hostname", + "libc", + "os_info", + "rustc_version", + "sentry-core", + "uname", +] + +[[package]] +name = "sentry-core" +version = "0.31.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7163491708804a74446642ff2c80b3acd668d4b9e9f497f85621f3d250fd012b" +dependencies = [ + "once_cell", + "rand", + "sentry-types", + "serde", + "serde_json", +] + +[[package]] +name = "sentry-debug-images" +version = "0.31.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6a5003d7ff08aa3b2b76994080b183e8cfa06c083e280737c9cee02ca1c70f5e" +dependencies = [ + "findshlibs", + "once_cell", + "sentry-core", +] + +[[package]] +name = "sentry-panic" +version = "0.31.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c4dfe8371c9b2e126a8b64f6fefa54cef716ff2a50e63b5558a48b899265bccd" +dependencies = [ + "sentry-backtrace", + "sentry-core", +] + +[[package]] +name = "sentry-tracing" +version = "0.31.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5aca8b88978677a27ee1a91beafe4052306c474c06f582321fde72d2e2cc2f7f" +dependencies = [ + "sentry-backtrace", + "sentry-core", + "tracing-core", + "tracing-subscriber", +] + +[[package]] +name = "sentry-types" +version = "0.31.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9e7a88e0c1922d19b3efee12a8215f6a8a806e442e665ada71cc222cab72985f" +dependencies = [ + "debugid", + "getrandom", + "hex", + "serde", + "serde_json", + "thiserror", + "time 0.3.23", + "url", + "uuid", +] + +[[package]] +name = "serde" +version = "1.0.185" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "be9b6f69f1dfd54c3b568ffa45c310d6973a5e5148fd40cf515acaf38cf5bc31" +dependencies = [ + "serde_derive", +] + +[[package]] +name = "serde_derive" +version = "1.0.185" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dc59dfdcbad1437773485e0367fea4b090a2e0a16d9ffc46af47764536a298ec" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "serde_derive_internals" +version = "0.26.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "85bf8229e7920a9f636479437026331ce11aa132b4dde37d121944a44d6e5f3c" +dependencies = [ + "proc-macro2", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "serde_json" +version = "1.0.103" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d03b412469450d4404fe8499a268edd7f8b79fecb074b0d812ad64ca21f4031b" +dependencies = [ + "itoa", + "ryu", + "serde", +] + +[[package]] +name = "serde_path_to_error" +version = "0.1.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4beec8bce849d58d06238cb50db2e1c417cfeafa4c63f692b15c82b7c80f8335" +dependencies = [ + "itoa", + "serde", +] + +[[package]] +name = "serde_qs" +version = "0.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c679fa27b429f2bb57fd4710257e643e86c966e716037259f8baa33de594a1b6" +dependencies = [ + "axum", + "futures", + "percent-encoding", + "serde", + "thiserror", +] + +[[package]] +name = "serde_spanned" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "96426c9936fd7a0124915f9185ea1d20aa9445cc9821142f0a73bc9207a2e186" +dependencies = [ + "serde", +] + +[[package]] +name = "serde_urlencoded" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d3491c14715ca2294c4d6a88f15e84739788c1d030eed8c110436aafdaa2f3fd" +dependencies = [ + "form_urlencoded", + "itoa", + "ryu", + "serde", +] + +[[package]] +name = "sha1" +version = "0.10.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f04293dc80c3993519f2d7f6f511707ee7094fe0c6d3406feb330cdb3540eba3" +dependencies = [ + "cfg-if", + "cpufeatures", + "digest", +] + +[[package]] +name = "sha1_smol" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ae1a47186c03a32177042e55dbc5fd5aee900b8e0069a8d70fba96a9375cd012" + +[[package]] +name = "sha2" +version = "0.10.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "479fb9d862239e610720565ca91403019f2f00410f1864c5aa7479b950a76ed8" +dependencies = [ + "cfg-if", + "cpufeatures", + "digest", +] + +[[package]] +name = "sharded-slab" +version = "0.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "900fba806f70c630b0a382d0d825e17a0f19fcd059a2ade1ff237bcddf446b31" +dependencies = [ + "lazy_static", +] + +[[package]] +name = "signal-hook-registry" +version = "1.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d8229b473baa5980ac72ef434c4415e70c4b5e71b423043adb4ba059f89c99a1" +dependencies = [ + "libc", +] + +[[package]] +name = "signature" +version = "1.6.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "74233d3b3b2f6d4b006dc19dee745e73e2a6bfb6f93607cd3b02bd5b00797d7c" +dependencies = [ + "digest", + "rand_core", +] + +[[package]] +name = "signature" +version = "2.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5e1788eed21689f9cf370582dfc467ef36ed9c707f073528ddafa8d83e3b8500" +dependencies = [ + "digest", + "rand_core", +] + +[[package]] +name = "slab" +version = "0.4.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6528351c9bc8ab22353f9d776db39a20288e8d6c37ef8cfe3317cf875eecfc2d" +dependencies = [ + "autocfg", +] + +[[package]] +name = "smallvec" +version = "1.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "62bb4feee49fdd9f707ef802e22365a35de4b7b299de4763d44bfea899442ff9" + +[[package]] +name = "socket2" +version = "0.4.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "64a4a911eed85daf18834cfaa86a79b7d266ff93ff5ba14005426219480ed662" +dependencies = [ + "libc", + "winapi", +] + +[[package]] +name = "socket2" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2538b18701741680e0322a2302176d3253a35388e2e62f172f64f4f16605f877" +dependencies = [ + "libc", + "windows-sys", +] + +[[package]] +name = "spin" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6e63cff320ae2c57904679ba7cb63280a3dc4613885beafb148ee7bf9aa9042d" + +[[package]] +name = "spin" +version = "0.9.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6980e8d7511241f8acf4aebddbb1ff938df5eebe98691418c4468d0b72a96a67" +dependencies = [ + "lock_api", +] + +[[package]] +name = "spki" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "67cf02bbac7a337dc36e4f5a693db6c21e7863f45070f7064577eb4367a3212b" +dependencies = [ + "base64ct", + "der 0.6.1", +] + +[[package]] +name = "spki" +version = "0.7.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9d1e996ef02c474957d681f1b05213dfb0abab947b446a62d37770b23500184a" +dependencies = [ + "base64ct", + "der 0.7.8", +] + +[[package]] +name = "sqlformat" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0c12bc9199d1db8234678b7051747c07f517cdcf019262d1847b94ec8b1aee3e" +dependencies = [ + "itertools", + "nom", + "unicode_categories", +] + +[[package]] +name = "sqlx" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8e58421b6bc416714d5115a2ca953718f6c621a51b68e4f4922aea5a4391a721" +dependencies = [ + "sqlx-core", + "sqlx-macros", + "sqlx-mysql", + "sqlx-postgres", + "sqlx-sqlite", +] + +[[package]] +name = "sqlx-core" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dd4cef4251aabbae751a3710927945901ee1d97ee96d757f6880ebb9a79bfd53" +dependencies = [ + "ahash", + "atoi", + "byteorder", + "bytes", + "chrono", + "crc", + "crossbeam-queue", + "dotenvy", + "either", + "event-listener", + "futures-channel", + "futures-core", + "futures-intrusive", + "futures-io", + "futures-util", + "hashlink", + "hex", + "indexmap 2.0.0", + "log", + "memchr", + "once_cell", + "paste", + "percent-encoding", + "rustls", + "rustls-pemfile", + "serde", + "serde_json", + "sha2", + "smallvec", + "sqlformat", + "thiserror", + "tokio", + "tokio-stream", + "tracing", + "url", + "webpki-roots 0.24.0", +] + +[[package]] +name = "sqlx-macros" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "208e3165167afd7f3881b16c1ef3f2af69fa75980897aac8874a0696516d12c2" +dependencies = [ + "proc-macro2", + "quote", + "sqlx-core", + "sqlx-macros-core", + "syn 1.0.109", +] + +[[package]] +name = "sqlx-macros-core" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8a4a8336d278c62231d87f24e8a7a74898156e34c1c18942857be2acb29c7dfc" +dependencies = [ + "dotenvy", + "either", + "heck 0.4.1", + "hex", + "once_cell", + "proc-macro2", + "quote", + "serde", + "serde_json", + "sha2", + "sqlx-core", + "sqlx-mysql", + "sqlx-postgres", + "sqlx-sqlite", + "syn 1.0.109", + "tempfile", + "tokio", + "url", +] + +[[package]] +name = "sqlx-mysql" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ca69bf415b93b60b80dc8fda3cb4ef52b2336614d8da2de5456cc942a110482" +dependencies = [ + "atoi", + "base64 0.21.2", + "bitflags 2.3.3", + "byteorder", + "bytes", + "chrono", + "crc", + "digest", + "dotenvy", + "either", + "futures-channel", + "futures-core", + "futures-io", + "futures-util", + "generic-array", + "hex", + "hkdf", + "hmac", + "itoa", + "log", + "md-5", + "memchr", + "once_cell", + "percent-encoding", + "rand", + "rsa 0.9.2", + "serde", + "sha1", + "sha2", + "smallvec", + "sqlx-core", + "stringprep", + "thiserror", + "tracing", + "whoami", +] + +[[package]] +name = "sqlx-postgres" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a0db2df1b8731c3651e204629dd55e52adbae0462fa1bdcbed56a2302c18181e" +dependencies = [ + "atoi", + "base64 0.21.2", + "bitflags 2.3.3", + "byteorder", + "chrono", + "crc", + "dotenvy", + "etcetera", + "futures-channel", + "futures-core", + "futures-io", + "futures-util", + "hex", + "hkdf", + "hmac", + "home", + "itoa", + "log", + "md-5", + "memchr", + "once_cell", + "rand", + "serde", + "serde_json", + "sha1", + "sha2", + "smallvec", + "sqlx-core", + "stringprep", + "thiserror", + "tracing", + "whoami", +] + +[[package]] +name = "sqlx-sqlite" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "be4c21bf34c7cae5b283efb3ac1bcc7670df7561124dc2f8bdc0b59be40f79a2" +dependencies = [ + "atoi", + "chrono", + "flume", + "futures-channel", + "futures-core", + "futures-executor", + "futures-intrusive", + "futures-util", + "libsqlite3-sys", + "log", + "percent-encoding", + "serde", + "sqlx-core", + "tracing", + "url", +] + +[[package]] +name = "static_assertions" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a2eb9349b6444b326872e140eb1cf5e7c522154d69e7a0ffb0fb81c06b37543f" + +[[package]] +name = "stringprep" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "db3737bde7edce97102e0e2b15365bf7a20bfdb5f60f4f9e8d7004258a51a8da" +dependencies = [ + "unicode-bidi", + "unicode-normalization", +] + +[[package]] +name = "strsim" +version = "0.10.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "73473c0e59e6d5812c5dfe2a064a6444949f089e20eec9a2e5506596494e4623" + +[[package]] +name = "strum" +version = "0.24.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "063e6045c0e62079840579a7e47a355ae92f60eb74daaf156fb1e84ba164e63f" +dependencies = [ + "strum_macros", +] + +[[package]] +name = "strum" +version = "0.25.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "290d54ea6f91c969195bdbcd7442c8c2a2ba87da8bf60a7ee86a235d4bc1e125" + +[[package]] +name = "strum_macros" +version = "0.24.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e385be0d24f186b4ce2f9982191e7101bb737312ad61c1f2f984f34bcf85d59" +dependencies = [ + "heck 0.4.1", + "proc-macro2", + "quote", + "rustversion", + "syn 1.0.109", +] + +[[package]] +name = "subtle" +version = "2.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6bdef32e8150c2a081110b42772ffe7d7c9032b606bc226c8260fd97e0976601" + +[[package]] +name = "svix" +version = "0.60.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e4a0071892c06482d6585e7b15146b088f777d4da18aa924d9f960d59b7e4f4" +dependencies = [ + "base64 0.13.1", + "hmac-sha256", + "http", + "reqwest", + "serde", + "serde_derive", + "serde_json", + "thiserror", + "time 0.3.23", + "url", +] + +[[package]] +name = "svix-ksuid" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8c0c2b19ae442a1842ba35f7eeff46e684bb24cb4a9571f41b48e5181e5eadd5" +dependencies = [ + "base-encode", + "byteorder", + "chrono", + "getrandom", +] + +[[package]] +name = "svix-server" +version = "1.13.0" +dependencies = [ + "aide", + "anyhow", + "axum", + "axum-server", + "base64 0.13.1", + "bb8", + "bb8-redis", + "blake2", + "bytes", + "chacha20poly1305", + "chrono", + "clap", + "dotenv", + "ed25519-compact 1.0.16", + "enum_dispatch", + "figment", + "form_urlencoded", + "futures", + "hmac-sha256", + "http", + "hyper", + "hyper-openssl", + "indexmap 1.9.3", + "ipnet", + "jsonschema", + "jwt-simple", + "lapin", + "num_enum", + "once_cell", + "openssl", + "opentelemetry", + "opentelemetry-http", + "opentelemetry-otlp", + "rand", + "redis", + "regex", + "reqwest", + "schemars", + "sea-orm", + "sentry", + "serde", + "serde_json", + "serde_path_to_error", + "serde_urlencoded", + "sha2", + "sqlx", + "strum 0.24.1", + "strum_macros", + "svix", + "svix-ksuid", + "svix-server_derive", + "thiserror", + "tikv-jemallocator", + "time 0.3.23", + "tokio", + "tower", + "tower-http 0.4.3", + "tracing", + "tracing-opentelemetry", + "tracing-subscriber", + "trust-dns-resolver", + "url", + "urlencoding", + "validator", +] + +[[package]] +name = "svix-server_derive" +version = "0.1.0" +dependencies = [ + "proc-macro2", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "syn" +version = "1.0.109" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "72b64191b275b66ffe2469e8af2c1cfe3bafa67b529ead792a6d0160888b4237" +dependencies = [ + "proc-macro2", + "quote", + "unicode-ident", +] + +[[package]] +name = "syn" +version = "2.0.29" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c324c494eba9d92503e6f1ef2e6df781e78f6a7705a0202d9801b198807d518a" +dependencies = [ + "proc-macro2", + "quote", + "unicode-ident", +] + +[[package]] +name = "sync_wrapper" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2047c6ded9c721764247e62cd3b03c09ffc529b2ba5b10ec482ae507a4a70160" + +[[package]] +name = "tcp-stream" +version = "0.26.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4da30af7998f51ee1aa48ab24276fe303a697b004e31ff542b192c088d5630a5" +dependencies = [ + "cfg-if", + "p12", + "rustls-connector", + "rustls-pemfile", +] + +[[package]] +name = "tempfile" +version = "3.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5486094ee78b2e5038a6382ed7645bc084dc2ec433426ca4c3cb61e2007b8998" +dependencies = [ + "cfg-if", + "fastrand 2.0.0", + "redox_syscall", + "rustix 0.38.4", + "windows-sys", +] + +[[package]] +name = "thiserror" +version = "1.0.44" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "611040a08a0439f8248d1990b111c95baa9c704c805fa1f62104b39655fd7f90" +dependencies = [ + "thiserror-impl", +] + +[[package]] +name = "thiserror-impl" +version = "1.0.44" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "090198534930841fab3a5d1bb637cde49e339654e606195f8d9c76eeb081dc96" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "thread_local" +version = "1.1.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3fdd6f064ccff2d6567adcb3873ca630700f00b5ad3f060c25b5dcfd9a4ce152" +dependencies = [ + "cfg-if", + "once_cell", +] + +[[package]] +name = "tikv-jemalloc-sys" +version = "0.5.4+5.3.0-patched" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9402443cb8fd499b6f327e40565234ff34dbda27460c5b47db0db77443dd85d1" +dependencies = [ + "cc", + "libc", +] + +[[package]] +name = "tikv-jemallocator" +version = "0.5.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "965fe0c26be5c56c94e38ba547249074803efd52adfb66de62107d95aab3eaca" +dependencies = [ + "libc", + "tikv-jemalloc-sys", +] + +[[package]] +name = "time" +version = "0.1.45" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1b797afad3f312d1c66a56d11d0316f916356d11bd158fbc6ca6389ff6bf805a" +dependencies = [ + "libc", + "wasi 0.10.0+wasi-snapshot-preview1", + "winapi", +] + +[[package]] +name = "time" +version = "0.3.23" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "59e399c068f43a5d116fedaf73b203fa4f9c519f17e2b34f63221d3792f81446" +dependencies = [ + "itoa", + "serde", + "time-core", + "time-macros", +] + +[[package]] +name = "time-core" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7300fbefb4dadc1af235a9cef3737cea692a9d97e1b9cbcd4ebdae6f8868e6fb" + +[[package]] +name = "time-macros" +version = "0.2.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "96ba15a897f3c86766b757e5ac7221554c6750054d74d5b28844fce5fb36a6c4" +dependencies = [ + "time-core", +] + +[[package]] +name = "tinyvec" +version = "1.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "87cc5ceb3875bb20c2890005a4e226a4651264a5c75edb2421b52861a0a0cb50" +dependencies = [ + "tinyvec_macros", +] + +[[package]] +name = "tinyvec_macros" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20" + +[[package]] +name = "tokio" +version = "1.29.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "532826ff75199d5833b9d2c5fe410f29235e25704ee5f0ef599fb51c21f4a4da" +dependencies = [ + "autocfg", + "backtrace", + "bytes", + "libc", + "mio", + "num_cpus", + "parking_lot", + "pin-project-lite", + "signal-hook-registry", + "socket2 0.4.9", + "tokio-macros", + "windows-sys", +] + +[[package]] +name = "tokio-io-timeout" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "30b74022ada614a1b4834de765f9bb43877f910cc8ce4be40e89042c9223a8bf" +dependencies = [ + "pin-project-lite", + "tokio", +] + +[[package]] +name = "tokio-macros" +version = "2.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "630bdcf245f78637c13ec01ffae6187cca34625e8c63150d424b59e55af2675e" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "tokio-native-tls" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bbae76ab933c85776efabc971569dd6119c580d8f5d448769dec1764bf796ef2" +dependencies = [ + "native-tls", + "tokio", +] + +[[package]] +name = "tokio-openssl" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c08f9ffb7809f1b20c1b398d92acf4cc719874b3b2b2d9ea2f09b4a80350878a" +dependencies = [ + "futures-util", + "openssl", + "openssl-sys", + "tokio", +] + +[[package]] +name = "tokio-rustls" +version = "0.24.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c28327cf380ac148141087fbfb9de9d7bd4e84ab5d2c28fbc911d753de8a7081" +dependencies = [ + "rustls", + "tokio", +] + +[[package]] +name = "tokio-stream" +version = "0.1.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "397c988d37662c7dda6d2208364a706264bf3d6138b11d436cbac0ad38832842" +dependencies = [ + "futures-core", + "pin-project-lite", + "tokio", +] + +[[package]] +name = "tokio-util" +version = "0.6.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "36943ee01a6d67977dd3f84a5a1d2efeb4ada3a1ae771cadfaa535d9d9fc6507" +dependencies = [ + "bytes", + "futures-core", + "futures-sink", + "log", + "pin-project-lite", + "tokio", +] + +[[package]] +name = "tokio-util" +version = "0.7.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "806fe8c2c87eccc8b3267cbae29ed3ab2d0bd37fca70ab622e46aaa9375ddb7d" +dependencies = [ + "bytes", + "futures-core", + "futures-sink", + "pin-project-lite", + "tokio", + "tracing", +] + +[[package]] +name = "toml" +version = "0.7.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c17e963a819c331dcacd7ab957d80bc2b9a9c1e71c804826d2f283dd65306542" +dependencies = [ + "serde", + "serde_spanned", + "toml_datetime", + "toml_edit", +] + +[[package]] +name = "toml_datetime" +version = "0.6.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7cda73e2f1397b1262d6dfdcef8aafae14d1de7748d66822d3bfeeb6d03e5e4b" +dependencies = [ + "serde", +] + +[[package]] +name = "toml_edit" +version = "0.19.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f8123f27e969974a3dfba720fdb560be359f57b44302d280ba72e76a74480e8a" +dependencies = [ + "indexmap 2.0.0", + "serde", + "serde_spanned", + "toml_datetime", + "winnow", +] + +[[package]] +name = "tonic" +version = "0.6.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ff08f4649d10a70ffa3522ca559031285d8e421d727ac85c60825761818f5d0a" +dependencies = [ + "async-stream", + "async-trait", + "base64 0.13.1", + "bytes", + "futures-core", + "futures-util", + "h2", + "http", + "http-body", + "hyper", + "hyper-timeout", + "percent-encoding", + "pin-project", + "prost", + "prost-derive", + "tokio", + "tokio-stream", + "tokio-util 0.6.10", + "tower", + "tower-layer", + "tower-service", + "tracing", + "tracing-futures", +] + +[[package]] +name = "tonic-build" +version = "0.6.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9403f1bafde247186684b230dc6f38b5cd514584e8bec1dd32514be4745fa757" +dependencies = [ + "proc-macro2", + "prost-build", + "quote", + "syn 1.0.109", +] + +[[package]] +name = "tower" +version = "0.4.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b8fa9be0de6cf49e536ce1851f987bd21a43b771b09473c3549a6c853db37c1c" +dependencies = [ + "futures-core", + "futures-util", + "indexmap 1.9.3", + "pin-project", + "pin-project-lite", + "rand", + "slab", + "tokio", + "tokio-util 0.7.8", + "tower-layer", + "tower-service", + "tracing", +] + +[[package]] +name = "tower-http" +version = "0.3.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f873044bf02dd1e8239e9c1293ea39dad76dc594ec16185d0a1bf31d8dc8d858" +dependencies = [ + "bitflags 1.3.2", + "bytes", + "futures-core", + "futures-util", + "http", + "http-body", + "http-range-header", + "pin-project-lite", + "tower", + "tower-layer", + "tower-service", +] + +[[package]] +name = "tower-http" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "55ae70283aba8d2a8b411c695c437fe25b8b5e44e23e780662002fc72fb47a82" +dependencies = [ + "bitflags 2.3.3", + "bytes", + "futures-core", + "futures-util", + "http", + "http-body", + "http-range-header", + "pin-project-lite", + "tower-layer", + "tower-service", + "tracing", + "uuid", +] + +[[package]] +name = "tower-layer" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c20c8dbed6283a09604c3e69b4b7eeb54e298b8a600d4d5ecb5ad39de609f1d0" + +[[package]] +name = "tower-service" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b6bc1c9ce2b5135ac7f93c72918fc37feb872bdc6a5533a8b85eb4b86bfdae52" + +[[package]] +name = "tracing" +version = "0.1.37" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ce8c33a8d48bd45d624a6e523445fd21ec13d3653cd51f681abf67418f54eb8" +dependencies = [ + "cfg-if", + "log", + "pin-project-lite", + "tracing-attributes", + "tracing-core", +] + +[[package]] +name = "tracing-attributes" +version = "0.1.26" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5f4f31f56159e98206da9efd823404b79b6ef3143b4a7ab76e67b1751b25a4ab" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", +] + +[[package]] +name = "tracing-core" +version = "0.1.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0955b8137a1df6f1a2e9a37d8a6656291ff0297c1a97c24e0d8425fe2312f79a" +dependencies = [ + "once_cell", + "valuable", +] + +[[package]] +name = "tracing-futures" +version = "0.2.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "97d095ae15e245a057c8e8451bab9b3ee1e1f68e9ba2b4fbc18d0ac5237835f2" +dependencies = [ + "pin-project", + "tracing", +] + +[[package]] +name = "tracing-log" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "78ddad33d2d10b1ed7eb9d1f518a5674713876e97e5bb9b7345a7984fbb4f922" +dependencies = [ + "lazy_static", + "log", + "tracing-core", +] + +[[package]] +name = "tracing-opentelemetry" +version = "0.17.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fbbe89715c1dbbb790059e2565353978564924ee85017b5fff365c872ff6721f" +dependencies = [ + "once_cell", + "opentelemetry", + "tracing", + "tracing-core", + "tracing-log", + "tracing-subscriber", +] + +[[package]] +name = "tracing-serde" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc6b213177105856957181934e4920de57730fc69bf42c37ee5bb664d406d9e1" +dependencies = [ + "serde", + "tracing-core", +] + +[[package]] +name = "tracing-subscriber" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "30a651bc37f915e81f087d86e62a18eec5f79550c7faff886f7090b4ea757c77" +dependencies = [ + "matchers", + "nu-ansi-term", + "once_cell", + "regex", + "serde", + "serde_json", + "sharded-slab", + "smallvec", + "thread_local", + "tracing", + "tracing-core", + "tracing-log", + "tracing-serde", +] + +[[package]] +name = "trust-dns-proto" +version = "0.22.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4f7f83d1e4a0e4358ac54c5c3681e5d7da5efc5a7a632c90bb6d6669ddd9bc26" +dependencies = [ + "async-trait", + "cfg-if", + "data-encoding", + "enum-as-inner", + "futures-channel", + "futures-io", + "futures-util", + "idna 0.2.3", + "ipnet", + "lazy_static", + "rand", + "smallvec", + "thiserror", + "tinyvec", + "tokio", + "tracing", + "url", +] + +[[package]] +name = "trust-dns-resolver" +version = "0.22.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aff21aa4dcefb0a1afbfac26deb0adc93888c7d295fb63ab273ef276ba2b7cfe" +dependencies = [ + "cfg-if", + "futures-util", + "ipconfig", + "lazy_static", + "lru-cache", + "parking_lot", + "resolv-conf", + "smallvec", + "thiserror", + "tokio", + "tracing", + "trust-dns-proto", +] + +[[package]] +name = "try-lock" +version = "0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3528ecfd12c466c6f163363caf2d02a71161dd5e1cc6ae7b34207ea2d42d81ed" + +[[package]] +name = "typenum" +version = "1.16.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "497961ef93d974e23eb6f433eb5fe1b7930b659f06d12dec6fc44a8f554c0bba" + +[[package]] +name = "uname" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b72f89f0ca32e4db1c04e2a72f5345d59796d4866a1ee0609084569f73683dc8" +dependencies = [ + "libc", +] + +[[package]] +name = "uncased" +version = "0.9.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9b9bc53168a4be7402ab86c3aad243a84dd7381d09be0eddc81280c1da95ca68" +dependencies = [ + "version_check", +] + +[[package]] +name = "unicase" +version = "2.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50f37be617794602aabbeee0be4f259dc1778fabe05e2d67ee8f79326d5cb4f6" +dependencies = [ + "version_check", +] + +[[package]] +name = "unicode-bidi" +version = "0.3.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "92888ba5573ff080736b3648696b70cafad7d250551175acbaa4e0385b3e1460" + +[[package]] +name = "unicode-ident" +version = "1.0.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "301abaae475aa91687eb82514b328ab47a211a533026cb25fc3e519b86adfc3c" + +[[package]] +name = "unicode-normalization" +version = "0.1.22" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5c5713f0fc4b5db668a2ac63cdb7bb4469d8c9fed047b1d0292cc7b0ce2ba921" +dependencies = [ + "tinyvec", +] + +[[package]] +name = "unicode-segmentation" +version = "1.10.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1dd624098567895118886609431a7c3b8f516e41d30e0643f03d94592a147e36" + +[[package]] +name = "unicode_categories" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "39ec24b3121d976906ece63c9daad25b85969647682eee313cb5779fdd69e14e" + +[[package]] +name = "universal-hash" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9f214e8f697e925001e66ec2c6e37a4ef93f0f78c2eed7814394e10c62025b05" +dependencies = [ + "generic-array", + "subtle", +] + +[[package]] +name = "untrusted" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a156c684c91ea7d62626509bce3cb4e1d9ed5c4d978f7b4352658f96a4c26b4a" + +[[package]] +name = "ureq" +version = "2.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0b11c96ac7ee530603dcdf68ed1557050f374ce55a5a07193ebf8cbc9f8927e9" +dependencies = [ + "base64 0.21.2", + "log", + "native-tls", + "once_cell", + "url", +] + +[[package]] +name = "url" +version = "2.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50bff7831e19200a85b17131d085c25d7811bc4e186efdaf54bbd132994a88cb" +dependencies = [ + "form_urlencoded", + "idna 0.4.0", + "percent-encoding", + "serde", +] + +[[package]] +name = "urlencoding" +version = "2.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "daf8dba3b7eb870caf1ddeed7bc9d2a049f3cfdfae7cb521b087cc33ae4c49da" + +[[package]] +name = "utf8parse" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "711b9620af191e0cdc7468a8d14e709c3dcdb115b36f838e601583af800a370a" + +[[package]] +name = "uuid" +version = "1.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "79daa5ed5740825c40b389c5e50312b9c86df53fccd33f281df655642b43869d" +dependencies = [ + "getrandom", + "serde", +] + +[[package]] +name = "validator" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6d0f08911ab0fee2c5009580f04615fa868898ee57de10692a45da0c3bcc3e5e" +dependencies = [ + "idna 0.2.3", + "lazy_static", + "regex", + "serde", + "serde_derive", + "serde_json", + "url", + "validator_derive", + "validator_types", +] + +[[package]] +name = "validator_derive" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d85135714dba11a1bd0b3eb1744169266f1a38977bf4e3ff5e2e1acb8c2b7eee" +dependencies = [ + "if_chain", + "lazy_static", + "proc-macro-error", + "proc-macro2", + "quote", + "regex", + "syn 1.0.109", + "validator_types", +] + +[[package]] +name = "validator_types" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ded9d97e1d42327632f5f3bae6403c04886e2de3036261ef42deebd931a6a291" +dependencies = [ + "proc-macro2", + "syn 1.0.109", +] + +[[package]] +name = "valuable" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "830b7e5d4d90034032940e4ace0d9a9a057e7a45cd94e6c007832e39edb82f6d" + +[[package]] +name = "vcpkg" +version = "0.2.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "accd4ea62f7bb7a82fe23066fb0957d48ef677f6eeb8215f372f52e48bb32426" + +[[package]] +name = "version_check" +version = "0.9.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "49874b5167b65d7193b8aba1567f5c7d93d001cafc34600cee003eda787e483f" + +[[package]] +name = "waker-fn" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9d5b2c62b4012a3e1eca5a7e077d13b3bf498c4073e33ccd58626607748ceeca" + +[[package]] +name = "want" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bfa7760aed19e106de2c7c0b581b509f2f25d3dacaf737cb82ac61bc6d760b0e" +dependencies = [ + "try-lock", +] + +[[package]] +name = "wasi" +version = "0.10.0+wasi-snapshot-preview1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1a143597ca7c7793eff794def352d41792a93c481eb1042423ff7ff72ba2c31f" + +[[package]] +name = "wasi" +version = "0.11.0+wasi-snapshot-preview1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9c8d87e72b64a3b4db28d11ce29237c246188f4f51057d65a7eab63b7987e423" + +[[package]] +name = "wasm-bindgen" +version = "0.2.87" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7706a72ab36d8cb1f80ffbf0e071533974a60d0a308d01a5d0375bf60499a342" +dependencies = [ + "cfg-if", + "wasm-bindgen-macro", +] + +[[package]] +name = "wasm-bindgen-backend" +version = "0.2.87" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5ef2b6d3c510e9625e5fe6f509ab07d66a760f0885d858736483c32ed7809abd" +dependencies = [ + "bumpalo", + "log", + "once_cell", + "proc-macro2", + "quote", + "syn 2.0.29", + "wasm-bindgen-shared", +] + +[[package]] +name = "wasm-bindgen-futures" +version = "0.4.37" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c02dbc21516f9f1f04f187958890d7e6026df8d16540b7ad9492bc34a67cea03" +dependencies = [ + "cfg-if", + "js-sys", + "wasm-bindgen", + "web-sys", +] + +[[package]] +name = "wasm-bindgen-macro" +version = "0.2.87" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dee495e55982a3bd48105a7b947fd2a9b4a8ae3010041b9e0faab3f9cd028f1d" +dependencies = [ + "quote", + "wasm-bindgen-macro-support", +] + +[[package]] +name = "wasm-bindgen-macro-support" +version = "0.2.87" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "54681b18a46765f095758388f2d0cf16eb8d4169b639ab575a8f5693af210c7b" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.29", + "wasm-bindgen-backend", + "wasm-bindgen-shared", +] + +[[package]] +name = "wasm-bindgen-shared" +version = "0.2.87" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ca6ad05a4870b2bf5fe995117d3728437bd27d7cd5f06f13c17443ef369775a1" + +[[package]] +name = "web-sys" +version = "0.3.64" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9b85cbef8c220a6abc02aefd892dfc0fc23afb1c6a426316ec33253a3877249b" +dependencies = [ + "js-sys", + "wasm-bindgen", +] + +[[package]] +name = "webpki" +version = "0.22.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f0e74f82d49d545ad128049b7e88f6576df2da6b02e9ce565c6f533be576957e" +dependencies = [ + "ring", + "untrusted", +] + +[[package]] +name = "webpki-roots" +version = "0.22.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b6c71e40d7d2c34a5106301fb632274ca37242cd0c9d3e64dbece371a40a2d87" +dependencies = [ + "webpki", +] + +[[package]] +name = "webpki-roots" +version = "0.24.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b291546d5d9d1eab74f069c77749f2cb8504a12caa20f0f2de93ddbf6f411888" +dependencies = [ + "rustls-webpki", +] + +[[package]] +name = "which" +version = "4.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2441c784c52b289a054b7201fc93253e288f094e2f4be9058343127c4226a269" +dependencies = [ + "either", + "libc", + "once_cell", +] + +[[package]] +name = "whoami" +version = "1.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "22fc3756b8a9133049b26c7f61ab35416c130e8c09b660f5b3958b446f52cc50" + +[[package]] +name = "widestring" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "653f141f39ec16bba3c5abe400a0c60da7468261cc2cbf36805022876bc721a8" + +[[package]] +name = "winapi" +version = "0.3.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419" +dependencies = [ + "winapi-i686-pc-windows-gnu", + "winapi-x86_64-pc-windows-gnu", +] + +[[package]] +name = "winapi-i686-pc-windows-gnu" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" + +[[package]] +name = "winapi-x86_64-pc-windows-gnu" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" + +[[package]] +name = "windows" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e686886bc078bc1b0b600cac0147aadb815089b6e4da64016cbd754b6342700f" +dependencies = [ + "windows-targets", +] + +[[package]] +name = "windows-sys" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "677d2418bec65e3338edb076e806bc1ec15693c5d0104683f2efe857f61056a9" +dependencies = [ + "windows-targets", +] + +[[package]] +name = "windows-targets" +version = "0.48.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "05d4b17490f70499f20b9e791dcf6a299785ce8af4d709018206dc5b4953e95f" +dependencies = [ + "windows_aarch64_gnullvm", + "windows_aarch64_msvc", + "windows_i686_gnu", + "windows_i686_msvc", + "windows_x86_64_gnu", + "windows_x86_64_gnullvm", + "windows_x86_64_msvc", +] + +[[package]] +name = "windows_aarch64_gnullvm" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "91ae572e1b79dba883e0d315474df7305d12f569b400fcf90581b06062f7e1bc" + +[[package]] +name = "windows_aarch64_msvc" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2ef27e0d7bdfcfc7b868b317c1d32c641a6fe4629c171b8928c7b08d98d7cf3" + +[[package]] +name = "windows_i686_gnu" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "622a1962a7db830d6fd0a69683c80a18fda201879f0f447f065a3b7467daa241" + +[[package]] +name = "windows_i686_msvc" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4542c6e364ce21bf45d69fdd2a8e455fa38d316158cfd43b3ac1c5b1b19f8e00" + +[[package]] +name = "windows_x86_64_gnu" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ca2b8a661f7628cbd23440e50b05d705db3686f894fc9580820623656af974b1" + +[[package]] +name = "windows_x86_64_gnullvm" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7896dbc1f41e08872e9d5e8f8baa8fdd2677f29468c4e156210174edc7f7b953" + +[[package]] +name = "windows_x86_64_msvc" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1a515f5799fe4961cb532f983ce2b23082366b898e52ffbce459c86f67c8378a" + +[[package]] +name = "winnow" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "81fac9742fd1ad1bd9643b991319f72dd031016d44b77039a26977eb667141e7" +dependencies = [ + "memchr", +] + +[[package]] +name = "winreg" +version = "0.10.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "80d0f4e272c85def139476380b12f9ac60926689dd2e01d4923222f40580869d" +dependencies = [ + "winapi", +] + +[[package]] +name = "winreg" +version = "0.50.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "524e57b2c537c0f9b1e69f1965311ec12182b4122e45035b1508cd24d2adadb1" +dependencies = [ + "cfg-if", + "windows-sys", +] + +[[package]] +name = "yansi" +version = "1.0.0-rc" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9ee746ad3851dd3bc40e4a028ab3b00b99278d929e48957bcb2d111874a7e43e" + +[[package]] +name = "yasna" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e17bb3549cc1321ae1296b9cdc2698e2b6cb1992adfa19a8c72e5b7a738f44cd" + +[[package]] +name = "zeroize" +version = "1.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2a0956f1ba7c7909bfb66c2e9e4124ab6f6482560f6628b5aaeba39207c9aad9" diff --git a/pkgs/by-name/sv/svix-server/package.nix b/pkgs/by-name/sv/svix-server/package.nix new file mode 100644 index 0000000000000..e7de972488e2e --- /dev/null +++ b/pkgs/by-name/sv/svix-server/package.nix @@ -0,0 +1,54 @@ +{ lib, rustPlatform, fetchFromGitHub, pkg-config, openssl, protobuf, stdenv +, darwin }: + +rustPlatform.buildRustPackage rec { + pname = "svix-server"; + version = "1.13.0"; + + src = fetchFromGitHub { + owner = "svix"; + repo = "svix-webhooks"; + rev = "v${version}"; + hash = "sha256-6758ej7bTvwZPWifl239rQMazM8uw+Y4+3EbjE8XsTg="; + }; + + sourceRoot = "source/server"; + + cargoLock = { + lockFile = ./Cargo.lock; + outputHashes = { + "aide-0.10.0" = "sha256-hUUer5D6OA4F0Co3JgygY3g89cKIChFest67ABIX+4M="; + "hyper-0.14.23" = "sha256-7MBCAjKYCdDbqCmYg3eYE74h7K7yTjfVoo0sjxr4g/s="; + }; + }; + + nativeBuildInputs = [ pkg-config ]; + + buildInputs = [ + openssl + protobuf + ] ++ lib.optionals stdenv.isDarwin [ + darwin.apple_sdk.frameworks.CoreServices + darwin.apple_sdk.frameworks.Security + darwin.apple_sdk.frameworks.SystemConfiguration + ]; + + # needed for internal protobuf c wrapper library + PROTOC = "${protobuf}/bin/protoc"; + PROTOC_INCLUDE = "${protobuf}/include"; + + OPENSSL_NO_VENDOR = 1; + + # disable tests because they require postgres and redis to be running + doCheck = false; + + meta = with lib; { + mainProgram = "svix-server"; + description = "The enterprise-ready webhooks service"; + homepage = "https://github.com/svix/svix-webhooks"; + changelog = + "https://github.com/svix/svix-webhooks/releases/tag/v${version}"; + license = licenses.mit; + maintainers = with maintainers; [ techknowlogick ]; + }; +} diff --git a/pkgs/by-name/ve/vesktop/package.nix b/pkgs/by-name/ve/vesktop/package.nix index d528fec7563a1..52c21e75f7b11 100644 --- a/pkgs/by-name/ve/vesktop/package.nix +++ b/pkgs/by-name/ve/vesktop/package.nix @@ -18,13 +18,13 @@ }: stdenv.mkDerivation rec { pname = "vesktop"; - version = "0.4.1"; + version = "0.4.2"; src = fetchFromGitHub { owner = "Vencord"; repo = "Vesktop"; rev = "v${version}"; - hash = "sha256-jSGad3qMhAdiGdwomQO6BIyHIbKrGLRGniGrJN97gN8="; + hash = "sha256-elgoX8z8q0+7uUia9gbcCmpDg+qYRWWUxdRuNV53Puw="; }; pnpm-deps = stdenvNoCC.mkDerivation { @@ -53,7 +53,7 @@ stdenv.mkDerivation rec { dontFixup = true; outputHashMode = "recursive"; - outputHash = "sha256-lTeL+8QujWzx4ys2T+G55NUP51c8i5lB1vAkUtzkJlA="; + outputHash = "sha256-KDJ8QmpwGb2lOdwWEl5y62pJiqEvpI59StfQZrN1PPE="; }; nativeBuildInputs = [ diff --git a/pkgs/by-name/ws/wslay/package.nix b/pkgs/by-name/ws/wslay/package.nix new file mode 100644 index 0000000000000..ed6c0c9b67354 --- /dev/null +++ b/pkgs/by-name/ws/wslay/package.nix @@ -0,0 +1,33 @@ +{ stdenv, lib, fetchFromGitHub, cmake, cunit }: + +stdenv.mkDerivation rec { + pname = "wslay"; + version = "1.1.1"; + + src = fetchFromGitHub { + owner = "tatsuhiro-t"; + repo = "wslay"; + rev = "release-${version}"; + hash = "sha256-xKQGZO5hNzMg+JYKeqOBsu73YO+ucBEOcNhG8iSNYvA="; + }; + + strictDeps = true; + + nativeBuildInputs = [ cmake ]; + + cmakeFlags = [ + (lib.cmakeBool "WSLAY_TESTS" true) + ]; + + doCheck = true; + + checkInputs = [ cunit ]; + + meta = with lib; { + homepage = "https://tatsuhiro-t.github.io/wslay/"; + description = "The WebSocket library in C"; + license = with licenses; [ mit ]; + maintainers = with maintainers; [ pingiun ]; + platforms = platforms.unix; + }; +} diff --git a/pkgs/tools/networking/yggdrasil/default.nix b/pkgs/by-name/yg/yggdrasil/package.nix index 5154ef60bd0a2..858e8400d0049 100644 --- a/pkgs/tools/networking/yggdrasil/default.nix +++ b/pkgs/by-name/yg/yggdrasil/package.nix @@ -2,28 +2,25 @@ buildGoModule rec { pname = "yggdrasil"; - version = "0.4.7"; + version = "0.5.1"; src = fetchFromGitHub { owner = "yggdrasil-network"; repo = "yggdrasil-go"; rev = "v${version}"; - sha256 = "sha256-01ciAutRIn4DmqlvDTXhRiuZHTtF8b6js7SUrLOjtAY="; + sha256 = "sha256-JeeOT3fb+4+eUyWl7rAXa5+Yf1XCT20xJeCdhBC0oeo="; }; - vendorHash = "sha256-hwDi59Yp92eMDqA8OD56nxsKSX2ngxs0lYdmEMLX+Oc="; - - # Change the default location of the management socket on Linux - # systems so that the yggdrasil system service unit does not have to - # be granted write permission to /run. - patches = [ ./change-runtime-dir.patch ]; + vendorHash = "sha256-yu725RgKDRmpNFNuffBFKZjZOFyzt00kKGuz696JHk0="; subPackages = [ "cmd/genkeys" "cmd/yggdrasil" "cmd/yggdrasilctl" ]; ldflags = [ "-X github.com/yggdrasil-network/yggdrasil-go/src/version.buildVersion=${version}" "-X github.com/yggdrasil-network/yggdrasil-go/src/version.buildName=${pname}" - "-s" "-w" + "-X github.com/yggdrasil-network/yggdrasil-go/src/config.defaultAdminListen=unix:///var/run/yggdrasil/yggdrasil.sock" + "-s" + "-w" ]; passthru.tests.basic = nixosTests.yggdrasil; diff --git a/pkgs/by-name/yu/yunfaavatar/package.nix b/pkgs/by-name/yu/yunfaavatar/package.nix new file mode 100644 index 0000000000000..369f89d7c888d --- /dev/null +++ b/pkgs/by-name/yu/yunfaavatar/package.nix @@ -0,0 +1,40 @@ +{ + lib, + stdenvNoCC, + fetchFromGitHub, + bash, + imagemagick, + makeWrapper, +}: +stdenvNoCC.mkDerivation rec { + pname = "yunfaavatar"; + version = "0.2.0"; + + src = fetchFromGitHub { + owner = "yunfachi"; + repo = "yunfaAvatar"; + rev = version; + hash = "sha256-hCpbe+gW9hkiVOKq7a55n5s3bMpyCNGWiY3D2b4VYxg="; + }; + + strictDeps = true; + nativeBuildInputs = [makeWrapper]; + + makeFlags = [ + "PREFIX=${placeholder "out"}" + ]; + + postInstall = '' + wrapProgram "$out/bin/yunfaavatar" \ + --prefix PATH : "${lib.makeBinPath [imagemagick]}" + ''; + + meta = with lib; { + description = "Utility for automatic centralized changing of avatar in Github, Discord, Steam, Shikimori, and many more"; + homepage = "https://github.com/yunfachi/yunfaAvatar"; + license = licenses.mit; + platforms = platforms.all; + maintainers = with maintainers; [yunfachi]; + mainProgram = "yunfaavatar"; + }; +} diff --git a/pkgs/data/fonts/iosevka/default.nix b/pkgs/data/fonts/iosevka/default.nix index 5d687585141da..fdd9ff2de15b6 100644 --- a/pkgs/data/fonts/iosevka/default.nix +++ b/pkgs/data/fonts/iosevka/default.nix @@ -55,16 +55,16 @@ assert (extraParameters != null) -> set != null; buildNpmPackage rec { pname = if set != null then "iosevka-${set}" else "iosevka"; - version = "27.3.1"; + version = "27.3.2"; src = fetchFromGitHub { owner = "be5invis"; repo = "iosevka"; rev = "v${version}"; - hash = "sha256-7ndJDdgDn5tnnUeB4etQ8bBZnH7NuiYoNQ9CrF2HtwQ="; + hash = "sha256-an2/Aqb+5t61CkiBhwL9lA0WPxhIC+tDDjhn8alcqJQ="; }; - npmDepsHash = "sha256-MNlT8VJTIvoZDAAdEs0Fa8gqO7dWhRR9I4Kw4qlW5Ig="; + npmDepsHash = "sha256-BQTM/ea/X2iqRkX510fAzouPNcV7cUmtY7J/CSUMH7o="; nativeBuildInputs = [ remarshal diff --git a/pkgs/data/fonts/unifont/default.nix b/pkgs/data/fonts/unifont/default.nix index 7784f4ac8c2ba..a8aba0c1fb232 100644 --- a/pkgs/data/fonts/unifont/default.nix +++ b/pkgs/data/fonts/unifont/default.nix @@ -4,16 +4,16 @@ stdenv.mkDerivation rec { pname = "unifont"; - version = "15.1.02"; + version = "15.1.03"; otf = fetchurl { url = "mirror://gnu/unifont/${pname}-${version}/${pname}-${version}.otf"; - hash = "sha256-fmhm74zc6wJK2f5XkDq/BRc5Lv+rCvcDRodgHCSiUQA="; + hash = "sha256-DGRIxE0HDX/cx7mQMBmGgRrbbj7fzWDAOMlhZM1/EEw="; }; pcf = fetchurl { url = "mirror://gnu/unifont/${pname}-${version}/${pname}-${version}.pcf.gz"; - hash = "sha256-cCDXjSbpCe1U+Fx/xH/9NXWg6bkdRBV5AawFR0NyOHM="; + hash = "sha256-/fogZ8mkOz/4YFZVxU3tTZfYwZw7zGizoQ3yQkF+aME="; }; nativeBuildInputs = [ libfaketime xorg.fonttosfnt xorg.mkfontscale ]; diff --git a/pkgs/data/misc/v2ray-domain-list-community/default.nix b/pkgs/data/misc/v2ray-domain-list-community/default.nix index 67bb06ba28079..4d81e0386a378 100644 --- a/pkgs/data/misc/v2ray-domain-list-community/default.nix +++ b/pkgs/data/misc/v2ray-domain-list-community/default.nix @@ -3,14 +3,14 @@ let generator = pkgsBuildBuild.buildGoModule rec { pname = "v2ray-domain-list-community"; - version = "20231015073627"; + version = "20231030084219"; src = fetchFromGitHub { owner = "v2fly"; repo = "domain-list-community"; rev = version; - hash = "sha256-DffJ9d5ppTVLMTfITKd0zwCqBEKKMCwupLAFMr/o+dw="; + hash = "sha256-5FVHjK68weGWjla8MBS1D/Ks5PjzBKLv/TeyjBSgYFw="; }; - vendorHash = "sha256-dYaGR5ZBORANKAYuPAi9i+KQn2OAGDGTZxdyVjkcVi8="; + vendorHash = "sha256-6167kRAC5m5FlBr7uk+qKUcjWsb45P5Vvovyb6hHSVQ="; meta = with lib; { description = "community managed domain list"; homepage = "https://github.com/v2fly/domain-list-community"; diff --git a/pkgs/data/themes/alacritty-theme/default.nix b/pkgs/data/themes/alacritty-theme/default.nix index 9ac00f8f687fb..203b260e251b6 100644 --- a/pkgs/data/themes/alacritty-theme/default.nix +++ b/pkgs/data/themes/alacritty-theme/default.nix @@ -6,13 +6,13 @@ stdenvNoCC.mkDerivation (self: { name = "alacritty-theme"; - version = "unstable-2023-10-12"; + version = "unstable-2023-10-26"; src = fetchFromGitHub { owner = "alacritty"; repo = "alacritty-theme"; - rev = "4cb179606c3dfc7501b32b6f011f9549cee949d3"; - hash = "sha256-Ipe6LHr83oBdBMV3u4xrd+4zudHXiRBamUa/cOuHleY="; + rev = "e1b08b5bc06d07dd65f5e72b12fd7f736e0e7928"; + hash = "sha256-wf0aT2uGe/6Ifv//lQStTm24yt2FX3kWQq5ebdmdPJ0="; }; dontConfigure = true; diff --git a/pkgs/data/themes/nordic/default.nix b/pkgs/data/themes/nordic/default.nix index a64b870d12b98..16eefee7bbb9c 100644 --- a/pkgs/data/themes/nordic/default.nix +++ b/pkgs/data/themes/nordic/default.nix @@ -80,14 +80,11 @@ stdenv.mkDerivation rec { sourceRoot = "."; + outputs = [ "out" "sddm" ]; + nativeBuildInputs = [ jdupes ]; - propagatedUserEnvPkgs = [ - gtk-engine-murrine - breeze-icons - plasma-framework - plasma-workspace - ]; + propagatedUserEnvPkgs = [ gtk-engine-murrine ]; dontWrapQtApps = true; @@ -119,15 +116,18 @@ stdenv.mkDerivation rec { rmdir $out/share/themes/Nordic/extras{/wallpapers,} # move kde related contents to appropriate directories - mkdir -p $out/share/{aurorae/themes,color-schemes,Kvantum,plasma,sddm/themes,icons} + mkdir -p $out/share/{aurorae/themes,color-schemes,Kvantum,plasma,icons} mv -v $out/share/themes/Nordic/kde/aurorae/* $out/share/aurorae/themes/ mv -v $out/share/themes/Nordic/kde/colorschemes/* $out/share/color-schemes/ mv -v $out/share/themes/Nordic/kde/konsole $out/share/ mv -v $out/share/themes/Nordic/kde/kvantum/* $out/share/Kvantum/ mv -v $out/share/themes/Nordic/kde/plasma/look-and-feel $out/share/plasma/ - mv -v $out/share/themes/Nordic/kde/sddm/* $out/share/sddm/themes/ mv -v $out/share/themes/Nordic/kde/folders/* $out/share/icons/ mv -v $out/share/themes/Nordic/kde/cursors/*-cursors $out/share/icons/ + + mkdir -p $sddm/share/sddm/themes + mv -v $out/share/themes/Nordic/kde/sddm/* $sddm/share/sddm/themes/ + rm -rf $out/share/themes/Nordic/kde # Replace duplicate files with symbolic links to the first file in @@ -137,6 +137,16 @@ stdenv.mkDerivation rec { runHook postInstall ''; + postFixup = '' + # Propagate sddm theme dependencies to user env otherwise sddm + # does find them. Putting them in buildInputs is not enough. + + mkdir -p $sddm/nix-support + + printWords ${breeze-icons} ${plasma-framework} ${plasma-workspace} \ + >> $sddm/nix-support/propagated-user-env-packages + ''; + meta = with lib; { description = "Gtk and KDE themes using the Nord color pallete"; homepage = "https://github.com/EliverLara/Nordic"; diff --git a/pkgs/desktops/deepin/go-package/dde-daemon/0006-fix-build-with-ddcutil-2.patch b/pkgs/desktops/deepin/go-package/dde-daemon/0006-fix-build-with-ddcutil-2.patch new file mode 100644 index 0000000000000..76729d488b3cb --- /dev/null +++ b/pkgs/desktops/deepin/go-package/dde-daemon/0006-fix-build-with-ddcutil-2.patch @@ -0,0 +1,17 @@ +diff --git a/bin/backlight_helper/ddcci/ddcci.go b/bin/backlight_helper/ddcci/ddcci.go +index 679beea3..ccbfc508 100644 +--- a/bin/backlight_helper/ddcci/ddcci.go ++++ b/bin/backlight_helper/ddcci/ddcci.go +@@ -103,11 +103,6 @@ func newDDCCI() (*ddcci, error) { + displayHandleMap: make(map[string]*displayHandle), + } + +- status := C.ddca_set_max_tries(C.DDCA_MULTI_PART_TRIES, 5) +- if status < C.int(0) { +- return nil, fmt.Errorf("brightness: Error setting retries: %d", status) +- } +- + err := ddc.RefreshDisplays() + if err != nil { + return nil, err + diff --git a/pkgs/desktops/deepin/go-package/dde-daemon/default.nix b/pkgs/desktops/deepin/go-package/dde-daemon/default.nix index b9a1da5ca2e80..1309b6d3f4831 100644 --- a/pkgs/desktops/deepin/go-package/dde-daemon/default.nix +++ b/pkgs/desktops/deepin/go-package/dde-daemon/default.nix @@ -62,6 +62,7 @@ buildGoPackage rec { src = ./0005-fix-custom-wallpapers-path.diff; inherit coreutils; }) + ./0006-fix-build-with-ddcutil-2.patch ]; postPatch = '' diff --git a/pkgs/desktops/xfce/core/xfconf/default.nix b/pkgs/desktops/xfce/core/xfconf/default.nix index 169efcb2c3254..16e6fb3209289 100644 --- a/pkgs/desktops/xfce/core/xfconf/default.nix +++ b/pkgs/desktops/xfce/core/xfconf/default.nix @@ -1,4 +1,10 @@ -{ lib, mkXfceDerivation, libxfce4util, gobject-introspection, vala }: +{ lib +, mkXfceDerivation +, fetchpatch +, libxfce4util +, gobject-introspection +, vala +}: mkXfceDerivation { category = "xfce"; @@ -7,6 +13,16 @@ mkXfceDerivation { sha256 = "sha256-FVNkcwOS4feMocx3vYhuWNs1EkXDrM1FaKkMhIOuPHI="; + patches = [ + # fixes a segfault, can likely be removed with 4.18.3, + # see https://gitlab.xfce.org/xfce/xfconf/-/issues/35#note_81151 + (fetchpatch { + name = "cache-fix-uncached-value.patch"; + url = "https://gitlab.xfce.org/xfce/xfconf/-/commit/03f7ff961fd46c9141aba624a278e19de0bf3211.diff"; + hash = "sha256-n9Wvt7NfKMxs2AcjUWgs4vZgzLUG9jyEVTZxINko4h8="; + }) + ]; + nativeBuildInputs = [ gobject-introspection vala ]; buildInputs = [ libxfce4util ]; diff --git a/pkgs/development/compilers/dotnet/versions/6.0.nix b/pkgs/development/compilers/dotnet/versions/6.0.nix index ee63a6a241d99..c60133da3c8d0 100644 --- a/pkgs/development/compilers/dotnet/versions/6.0.nix +++ b/pkgs/development/compilers/dotnet/versions/6.0.nix @@ -3,177 +3,177 @@ # v6.0 (active) { aspnetcore_6_0 = buildAspNetCore { - version = "6.0.22"; + version = "6.0.24"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/a936856b-96f0-4525-8f74-b96b792c3664/2da9be398c92985d3f95c3336361d1ba/aspnetcore-runtime-6.0.22-linux-x64.tar.gz"; - sha512 = "a42f600823e19611ddb202bde1a8da8d0e9dadb22262cb2122f8c85af12bddee8793524d9e2096c188b267bdd852ef90bf93533c2d4f2f3151742cfc20fdc244"; + url = "https://download.visualstudio.microsoft.com/download/pr/8f5a65c0-9bc8-497d-9ce2-4658c461dc55/b6c01c3cd060552d987501ba6bbde09f/aspnetcore-runtime-6.0.24-linux-x64.tar.gz"; + sha512 = "b14ed20bb6c2897fb05cf11154aa22df3c68b6f90d2e9bc6ccc623897a565f51c3007c9a6edcdbab2090c710047a3d8eed0bcc6df19f3993d1be4c6387238da5"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/000ddf12-2c8b-4d97-9b3d-f76c8fef461e/c2dfb5a82b7952cb272c0f5dbeb7fcb1/aspnetcore-runtime-6.0.22-linux-arm64.tar.gz"; - sha512 = "bd3dc49cd2b637edc3797206a0b6b07b40f774a25c3c6932bc86d345cfb90f4af7c0927e1b39cf4fc638ce67a5291b0ab7a5bfb030c629f8e4e0d9ce76715532"; + url = "https://download.visualstudio.microsoft.com/download/pr/d562ba2b-8e2c-48e5-9853-f8616a9cb4e4/f4e251ba67b718083c28017e3b0c6349/aspnetcore-runtime-6.0.24-linux-arm64.tar.gz"; + sha512 = "db5de0888441e93466f84aac459d5ea0c9079c9b8e00308abb0ccc687922bbe48ace22b5cbdeb0f38d89cd115440deab5d0b4f1499611822dfb8a0e9f13c4309"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/447de6fd-79ad-4a1d-a7ea-48f57a8e1280/27c1a55772876bf109b7c2caa5038d9d/aspnetcore-runtime-6.0.22-osx-x64.tar.gz"; - sha512 = "c899865b0c3b409273fc9d4eec1e0d37406021acbc40d34aea8566fbd1cdce541bf0f1011a625ec0f61798ae334d244f72874943da790dc3d4b98611b140a954"; + url = "https://download.visualstudio.microsoft.com/download/pr/cf267621-f2f5-47d8-90b4-e8a4555de21b/aa82da20c081e6359b1ffbc8261b5c73/aspnetcore-runtime-6.0.24-osx-x64.tar.gz"; + sha512 = "8cfab4466ab5a82c7e0110541708b08f894427036f54e2e8add649b9777c86b856f7d5fbd4c2709bc74343b5b1de937b13bff2f0b7e68726072f93b417632603"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/4f2055fb-f5f2-4953-8341-4c56ae1f2893/52d66998e9326c7172d77a706e752861/aspnetcore-runtime-6.0.22-osx-arm64.tar.gz"; - sha512 = "c39e137d351125fefc078882311eb7de37ec8188444767a15b56d6f242bf5855e0e79cfb205a45c5083e86f039b5e7202727a1f8eaab92706e5c705ba782aafb"; + url = "https://download.visualstudio.microsoft.com/download/pr/516e1a2a-0256-48d9-8212-c95a6c9d93de/6abbcc369ef1d3e03e6e28f0438ee295/aspnetcore-runtime-6.0.24-osx-arm64.tar.gz"; + sha512 = "1590236034ca91d347b045843d790288024b19939d34f356c6914bdc7ce000af9ceea63a9ce69fa599d126fbc6dae405a3a42cd4a02edf5ffa067388da8b4da4"; }; }; }; runtime_6_0 = buildNetRuntime { - version = "6.0.22"; + version = "6.0.24"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/f812da49-53de-4f59-93d2-742a61229149/35ff2eb90bf2583d21ad25146c291fe4/dotnet-runtime-6.0.22-linux-x64.tar.gz"; - sha512 = "c24ed83cd8299963203b3c964169666ed55acaa55e547672714e1f67e6459d8d6998802906a194fc59abcfd1504556267a839c116858ad34c56a2a105dc18d3d"; + url = "https://download.visualstudio.microsoft.com/download/pr/872b4f32-dd0d-49e5-bca3-2b27314286a7/e72d2be582895b7053912deb45a4677d/dotnet-runtime-6.0.24-linux-x64.tar.gz"; + sha512 = "3a72ddae17ecc9e5354131f03078f3fbfa1c21d26ada9f254b01cddcb73869cb33bac5fc0aed2200fbb57be939d65829d8f1514cd0889a2f5858d1f1eec136eb"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/1cd7db66-695f-48d8-9e79-d61df9774345/4c363363f91445c542e8a997e3568ac4/dotnet-runtime-6.0.22-linux-arm64.tar.gz"; - sha512 = "bef57f12a8f9ad3c41767b85158f76c996f38db56bd4b8d800d9ccd107be3e1d47a3d2917a252bdd937e3c30547e431dfbc295c7ffce8eb4ab072ade426c53f4"; + url = "https://download.visualstudio.microsoft.com/download/pr/8292f37d-c0b7-4371-b307-990c488ffce0/95142913864b1f8cf45d3bc432a8c193/dotnet-runtime-6.0.24-linux-arm64.tar.gz"; + sha512 = "43ec6b177d18ad5dbdd83392f861668ea71160b01f7540c18eee425d24ad0b5eee88dfc0f4ad9ec1cca2d8cf09bca4ac806d8e0f315b52c7b4a7a969532feacc"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/b1dc97bc-8a17-4211-831f-8dd2c01399ce/9972b4153b37a16773b13ea0dcd12268/dotnet-runtime-6.0.22-osx-x64.tar.gz"; - sha512 = "cea7d3de081cdc6053861398700211561e2c7990be2e8d982b007f485321c5b6255622069d4c4adf2c0ddaefbd2438625617b10294d7c05dcd36d283bae40567"; + url = "https://download.visualstudio.microsoft.com/download/pr/3adf2172-7ded-4053-bc86-b5236b1a3830/80038eb1ea0019995c76660f18e9a290/dotnet-runtime-6.0.24-osx-x64.tar.gz"; + sha512 = "25afb6eb9d9404332efe32407e1dcef080a79372b8631b7720daf62bdea42c4fd36c1fdc12c6333c9c1754a1cb29f5ce64a1436e6392db396a9dce647a8f2c16"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/48cddb0a-2a08-4d83-b571-00772a73d05e/5489b285d12781a983a0f17f26973369/dotnet-runtime-6.0.22-osx-arm64.tar.gz"; - sha512 = "5038b29e5794271284d8316cbc454c8b1f1e54c30fd15305051008ff005a79ae22367bb2a50b03ffa4ce00228d1d82a3361d675a1a1a2c8ffaee3dffdd7c4eac"; + url = "https://download.visualstudio.microsoft.com/download/pr/87743def-9e7c-4157-8ca5-d818496e41ff/97ab6a39043f45d7701f91c422a663f4/dotnet-runtime-6.0.24-osx-arm64.tar.gz"; + sha512 = "fbbf6b385172700e4864db9db6f85bcec6fe447d504d181878ae7a3d7b4e06f19920c7aecbdb4c4700bc65f51abb7409cb68e99dda4af14319909bb2816c22ff"; }; }; }; sdk_6_0 = buildNetSdk { - version = "6.0.414"; + version = "6.0.416"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/d97d1625-d7ed-444c-a7e9-e7b469842960/d8b97220d0d79119e3026da2b956854e/dotnet-sdk-6.0.414-linux-x64.tar.gz"; - sha512 = "79bb0576df990bb1bdb2008756587fbf6068562887b67787f639fa51cf1a73d06a7272a244ef34de627dee4bb82377f91f49de9994cbaeb849412df4e711db40"; + url = "https://download.visualstudio.microsoft.com/download/pr/675f1077-ab10-40cf-ac18-d146a14ea18a/522055f875b0a2474dacfa25729d3231/dotnet-sdk-6.0.416-linux-x64.tar.gz"; + sha512 = "5a3c60c73b68e9527406a93c9cc18941d082ac988d0b4bfea277da3465c71777dded1b3389f0dde807eda6a8186fcf68d617d2473a52203cb75127ab3dafc64d"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/a2afb4da-478b-4ffa-aeeb-a37a313d6fc8/0897a8456d42f306519de9a15b1e14ef/dotnet-sdk-6.0.414-linux-arm64.tar.gz"; - sha512 = "225367725fa2af00240654863c4dbe2370b95542d8c411a78017e37e13031a67049bcf570b94d9fdc9f61b1d13db7bf7ff9772bceccb70f43dd468302a47016c"; + url = "https://download.visualstudio.microsoft.com/download/pr/a56a7895-ec29-44fe-9fbf-3ea6a1bedd3d/47393de218098a0d63e9629b008abf07/dotnet-sdk-6.0.416-linux-arm64.tar.gz"; + sha512 = "b121ba30bd8bab2f8744f32442d93807b60dac90f8b6caa395d87151b2ffc335f93a95843f08a412d0b90c82d587301b73ea96f5a520658be729c65a061a8a80"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/25ec70da-5c05-4d55-9f1c-fe103417da1d/afcf8ecac02c9e8a927c128c9a72ec1f/dotnet-sdk-6.0.414-osx-x64.tar.gz"; - sha512 = "399c9fcef1ac858685f67d33079a49fd814d90926d47161680eda23820281acbd3b0a98fc7dffedeb9e2072f68880d74de3e4ff4d369046af157817dce61d5a1"; + url = "https://download.visualstudio.microsoft.com/download/pr/fd03f404-c806-4eae-9bda-0d002437c227/314b39bd905ad559bf38421d8184f0b1/dotnet-sdk-6.0.416-osx-x64.tar.gz"; + sha512 = "cccd47ac03198f7c2335abbf9ebaf11d76e229cd2690f334bafd70363de7045e600c33057d16689fba6ed95bb2f80ee8cd8258152c07c1972323471dcc6f2df1"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/72bd5609-d0bd-4fb5-a563-6f426038a7d9/01507b650934aab36c340284d0819ba3/dotnet-sdk-6.0.414-osx-arm64.tar.gz"; - sha512 = "02c65256834ed5cb947089ae4f0b2f5ad0bda44fd3abd06d9f5003e2090017a384a569ef08fa7f4abfdb368345c34242569cb81980c0463529469e522e742042"; + url = "https://download.visualstudio.microsoft.com/download/pr/ac99e470-ab07-4f1f-901a-3d14c9dd909d/a2a51c3f12ba268e22166cdeca54cc65/dotnet-sdk-6.0.416-osx-arm64.tar.gz"; + sha512 = "7099b3dba1137e1f429adebc3ebb4cd002d6528dd74426a687c2919b7d01acea49cb65c2cff1f1f2e283d96159440c60d909258d2350b8e76df3e513152b23f6"; }; }; packages = { fetchNuGet }: [ - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm"; version = "6.0.22"; sha256 = "0naka2szh9yxbqh99b4hswmxdspknckxm1dc7y56b8685gpwj202"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm64"; version = "6.0.22"; sha256 = "1xvqqc7bzj764g3scp0saqxlfiv866crgi8chz57vhjp9sgd61jw"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm64"; version = "6.0.22"; sha256 = "0nwnrchpajsllg2gxnxgyxgdbdamsnvpav1yv746bdjh0anb4yr0"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-x64"; version = "6.0.22"; sha256 = "0ss0avj940d47pykh7sqsks6g15ny0qwp67kcbzb9nc5h6gi4p18"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-x64"; version = "6.0.22"; sha256 = "1gcv99y295fnhy12fyx8wqvbhbj6mz8p5bm66ppwdxb3zykjg2l8"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-x64"; version = "6.0.22"; sha256 = "026r38a7by7wdfd3virjdaah3y2sjjmnabgf5l25vdnwpwc7c31d"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm"; version = "6.0.22"; sha256 = "1bfff1342735kp4d9rhmwf8jflj40dvpy1gb3gvd7dri8vqhk3fg"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm64"; version = "6.0.22"; sha256 = "1d58anf2ws7gs52fyjj3i0fr62dva9va605vswl95d4w8av5bgnj"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x64"; version = "6.0.22"; sha256 = "0ygdqsd312kqpykwb0k2942n45q1w3yn1nia6m1ahf7b74926qb5"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x86"; version = "6.0.22"; sha256 = "075z4rn6nx5jqgxksdcr743mrbd6lw8hvsxkbmyg5ikqxfwqa1ny"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Ref"; version = "6.0.22"; sha256 = "0fqpl1fr213b4fb3c6xw3fy6669yxqcp1bzcnayw80yrskw8lpxs"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm"; version = "6.0.22"; sha256 = "04xvsm3kjh04d0cbw524f021kliylgi2ghcm7w0bm38p29022jh0"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-arm64"; version = "6.0.22"; sha256 = "1ib0x1w33wqy7lgzjf14dvgx981xpjffjqd800d7wgxisgmakrmr"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm"; version = "6.0.22"; sha256 = "10dah19xqs4qkvirjj921hrkyrkv3a6gis562f4grqggmr6kb9a4"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm64"; version = "6.0.22"; sha256 = "0gri1gqznm5c8fsb6spqb3j88a3b0br0iy50y66fh4hz9wc4fwzm"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm64"; version = "6.0.22"; sha256 = "04b1p8whw3jqxdxck1z5m5zpa56jfqrzspa7ahaq9xqqfacsfnzx"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-x64"; version = "6.0.22"; sha256 = "170d8md31m3cfxwbanpv2amr5cmd1kkl9wl2w0jz9ggiwykc81nz"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-x64"; version = "6.0.22"; sha256 = "0k1i74wn6j7nq0bd8m6jrpl65wda6qc9pglppvz4ybk0n2ab1rbi"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-x64"; version = "6.0.22"; sha256 = "038bjwk201p2kzs3jflrkhlnszf7cwalafq0nvs2v8bp7jlnx5ib"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm"; version = "6.0.22"; sha256 = "0pvab3a6h8cv1qjwkl90n44jh9z3aajgwq5dyq11hckxq5iga09n"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm64"; version = "6.0.22"; sha256 = "0h1jr5lacsxqw4dx4fclxfbn711vvdkj7j7l2wq2iqhfkdj6r7d7"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x64"; version = "6.0.22"; sha256 = "1bjy3zmrmaq97xp0f3nzs3ax330ji632avrfpg8xz4vc5p8s1xpc"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x86"; version = "6.0.22"; sha256 = "1g190wngdz8758knb5ckgzip6hw6a72cjwiqgszmyh6hfisi553r"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm"; version = "6.0.22"; sha256 = "0px26kil779qjcram05smv4lq600l35r0klwh4qrwlrjq4pj2250"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm64"; version = "6.0.22"; sha256 = "01gbl9dgky4h7ijxryz3527l39v23lkcvk4fs4w91ra4pris2n8p"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm64"; version = "6.0.22"; sha256 = "0qplswzqx17xa649mpr3cvlap926hlylvk1hh77cpqyrx5wz7855"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-x64"; version = "6.0.22"; sha256 = "03nbcav8if0yjkxfkkk5sknc0zdl9nk3lhd847qa602dsigabaz9"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-x64"; version = "6.0.22"; sha256 = "09gfqdxbh36bjx20fw9k94b9qa9bwffhrq0ldwn834mx31bgrfs8"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-x64"; version = "6.0.22"; sha256 = "1sq1ygsrpv2sl85wrs8382wgkjic0zylaj1y8kcvhczcmkpk3wr5"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm"; version = "6.0.22"; sha256 = "0svzrwz3zi40xab1v1fd1rk2vcmxj1y6a4q6ap5hx0y7pck3xlcr"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm64"; version = "6.0.22"; sha256 = "0596z83qqgrjvih2sqzjhm2i6ww8s3c4dhjfjl35d5a676j44n31"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x64"; version = "6.0.22"; sha256 = "1nn254xv1hi5c4rg38fbfkln3031vv545lv9f4df31i8c1yfzz24"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x86"; version = "6.0.22"; sha256 = "06hswqx0p4gdvb4r1ff77kwcmwsswhc0h79dffnmfdrll0a10yca"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "0rii1mcsrbz6j0mcnbak51rm7afbxhilkvlfgxqvipgdg0xq0nyv"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "15k8187hcs54l1wjh5qd3w48sjcpad0z2dn2ng92kmay74jl1yjy"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "0nwcbkmxpjqafpbi7i1lrw3k235jn8a3g5aimnvppfi2plpys8f0"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "11cgpvhrq80r2fra1fqpcarp02nfn69v27av4svmglkv0gqc0fvw"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "1x37zyxhv830480kdn96k1w6lh2yby31dpdh6w9yj475fh5na3dn"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "0l7whkm7lidyq2qdbrrvwi3qjk19w2712g9ks1mr4zgqcc29cipx"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "1sj3a6g1l7g1w4c7wrxnswqz1n7kk7f0m63zx2jmqhvx5igpnnvw"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "1c25fmcb0x2alhnhlfclh5vk4b2rrd675vm21wh4jyjv56vls6js"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "04k53x0vc7zwlzxc8n5qg12wxg2r7nppp19sp9q4qfampyr92r2z"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "0pgjn0mkgwrwam03zwyi0f9vz7msnnblw2wxg67wwij1azmjnb20"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "0p0xga68ms5m4a0f89jgja8r79ps03d3ka4m9ni9z7yzhq83fq6n"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "17hr4fpl6a8nq3qphhg7m8z5ad0l5az4whh9dk28n0yis76dy5fn"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "0qvqnz9b4cljffmms8yms9rijyfc18igbvg5l0qa4y50416r6i1i"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "1m56r3admq89lwp4cxsinzcrr8hdl6rr87vj439p9xkpc8yw83a2"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "0zwl7c2vjwwifqb9rfl5s3xfffhhlzffh12zjgd0lzhx7y6fn8iw"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "14h04a5skmdlqd2yr00h3ybgw9mnvyv9zlpg7vij7qgdvq4zz8p9"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "1gw9wmg6nqgahgk04g04rfg3v9d8rs4qfhiz6g4n4h6v8lxwirjw"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "12wscn8jkpbgcj1kwwipyin0b61i99r0z6pwg5wrgrirvv0a9jnh"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "1pl1g7s58ay6dryc1mk1haw3g2ywv1iakqv9wazk9cd8d5ls1mpp"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "0inrily1l901723j2ak983i79vl8ppb01khrpwvfnibcycj8l2d5"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "0vawg1744bxbjxcb5jaqkxcz59bgpg5c231qckjiza2ycrw5nfhk"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "1xywy4lipml6ifi7w8aghnrbp8br421iqjfni8pr25d9fri83rk9"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "0smyxwpihifgbyx8kpqbynp9az0m86k1s1ikdbinahglhj9bxca6"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "1ixmmhyq37s8v76fsj35ffpgvab5lzh9wf4z3x0kkp9v561knh05"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "172wq4gdf64ri5qs9s33wyca5rg2mm9vbfzljf6dszy47847n5yd"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "0iginfaq7smfipidp8vr2jjw0i4xq8fq8km1ki3z6gkxp8p2w3i8"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "1mb10yml3spgamwllqsxx0n7gimj8nac0lc7cz5yq56fipp4i14g"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "1bj7rkqiiy1wrfyiq47h671n5igphzd7xrpda7myzh0xcsvqhxab"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "10yxzymgg8cxhymqhrcr9vqg102fyvh5dc2zrdaqxsf64hv469g6"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "0yv8jv3gbsji81pn72jx6is60gy4v4f657kbp4kk7f1q78vx1046"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "1jsnywr0vd4lkwi6gr6s06pv2bl8dsjhj4q6vxk276i6bfxss5jd"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "02g350h6537fnv9zsw6i4anbaq5f4mrfsqlrsindxbfmqapnbm5w"; }) - (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "0ipl5zjcmlzm0ia00hkqgzc20f6k7bsk68rr1yc3rzzmp6gcjgml"; }) - (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "19dqa1s2gz2rfbqsqsnzxxybbkd2y412ck19y06vzbjwc3r5v358"; }) - (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "1mn6zmgc0n7lbc6vxvnyxf5znvdzsqhvkyfhpfga67npj2i8w7fc"; }) - (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "0razqiq1hhzrf46m71vx8n8gvraavndig5119g8wh7rlxhrrdwk0"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "14v8vrfx3ncclki3nfhg83p01d7abwqsfmgqyjwka2slhjrapgpn"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "1pqdmbcs3scxa1xqw4sa7y9dky9nd5z4vzzx5frjxx3255f8zcm9"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "0yabmsv8lnrvsylxvs96vswwky4slp3h9c0gn7x0agpwh7wzhwg5"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "18zhyrldffv5scvwvc6v9p0dg606d204m1rdijr2sx1g4sg3gplg"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "032zmbhry64pzk9vlmgk8pc1bwz0jcx8dnbz1w34wp8wwx8f0cdz"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "0gcfaki5mf40x3yw97dci8dwlsyhjvjy0ysbid1g80ag9mkjqh4b"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "08057y5d4sjk77f24lnsiv8dbn2axgz8mp5sfzvmaqzzig3w3j3v"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "1zx164azcsrss62m8dk8g8nkl9kq8z7n1mn756jskdrdmdslqxjz"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Composite"; version = "6.0.22"; sha256 = "0i9gw5d7gqjbir7ip9904zj6n3sr81xv8lf290xbr163l2f181iq"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm"; version = "6.0.22"; sha256 = "1si0dmcjdwdm4z6x412hvyq35jps0rv1y483s83wkv22b0j7l3in"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-arm64"; version = "6.0.22"; sha256 = "0166gwarhhnary19lf80ff33bkx00mkm24f17bc8j6v7g3a7zvq6"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm"; version = "6.0.22"; sha256 = "0g2sc6359k3z3f6h2pqg8np2cbk57gpzbyqyn5ixlv34gv3pfhfc"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-arm64"; version = "6.0.22"; sha256 = "1x7wclv93q8wp7rip5nwnsxbqcami92yilvzbp0yn42ddkw177ds"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Ref"; version = "6.0.22"; sha256 = "0km8184kma8kgz7iyl3j6apj1n7vskzdhzmq3myy3y36ysqrb4wf"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm"; version = "6.0.22"; sha256 = "0nhd7q0piy6frfv7fx00lf7hdd0l6mpj3bb5w2c1ijfqlcny88ww"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm64"; version = "6.0.22"; sha256 = "0vhpqbywilqkyyvlra6sq94vc5p76da962g550lmw18yfkzk5i1q"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-musl-x64"; version = "6.0.22"; sha256 = "05yyssk0vin5s7r5cs43il19ki424ikpcifw1nrglw5ar700pw50"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-x64"; version = "6.0.22"; sha256 = "09if60d7175yaraf1ljg47lcxg3wpnm3yd33a68g60zd3qi80har"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-arm64"; version = "6.0.22"; sha256 = "10bq9y4vmw09a5apyzqa8zgn8r1i0wysrqaj0rw7bjjl3iz4vifv"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-x64"; version = "6.0.22"; sha256 = "1l56sx3rjmdq8i5cwdzd90vkbx5nyzbbc7rzckmbw7lbi92ys8lc"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x64"; version = "6.0.22"; sha256 = "0gqv5n9kb8avfn9hqn50ybm12hxxrz35gvvfrppdwdqain13ypca"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x86"; version = "6.0.22"; sha256 = "04kkaxkqxw67cn58h46li5kxv0axkdh9f2mr22n4llysbfamzcd1"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "10rlwyacci7l8j028n486a1icbsx4lvfq92k88a4h75ys5iy9r63"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "1n313j4lrdsr7yw8r0kxcd1137w4kqmsypjjadcdcq3wm1c8207p"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "126sn9p98shb8pbf4wd5vf94fl2jbmvshdkdmq4knyn8n6bg3kvf"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "1wav33bqfz7237cr55x3l27f06ybdrm9zl2dnapjp79ipp73vqj7"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.22"; sha256 = "07p1gccdwhq7rsvlniwvy8ja4dbxisv4822yawffkwwmpnh94byj"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHost"; version = "6.0.22"; sha256 = "09q14pyk13ki8wc29wy87adq393g35aanfsp4bdag8gb68qlq847"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.22"; sha256 = "0hvjnnviv8rc3hgw9ypzvx9b19riyb0kyq34g9sg2y3bamhahd86"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.22"; sha256 = "1zjdfjp161n48s8x4jx1f957j49x4g10f61p2b721cc616wfpvik"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm"; version = "6.0.22"; sha256 = "1qcv9286f4c035naqfjmscqn11hid1ak5qw4lv51i0qijd6bkqad"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm64"; version = "6.0.22"; sha256 = "141zgcsw9v8pyf0cgg6g433ba1xg87343gpcy9mpnj2jpczhh0cr"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-x64"; version = "6.0.22"; sha256 = "0cm4bv0izfyh6ynr9zdjy2gn6c6vsqfrc9b0pjmadgf07mw9sns8"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm"; version = "6.0.22"; sha256 = "1jci3jmzxjqi0h2fwmxqh8vss3cnfw0nv6bw7s13a4jzx1127cxi"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm64"; version = "6.0.22"; sha256 = "1yx5y4s9ihdgk7pmc2il516w790d6rkklsqlxj5w4yy9vmj16mk6"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-x64"; version = "6.0.22"; sha256 = "19jrak7w0dbyn2jrvxqzjizafglw1w6v84qfqywbbqkhplr6km3a"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-x64"; version = "6.0.22"; sha256 = "0pdzn9s2qdw8ngk2ygnj6xil544h801xhxi0lz0d80dws2w8440f"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-arm64"; version = "6.0.22"; sha256 = "1savfrhbcalhdfkc3z6008d7rx0hzr4ry3nvcw7kchx6mxf2pkxf"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm"; version = "6.0.24"; sha256 = "1xiw3kdc76b9hqf0pyg9vapdxwv637ma1b63am9dpvm8qprn01nh"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm64"; version = "6.0.24"; sha256 = "08670zhn2ywkwy0d7sj89rikxccy5qg0vsjwpbypvzndawng0bb9"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm64"; version = "6.0.24"; sha256 = "1iwnzs8pfrkvqyp0idxc7bx4k8970zfbsdrk1xc3v4jw99hj0q2i"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-x64"; version = "6.0.24"; sha256 = "1d7j7b8vvbrdf4hiji5snmn8yi39scd2kvnbs5f9sy26424fz22y"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-x64"; version = "6.0.24"; sha256 = "0knx6lhlqxn3lkgakpab0663788q0si00m9ga7wdn2mzqq0s9yx0"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-x64"; version = "6.0.24"; sha256 = "0qci0ghi0cnm26pym6qlp8cricnbgzdxzwzc8ay1sdhha8dbh375"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm64"; version = "6.0.24"; sha256 = "1qr67bb1wqjs43xwypnqlrx3fzhhm9gyjwdniqr01c48yg8d33yw"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x64"; version = "6.0.24"; sha256 = "07sr9hqzbm1p5cmvzwia30yv5cjf5b1bm0l4bx45sg53g8niramp"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x86"; version = "6.0.24"; sha256 = "0cvvmh90vil156qqgy2kbv1j6sgrp4z977f3zrwbsw4pj9azdalx"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm"; version = "6.0.24"; sha256 = "1czq36l5l01f6r1mahzg8fim1qjxgs345mcyx1f4gq024dw1fmfb"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Ref"; version = "6.0.24"; sha256 = "0lriw4f48f0q2vyagbngnffshdismn3msn7d6dj0lb2xdkzsz1f1"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm"; version = "6.0.24"; sha256 = "034p01vm5jfz94qzqcvpph5fjk6rnkjwqlsm39ipc38f4r4a9iif"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-arm64"; version = "6.0.24"; sha256 = "1671gfqabmbqnjq1djx17j5q3zbaf6ivapixyhsla1bz1gadm3g4"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm"; version = "6.0.24"; sha256 = "0l2d49an5bmdfd7hgykkd82n7i1l9kpj5k3vfwdkv5274iaiqagz"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm64"; version = "6.0.24"; sha256 = "1vyy01i4w2wcx82mrjjsbp98v9sjn1cwhdvkhrw8yrrb04lcxbir"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm64"; version = "6.0.24"; sha256 = "1ij8xlr044laq4lhl833994hpr636hyisx072c6wmmm21vr9i312"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-x64"; version = "6.0.24"; sha256 = "1mdhpqdwcly31x08n6wk39n970h98kqgr6hrh8grqln2fqz2xgw8"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-x64"; version = "6.0.24"; sha256 = "02l6javfqwsaialkimmpsq3v4dhb1j4sxy19yvr5w5sdjmq1jh5y"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-x64"; version = "6.0.24"; sha256 = "0g99fqr27h1ya2why3inhcqhyrxrg3g0hvcnqvqp153njcbdl9qg"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm64"; version = "6.0.24"; sha256 = "0i6gfdlb815322n4rj7mgagrdhpj8kha73r8h0w9y0bkwgjlqw6v"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x64"; version = "6.0.24"; sha256 = "11nfqmjk11446nl4n35w2l94dsjbbm03lwz47vffibcqmymd57xh"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x86"; version = "6.0.24"; sha256 = "1n0s52gzfc0i4wwbcfpqh02z3kdjxjpgpvslia1cf8v5wqn690pm"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm"; version = "6.0.24"; sha256 = "0j30fyz0cavqd059iviglpx1c3q7mlplvzhnwl2m46hdj18ln8pa"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm64"; version = "6.0.24"; sha256 = "1zcn4px94z67j60cidynm5ab8cln1rrxabv7c24mlajqnkfw14sb"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm64"; version = "6.0.24"; sha256 = "1hw8rxghsagw8vd6f5sgl16s7x5d5ix0pf9zqs9zis1wfm41lgv9"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-x64"; version = "6.0.24"; sha256 = "0w2aq1bmbpbb2b79frr2j7xnf2h5mszip2wgaxzbl1vfsnq4zs3z"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-x64"; version = "6.0.24"; sha256 = "0rylvdvdc5rdmw2vcqi0fdzmiwwa1pwlqiavqnb2pslhhq8qg4mh"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-x64"; version = "6.0.24"; sha256 = "1wb4w0izm4njhgh4dji4zv072cw5h2jkw7qdaa98130ai5czg5x2"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm64"; version = "6.0.24"; sha256 = "1crdfd8p83syn7m4n7vm82lr9lcrz5vq7k4jrk6g3xfgl4jkym2n"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x64"; version = "6.0.24"; sha256 = "1pc0f31pvfzgdgwlnvpjysvjmzakskllccrsh5qp28ccrr67ck0m"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x86"; version = "6.0.24"; sha256 = "1lpb81zpfdiz4c1jyfq7y7m4v6icq8b8dg5ainrxjzjz8qjmn7qc"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "1x3h6w52ab7cwxvshnjbhb9vdfifbnjmwn2kgw2ngl6qxvygikv3"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "0ncqxzbpgfgdhrvl3j3csmr749nlzxp7gqf467wsgxd9kri848rv"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "1a5935lb2rb9hj6m08fh6r0br8y3i7vq5xzy48hanjdb6cair3k1"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "0l5n8pl4i8khrz3nv045saihvndbgwqqip44yc5r5abjbpljp5zq"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "0yv1bmgg85g2abph7wmkv9y7p4s5l51wa3j18rcd7wx63cjik1sa"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "1m17lihc3fya44y4vpnacbia773gpg4bqd0gy3lw86gx7rs4n343"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "04q13b76icmbp7cpjwfbw5hlqxnqlrgs0d0xsp7hxlqvnpg1ba9a"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "14p0wpb8w26zagjnp9jvbdqzvgg04s3b9midhz47zr78qjqa0k41"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "1n66dxxkh5ax83wp640znw80s1j03sq6zbpi1wsvmm9xbasskjw6"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "0yg3fc5x7frqmvnca244rhwbqwmrcyrqwp0kv2102fs08fjcyk5v"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "0fdnvq997sq16fkc9sjaghzmbahvp5k6zk24s8s51ypbniynwpq7"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "1n9bjddbmi6w9bsz4vpc9fx3wyn6ygvh05wcd98d3rf0p3ynghcx"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "14h9xxha2qb2smnk2iy6inhwmsjmkpv4kd92l42i0is19k1sq852"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "18mmlg42j8hs9qlq74pxhpj1sm53gqclsrpdjq3d4gpfg6zz7h02"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "05s0qdlyasjrr8vf6kfx18vixn05iwsk23hpsp7qdjvx560kdza5"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "1x7nqpb0psqk7q9ifhw149b6awcpm8lgpy2pxz03frdnbpjms7x5"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "1jigailv8p3nmmy8qpscxyq8zrdlwkfrls3qicn9arp9ni8phmgs"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "1pycy8jspvdga940frd06smsipq10bip9ipd466pnqicaa8nawjn"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "1gm99469wb35v169dpprrnkwkvbzh6v2lapkw4v8mx4nylfc84dx"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "1sgjiaync06gy6a1zmpyvikbk3l868k2qg3jag1dyyyl2s1hp02c"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "14nh4hlk9znngl1kl2bhi0ybpsn1kmxb0hq122zqjwvjbfqahlzd"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "0y6a53kfhwaddm7yw263yyn6c5fghihlh76mmfi1hba9bf9615qs"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "0ya7bx3lg92bil8mswp9awhlr2gg2z77kmw90l3ax7srymbimzfn"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "1x1hlgn4j9vql8p7szrjrli46lyjn4a4km9v3hj5rg3ppm1wd7wl"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "12b1l6fc9dajvb877kffidyqiicfkk1cxpr5w6cgcvfif3cxak87"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "1dpkwqwj4ldasixv2lkg1smql3cgxavswyk53pflr604v1519f9g"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "1ma16r7q1y8000wcwa3rxk5p4j6pw4gdfhbf64cymcahn49azh63"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "1kf26qd6ajcafssk674c44nmqr68bp9fibgrglqz67hz9r8w84bb"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "0sm8r6zdwxnwv947yszq8p5dl05j846lk2l0dxbd78r83iskmpkm"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "0059gcn5qkbkqcrrcn75nvw54jcc3q06jyq87l4hbvm9l1w6igrg"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "137nq1bv3q48cn14annxsf2zqg19ppg81fkan6vjbb9vwvcvkx25"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "0gz9ipmh5sn4fds2baqfzc8gzalwmifxs2h3qril1rawxkz29s0z"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "1h2pp8p38ilp1hlrjzh70vq2s7k9n4jmcsjpcmzghdaahdg2m8kf"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "1npxp73s5pj6cmy9j2cxnfr3cvbm86g6jmq6194qpax9b3xh3a8r"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "06v40vi7ckrn1rl8ynygxaxr0dj0ll5qqsx8k11qk8dpc6849zrd"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "17lk8414hnpn1lpxnqqlkk612l5dyp9yr8kk3hqz7ygi5i7m0igh"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "1qlxjg6ynf5fkswb65bk0sg20yklq207x1frq2hrccm5s2f53v8w"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "1a5wq6y4qixjd8xadw4wfwx7qrbz9rvhfq5f61sfgsc14lkqjs0r"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "1biz5x9pznlnik0k9jz462z5f3x87frmxayikcb655ydbaiwibkl"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "1qvqfkpr8vrfn3p3ws1k4b7mv4n4swc31grvs7bvx6ah8qfacjgs"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm"; version = "6.0.24"; sha256 = "0l1j6ybwawk6w01ffaj2rs6wac6p0lps2wsq21pc5imjcbm2mgyg"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-arm64"; version = "6.0.24"; sha256 = "18cysr0gbw18hkvc03r6gmllp2s63a0s5xvp02iryrdhaa0vr0qz"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm"; version = "6.0.24"; sha256 = "08kjhz9cw50vw3rd904r873fvdm7z4w8lf9k77ws834k92hr2yrp"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-arm64"; version = "6.0.24"; sha256 = "0ygdkff2qln45nc9yb2pcrpx3p01bf2bk5ygm34p5mcfqys9yhpa"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Ref"; version = "6.0.24"; sha256 = "1fy1hr14igy4lix4vmwkjj13cbyjjfhx8izch9cd9hc4f1y25767"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm"; version = "6.0.24"; sha256 = "09h7bvwsi2bpd8c9p11amqj2mw0hl4rzla333xmz28p3jf2l06yh"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm64"; version = "6.0.24"; sha256 = "15sqxccpc9s8djhk1cb1rqlgw20qd2bx8iij0i11riblqg8n37in"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-musl-x64"; version = "6.0.24"; sha256 = "0vxb0a7zvhhljv8w5bz7ryn8hl28r9j0s20xm1rj4ifggpfkgzgm"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-x64"; version = "6.0.24"; sha256 = "0is94agm1v7q3qhxx8qkfxip92zikd65xq70mg7nl0qms8p4cc41"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-arm64"; version = "6.0.24"; sha256 = "10yk9qlw0v0dkwmzhx58spbpab7xlkxnlzji9dcknmb2yxh4g870"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-x64"; version = "6.0.24"; sha256 = "0bln3fn5pyc9s03yyfln517682jcnmfnw7v207swdn2qrdcfgdk2"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x64"; version = "6.0.24"; sha256 = "1yxr2n4p6ijc5hi5ym7hbafqgc6b0ckl7wzh2w829mmg16ww4nsc"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x86"; version = "6.0.24"; sha256 = "1bryp4rpa21q7fmlr71j6p9r9p30f09mzddkg3d85ll7faap7iqx"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "0v2bc1is8786h50nhzf74sm90l1knn85a3f7phxpp8mdsn13ff9z"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "1wmgjg4fl9c321yklb0nl0rzj83646xzcf9akj6nzz9ihmq5jp5v"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "0ikg13k88chg6wv8d9bpivnn1ldpnx2yqs348sk6l4i2m1wyz5dz"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "1d3qs0cm2nmf99rv0milmh3g6y5riz66xlkppc6dhn8p1lqrgaf5"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "1w5gjdv7dpig78m334bavlhl6938g5h7bsx26wlzb3rzc9vbyv5f"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "06fhdy6hm78hsscdlc8i22wm439z3fw4003i5r03vvwlpgwm7y3c"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "157gd8fi7vx2cbak8k1vxri8fy54f4q02n6xi0jip8al4l018kn5"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "0sps772kj4sa7cb6rcwlssizbxj7w7zvqfaflalm9zq2m23v7q3s"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm"; version = "6.0.24"; sha256 = "0wsmpychdx33pcn6ag6wk0z728jfzi3gds0azh7mv8qizg5b7ak1"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm64"; version = "6.0.24"; sha256 = "0lc7ckk83bc301kqascqgh2cw0f20rmi1j9144yikpr38x4irg78"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-x64"; version = "6.0.24"; sha256 = "0k0vyq8dixgp87mskkhdn8bbhdpza1imjfx1jqycms6l4m3aiffh"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm"; version = "6.0.24"; sha256 = "1g9dl6n77b9bfraz83hsb3qc74g3wjciwr1r5q3m8w44iaqx6vf0"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm64"; version = "6.0.24"; sha256 = "1iabbhilq865ccrdq6z765ay6xgqlpcb1abzkaw1kr4lcdp5qh4q"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-x64"; version = "6.0.24"; sha256 = "1hvz3zfgmk6pc7q4f400fnd578yfrah69fm5ybk4lxywkydazjn7"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-x64"; version = "6.0.24"; sha256 = "12d30k8ia8sl4n4q4dzqx2daj7zs20h439x2lgj9bn9gxbrc9kw6"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-arm64"; version = "6.0.24"; sha256 = "1ibh79yqbbxxvk8h1nr30kmcj7lz7y733sxdbvj5a28nbvka6axs"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm"; version = "6.0.24"; sha256 = "1xdnk0my2j1smvm1lyb9xxda78nx9pnl7pnjyaxbyli918qayyjg"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm"; version = "6.0.24"; sha256 = "1wxdh02z70dx4x3vx6bq1krc69irrdiar7662wqkcic3lkgqhdpm"; }) + (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetAppHost"; version = "6.0.24"; sha256 = "18h52kg8brvdm2kagjm4lfkmy42sqmxc3avv7wgn1nxrlfdl221l"; }) + (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHost"; version = "6.0.24"; sha256 = "1xbvhii2p53l6xklg2m54pyk6ja4480hkyykas5m7gvzwglnlh2n"; }) + (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "6.0.24"; sha256 = "0c8gpc4qpr2v6hwn7qswdwyv689gczksvfw9wmqij0nmy2fyrdyz"; }) + (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHostResolver"; version = "6.0.24"; sha256 = "0x94xqff4s0nnwslpmyw1g50k4vsrb6g2xvqmiis2lg8422xi7jg"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Composite"; version = "6.0.24"; sha256 = "1s9vsk81c8bkbviig3x0i45skhsifxwn7sgcg417pvzj27l495a8"; }) ]; }; } diff --git a/pkgs/development/compilers/dotnet/versions/7.0.nix b/pkgs/development/compilers/dotnet/versions/7.0.nix index a9ab7b4a6cb79..837e3b337934f 100644 --- a/pkgs/development/compilers/dotnet/versions/7.0.nix +++ b/pkgs/development/compilers/dotnet/versions/7.0.nix @@ -3,184 +3,184 @@ # v7.0 (active) { aspnetcore_7_0 = buildAspNetCore { - version = "7.0.11"; + version = "7.0.13"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/dc2c0a53-85a8-4fda-a283-fa28adb5fbe2/8ccade5bc400a5bb40cd9240f003b45c/aspnetcore-runtime-7.0.11-linux-x64.tar.gz"; - sha512 = "a5691a53a1be91751bea5c1f6faa2e93d19f5be61dc5a4953a6d6ce33359f78126873022fa1a25e2694dd85ef9671b566bf8b6c5f399f1eb017ae26833867019"; + url = "https://download.visualstudio.microsoft.com/download/pr/a4ac0f7a-a65f-4222-bd1a-c1a94f7df32b/2c62b82c325a8c396db10f09cfa952c5/aspnetcore-runtime-7.0.13-linux-x64.tar.gz"; + sha512 = "930c83d7b553529f37b1516848f64ac5bde479bc5dff5e89edaddc4f7b552924f9b51b58367df8cadb9055b4a7220bfa5a4d39e09fb6b51f4bcacf3b82416ba3"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/cd1c8c35-921d-44dd-8296-f76126a73e86/5c7c20fb1df66c7b1853f77ffe858d1c/aspnetcore-runtime-7.0.11-linux-arm64.tar.gz"; - sha512 = "e8864d261487d3077b0637e710d9348209dd7fe19a0cdd60edde2e43d238f1e534b9485282230c8b1cea0faf4bff1887f07dc919dbeb9ea7f97d4b26b9c7aa91"; + url = "https://download.visualstudio.microsoft.com/download/pr/53990197-c340-4514-b12f-a6c6580cc1b8/c25e55e6e23e7bc94701dc982525d66c/aspnetcore-runtime-7.0.13-linux-arm64.tar.gz"; + sha512 = "a091c7bc7dabf944ad2888908e8becb0b9ed6a8f3f0475c845559804bfb35d6d76fb81ecafac4d9a589b64837258304d94d5c412ef8c75e138582072081f270e"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/6df3136e-ba50-43e8-a68f-93e347c63693/e1b7ad4c0009723ab3a83db65969d0b7/aspnetcore-runtime-7.0.11-osx-x64.tar.gz"; - sha512 = "c0925ba2ff686438a40e5b61b660dca48103b37ad42f30828a1bf20ac2f9750a0f2643beb533eef877519f56757f3d4c50ccc5c1c172527883981b0d7974677f"; + url = "https://download.visualstudio.microsoft.com/download/pr/1858183b-b0ae-4866-86b9-af2efc7bf05b/d69c3f2f527c182a841c7233dedc496a/aspnetcore-runtime-7.0.13-osx-x64.tar.gz"; + sha512 = "d635ac072df5f5cf587470c656b6a55e880eeba2f00c12cb6e239d7cbd0a52d92b094379de80ff60fea426049d96e54e095417f089890eb92630d3c07a20a67e"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/f7ea90e7-5d92-44d8-9b55-211182814710/af6bbc87d7505be5d4b22f130076a65d/aspnetcore-runtime-7.0.11-osx-arm64.tar.gz"; - sha512 = "799460d18543a4e3fcb0b0ed824bbc248afd9374bf74142d12a65d422aa8eb939914c870f3d575ad121d035c19adcf4423815a34e24969b9eda15a2048de8b68"; + url = "https://download.visualstudio.microsoft.com/download/pr/a7823689-d818-4744-8bd3-fef504768c3b/7160531d6f935155772e4b0d4a0e3b78/aspnetcore-runtime-7.0.13-osx-arm64.tar.gz"; + sha512 = "6734869eaa22f163d8fed52ea3b1f11f22ceb0876337114a0b9927a96e4fb82f826b6ddea3dd7061ac02da2e13c32c9ae6c946ca5ce53007869a97c0cdae3f94"; }; }; }; runtime_7_0 = buildNetRuntime { - version = "7.0.11"; + version = "7.0.13"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/948e3f45-a2c8-4d34-954e-a360851b7ff2/aad7d4a9b73242625bc33b0e9c124478/dotnet-runtime-7.0.11-linux-x64.tar.gz"; - sha512 = "110db17f1bc9e5577488e7f5425c6c639851af68c8d7dd17b0616469755c27d3c8a78ab01aaab13ed4849c676230bfeef9113f1dc4cda34c5be7aa1d199e7d57"; + url = "https://download.visualstudio.microsoft.com/download/pr/084709e8-8937-4c46-a361-28212cb2838b/4c5d7393c6e79f816a1591264411c22c/dotnet-runtime-7.0.13-linux-x64.tar.gz"; + sha512 = "00a0b9c101c665ea9e751ce645c68840b02450c4a9f268149e6f59da1f179e85f0932475b8a72162b5271fdfe2ddc88eb21d09aa78bdd7dc285983445503f758"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/6079be92-f70b-447f-bdbb-ee85e5b04d14/249738ad78341a40f9765599281579da/dotnet-runtime-7.0.11-linux-arm64.tar.gz"; - sha512 = "567b39c4b8ff278349fa76522351e6f399eadd9a86189150a312fa7a4d365c60ccad8a06564ff4b8acaaeb907222d6b154b711e324989f7f6c234dc5a85ea0da"; + url = "https://download.visualstudio.microsoft.com/download/pr/08f8d331-b20e-4400-a1b9-ddd7b4977fad/b162a6c808f713914ad3ec65f88521d9/dotnet-runtime-7.0.13-linux-arm64.tar.gz"; + sha512 = "e3a465923ed3325f3d427a4737e0e23bfcd549b1ad2c2374e65a3d865553790e644a57a0aef676893050085a389a846737ce6ddf6f2f53e7bae7d3f6253c06d5"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/ffaab50c-bc8e-4b4a-a1e1-7bd859a3e7dc/5e6a62a33021d44df7807e3fcca4d111/dotnet-runtime-7.0.11-osx-x64.tar.gz"; - sha512 = "5e714641c1693abe2662ee71f6aae7ddb35a8a3869939f024f63666d7e90fdf2e5e25af5d7e53c81fab293706640c391ce6be4f737df3fe2a0d769bdf443178c"; + url = "https://download.visualstudio.microsoft.com/download/pr/30e43cae-eb9e-4d8e-b1ab-bcc4773f9fae/06137966e03cd705d55a86e10d8a6340/dotnet-runtime-7.0.13-osx-x64.tar.gz"; + sha512 = "e28407e6e466ce8708a9648e59df6b574da5794c61418217edcbcd068bb72086761a7a9f09c3c35cca3f7bba9c8aac28c8cb6b64b6fbfefbc3016dc1f6292ab3"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/6120c903-2058-4ea6-a62a-6b246750c2c9/28d586c9ecacc7fe95a65f98dc6acd6d/dotnet-runtime-7.0.11-osx-arm64.tar.gz"; - sha512 = "546ec5050ebc70ed17252d401cc43c9bd628fbaa40a6a764a4ca567fb37d0db14a6c0e28a190bdd74254e886aff9fed542830224f0dbaea32792235386648ea8"; + url = "https://download.visualstudio.microsoft.com/download/pr/ee9ebef3-f459-4337-bd45-521c818fae52/58efc8c2ea98c0fdcd8ebb15700a0565/dotnet-runtime-7.0.13-osx-arm64.tar.gz"; + sha512 = "d0ebff0a46471ae1450de439b870b775e88901e05d3716261371e2283b5ae469bc03b71f545d08839990e7473517bb583bb6174215e412f10d873c9de5972f06"; }; }; }; sdk_7_0 = buildNetSdk { - version = "7.0.401"; + version = "7.0.403"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/61f29db0-10a5-4816-8fd8-ca2f71beaea3/e15fb7288eb5bc0053b91ea7b0bfd580/dotnet-sdk-7.0.401-linux-x64.tar.gz"; - sha512 = "2544f58c7409b1fd8fe2c7f600f6d2b6a1929318071f16789bd6abf6deea00bd496dd6ba7f2573bbf17c891c4f56a372a073e57712acfd3e80ea3eb1b3f9c3d0"; + url = "https://download.visualstudio.microsoft.com/download/pr/ff8c660f-ffa9-4814-ac2d-4089e6ec4eb5/dc806d344844f1d58d8015d105e85c65/dotnet-sdk-7.0.403-linux-x64.tar.gz"; + sha512 = "2e96fa4ee32885a4433be12aac0e10998f9e7f0fe4791f33cd31966c0e0d345d978514787a36c5f0f43c7754e9639a5d52fc96c9f44cf56c0cfc9a8ad2620dd6"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/799b3459-f1de-4c88-ae38-fd1aa76c2d73/db275a0fe9776b55cf0f81cb0788b6a9/dotnet-sdk-7.0.401-linux-arm64.tar.gz"; - sha512 = "7c6ba2047998c906353f8e8d7fa73589867f46cbc2d4ece6cc7ee4ca3402b6a18717089b98002c7d15e16ca6fd5b11e42037b5fb0e25aff39075d67d8be49e25"; + url = "https://download.visualstudio.microsoft.com/download/pr/558bb19a-c08f-4aa4-bcbc-481e9b050031/4de7724688881c9ce6f0e5cfb8a2acb6/dotnet-sdk-7.0.403-linux-arm64.tar.gz"; + sha512 = "0980f3f888f1267a5dee5c916ae8d0931f0c6789f1e7334fb7b4d5ab27a1876ec014d30be8977d314e4aa7302b197dde09ed39cdc5ed84b366307148d5350deb"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/7190497a-9e02-4369-ba8a-29e7a4acc69e/45af3f104e254cc37cf48227bc8e464c/dotnet-sdk-7.0.401-osx-x64.tar.gz"; - sha512 = "7c0ffdc756e13606982a58f21e8fe6fb4a0cfe0210ffba925e81f70b0266715f17d2dd9efeac72c23d552f099c173b04c1c31d07a050151ffc65578ba2d922aa"; + url = "https://download.visualstudio.microsoft.com/download/pr/ff4be5da-8947-4b41-ad0d-84c98bc6d36d/4a20953b6b2aaa5ffd0f0a37e723698b/dotnet-sdk-7.0.403-osx-x64.tar.gz"; + sha512 = "50a38d89af656ac5a3110761182c1b8b6ca15821eb4fde8d0eaebb6dfbeb4c9046a80c00004cdbdb4e5165c6cca1f2c6ef0ca5ff84fc9c32b4c298a9f620bac6"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/4246aa3e-4c90-4022-b3d2-5bf36547bfa6/8f75268f923723fb2c4a44b271dbc042/dotnet-sdk-7.0.401-osx-arm64.tar.gz"; - sha512 = "64878c33a80a13eeff58304832b8a00bdea7da088d8683903c4adbf9f6aaab4ea9bd55f5148c76518526d483ee43ab8a76f07afd60da5fc8081456f0448ac3ed"; + url = "https://download.visualstudio.microsoft.com/download/pr/ac1ec933-8265-46e4-b725-5843d483aba9/f41605b8581d114a5131f7761f703a20/dotnet-sdk-7.0.403-osx-arm64.tar.gz"; + sha512 = "6083b9f469dccf097a6a1bd4a264ab5438bce653ceceb54cfba25526845783e43e57e6b57eb6c7b4157108d9572ca62d8df2ecdbc1a0a36d9f08310b9bb3c9a1"; }; }; packages = { fetchNuGet }: [ - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm"; version = "7.0.11"; sha256 = "1l9vydgqzsl8mcx2b58gwkiqy46v14by5fh6im0ibcpv1l8raijj"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm64"; version = "7.0.11"; sha256 = "0hmsqy4yc3023mcp5rg0h59yv3f8cnjhxw1g4i8md67vm5y04lfv"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm64"; version = "7.0.11"; sha256 = "0dazipajzj78i4x8f7m8c7sa890il4b46pxzfyz2vq21jb2g9lv9"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-x64"; version = "7.0.11"; sha256 = "0d6ny4i84fxzadvxamicr5qlmpnb1d6zndw8rkrqsaskpl57l0dm"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-x64"; version = "7.0.11"; sha256 = "18sk9wka8z5354ca77q43hi0615yjssdjbyi0hqq92w6zmg43vgc"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-x64"; version = "7.0.11"; sha256 = "0wxw7vgygg6hqzq479n0pfjizr69wq7ja03a0qh8bma8b9q2mn6f"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm"; version = "7.0.11"; sha256 = "1lvjhrv6c4mmqa645ml4rfj29ardpgxq7rw2jsnxr4qyv1d8iba4"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm64"; version = "7.0.11"; sha256 = "0fmnfq59454vc4jsynvqf768m8qzzbnl9gv8w4q15wz1aqy02789"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x64"; version = "7.0.11"; sha256 = "05ywwfn5lzx6y999f7gwmablkxi2zvska4sg20ihmjzp3xakcmk0"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x86"; version = "7.0.11"; sha256 = "0b3sqvy48477yxzh1jfwjz69nrpnhpmy063zb5qj69birpcqriyk"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Ref"; version = "7.0.11"; sha256 = "07i1axzlpkprd9imiqxvaxwwxzdrmq8s9vd8k22gdv742wysf5pn"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm"; version = "7.0.11"; sha256 = "1i9z9q6b4zna1vg53cz2zxp4fv09jsr521nab4yvavzn2khsb32l"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-arm64"; version = "7.0.11"; sha256 = "1j0zbd4rmmd3ylgixsvyj145g2r6px6b9d9k4yxxg6d61x90c165"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm"; version = "7.0.11"; sha256 = "0jc8gq3p0qhd5ws9cwwrjghvqbxb5p0chp43na9knkw6m0wxdxdz"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm64"; version = "7.0.11"; sha256 = "03nkxjn4wq30rw0163rqi8sngfxmcvwgm0wg7sgyb1cdh0q1ai68"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm64"; version = "7.0.11"; sha256 = "0azkiy2r6zbgbcgv8ymdlhwydmap79fw4ws1svyl2yy6ws3mynfk"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-x64"; version = "7.0.11"; sha256 = "0wsy6m1i8znx4y2jf04fnzr6kwzrbqyqvzj6inmdpdnk845lfcw5"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-x64"; version = "7.0.11"; sha256 = "12hh69sr4wf8sjcw3q71vky51sn854ffahbq6rgz3njzvbvc0dbj"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-x64"; version = "7.0.11"; sha256 = "1j1k735gkwba93n5yck87wppfpsbny979hppcygwrk81myf3fv03"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm"; version = "7.0.11"; sha256 = "0hj29pn703vmhkr5x5rx1a0g91f0dx4h7synn1zk4fyzdc5bvj02"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm64"; version = "7.0.11"; sha256 = "1wrwzn4zg5fh00pbiv1s4b8fbcz99vv4x2w0m192k1pz84ywgw8w"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x64"; version = "7.0.11"; sha256 = "0ifshdx19bgnbgynbk6iy6gybnxmp63nylrn7068x66hvcavh7kh"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x86"; version = "7.0.11"; sha256 = "0px0ha4a256rawssqmzsi2grmydxzi31r9xxqdq2sn8dfpvdshzk"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm"; version = "7.0.11"; sha256 = "14159534yavrgrw04r63rcgvdnfv83xcplvb8h2nhrjgsl2kmabk"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm64"; version = "7.0.11"; sha256 = "1gzwc96fs222ddia0k1924cn7gxm2a4anqgcxhmavx56x76wsy6f"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm64"; version = "7.0.11"; sha256 = "1mfyq49hcjpj93zhxvy48hh3xji8jfj1hc8caf5wap4jna9rn2dx"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-x64"; version = "7.0.11"; sha256 = "0s3jx6gmjh907kzcqmd26202vl0knbxqbkf55m4wsk7ar3mgc8m8"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-x64"; version = "7.0.11"; sha256 = "0vxza49wwiia0d3m887yiaprp3xnax2bgzhj5bf080b4ayapzkf9"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-x64"; version = "7.0.11"; sha256 = "018qf23b0jixfh3fm74zqaakk01qx6yq21gk2mdn68b0xhnvlzma"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm"; version = "7.0.11"; sha256 = "06x84avjby7q10shqgfzw6z9d2smgwibg51vfw0dzaw648x9mh0a"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm64"; version = "7.0.11"; sha256 = "0i7x1da6drv8wl2ml9cpzbdalnmlkz86l50wgkirgnwczh3ia054"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x64"; version = "7.0.11"; sha256 = "12xmw2kcpf5rh8sv4y0mqzp917f7q8g4mfh5navqw4jmnxyb26qq"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x86"; version = "7.0.11"; sha256 = "17n1m76ac0i10vkp3y04fd8wyxf2ywjwc6m9a8z1gxgwbmfajs8h"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "08flk8ygkyzys0iwv447gndnmfqf9b02api0dcqnzq7zhbgvhxyr"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "1x9pbqldaz0h2zmw363q68a9zxp5d8xw45s1i40fb2nwl19qqvk8"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "1x1n63nav3x1is0v6glzjy8wbk343ns7n34q831hw98l4v4gs8c7"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "1lpyhwb27fk0d07ibq05fyvhx5lis7gzy3fb2wk617vbwa4aj5vn"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "1yzjid5v639xa91l2hk7kxj2a9nszq4qbydxwlw0z1c1vgzx6lzd"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "10k58ncj2q9d2aszwbqldyprficbg0dlv7vy874h8ws1ds43hgpk"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "1cbzcxwm5q51sd3ba3cfnkmwf72blqy01j98j3p94xj0fp44s82q"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "0k7xdk2k7jrrlas8g6yw0jbmm6gch6ay2vgnayb4nay0l82zczrs"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "1nyj6d3ys9c0ffhy2vjgvkbc7z7qa4p7j0z1w76zrawmiikj0j9p"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "02faahlcq4bl2v0rkbpf1gv0a45vk4xcazbcb28iybdnqmz0jb7v"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "1nksv1xyss8nhin1ac179w05dfn1181amkk4mb340r1zc348qm6j"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "031n5cmmz6z01z7gwq249xc1rysgzvvy0s7jznn9mfbyk7b3f3cz"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "1f8s6y4pyxj0w8l3hbvsyph776c4j0w51h7y7bfb6ldpaa4rf7fz"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "1njk2rc9b1vv9i5v098iycgfsc1wq752x0dj0qpiz5ahmknwgjn0"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "0bgdv0j8mhqsvw7zv225n4x4dlbhassl5klga9zhxxh1dnhfhnv0"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "02pkvvpib02rv0i00abygckw0q5rr5ykv2ffn1f15lvfcakssmzf"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "1spyrjrb5nbawj3npa4xjjl3yq5d2fd1z77bqc2kjnsvmspqcwdn"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "16ddj8gdwhnbynwdfrk56pk1nh38zs7amibpw156iqc0plwpilgc"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "04shzps9lbqwm2njzp8p8iay9b4spj62rgnz79qnjk10drbf4f35"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "0szgfr0r9zqkmbbmcvjnylyvkz9ppfbx1k1dnib6wyxfaiapnl69"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "0gpprrzbvv89kxg9k4sa6j7b16i153zy53ailnr3gqaxw3lvp8ra"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "1gz3g8gvj5gyazlr24x9cxg81rq6wlzy42zc77dxsrlivxx2jwpb"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "0m9h8f9vjpwkf7rcfriqfga11gchv28r7g6w22kc3gxdrba87vzz"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "09zmxhxsjbp9qwjhwc6qlckavi62iqqqa0xhd7cd0x834c2v7jag"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "1hb45sddw3fxlh7yajj2z2s5zzw3sz117p2qi5ihqb0p7chpibv1"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "1x7n2pgxaj2iq6piqav7vfb24n49szrdyalxa31ypkwb4b47s3lp"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "1qznwkwrcl098xwzp9hj0qrz0ch69g0mbg332md94pnzw70wjg1g"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "060hg3kiy679h8n71vx7vn6wsrcb10cvnr9yzkr9j060rdiz1jw3"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "0mjqsvqd8basizxfjrwj1a5ibjajpm1n9xg800cnfi8m7i9gm9wn"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "010icnyhwfxz7gv5s28p88zvg20lsm1fxlgwdcwgns7swiv6vj75"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "0ccyrh87fl4bsxr3a6h54cbnxpm7igm32jfh87s6if1ikb9wp09x"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "1mgi1gl3gvd5rirj91rar32s2ww6f3hf82xpbc3w8bjn6dlnd541"; }) - (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "0sck1d3dgk78rr6dmsdyrqibp8sk4k61286zvc9h2lzl3fdxizj9"; }) - (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "017x7dyjvizddd1fq87hijjw9n4dq9naqqksj25pc591f7zr181m"; }) - (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "1ajc5ipw7wjw0c07zpf2bjx3sch3d72njpdwg2j561a6v76cj8vx"; }) - (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "0mkjr1shvvrh5rx3q76dp2jrk040ivy1k34bkirms4kh8y680jx4"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "1ni1q83679hchrsmbr15ylj1kcbmaw3lsgfp3ml8m2xig1x2hngw"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "0ivy2mi36wgmpm0m3rwmiirzbvfypdm63sh4nw6cwkhfzcy7ngif"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "0j1ywgpg2m6pcq9c5cnmac0shjwq6y6lr0p05hzrrkl9amsbgl10"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "0bnm6nq7y93z3q33hgsw112ch1kz39bkw46yn6bl3gs2vwl7pjxs"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "1n31igwjmjsl5rdzyamcr3hr7qgj4950z3ki78adfgcl0z1a98kf"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "16cvmpkiaah393pxrl955gd31b9pc3z5pm3wd74r6sd687irgi20"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "1had0cfkfr9jpbl4lf53dn43c1yccsns9wh45di87in58sr52k1w"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "0xr7anzg7hazhczm5kh28l2lvagzxk4y56rb2xlmmmdjs6y32rpw"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Composite"; version = "7.0.11"; sha256 = "0knl5q76l171fnc3q8yl5f81vv5bkg5m67xm6h0c2szal6s2492c"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm"; version = "7.0.11"; sha256 = "0cxw0ck22ngw3l4d7v2yswqiy7rbcrxgbjf2d98s1k73vrpv4czv"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-arm64"; version = "7.0.11"; sha256 = "01km0wqrga2bd2mir9syh2qiglrp5y233ahyf5vhf5crb9m01g2f"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm"; version = "7.0.11"; sha256 = "040zkvkgyx0cdzgr21x6ysm4m1nb3y64yn80ffbkr7rlfqfyd2rn"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-arm64"; version = "7.0.11"; sha256 = "15b62hxrpfy19xvyxlyligixxpa9sysfgi47xi4imx5055fhwphh"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Ref"; version = "7.0.11"; sha256 = "0i8h7ifrni8hnawg59wkicrnz4xz7ihidnd7s9xz1iwigaq3q65l"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm"; version = "7.0.11"; sha256 = "0a8fa0758i1gqb44n2v7ha5mzqp9n7rnwc0f9vac11glkvjwba0c"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm64"; version = "7.0.11"; sha256 = "0g16xzqqdzzrk22dqvn0wf55lh3rk77v8m2kmk7ac9ha77pm5a09"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-musl-x64"; version = "7.0.11"; sha256 = "1ddhka5hpwbfqmz7gklg7w8vy6vy8kja1wxbfyvcx806wj4z6zzh"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-x64"; version = "7.0.11"; sha256 = "0gjmkkgd85vbd6zj69hr81jn2cbj9zlhxkskmhjsm70k6x9iwbxj"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-arm64"; version = "7.0.11"; sha256 = "0avrzj53p512565m904v54x72xmkvznr3jp5r7psjvs4hvbdg26b"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-x64"; version = "7.0.11"; sha256 = "0f1fimz923ahxw6cgz6fkz2m1b3clzi9k9yb08y8zc6dc5jc9kav"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x64"; version = "7.0.11"; sha256 = "1hsp6kyw0l88f2i2r9xsyri907v7n0m9ncpr8j4kbwr0ibqnnnxv"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x86"; version = "7.0.11"; sha256 = "1shdz0sx66vjv26hlyqvyakh8swmq0238w74lwpihpml1bz2bafd"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "1zd472n2831hmpb14zzcqc5p0rdwkpm1qzw3ciqs3rcapna3bzs1"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "1ngxsy9fcsx8rjk71skx9ih1lrj3hp809si2i0rykp8sk95gihvi"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "0s5cslrzmv9i2755s251bcf0hpkr8kh5kfad89pympryl0snqc6z"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "151h7vkpd86psgh3ykxfnfj74sccbvzii07mb1p6ia52l9jihx2p"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.11"; sha256 = "0k0x4v8rhp6hv30r15g2bny46zx2d32dlf4a5xlrz7va7n95ld86"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHost"; version = "7.0.11"; sha256 = "0cdj4sp2z7gh861m5w98hr64inrf1pr302h0dhabipkj8891rp7q"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.11"; sha256 = "1xbvxv7qhgyxl1a1w9jm46zrkia54r8liw5ssjj4kg9cagdxml4m"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.11"; sha256 = "1gh9wxaldind6xfq6ychizaq18s2kf5n377h6wbxra8055nr96gs"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm"; version = "7.0.11"; sha256 = "1iy49hg0drhcrqfn6wrvk9cywdbv9hz061yz3216kih02pfs3hv5"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm64"; version = "7.0.11"; sha256 = "0bxcmi9zx1cqwxf1bzk3n9cmigm7flhid4qr7nzkmlpczdbnk2w7"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-x64"; version = "7.0.11"; sha256 = "0vhqzbispsdcwywqzz7wvbmm9sr66j2d67nhbvcm283s9ms6wcdj"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm"; version = "7.0.11"; sha256 = "08aib3f9rid6h04r7wk8129qmhs9fcz2qav6bmmjd9gjf9i8iz9y"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm64"; version = "7.0.11"; sha256 = "18r221rvnx66n56yxqlwh7lddis1zg6z0qajnraf430k8ilbjwj1"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-x64"; version = "7.0.11"; sha256 = "04wg0nvq7yl7llk0gc7jc29iv7bw8ablaajw3hrzv0yx6kkhbb4z"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-x64"; version = "7.0.11"; sha256 = "036vlbafkjnlkqml7h04wbf6qkxnhshl6m9a8x4kdf9w19bcs0k9"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-arm64"; version = "7.0.11"; sha256 = "1c336daa0871l42lwwq7jgh7mkbdbc877dw864wwv2i638rdbnp9"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.DotNet.ILCompiler"; version = "7.0.11"; sha256 = "1mzr6qxz2vnc0zy3gs87ignrq7yiid61b3v22ifv9cpz4x6vdd72"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.DotNet.ILCompiler"; version = "7.0.11"; sha256 = "1y41fwdkski1hl93x1lgkdg81jnjf2k57n5adnl8faqb0ybdbijc"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.DotNet.ILCompiler"; version = "7.0.11"; sha256 = "155qq0kls43bigrn7iikpw7zn0am51zaf7nya4gb3ayy9cy6s35n"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.DotNet.ILCompiler"; version = "7.0.11"; sha256 = "1yzlmivfm66m6axqlxv99yw8iffl6kn4bamxzzy7wwwvh25y8440"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.DotNet.ILCompiler"; version = "7.0.11"; sha256 = "1qd1rm707kiwdp5kbp8vqnspvgjdd93x3iny6pjhaavjk0mpbrwg"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.DotNet.ILCompiler"; version = "7.0.11"; sha256 = "12341d3xya1icjphf8vscnygcnd3ydb5c1b2k5gq7nfpdsdcxym5"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.DotNet.ILCompiler"; version = "7.0.11"; sha256 = "1b1qhysd110a0l8p97yvwgl3q837h2bw56xmqxfsrk4qvnp9n4il"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm"; version = "7.0.13"; sha256 = "01iggc6rxg20min4aa3x8v1baqr9qikf99nal80llyb02fq265hs"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm64"; version = "7.0.13"; sha256 = "0x760p4jx5qydsljc2d5r0qkvnghv0axzcpgyzm8pvbfq1kijrj2"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm64"; version = "7.0.13"; sha256 = "0z2qsiccm7hkkdxd8l9yp9ykswggaykzqawjg51wxh7nq5rmz24y"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-x64"; version = "7.0.13"; sha256 = "10nks106xh2c6w352bzamba8ags8yvbwkiiw0mj5imrqgi0kvd52"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-x64"; version = "7.0.13"; sha256 = "012xh79xc2z79jmqjxmgwjw8pbg1my8v12glx3dm3i5p7syccfq4"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-x64"; version = "7.0.13"; sha256 = "0nnkr84pr5zrds8mzf8jkcg9aj85ssjybdqj5khmmjjvailljjyn"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm64"; version = "7.0.13"; sha256 = "0jan2ajrdmjgxc4hlany11rmsz6pipn8z10jxl6jrab4zb7xv0jk"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x64"; version = "7.0.13"; sha256 = "106ng227iyydd5sv0b7w0snibyxvgrq8z0jivfbydzng84ijpwnn"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x86"; version = "7.0.13"; sha256 = "1kw6jdvlssj9bpg67lx1xmwpiad1krpldbbab7f5wyq6yvchd30d"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm"; version = "7.0.13"; sha256 = "0411abg5ay308zgw34p0jdim6n6913mgal41azph3wqakw3fsiks"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Ref"; version = "7.0.13"; sha256 = "0rm0jsznzbpp6r8y4hgcy6y1x6460hb38fdxikbbfnppinpdy549"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm"; version = "7.0.13"; sha256 = "1d2p5phx9rsi960nji298px9idnama424vipjv76vknc4j7qbsvf"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-arm64"; version = "7.0.13"; sha256 = "1blzmczw1hxxfsifh95p9xxyksyvkgyp808xki2ylyyi69dlz5s6"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm"; version = "7.0.13"; sha256 = "096r8swgq0iw4f7bkcjz85b43qqdzfcsg4qh8xkk4nrfkkilwycw"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm64"; version = "7.0.13"; sha256 = "1rfgwi1gr1jyym50yvcw295v3q2333jqfi42bain0xxq3fa539j9"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm64"; version = "7.0.13"; sha256 = "0d410mpgv8y0yj7kixxaylw5j2b8f9krravcq8i5zpdbxzjbzxrz"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-x64"; version = "7.0.13"; sha256 = "1rkfpifnc2n1ijgxpb86rraa7jyl8mj1w65lpwhw777wk039vbz6"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-x64"; version = "7.0.13"; sha256 = "01miqpbazjc1hmyl9w4shnig3ijga4ddbyjmhr98sin6fkrs4797"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-x64"; version = "7.0.13"; sha256 = "17a0lzd7zhvvvx0dw79isri74nhwhdi8hdiaaz9svl03pbs7gybs"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm64"; version = "7.0.13"; sha256 = "1d7placw1v8i8n3bq687nvvckq4jxz2kxqj9q0q7nlwjzl3vpyab"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x64"; version = "7.0.13"; sha256 = "1kwy9c5q95kpf1xs2v3mir7qzj1px8rgv0bvlcw3nn3k7bwk9504"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x86"; version = "7.0.13"; sha256 = "14cv63fa1bzlvjfxicj6df3ay0df59a77rmyb0b95582zdm51hyy"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm"; version = "7.0.13"; sha256 = "1c5l1q53k8vrdapk3iafc1njdp9y2lqsyf8k9xzjhxkx2asr3gsb"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm64"; version = "7.0.13"; sha256 = "1k6hj6k05gkgbh1pspvbdryzdxchfs6as6509fsm1rp8s327fh33"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm64"; version = "7.0.13"; sha256 = "112nfx12kz48v5izvqbkiv74r4n7293bdgkwcyvbf5nzmkkm49v3"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-x64"; version = "7.0.13"; sha256 = "0yw489apwhpr36m0450f88ximlj8hmfx4m6fdscxfy7bl9az4y3r"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-x64"; version = "7.0.13"; sha256 = "1kmwsx7d1pf2ayl44rja1fj3qpd8valpigly9hzv1kgxbq95wp1d"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-x64"; version = "7.0.13"; sha256 = "0w8iz1qm9lxsfy3vdgq6nhhkkasmdqpp2flbawr4w4z0qs082mp5"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm64"; version = "7.0.13"; sha256 = "04rfjbqr89dw631w541z6h1gi7lk7nx6cv25p789hv4289qnkirw"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x64"; version = "7.0.13"; sha256 = "1b22qn4j8bdnm8i4mz544cazmz84bxv2xc6cv38qz7rw17fy28hh"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x86"; version = "7.0.13"; sha256 = "1bsrfvp7gfga84ks48wjjc0j0y4gsvzp4dmw4xqs3y4f8wc1f1jq"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "04xwjavsgxyhmiq6hw0sb8lcrpsmcfjqvg2i3qgaf85rcy8vsqx9"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "1fwj19yg50j4mkd58b0fg440a939vy9lzfyyx4qapssba9wilv5b"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "08y9k3kn5lfdk11vlqnsf87vvl7vi8w2an8mpll0drw9yawf2zws"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "1j4m58i3dqj3nivnxkh91ic1q0z0visfi9r9aqzf2iwmq7njsxgx"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "0km9sjb6f1s88y8v668wnv3lkls3hn5lrgazagmwgs0hw6x70xpm"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "0swj57pqrh3435s8jcqci86ifkqhf977ipgmsqa6l0dz365nchl9"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "0176s7imvc1fg78xmjxznv7jr99p0nxsariw48axpm6c5fqv5hhx"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "1idvvmbqwg16nxkyblrkxbrbhrz8qwfcw5iyyjpylkjkawklxrc4"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "1gihrv3yny5s98sgsaafgfh7nhr4yw7biyz6kqxi8hbwnyddsx8x"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "1kdywv9r7ij8krz65wpyj5pfffhnqg6s7n2s1bhj249x0ggx31lr"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "0xpiqma99vqq8i8v6szrqxj056sfc1yjwx16hmm7bl30b1a0vzh8"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "13w733b4pxvani3b3yxdpq72jfaj6amvqzg48zl44i52lrbi5a77"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "06j19xdcpw867qn8bfwsafadb1nxzz1wyj2d19dzvhxpxj8vvia5"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "0s6kxlwkwvb3csgibsm8rq30k3mf2vr6qjx72fzzhkw20b1gsazr"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "0mhkylq4mhgm82vlicd6fxrmq90mm6a58k1xjpq6njmzmdy6485l"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "1fs15j6mzn1nx3kjzz47b44sz45vbfjyr34xfq67sh7frba5ka41"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "0p1dhgw2avg0gqy99ykpdzx869rhbbvca6xk9499vyf7sam4k6rr"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "0psmzbjz0pp7k9mrqxzlwhwbr9yxwfnn08yj54yvpafxlwyka413"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "1qgcq5qfhnaxrmcipd4jn8cjy2lm0wf2z82xqfnsamz4p4h0ssln"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "0lk9mlgr3mq5ls6llc92vi7k88wv35x58s80f4gix04dal14jrx2"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "1h4x03zk6qj9pg68xcfxvjg971z7jfhsk0a10wa6iavl979bnyhg"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "0a3dl5laq2zwl5s5gj7lf18l3kh1k2h9x1myfbw8pp5g5pcq1igp"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "0zn7myvbcqrgi4sfcwjxfqd5zhfqp06zzjl3383a8xl2679qf0jz"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "01jqs98r0xazngnrdz7lq7hk047laafmwd8d075k3p132cnafq3y"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "0jjfx2xjcg3kridkdf199yaxcynhglcjq9j5v8z5jlhgwxqy9v0f"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "0gvwiljarc0fgd84gb5zdh4550nbzhd934aba2c4jl5wl1773cla"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "02rv25ssljf5b8jhs8za6hbfh9nab9lk4yfpp7na7izgm4lfaw3w"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "0kslp81hsmqq6m6sa5hdrfch8scw130smn2jixrjqhqx5qvh1srm"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "1wv5xxmygp4spdpzq0g2j0rzr3jjrmvi930gfl4hfpwd9mqmr9qy"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "1r893njy0lr89as72qag659cg4hq0w1r6awby45a3iiyzwj6nc70"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "1znngzk9jlrzq9vmd5qghaji8brjbbyqcg8fcina0gwq427rcvr3"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "1kwfa6637bg7gc6f40aivqnq1g6cwqjjn3xlxl02bsghcn8z16l2"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "0vgql6x47b6fzr4zr6r308znfnrkafp7v8q8f0i7ma23rm38dmjf"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "0gsjmrnrk5v4pp14yzqn0q9lwwlpdlbsb3py626q9zjhlabqz524"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "1z3bnv9892bi4lp08q5i29xiyra2d38dg7ai1ar4cc4z7vphfcw6"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "1fm1y8cdfw30iic0dx3f98gziw0bn4ya0af2g79r1p21arki2lck"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "0a1ckhf994dnyr8llabi2za8chgzc2pi9kg5kxd4gvah0l4ghbzr"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "0bxxahlr8xsmyq2n59d0wphrvi0b2qlb2j085mx56zhysj9s9drz"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "0gv0d0lrgbg3h5ldfqyginvi7hy38fpz6573f3r840k0cz5f8m04"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "18s4pdmxv3rwlsr4ygfjs1r6ci4q4znjx0vf5r7n4fbynscr31pn"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm"; version = "7.0.13"; sha256 = "1na7w99yqhp6h6m50fa020fi9qldjwbdp2k6b2dcfw0lfi3f0dl2"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-arm64"; version = "7.0.13"; sha256 = "06cqhkkv4kysgsd31r14axvav3m490lhs5b4mc2ssc4r15g0ym95"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm"; version = "7.0.13"; sha256 = "0y384akvxkdqij1ywlf2g8afny5ss5wgpfx18xfd0nmcpxbl4fa6"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-arm64"; version = "7.0.13"; sha256 = "0nqqqdkvk3xfjr009kdn30900wgrj2hzpzzrpga7y7c38nlpmsqi"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Ref"; version = "7.0.13"; sha256 = "1ip83wmb7ldfl02261acgm29ixzv9pxxliddmw3asp02ins45x58"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm"; version = "7.0.13"; sha256 = "0b8lydw8sf6bcvg5rcvwl8a2x6lwama30h9nc1clsfhd5vljdgzf"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm64"; version = "7.0.13"; sha256 = "0jhgwkw13mm744vfz6gbhajx9kajy9n4ph7kykqnnfmz1n7w6ryq"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-musl-x64"; version = "7.0.13"; sha256 = "15iz2jmlk445193jz9rifc86fcz801x0qg2ikjqxnj7dn1zz24rr"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-x64"; version = "7.0.13"; sha256 = "02lfq0ifxclr9af5ndfz48ds17a1m8g7a29f6j6m1qhnil29jkj5"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-arm64"; version = "7.0.13"; sha256 = "13z1p7w98gsj1lrqq14p2xjmgj0lm5xl2yqacxlc60gsb91f40s0"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-x64"; version = "7.0.13"; sha256 = "1xb96ch2k96m48nmgwisk9bi7c49ix3di7yd9zjqci3gp854d8ka"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x64"; version = "7.0.13"; sha256 = "0wj0vv2c0wx0p5wxkcr5hdbqdp08kmp08d7r2rjz6jfdd49h9i7m"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x86"; version = "7.0.13"; sha256 = "1rrgksmcz4fpzwa8yiahk3wdyg7xnng6jmm3kvzh15y4mw8xir7x"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "17f2pgpp560m1pr2n2l4h0b8zbpz8p6nvqigp82k1g1ys95qbhdy"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "1ic5h46g8cskifldj1b8rgzfzkc1scygrqpmw00xnncp3kzwxkl2"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "0crxk42iy7qm13bcpd8ra6kdd3gd2bg88vg5ky9czbm0di57w17d"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "1h643k0g83g3yw8p7s0qvsfpqagp75f98x008qqrw127li716y8g"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "1svvamildi5sw88jllrl0qkb7pdx7g9ccp53ly11lrzls2y1nxc2"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "1q94dzclwp30g3dvw6681djz4pxz0mr2i8w8yb43ikcqm99k6y2n"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "1vrlcqfaxdhmd79lry7nbqa8023vs7zd6728c16rjlkiq69r9yjv"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "17da9plgd1jbdfiqm000xg0aj2c37h8qmm23k96sdg8kl5dkfl2f"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm"; version = "7.0.13"; sha256 = "1cplbbiib4h7x5g0j79ijkj4kvw146vnqrmp7h2pbk5912mprzi8"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm64"; version = "7.0.13"; sha256 = "09s2ykhprx49iwqv2bnsa0nvfvjj6hxh40fy13b90kcpkw1d4vjw"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-x64"; version = "7.0.13"; sha256 = "0dfmwfqb57k5j2b2s4ysg3hm0hzswnrjxilglxcr1r8irk7gr5i3"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm"; version = "7.0.13"; sha256 = "0sb24snynvr1bsrhgy4x45z1rjknjfpfs80r0hkhxj184scqakj3"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm64"; version = "7.0.13"; sha256 = "02hhkhl52cpy3cfl3yfjpyxm4bgkmv4yi2y83fzfrfqim44dslx0"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-x64"; version = "7.0.13"; sha256 = "0g4bn4kv87rln4yjl1igz0mi8rcd90ws1jprn1aqdcxzqqzapzjk"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-x64"; version = "7.0.13"; sha256 = "0hg6y7fd5kx3c6adssxqmwgr606l9h8b31a282lvsw978dmbybj1"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-arm64"; version = "7.0.13"; sha256 = "1xxd33h6gn2xmcgv5g8q5c2l3gp77pdf1b6dzvfmwm9xnq6ms3ci"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm"; version = "7.0.13"; sha256 = "1h98p62vh2f5hxziznrd6lljg9p9rc5v72rn6wj1dpgb97zr535r"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm"; version = "7.0.13"; sha256 = "13dd70r5y5k7zniwqzzicg5n10kjjb7an02irw9vxbzw35vhn9nr"; }) + (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetAppHost"; version = "7.0.13"; sha256 = "00gyzw6v3npfppkakq78s73si75jgxcgssz9zwccd8gpa3rg82m9"; }) + (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHost"; version = "7.0.13"; sha256 = "03l7nwkx12k3h883x4wnpnkxwk2h2y44c9z96a5f7xm73idfnppg"; }) + (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "7.0.13"; sha256 = "0b9cmcc5cp6ays7qvb22s9fsw7mmfqyvn7krh7ywihap074ddzrq"; }) + (fetchNuGet { pname = "runtime.win-arm.Microsoft.NETCore.DotNetHostResolver"; version = "7.0.13"; sha256 = "0nn2advczdrnjl0nfl877876bkimwbblr8wkafr24fjkza7al4s9"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Composite"; version = "7.0.13"; sha256 = "102rlvqhzkw74gpfn8zip1qwbkpbx6mklgxfis874d5np1x1wql2"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.DotNet.ILCompiler"; version = "7.0.13"; sha256 = "092bgrnwpzk9y0ar9xcd2n5j8ilba3f7l296n3hkvgz0mmzihc80"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.DotNet.ILCompiler"; version = "7.0.13"; sha256 = "1p3x1abm40kwqaxhpp3xszpg39hmlqwxw5kml1jf7drmnij79496"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.DotNet.ILCompiler"; version = "7.0.13"; sha256 = "03l6ykmd3q1f5karl4njbb6977hymg2zdsb6b590267czfh0xap3"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.DotNet.ILCompiler"; version = "7.0.13"; sha256 = "05xyp2f5fp5j75k6c4v8lp0clq66mbxrlc5l0lja5s502cypvj83"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.DotNet.ILCompiler"; version = "7.0.13"; sha256 = "0gzsb4hhk82dpwilaiwin3qgp7mj2jhxa7ync68a4m20x1y5d5vi"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.DotNet.ILCompiler"; version = "7.0.13"; sha256 = "0cbvq87q4pdyvawxq2ix1y6y8mminx9kl6g3nxfmp7ss20qd025f"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.DotNet.ILCompiler"; version = "7.0.13"; sha256 = "1vn2pv1d0ir01zga0bpahhzmkn2lr7m0c5bf0s1i92acsq0z9z21"; }) ]; }; } diff --git a/pkgs/development/compilers/dotnet/versions/8.0.nix b/pkgs/development/compilers/dotnet/versions/8.0.nix index e7bcfdbdd8c4f..d1da16d88e5e8 100644 --- a/pkgs/development/compilers/dotnet/versions/8.0.nix +++ b/pkgs/development/compilers/dotnet/versions/8.0.nix @@ -3,176 +3,176 @@ # v8.0 (go-live) { aspnetcore_8_0 = buildAspNetCore { - version = "8.0.0-rc.1.23421.29"; + version = "8.0.0-rc.2.23480.2"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/02f4c6c2-c137-448d-a189-9ee3a3f6f99f/192f2c750089fa0194f04f5a805bd21e/aspnetcore-runtime-8.0.0-rc.1.23421.29-linux-x64.tar.gz"; - sha512 = "d5f9e7bffbf2b48b26a317dd1d78bc866973b4a2cda448cd7a7ee64c0ffaf98fa3c4b8584d32528026674bdfd99f602f0fdac8242176815705e080df83825efa"; + url = "https://download.visualstudio.microsoft.com/download/pr/0d7fb51b-f30e-4b84-b4c2-b739ec8f7978/68e9fc71fb2c4f01a9c7f25672caf1d1/aspnetcore-runtime-8.0.0-rc.2.23480.2-linux-x64.tar.gz"; + sha512 = "5d8d50498be52ee4c8ae83e9ca82ab947b187f27b56047cc8a09f6ca2ba6bb7532fdd30bc035d518ce636965371f2ed16c9f97398f04d836f4f67b11b5ce50a9"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/de4037e0-6e5e-4a40-9c83-555d30d9c21f/f607c58db3f81aea2c7e56b0ddbf9ac6/aspnetcore-runtime-8.0.0-rc.1.23421.29-linux-arm64.tar.gz"; - sha512 = "ba8035da535cb3bffa720e962e6f9e0f88b36e1221b588f2a126ee4b43c02e4d8c27958017d29e5ab68121fab6a564fe0a27099c4103ee3d527f8554b4ab495e"; + url = "https://download.visualstudio.microsoft.com/download/pr/c5d92a9c-c318-422e-b66a-7849199de735/6c3bc3f5958917851fe7dacd383bcaea/aspnetcore-runtime-8.0.0-rc.2.23480.2-linux-arm64.tar.gz"; + sha512 = "a539170e9f0cc07801142b4f301554bbb76f22c3bc8dc4c421ca5c9be4dad93931acbb5a1d516f5fca57d739d33d10bccd33a480eb9e0d40e0f7594c38e405ea"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/c3612fc1-f335-4b1c-a08a-08267100ff43/dd06c8e7021c27becdfed27838be253f/aspnetcore-runtime-8.0.0-rc.1.23421.29-osx-x64.tar.gz"; - sha512 = "28c2cc2b1b32a3d4b287f2ceec42ac7fce59870bd6a72f6767d347fa0a9c53210c5328e4d747ce010512dad149109ff072840c9da9301c8bd66a178169458518"; + url = "https://download.visualstudio.microsoft.com/download/pr/76affdcb-9294-41e4-a5c7-91629309e11b/75a24f3cf07097a94c58e22acf1e709a/aspnetcore-runtime-8.0.0-rc.2.23480.2-osx-x64.tar.gz"; + sha512 = "b798c397e2ddd8564024859f8aca2b9043863376b8327661ed83fb626bb51c26b1d5ef5a0ce6848031f14c480d4ba936aa0c4bddde8f38aea993d72ade10153b"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/6dbd02b7-f3e8-46b5-a3e9-ea482762a02d/430b0d87ec687b4a9968ca143ea95789/aspnetcore-runtime-8.0.0-rc.1.23421.29-osx-arm64.tar.gz"; - sha512 = "dadb90494fb36a1d38b12d2903a385b76ee7325eba59d44acf4e10c3019bcfd636cf0b9a7c3070516325c6be4f5421c11fad7a2293ccc2b1c7a5d3c62bbf07e1"; + url = "https://download.visualstudio.microsoft.com/download/pr/32f5d2b8-3b63-4d4d-8a7f-876adad4efc0/c1f62a3e480fb0e38faa957d34c0be54/aspnetcore-runtime-8.0.0-rc.2.23480.2-osx-arm64.tar.gz"; + sha512 = "9cf9dce54fa4d1ca27955170c5378b826400e4ae45a9312f97f3a9d87ec31bd3231d70e482c36499fdc0d83f80af8860cd87d70dbbbf614f0312c6f73f71e744"; }; }; }; runtime_8_0 = buildNetRuntime { - version = "8.0.0-rc.1.23419.4"; + version = "8.0.0-rc.2.23479.6"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/8cac1522-acbe-4052-9f6a-19341a8f9dae/1cf1396b382e22cb1ba21a27f3b79725/dotnet-runtime-8.0.0-rc.1.23419.4-linux-x64.tar.gz"; - sha512 = "53938ec3aa4353cfb760d22faa850821b54a53fdd864c4969f48caa6b718ba207162b04a196e85543947acb7d3e719982edad1420b76198562051846f51b1b5c"; + url = "https://download.visualstudio.microsoft.com/download/pr/4fb768da-b0ff-495f-8673-869c2f7e59bf/527c1e1d55a9fbcdd86018bc62b07a03/dotnet-runtime-8.0.0-rc.2.23479.6-linux-x64.tar.gz"; + sha512 = "f1565aa5a5a98b3ab2cd92376b0b1bcf4420b6377047bdf2324a7dd86b82f5b4776a2795395bb777a3f7d6f6f9b8dc89721c2fcf93b4c7532b42b263f9fdc828"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/78e40734-8864-48f7-8c03-971ee500d93a/4b2fd807bb790d9ac3cd8585ff8cb6ad/dotnet-runtime-8.0.0-rc.1.23419.4-linux-arm64.tar.gz"; - sha512 = "6f5ca722ec2c4a400b9c19b17a3d9a10cf92b265c90c1e1b4822c12117580c286e99134f7c223f3dcd71171d5799e1498d38129dbd1bdff606fd64fe451458ba"; + url = "https://download.visualstudio.microsoft.com/download/pr/d16acf4b-d37e-4e3e-8f8c-73c7eff96bf0/ceb8eee1c24d194d8614f3b0a885e9ce/dotnet-runtime-8.0.0-rc.2.23479.6-linux-arm64.tar.gz"; + sha512 = "7f92e7d5f51d1623e2ebccb79da1f047c4a125b565cedb0a4be3d9deb2010c1f8c03276a926eb9a7866bc1ef9c6585724c41d268e9d2fda8012613aa6fa4f95d"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/29e68c3a-f37a-4dea-b7dc-bb1890b28d48/3ee60668c4ccd17ea565d6c204ef1f64/dotnet-runtime-8.0.0-rc.1.23419.4-osx-x64.tar.gz"; - sha512 = "ffb0a22c0e4b9cbefc99a1e016683987dc4046abd9f49f5e48bbb93d0434e818c66274422728b328c97ca1dcd6419c7fbb88ba747edff6a8e92213141ce42bc6"; + url = "https://download.visualstudio.microsoft.com/download/pr/d8b1d5c7-2328-49bb-92d4-7c3db905a1bf/500d836a2747b281059ff025cac9a79e/dotnet-runtime-8.0.0-rc.2.23479.6-osx-x64.tar.gz"; + sha512 = "50ab2233f01534784759439752312749731f5e3a46947da40052186bd87459fb19162c0354fb9c44feb8e3693b6dcd6d791782f63c86add4179c6ed6f6c4ff28"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/59ecb50d-0abc-4bd1-ae81-8a252027d3e0/43ed857eea3316732b1a5cb0c68eaa50/dotnet-runtime-8.0.0-rc.1.23419.4-osx-arm64.tar.gz"; - sha512 = "f5810ed4c8ce565f1eb3505b7994e54ddf6d87f8903f739016daafc01ba532caa1b84e39e4e42b73f392703af973dfcaa2165b4630301a859fb49ba411d6ecdb"; + url = "https://download.visualstudio.microsoft.com/download/pr/148f6949-ee92-475f-b45c-814139f2bccb/1e031945c3524f31abac2c8442794875/dotnet-runtime-8.0.0-rc.2.23479.6-osx-arm64.tar.gz"; + sha512 = "8c9b86c1dc4fc0c6d5086d3a1f5fd28b38e2d94746a1529f3d9783e7240e067fd830098be81052629253c1548b43f4937cea92370212a556448320e294ef887e"; }; }; }; sdk_8_0 = buildNetSdk { - version = "8.0.100-rc.1.23455.8"; + version = "8.0.100-rc.2.23502.2"; srcs = { x86_64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/8cccb582-1956-422a-8655-fad2fa12c247/4e86a676860c2ced06228a5c8d21718d/dotnet-sdk-8.0.100-rc.1.23455.8-linux-x64.tar.gz"; - sha512 = "b182c4d496f1e3d6ff109c304972f5011a343750ed11ed8ab273ad0bd2d1441b7393fbc20968b54f61acacd8c372528f9a91a7a956362787a362b4821a434d81"; + url = "https://download.visualstudio.microsoft.com/download/pr/9144f37e-b370-41ee-a86f-2d2a69251652/bc1d544112ec134184a5aec7f7a1eaf9/dotnet-sdk-8.0.100-rc.2.23502.2-linux-x64.tar.gz"; + sha512 = "45f09e7b031f4cf5b4dcead240fe47e2e3731d97d22aa96d3a02a087322658606cc22792053c3784c44f15d7c9bad0ac9dbda90def7b4e197f2955dca9a5bb6c"; }; aarch64-linux = { - url = "https://download.visualstudio.microsoft.com/download/pr/7f0829c2-839e-4882-9e21-fa4fc6bac32d/5ade892179b687046b1252638b8cde01/dotnet-sdk-8.0.100-rc.1.23455.8-linux-arm64.tar.gz"; - sha512 = "686a10b89217fd5d28e4b587dc231d0bb2630fe7dfc7423611406fae8812ce1b53aae3e079b924280fe589686153919272f4b5ba0c0292d68ae50a75530d015a"; + url = "https://download.visualstudio.microsoft.com/download/pr/0247681a-1a4a-4a32-a1a6-4149d56af27e/5bcbf1d8189c2649b16d27f5199e04a4/dotnet-sdk-8.0.100-rc.2.23502.2-linux-arm64.tar.gz"; + sha512 = "b07059a8b6b5586134a63a20c952f4f029372791d53e4a3a1363d39b8beb62b4c7dbc23c7de202397310c79aaaa110d35d0dd5d996420eaed0ed7f77e2dbc669"; }; x86_64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/17670d0d-05c3-4e4b-8d72-5e31bb7f7000/44395256cb038899393d7958db2bf2e8/dotnet-sdk-8.0.100-rc.1.23455.8-osx-x64.tar.gz"; - sha512 = "184a845b4b395f4c00b3c9e846977a2af446686ac0e4c916f2736f3e891d3045341a8f391517a19f50900ed262ca4999d28e872bd6d0faa0729f6a5c4ad183bd"; + url = "https://download.visualstudio.microsoft.com/download/pr/2cb4fcbd-ba5d-41c4-9907-8120aa4b5f23/98fd104ada4105462cefb1123a0df533/dotnet-sdk-8.0.100-rc.2.23502.2-osx-x64.tar.gz"; + sha512 = "48268afc73335c19c96bd77bea49eedd461056b1b640703ebae39b3003875ba0b0dbdc13ce7aec0c74ae842bd01647cd1c225ec555439972f3e16300245a48fc"; }; aarch64-darwin = { - url = "https://download.visualstudio.microsoft.com/download/pr/91a1c0c5-ab26-4dfc-8aee-6c0cb2354774/7e12ab1e86fbabc3417eb4036d955f67/dotnet-sdk-8.0.100-rc.1.23455.8-osx-arm64.tar.gz"; - sha512 = "a658e0dd633175ac5c7d7c1481cdc44f431e85094e29d0f21f5632f447469a452f5fcf5cf6e42cd4d0053fabca6bb4a7e5cc0f859f09cecbd062301c24cfaf79"; + url = "https://download.visualstudio.microsoft.com/download/pr/6c9084b3-c512-41be-afe5-84e156f250b1/6e1c12684b4c5b95f122f0659f337ab3/dotnet-sdk-8.0.100-rc.2.23502.2-osx-arm64.tar.gz"; + sha512 = "c7f955ba587cb00aa688dbba987acfd4203519da0dc5914ae7e1ecdf8f95089a84402b4d833c7b6186bdc1f70215e399646117242a054c1555087aced61d119a"; }; }; packages = { fetchNuGet }: [ - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm"; version = "8.0.0-rc.1.23421.29"; sha256 = "0ws54phj14833xz9w53frr3pnq6ps0pfrbz173i9gj5xkhjf3mpb"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm64"; version = "8.0.0-rc.1.23421.29"; sha256 = "1sz6skh1ddvdcib8ydi6km593ah3cchgz2fs61kj03z6jg2vz9la"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm64"; version = "8.0.0-rc.1.23421.29"; sha256 = "1r8681ixjxyixznhwakwb19cs8hnwq7pq87n4dpzqpm531jmjkcm"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-x64"; version = "8.0.0-rc.1.23421.29"; sha256 = "1hmza9icxnxj6dcdivxmngpvrg2ncri1gh849rbfzk04swylp6f5"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-x64"; version = "8.0.0-rc.1.23421.29"; sha256 = "1m6a47bnrl8n9ahnh01mg2fkc20lmfjjg3f7xzbdngnikm6vzcxv"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-x64"; version = "8.0.0-rc.1.23421.29"; sha256 = "0ygb60mpk1rkz67v1d9vf3f7zfvdzg5a4ckc1yqcfb2n4a64rdbv"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm64"; version = "8.0.0-rc.1.23421.29"; sha256 = "027xhd1r4my8952fajl0smpdikj4ndn1j5gkyhwrg4z45xx35q18"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x64"; version = "8.0.0-rc.1.23421.29"; sha256 = "0cir3vy94ki9v0zzkm49f33mxmp25i2v0c3gp4fhmnhpsfn0x7rb"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x86"; version = "8.0.0-rc.1.23421.29"; sha256 = "1ydhf3l9c7grakdr1qsqdgbdvp0zqrc4b66xj7imgpx1k92i2m2c"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Ref"; version = "8.0.0-rc.1.23421.29"; sha256 = "1mpha730nn451zp3j7h72a4jiwmgq4sqx4r9943v60yzn93j9nhm"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm"; version = "8.0.0-rc.1.23421.29"; sha256 = "1r8y9ra1qc0jx04jdkqcqnwaqlkr9ah081c68qslj7a2izhz1sbp"; }) - (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-arm64"; version = "8.0.0-rc.1.23421.29"; sha256 = "16vy79c7byrqwd9f7vm0xbah3k4y6yis0flm9jkfk0hp4bb0y0js"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm"; version = "8.0.0-rc.1.23419.4"; sha256 = "1q8dsj0l622jxwxxmasmwcp1mdxi6fxyr5swhw9pd0vq3i8y13m5"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1254rvx06wjblf0y2msh1zdg0fky861l8x5f5w7hm5l14ys1firb"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1q258zk3kkc3qk39yyfvqw3vlcmz4nf4wxdwg79dfp7i6wcny72v"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0r5f54vyj38b7simbk0481zfawxr3z5q7sivfm23nmfwxpir80ma"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "10kjms0wx5iialcvd0fp64vriv4cyk7k22wqh3km9mh43i620px7"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "03sgkb2ar63wllisx8rmpc3yrngl61yhlmqinwbc5bhyaxpmqnk5"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0b747vkvsapy5p4sgv0nw1hs1hak04pbnsqysj4r7ypf4f9bnrhs"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0lnxq6risl59ig9svhra6papn0i9rs2pr4zgnysnbfg7gvd3fiwh"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x86"; version = "8.0.0-rc.1.23419.4"; sha256 = "1h8xa2kvg6pl8fc1js9lgbvcckh12c496j5hqjiclj6cbsfr3i2g"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm"; version = "8.0.0-rc.1.23419.4"; sha256 = "0hrxbkqp97mqp6rjpm3azcpvmkkaxz37jl7ybv1bh2m3f0zk66jy"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1x5pq1y4gn1gwnqmq9mj02wki5yncidlnmaf2przz8yingfw0hq6"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1855npscp1ziab6a50fh0vzv8j4z0sarp94cl3c1myk9ndnkzksn"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "03ib84r9xjfzifr5g0b7hifyb5nc6ynk5s3pjifcsplhfhr7hhvq"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1arzm0mqdj0hnlsfcki8z3zbbp5mpv73133wc8yxpymh6f000bv2"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0f403j2sis8p7y1w2nkbp03xq8qq06f7q94d8clm9c98vppw75sj"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1ngwm0hpg00z8hi9kfrc4p8ii51piymn1kkgkbh5wcdz2rmfayc4"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "00whfl9s9qd43jv68rff5g6da0k6y11yc2pg6v681967fnq31jqp"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x86"; version = "8.0.0-rc.1.23419.4"; sha256 = "0rbyh9a41wvygzfja0wm305bqisnsqxhlfhynvb8p5yv1dsg7w4w"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "1s8f5mrwnb66azhbrxpy3ab1b7crr3zj1q8fvsym80kl6xapzwva"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "13a7z8m4izwjd0qh3p01kxadxagq59klw173dqn5l57wzzj8vsxs"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "059c21fq6kql04kn56yq5ahm5wc3321b12q50hsg5lk6w3w7xgj7"; }) - (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "110aymhj4rj39vpvbkyph9mdx347xydkdcfsdvw1ablfya1p933f"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0kynd77v947b6lxhjwynm9yvz5mp6wb4d4jbl8ccqzw0f4g57qxq"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "1ix7jjpqzxjyjqfac2csv2j8zr0xai601m14r5swqs3fy1cpm8zg"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "19g1awn1ywnmwm6z547011d3q1k2wn58sbg4dm5y4pinmcfm37wm"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "0wyafqqjxksrp052rqvwxaqc3m6yzhj095w8myqbjnxwyfzsikcr"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "183lwi2xm45699zhynw7zgd4sa3zpap6p8h2036i94kfr24ir61n"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "041n6jrvwlchdvy7xnmwk0khvf4ybmyq5lvwaiav1xxw0a1dyn3h"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "1k6011bq71b3whz9lg7kc8lgf19jn221qzj694m6qqlzrbb3g2s2"; }) - (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "0qkdinyq87rfgiasjgwaggid86xw6kcbjx97w183z4fb65l561mh"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "08h2djggfpjh0q38bq2hjqk5xf48iz343352n6yvsa40rmn7p0fv"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "1j4gw5c2p0fvjdhnyg2fcwlfvdgh4sk0v1w3w004xkf9j5jv1sf1"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "0hh73hk9iq15i46k0h2c1y6ixpi5w0i38f8sk5cijbvkpb1cahwc"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "0n3qcyyd0qdnv63ym0rlrw5gvq4g4s65qq6qr5nxpn46iwgz9p07"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "1grdchbc8cw94ly9ihnz675c6kg0rnwzdkciwsspnkixfmr8n4wb"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0ndrih51r1ggdbgbjn2gyvwarl0i6qkzp9ravvx92jn02k4bb5yg"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "13x9gnxzk6k6ipijgmi9bivkj4ibqlsb04fs1c0ag0vsdacpwm4d"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "0rfkyclsv8451xm8hh8hd55sw9vbr8i60wi67dnjbip61ydl0sfz"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "1bp2aixzvmvmzkaqq4diqw78azg82751s64s2wn2zkjb9big5d2g"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "1mycvp040slw87cl1cnzcfaxmrdjj728sw6dnhyc9z6x75prn7sv"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "0a0c3adk3v7qcrxw5wizqxmbkj3fs57r3a0179c8s92vhh4y31l8"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "1dgy2n8acl6kcjpaa6s869v52rvvpkra9wrh6af0zy3z7lrjw3za"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "18rzizk0db8ivbl6hm80r5lzyz2i1gjj1k32nsbhh6x6x57b9a05"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0a8cnaalpb7v09ijm38anh9wyvkd2sza5q87ggmhc0ji10gdlsrr"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "1qfyiwpvh1lw48h3jhry2vkk3qq42avgzfq58xspc87g4km7nq45"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "0mnpsvlnw2h4ggw6h3y7cb58a0255p4501m7d2k9jyx2fvkrbiqc"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "15h0vxsg91v0yprbg8yf7ny9h0xdy93s4xp7i1x8vqfxizh89l4x"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0wiqmcib5cwxfsyvhf7gq6r76caycmyns08q8hifqksj6lfbi64d"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "0qcnaz0slz50lzpdhghr6gxck5x8ljyhc4p8apsk52ir66cb9sfw"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "0x1bgi69ylpr280ayzj60dxbirqab4ysxjwzqfwglbjdvqkkwn38"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0fdng2vpzljjpdqjnz2pr8naznlx0vgkbypigjfdkpcrmmdhq004"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0bwbyzcqcbqnaybkb106sq68035vh7kl8i1zlfq6hgd7rsbc5xnx"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "060bkh4viwpc1fkhxkpisbxwvfcld1lbm7wjlyl69p84nikyllnf"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "0ma4h0bbham9z57i9fdgf3arz6x5cvc5mmcwr0zm7bzyrc049mdd"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0m95wrq9q8d965yxjkx1mxjnhq35kqhlc868nfkw7i0bgshizaqf"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0bk9wb7vmb5d8pr2lh1zg0gqkx013b760b6mdhpfc0qp3jfqza5j"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "0s5yrj4hgamn6r69z5a8phm8v2wcq4f725jzlpfa90wnys09qn64"; }) - (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "17mla05aq6ab4amw6arq068i3vf3f56gdzhm1s9k2298gfjk71c3"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm"; version = "8.0.0-rc.1.23419.4"; sha256 = "059v72l55w71i4410jifilgzv9f08mkal7yq87smm5pfmqnl2v35"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0qxnryxvmn6rd8aa1v8knsh974v99n7pqz7lzhyln5f5dr0rpr1s"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm"; version = "8.0.0-rc.1.23419.4"; sha256 = "024blpk2224i4mvkkdmjrk2zlb7kh1shahkbbk71l7rniagyd2aa"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "04k93say7b842bvh2x853skj5ymxsq3b11vf6rkfcqz6b7hvn7pj"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Ref"; version = "8.0.0-rc.1.23419.4"; sha256 = "139j4mdjhqnysgal1zifnhwpmnhd8i6a0x46bjxcwskqm3n85c2y"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm"; version = "8.0.0-rc.1.23419.4"; sha256 = "08mfzspgv3sjcvc2smcsab4q35mbj7cn6ky08nr5clvmf32ddkbd"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1wq65zww0ng7w8078bi10km23s7wf1fr2srmzzsk2ailhwhp0ky2"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-musl-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1285632nhb4gqnxqy1rknfzsqn6cg2xaz1p0chdiqdjlw6n8456x"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0q5pkl6bji11bskxhgnimbbl9zzv3ly335h169qdi98xig7npv2s"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0998hg6n48j7zrhkx7kyn5hk0axf7h9g61qh4gbfpn353zf6ajbx"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1s1i1xlszd7rfrg76m616rlwg96zsap81wcjvj68nijfmv563snz"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0aif2k51bxc59rskjivcp7lwdnmdw7dnh5gw5aj0hgd1shljms9y"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x86"; version = "8.0.0-rc.1.23419.4"; sha256 = "1j5l7zqr8jkj4bgrnmf9ay0zfc43m47q78f8xkiv96pa2bxp9b29"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0aklq0jrjcqgihc6l7cn1j5swz3kxsq02zrvl745a197k2jr10hm"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "17ffbsy4cfplaw8cdly3gqfgkzqxmbgrbwnqca6b7lak1ab53mr3"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "0kk6w9sid9hkqggxxnmzmz3ng14qq049qhz06zq40lhcgbyik96h"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "14s7gxqid5yrlja1aimaq3r40bj2p5karn8ma80368m3zlslm1dw"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "0k24km7x79kxy4blmgzclvqw4m8smlprb0hyi279s1ddg0vpplc4"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.1.23419.4"; sha256 = "1davz97niy36wpsim42yrjm77k6sflcsc0sy5nb6lq9kxj02hypy"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.1.23419.4"; sha256 = "00xw4yjkvdl0x1c60cbbh5gf51cmax2laplhlgilkyazjzrbf3xr"; }) - (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.1.23419.4"; sha256 = "08yqn96i057lfdrs7xjbambw7sr2aalhskkblvyhqykf8sw24ckb"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm"; version = "8.0.0-rc.1.23419.4"; sha256 = "1w5p3lngqmp5yqwh96kjdhdlzszik5vw9nx7snsfysjwyhgbr8b0"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0zwvkqg0nf981gr6wff2ci2dhb6rc9girg3s0gqz7ysldbxnznsd"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0kc57i32xqmrjif82czr7ivsrzf41wmdc0zjkk3qak3j8s0j629f"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm"; version = "8.0.0-rc.1.23419.4"; sha256 = "1l8mz0l6g4zv2qnrfsj85miknhq230942l8xvw62bzw4rv89lcp1"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1d7m6zgiakdqi6ga0xdaamqjk6y8bxd2fxirmrgzpr0l57zqwhc3"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "084pm2qnh8mn5cpf4zs7drqs5zifbph0s6m9h62xgrixw3jv4i6x"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-x64"; version = "8.0.0-rc.1.23419.4"; sha256 = "0szyl8qyc5yc2ah9if4xk20wgny5cbr7hmdl2mzqpbpn5fcm36b6"; }) - (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-arm64"; version = "8.0.0-rc.1.23419.4"; sha256 = "1mavnwcgnzx1dn7h0cg172p0yv00xdaspi6vk34df1s6d4cc35vh"; }) - (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.1.23419.4"; sha256 = "0xqxz80rr7h1qlgw6ax2pqj33ngv31xbzljhpd60iv229lfzdvia"; }) - (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.1.23419.4"; sha256 = "1k6ivz7pcwk7w7fq283q2n88bm0rw7acfl8w9nj8iyag8gi7rpyp"; }) - (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.1.23419.4"; sha256 = "0al490xcj68xp13q2xl15wd03zld1l3qf88sd651q6jixgwrzbm6"; }) - (fetchNuGet { pname = "runtime.linux-x64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.1.23419.4"; sha256 = "0wan79hagmkh2in263lbpsydr96l4s6i48qylpgn3fzwdv24idb3"; }) - (fetchNuGet { pname = "runtime.osx-x64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.1.23419.4"; sha256 = "0jb3gx2ydf4jq0szk071g4l4286alffa6hc4xhy3zqax4vggyakz"; }) - (fetchNuGet { pname = "runtime.win-arm64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.1.23419.4"; sha256 = "0v4g1bva86vxvkhfcimmr30i5d7xm0r9sknf84az2b450b5vfgpm"; }) - (fetchNuGet { pname = "runtime.win-x64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.1.23419.4"; sha256 = "0944c1j5gd3hvw7aij5y8wydbv70zb7dw8gs4qpavwjg8vcbs9cx"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm"; version = "8.0.0-rc.2.23480.2"; sha256 = "0406jvshxa3j1bc7ss9d717ybbjnf5n6260i9ir231nzmkdw4ich"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-arm64"; version = "8.0.0-rc.2.23480.2"; sha256 = "150ja9f96yw7j4mf39kxa541xkmgzmfjgm7jwdmlaln2v97chsk4"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm64"; version = "8.0.0-rc.2.23480.2"; sha256 = "1z6lj26cqf3qg3xhhlp8g8k9q93ysr1j2ly41xwi5sccd2x8vwil"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-x64"; version = "8.0.0-rc.2.23480.2"; sha256 = "10a4pvibil5slnca0bzzpf6nbvan219yg6d6srr9hnqwi2a2la62"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-x64"; version = "8.0.0-rc.2.23480.2"; sha256 = "1qcmw41rbk56y7l79f9xqli44f8xa7rqi2bnncfngfbd54q3ijcj"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-x64"; version = "8.0.0-rc.2.23480.2"; sha256 = "0zq25xvypv6fnyy3gx7ivk41z5nyz89x52bf9ayry3391hc5avd1"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-arm64"; version = "8.0.0-rc.2.23480.2"; sha256 = "18rwiycm6nhm7mz2gk22yaqmq1sdfsvq971li08czyia2lgxk6wz"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x64"; version = "8.0.0-rc.2.23480.2"; sha256 = "1qiigv37ikmpbb8j0j2zp1asly13xb8bxj45zh58paycaks01sss"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.win-x86"; version = "8.0.0-rc.2.23480.2"; sha256 = "1f8d7mc4kil4xfyj1ki53yqm30cbpms8v1kxpv3harp5dkkgykwi"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Ref"; version = "8.0.0-rc.2.23480.2"; sha256 = "0za8iyskzp7f9mjn8nizz3wjmrpylyv24a70vwavbq0h0h8rplsm"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.linux-musl-arm"; version = "8.0.0-rc.2.23480.2"; sha256 = "1vac7gcv8nqyjn4jylfh5yix8282siarbm5dwvnrsw41ngndgcff"; }) + (fetchNuGet { pname = "Microsoft.AspNetCore.App.Runtime.osx-arm64"; version = "8.0.0-rc.2.23480.2"; sha256 = "0cx4606hlbi9x55vbd99vrbkmhnaz3dcqc7x3sh3ih9f2mpzv5q2"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm"; version = "8.0.0-rc.2.23479.6"; sha256 = "1l1n2wb374mlwpbk5ivka3j073l8mi89fh92p503iaa47xf95ixl"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1xc9hkx2qam19nfnkanm5yvd3iycvw1npql2limskf20qrwr5f7v"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "06rk4p7p4ypx7xd2c0dxb142frv9w4gv8720j99392rpzrp1qnmi"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "0ib3f4wqzx10298gd47j6sqak80f6idrqw37crvgfixsggik23wi"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "12yxilcrlwkwrjiyl72sdryjwh1ilxnqq51zm5r10gadips2rzqq"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1mbzfbh023xlx2mghhm2f0d4hx9bl9b09d0lfhvf9zlcxhwj8wni"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "05csm5zlrssg94p2vg8zicjxqbx92l5igglsjbwb5dqbvdihz1ih"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "08ify83j27lx0pgjkz4kcg88a2rv89bxqd8fagaafqrjw3s0d68x"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.win-x86"; version = "8.0.0-rc.2.23479.6"; sha256 = "00lhcw22qfskdljfnk5amfy2j5x8c3mfvgam1s91awh3p4iizx1d"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm"; version = "8.0.0-rc.2.23479.6"; sha256 = "1pmxwyaynv50fp32b4g2nhys1shpajnpc0q43kgsfs31hmrq32z4"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "0shzhwgpp35vi2y3fvd0rs458lnwn1wk2361x9q50wcpadiv72hw"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1w9j05l8n1r40liq6i04cmc74hbxj4p2j04yqsfww6rx8r4ls241"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1j17rgswixgbli421sgd17cfsrykdv46jmd0337mdgxf2xj99c37"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "04h64nkpxrkp63p52csb4nrkyg8l1gg6r0m3xzl0h8303w88wwi3"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "0d84yjd67fpl8j1j9dccqqfpg8n717qvxk5y8mhp4rahfi53zk58"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1q6mqcjj4cf3x1mlh0ca5pd1vglq5i9ci0irrm45xqaz8n5190cx"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "0l9i4y94lmv9m4m44i1gff6a1s8fhdmznz015yf177pbsymm1kjv"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.win-x86"; version = "8.0.0-rc.2.23479.6"; sha256 = "1bzh85sps3i0ga6pbdrcbd4a0knpq0n41pnknfz6fhyqn9xchpcy"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "1h36s9sk8dx8dj5g0dkpcnl2g31jbibjal7344zcs6s7d7zjifc5"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "1zggzn0z7clh6sic4hja5arhhraaldna4pyprxk88hkfs2h7k3s5"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "1m8rvvlglivcrqadqjfggrh55c1sm1xyw3fd354v7xxpyd7nsak2"; }) + (fetchNuGet { pname = "Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "0rr4xpy6l7pm4zqr2faqihx7qpia9w3y81bzk0zn9rs2wa2g3pj1"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0mdavjwsl7g080ik8brjnxvzvsznqva02854nsba4i8qkrmgq63x"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0a1pnyc8hg1x6q9i0fg1zp5aip7rqxwirnjw7vshdqacadcr86wi"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "00v40ws0qhl87injb20dszay6cz0ig1ralqz0n2v2bymgcdbh1bx"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "0qiqj1i4z3smgpza66cpr1ad8ycbbk9iqs150ribwz350ypa5b00"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0ir0njnhcig7b9drq3qjlid38111h7810b1i8nz0qs1hjza3iryg"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0x7yvqh099bhvsb5zg1mjxyglf1hahz7w36cvz1x5i4d6z63639m"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "0nw4gmjndfnlxaxji31k9llgn6cf4csxzjfpp01qkn7v2wmfl5jx"; }) + (fetchNuGet { pname = "runtime.linux-arm.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "1kx93ay2gx48llqd6l4l8ii29im1ilp5axz99ggfarbsvz8iw648"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0rbhkxhd1aias78dqhyj3h0byw0pj72nvqydsl3s6zzb44a42v1l"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0dzcdapx5pi24zc2zrxgbz82y0p06s7hg7wh56waa4kbgc7rzfbx"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "0crsvb0hdp0c5a7d0mrc3i0dwvlvfv1hw44acf3z832q41py3gid"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "1ps9lwwnww8s877sx8lpp6m03kgxgv3bvi9d3rxhfq83yzhawg2v"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "068s9idrwapxsfv169chsdrsw3v74ihhing3x8mvyfwjkswnfm1p"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "1qqphry16s89i7dwnb6n65vkc18mpivin2mdjp357a3jgi2c8z2m"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "0m7qph06wxhsw8id1xshyp1bdfk04bdiwfrz3j6ayk6ihg2mw2fg"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "06khkpzfhscsrw7bcvq1ag6by6n2296w8ik0zbi5mq2jm5lx4h4s"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "06sq2dsxg1gl3g5g2x9y2snh9xczi09ci90mb4im21x2dd5i91m2"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0bmhncabzz56r2ac46k1jqsjzgaflvnycbwkh9ksdywm91fcca8k"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "01q00rdyg4dby0zvfkzc8sgyn2434bpzfzjxv3xpc4am05n7nikf"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "1n55lqdriy3kvxmcg2kfgri6si4avf6hi7hxl3pxi3y7ki2aqgq6"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "04yzid7r8ahscjsbphi1272vwjwy6frz1817w15wwby2szprwhqm"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "17xkhj0c41zwpfxm0yvllp12f3zqvl85kg0kwjjfi6z3v3grw9wa"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "1lcbw3yvrm5iha9wjnsvw79nhjcb1px3h5pwhhy3dqcr9l09jnql"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "114s3bqv2diclr44mgshpsvybcldjprh40i51ibz7n4i0kf43km3"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "1a068b45d9wh489mv3cnkxk64qb7piqf4nbc6li37mnk5vqkkkan"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "08p6d8h7sfliy3ynzz9wnrp3b4gvdn9ldkyrqgph57kyjgvalk1k"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "17zrq7cvbmd89rfyhykllijhdlbb9yf90rfv8bkb3cwm12mxibdn"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "0698kzvm0fpgyq1m4h09x3d0nzzf9xvypds1zbn32nynil2wrfi1"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "15wbakil6wmcbq65zdn6lsnslzi3lcpsxqiycqk97s9h735n7r88"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0vvfd9rw5xbhxvid2qsbssnvfjimjadpckkh1cjh2wwb5phx2za6"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "1j6cvvgxjpqzvf81i0daizcr01fxabbvggba1ljsvzn08ky14azg"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "1s0b8aphk0yzikfsfd40mnq70x5izx9gwxk3rh5q52fk2h7p8vn0"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0vv5a04q6k5ch1xacz96dgvj9174fbmq03i6lfj1pkmvmknxwmk3"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "1kwm3zwwijqf52piv867463injdnajx8hhv2bszbl569v0mpyald"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "06zl77hfg9ha54xmwqmd4nvjzj1zfpdl3gxw72wqi98w1imfakjj"; }) + (fetchNuGet { pname = "runtime.win-x86.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "0fnx3ig9mx68kwcqp3hqzxys6vqfwc4iz1acxqbs1h0r7k83ka40"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.linux-musl-arm"; version = "8.0.0-rc.2.23479.6"; sha256 = "0n54h4b8l7xhxz6vx3qbz7b466dvlc7sjyrw9v4p3axzpgaz63yp"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Host.osx-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1cyacd6297nm6cw8w0wxkwl06khb4ng94qdwlzfx5hs2gday34mc"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.linux-musl-arm"; version = "8.0.0-rc.2.23479.6"; sha256 = "15ldwj8r25lric5hnyp0kgj3fi1rzlhbvzr1pyzndhb79kqmw9h5"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.osx-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1r3lssmrxjs4r1qfkxm4hq60n9hzdalv8637fzyrp0gqxd7nzl2f"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Ref"; version = "8.0.0-rc.2.23479.6"; sha256 = "1l9a6flcj2ysxp0msvdz3p9zj6rc3r8dvr7gngn0qh17nklifk4x"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm"; version = "8.0.0-rc.2.23479.6"; sha256 = "0vds01dh5wzwiicjx9zvbhf9sdn6g22y5vy46w6c8vyr5kj9bhw5"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1qza3phfq6hmiig4qy0x14ghcsr9ha69yabsds84fpa7mx2w8xsd"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-musl-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1d106zdvv90z6da6w5lxn31x79hnb7in3mm1c0hxmy7lfs2nx33j"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.linux-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1bykc1r1ljvqqz6v5qzvh2zqzbiav8983657fn1yn5qwdqrfc19l"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "0cac6scv56d4l8bfni7nan7jkj6c79c0vipxl3pabdpsyhkpw7fb"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.osx-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "0i1wkbi0ld3a8mnk809z1vw9zla0w2b5q1gkxj9p59jgyp4hvgy2"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "0h70028z3dvvdh2r0v3m21w8zqi4w6x6fcqb58k2981dcrvgfzza"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Runtime.Mono.win-x86"; version = "8.0.0-rc.2.23479.6"; sha256 = "0y8fr3940y8w4qz2pm07h3kv0gvjmygpij6h0nshkmbvhmx76ccw"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0mf4vmh7sx8lshrc8b6al3nnx9lzylrz8xklngqnskbdw25a6z0i"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0z0z98zx7b146lbyl5rhf9vx8sq8qmra0sf9yh99k83dxi17lcgl"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "1rs79c6lw9clp735p8bh48wwfiz93kwb8d8dj2zksa4hp1s5am31"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "108qga3arini479gpr5l4abgrg9aiqshj2iyyrsn4g39b3k2kys7"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetAppHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "1fn7hqmlqihxprqkig3kpi7mm7qiqm0knrpn1pj94r5bf089jhyl"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHost"; version = "8.0.0-rc.2.23479.6"; sha256 = "0x45ii2slpfbh2ln3d6bdmvl1dmqm0m282lfk57fxlp89ra2n37v"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostPolicy"; version = "8.0.0-rc.2.23479.6"; sha256 = "1ph3lijgmj9n1ah1s88h4509l20ljlylzra8fl2397nrk5nampnj"; }) + (fetchNuGet { pname = "runtime.osx-arm64.Microsoft.NETCore.DotNetHostResolver"; version = "8.0.0-rc.2.23479.6"; sha256 = "0biam46326xx3f07vbz2pa0xvcs6j7v6hy9sdzvvzjdlbr2vkxch"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm"; version = "8.0.0-rc.2.23479.6"; sha256 = "1ln1sqw852h2aamksl4xbrxn8rpsf9v0f302nj86rlnkcd36nvgg"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1vkdzpsma3h6fkd2q6p7igffhiih2w33mnmihjjcqyg0abxcrisf"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-musl-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "1c9c4sdz7ijywj1h2lrqh0g66kwphawh9wz4n1liqdc8iczq5s33"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm"; version = "8.0.0-rc.2.23479.6"; sha256 = "0c6waw5dwkj0s9l51bbgk1m31a89a6w40m7sq2h4my5pa0fc646p"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "02ajhidm312xy397rmw6vvwc84jj59gdv9qwimhkwj3jli51cc5s"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.linux-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "07p2gz8j3pvq6fj1ikp65hzyhw8f76qbsap7ri90myhzy92cfqd7"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-x64"; version = "8.0.0-rc.2.23479.6"; sha256 = "11wdcm9wf2674l3pybv83pi95d7103xh1psq5kkx72zahwjc40sm"; }) + (fetchNuGet { pname = "Microsoft.NETCore.App.Crossgen2.osx-arm64"; version = "8.0.0-rc.2.23479.6"; sha256 = "19v4j3p17hdadgsc6gzqb86iy3ndrkslqfnyvskypcczrk4d272z"; }) + (fetchNuGet { pname = "runtime.linux-arm64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.2.23479.6"; sha256 = "1rl7n1v9zv6fgxv4g8jrm8b2siic8bglwwylacq9mvmfk4ckcnd2"; }) + (fetchNuGet { pname = "runtime.linux-musl-arm64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.2.23479.6"; sha256 = "1gc5ilas07492zc5fb5iqrhhas4mx86xx3ga7p1dwgwlmhbpzq6l"; }) + (fetchNuGet { pname = "runtime.linux-musl-x64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.2.23479.6"; sha256 = "0qb1rz9qxdjs9ig68chxxjcgnya8aff4c0ipd66afn9q1k7faw7r"; }) + (fetchNuGet { pname = "runtime.linux-x64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.2.23479.6"; sha256 = "1fipxybzd7vah2y5rndb5kpn2n8mqcizp2m1lbi4fwi4mlmc6mqf"; }) + (fetchNuGet { pname = "runtime.osx-x64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.2.23479.6"; sha256 = "0fgfvrxz02p1w1i0s0a5i8xq1cvd4l9pj40m1rj8dr7b2sck45xy"; }) + (fetchNuGet { pname = "runtime.win-arm64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.2.23479.6"; sha256 = "0yhql04nzmfawp8qy5m2byx2b768vpf0lj4l88gyjkblpacr37hi"; }) + (fetchNuGet { pname = "runtime.win-x64.Microsoft.DotNet.ILCompiler"; version = "8.0.0-rc.2.23479.6"; sha256 = "0mmdhddwx8xa1rspcmfakiv4lyk3h8y64yizir252r2pf5knh40q"; }) ]; }; } diff --git a/pkgs/development/compilers/erg/default.nix b/pkgs/development/compilers/erg/default.nix index 4518659d9f7f2..27e32df06312d 100644 --- a/pkgs/development/compilers/erg/default.nix +++ b/pkgs/development/compilers/erg/default.nix @@ -9,16 +9,16 @@ rustPlatform.buildRustPackage rec { pname = "erg"; - version = "0.6.23"; + version = "0.6.24"; src = fetchFromGitHub { owner = "erg-lang"; repo = "erg"; rev = "v${version}"; - hash = "sha256-7UzITXvEpzMdKj9YIsuz6uYBLtk//OmTlnUegTLu+HA="; + hash = "sha256-J8Zw79TXYpDfnsx6UgB4sqY1vdwVHildqtCcXlBvUxQ="; }; - cargoHash = "sha256-A2HjobYgM22CIWYJusJUfPObNHlhN7y1lsv2mVzvluk="; + cargoHash = "sha256-4FhD9MvAhP88WGqVIUG2JHxd/gbDYf++bdlS6lVW0xs="; nativeBuildInputs = [ makeWrapper diff --git a/pkgs/development/compilers/graalvm/community-edition/graalpy/hashes.nix b/pkgs/development/compilers/graalvm/community-edition/graalpy/hashes.nix index da582e3ea1925..c18e7bcba0068 100644 --- a/pkgs/development/compilers/graalvm/community-edition/graalpy/hashes.nix +++ b/pkgs/development/compilers/graalvm/community-edition/graalpy/hashes.nix @@ -1,22 +1,22 @@ # Generated by update.sh script { - "version" = "23.1.0"; + "version" = "23.1.1"; "hashes" = { "aarch64-linux" = { - sha256 = "0n0zz86h7jsqgdiyj6vj7qw57ny40jpmfvylyxq70riy86a4zp67"; - url = "https://github.com/oracle/graalpython/releases/download/graal-23.1.0/graalpy-community-23.1.0-linux-aarch64.tar.gz"; + sha256 = "1jv9icfh3w8gdch0h3l8mm6q96z3lv89s8zv788wvkkb87zv8w8m"; + url = "https://github.com/oracle/graalpython/releases/download/graal-23.1.1/graalpy-community-23.1.1-linux-aarch64.tar.gz"; }; "x86_64-linux" = { - sha256 = "0nnv255f2bqc4l88iw48f71874ryjn16bb8qn1yk7daj1pck80vj"; - url = "https://github.com/oracle/graalpython/releases/download/graal-23.1.0/graalpy-community-23.1.0-linux-amd64.tar.gz"; + sha256 = "108qdf0ss9l0x6k983v9yg6m5i7aqwfdxjqa5fx62xj027wi5pqk"; + url = "https://github.com/oracle/graalpython/releases/download/graal-23.1.1/graalpy-community-23.1.1-linux-amd64.tar.gz"; }; "x86_64-darwin" = { - sha256 = "16kp66l0176sbd8jzvq3y3z7d9zvkqzdaw8vrvnk2qkipa136n0k"; - url = "https://github.com/oracle/graalpython/releases/download/graal-23.1.0/graalpy-community-23.1.0-macos-amd64.tar.gz"; + sha256 = "019s7vlr8a6x60g0yh36pdf2vvan1v2wmq8z4xrcgpl96zpwwn5h"; + url = "https://github.com/oracle/graalpython/releases/download/graal-23.1.1/graalpy-community-23.1.1-macos-amd64.tar.gz"; }; "aarch64-darwin" = { - sha256 = "17clq7n1n5ww22rh9gp5h9ljhjvggcik8amhd70pwl4cjgv9mhsv"; - url = "https://github.com/oracle/graalpython/releases/download/graal-23.1.0/graalpy-community-23.1.0-macos-aarch64.tar.gz"; + sha256 = "0qbanbivkj62cjg2ll4ia23c435i1cvwy7pq19dvj8s204mpl8l2"; + url = "https://github.com/oracle/graalpython/releases/download/graal-23.1.1/graalpy-community-23.1.1-macos-aarch64.tar.gz"; }; }; } diff --git a/pkgs/development/compilers/graalvm/community-edition/graalvm-ce/hashes.nix b/pkgs/development/compilers/graalvm/community-edition/graalvm-ce/hashes.nix index 377a05426c9b5..e9454dca7250c 100644 --- a/pkgs/development/compilers/graalvm/community-edition/graalvm-ce/hashes.nix +++ b/pkgs/development/compilers/graalvm/community-edition/graalvm-ce/hashes.nix @@ -1,22 +1,22 @@ # Generated by update.sh script { - "version" = "21.0.0"; + "version" = "21.0.1"; "hashes" = { "aarch64-linux" = { - sha256 = "199h3d6zayw28xlyggldap6nafh5fnpfbshs0rsf94dfgv7r4kmv"; - url = "https://github.com/graalvm/graalvm-ce-builds/releases/download/jdk-21.0.0/graalvm-community-jdk-21.0.0_linux-aarch64_bin.tar.gz"; + sha256 = "0vb1bdbn4lqig4jihynacbyrj551m1pcmj6qh86kdwx0kn9400yy"; + url = "https://github.com/graalvm/graalvm-ce-builds/releases/download/jdk-21.0.1/graalvm-community-jdk-21.0.1_linux-aarch64_bin.tar.gz"; }; "x86_64-linux" = { - sha256 = "06dkb1yimk5q3yzjk6kjsrs2pkbjxgz9jr5vj6wfb2y5ri0jjhkc"; - url = "https://github.com/graalvm/graalvm-ce-builds/releases/download/jdk-21.0.0/graalvm-community-jdk-21.0.0_linux-x64_bin.tar.gz"; + sha256 = "1gvkxqmbsh7pklh9bkhndh08nnjcmgq0xpzc96dgacqnlr4fx0sj"; + url = "https://github.com/graalvm/graalvm-ce-builds/releases/download/jdk-21.0.1/graalvm-community-jdk-21.0.1_linux-x64_bin.tar.gz"; }; "x86_64-darwin" = { - sha256 = "1qbz3xfxj7nwb01cy99hd22k3pim8j43blcdcys48l8xcb234nlk"; - url = "https://github.com/graalvm/graalvm-ce-builds/releases/download/jdk-21.0.0/graalvm-community-jdk-21.0.0_macos-x64_bin.tar.gz"; + sha256 = "0sks663ldc0m3rhc882mzn44kipzbjw7325dhkpwy874p47j9zns"; + url = "https://github.com/graalvm/graalvm-ce-builds/releases/download/jdk-21.0.1/graalvm-community-jdk-21.0.1_macos-x64_bin.tar.gz"; }; "aarch64-darwin" = { - sha256 = "0dqgsp0bhqvv07b9kb0cxqm5cw47kapzbfbw13570ydgc0gfg3f5"; - url = "https://github.com/graalvm/graalvm-ce-builds/releases/download/jdk-21.0.0/graalvm-community-jdk-21.0.0_macos-aarch64_bin.tar.gz"; + sha256 = "0i7zzq1czgc4lk1z278zp4cml4kdryafhrma5rqaja75933jpi2h"; + url = "https://github.com/graalvm/graalvm-ce-builds/releases/download/jdk-21.0.1/graalvm-community-jdk-21.0.1_macos-aarch64_bin.tar.gz"; }; }; } diff --git a/pkgs/development/compilers/graalvm/community-edition/truffleruby/hashes.nix b/pkgs/development/compilers/graalvm/community-edition/truffleruby/hashes.nix index addd6749e7d64..51e40dd590d58 100644 --- a/pkgs/development/compilers/graalvm/community-edition/truffleruby/hashes.nix +++ b/pkgs/development/compilers/graalvm/community-edition/truffleruby/hashes.nix @@ -1,22 +1,22 @@ # Generated by update.sh script { - "version" = "23.1.0"; + "version" = "23.1.1"; "hashes" = { "aarch64-linux" = { - sha256 = "05q0xqm7qa9mw7v4kwyhbqsx27x19msf9rbbzq60dinp5724r721"; - url = "https://github.com/oracle/truffleruby/releases/download/graal-23.1.0/truffleruby-community-23.1.0-linux-aarch64.tar.gz"; + sha256 = "0d8lxbfafgyirgs06bmfbmww61h8w3sr95z7y4x0ykfs7mghsnpd"; + url = "https://github.com/oracle/truffleruby/releases/download/graal-23.1.1/truffleruby-community-23.1.1-linux-aarch64.tar.gz"; }; "x86_64-linux" = { - sha256 = "0bfcqcax9424vsdqzr18mxkhi2wpzc4xaji98anm8mcjkyl1r89q"; - url = "https://github.com/oracle/truffleruby/releases/download/graal-23.1.0/truffleruby-community-23.1.0-linux-amd64.tar.gz"; + sha256 = "1304yvllffnhwmpbcdsgcwkhc5w5w7r1rhxdwb709if8kglx793y"; + url = "https://github.com/oracle/truffleruby/releases/download/graal-23.1.1/truffleruby-community-23.1.1-linux-amd64.tar.gz"; }; "x86_64-darwin" = { - sha256 = "1yj9nk670hgh9104s1j207mqldagfvvvscj4bfgf3jlbcq5hvlhn"; - url = "https://github.com/oracle/truffleruby/releases/download/graal-23.1.0/truffleruby-community-23.1.0-macos-amd64.tar.gz"; + sha256 = "09lfski3dj3zzp7cdfrndjafx48ln0wdgb7cs3an3krh6xjchi8l"; + url = "https://github.com/oracle/truffleruby/releases/download/graal-23.1.1/truffleruby-community-23.1.1-macos-amd64.tar.gz"; }; "aarch64-darwin" = { - sha256 = "1nmqyn4vzwjsvq7dly8qn1xx973jg027xfbs988vf3nljnhkpq5l"; - url = "https://github.com/oracle/truffleruby/releases/download/graal-23.1.0/truffleruby-community-23.1.0-macos-aarch64.tar.gz"; + sha256 = "152mrz5hfnmsf5k1gd6rsb6yacy3zyjm2jl8q3zjl18n784np57b"; + url = "https://github.com/oracle/truffleruby/releases/download/graal-23.1.1/truffleruby-community-23.1.1-macos-aarch64.tar.gz"; }; }; } diff --git a/pkgs/development/compilers/temurin-bin/generate-sources.py b/pkgs/development/compilers/temurin-bin/generate-sources.py index 79bf8aeca275e..bb60d6903df12 100755 --- a/pkgs/development/compilers/temurin-bin/generate-sources.py +++ b/pkgs/development/compilers/temurin-bin/generate-sources.py @@ -6,7 +6,7 @@ import re import requests import sys -feature_versions = (8, 11, 16, 17, 18, 19, 20) +feature_versions = (8, 11, 16, 17, 18, 19, 20, 21) oses = ("mac", "linux", "alpine-linux") types = ("jre", "jdk") impls = ("hotspot") diff --git a/pkgs/development/compilers/temurin-bin/jdk-darwin.nix b/pkgs/development/compilers/temurin-bin/jdk-darwin.nix index fe0c5792a53d4..5122b6ed72945 100644 --- a/pkgs/development/compilers/temurin-bin/jdk-darwin.nix +++ b/pkgs/development/compilers/temurin-bin/jdk-darwin.nix @@ -22,4 +22,7 @@ in jdk-20 = common { sourcePerArch = sources.jdk.openjdk20; }; jre-20 = common { sourcePerArch = sources.jre.openjdk20; }; + + jdk-21 = common { sourcePerArch = sources.jdk.openjdk21; }; + jre-21 = common { sourcePerArch = sources.jre.openjdk21; }; } diff --git a/pkgs/development/compilers/temurin-bin/jdk-linux.nix b/pkgs/development/compilers/temurin-bin/jdk-linux.nix index af9202aa40785..87a00a373916f 100644 --- a/pkgs/development/compilers/temurin-bin/jdk-linux.nix +++ b/pkgs/development/compilers/temurin-bin/jdk-linux.nix @@ -23,4 +23,7 @@ in jdk-20 = common { sourcePerArch = sources.jdk.openjdk20; }; jre-20 = common { sourcePerArch = sources.jre.openjdk20; }; + + jdk-21 = common { sourcePerArch = sources.jdk.openjdk21; }; + jre-21 = common { sourcePerArch = sources.jre.openjdk21; }; } diff --git a/pkgs/development/compilers/temurin-bin/sources.json b/pkgs/development/compilers/temurin-bin/sources.json index e4744a7996092..00a0e72997ecc 100644 --- a/pkgs/development/compilers/temurin-bin/sources.json +++ b/pkgs/development/compilers/temurin-bin/sources.json @@ -6,10 +6,10 @@ "packageType": "jdk", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "45f56d75da2f55b29e7307cc790958e379abbe6b5f160a3824dc26e320c718e5", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jdk_x64_alpine-linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "d5e2235d3707526f7c9ba3f0dc194e60d5dec33eceff2a2dcf9d874464cc0e9e", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jdk_x64_alpine-linux_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" } }, "openjdk16": { @@ -26,10 +26,10 @@ "packageType": "jdk", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "b6edac2fa669876ef16b4895b36b61d01066626e7a69feba2acc19760c8d18cb", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jdk_x64_alpine-linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "c2a571a56e5bd3f30956b17b048880078c7801ed9e8754af6d1e38b9176059a9", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jdk_x64_alpine-linux_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" } }, "openjdk18": { @@ -57,19 +57,35 @@ "vmType": "hotspot", "x86_64": { "build": "9", - "sha256": "68d0f0c468064e944e304cab64fc162335d4d9bc0ddab7e6ff7a395a0bceda74", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jdk_x64_alpine-linux_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "b03aced4b7a1c49bc00297e35e45480fd03818862b93e17e1551a3b721e89306", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jdk_x64_alpine-linux_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" + } + }, + "openjdk21": { + "aarch64": { + "build": "12", + "sha256": "77006c0a753808c2a6662007906eb6eb230f2fb6eb9d201a39cc46113e68f82c", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jdk_aarch64_alpine-linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" + }, + "packageType": "jdk", + "vmType": "hotspot", + "x86_64": { + "build": "12", + "sha256": "422f23f5109056cacb9227247bebf8532e2dc3c9d505e71637ba610569d6b3ff", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jdk_x64_alpine-linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" } }, "openjdk8": { "packageType": "jdk", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "cfdf8e07c8eeb087b7a2895b90fc0a19986bcff85006f1e2b708e3964909aa8e", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jdk_x64_alpine-linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "5", + "sha256": "6cf2d4925c387c4cdc0bf2e71de3690527141b5244695d0b3109ce83a8512235", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u382-b05/OpenJDK8U-jdk_x64_alpine-linux_hotspot_8u382b05.tar.gz", + "version": "8.0.382" } } }, @@ -78,20 +94,20 @@ "packageType": "jre", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "b5d71cdf3032040e7d2a577712bf525e32e87686af3430219308a39878b98851", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jre_x64_alpine-linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "6a3d1759bdf91433411d37ca2ad1505a7f214c1401797834e9884165c2457368", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jre_x64_alpine-linux_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" } }, "openjdk17": { "packageType": "jre", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "711f837bacf8222dee9e8cd7f39941a4a0acf869243f03e6038ca3ba189f66ca", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jre_x64_alpine-linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "70e5d108f51ae7c7b2435d063652df058723e303a18b4f72f17f75c5320052d3", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jre_x64_alpine-linux_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" } }, "openjdk18": { @@ -119,19 +135,35 @@ "vmType": "hotspot", "x86_64": { "build": "9", - "sha256": "0e95fa3719f7989908dfcc77ef701c6fe1111c4195ee3c6858faab5fd37525c5", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jre_x64_alpine-linux_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "53b34747a3c042a4cccb2b8b78fba3330b105bc523f0861237baa9143dc39115", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jre_x64_alpine-linux_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" + } + }, + "openjdk21": { + "aarch64": { + "build": "12", + "sha256": "2898ea1ddf6f70f09b09cf99d928f6d4c862f78f81104f5dce3e44a832b8444a", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jre_aarch64_alpine-linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" + }, + "packageType": "jre", + "vmType": "hotspot", + "x86_64": { + "build": "12", + "sha256": "a8fcc43927664ba191c9a77d1013f1f32fec1acc22fe6f0c29d687221f2cc95d", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jre_x64_alpine-linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" } }, "openjdk8": { "packageType": "jre", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "95d8cb8b5375ec00a064ed728eb60d925d44c1a79fe92f6ca7385b5863d4f78c", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jre_x64_alpine-linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "5", + "sha256": "7040d865493f13204194c5a1add63e22516b1fa4481264baa6a5b2614a275a0e", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u382-b05/OpenJDK8U-jre_x64_alpine-linux_hotspot_8u382b05.tar.gz", + "version": "8.0.382" } } } @@ -140,36 +172,36 @@ "jdk": { "openjdk11": { "aarch64": { - "build": "7", - "sha256": "0c7763a19b4af4ef5fbae831781b5184e988d6f131d264482399eeaf51b6e254", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jdk_aarch64_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "8c3146035b99c55ab26a2982f4b9abd2bf600582361cf9c732539f713d271faf", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jdk_aarch64_linux_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" }, "armv6l": { - "build": "7", - "sha256": "be07af349f0d2e1ffb7e01e1e8bac8bffd76e22f6cc1354e5b627222e3395f41", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jdk_arm_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "1", + "sha256": "e83674aee238ebb5f359b9395b3c5e3fad5b645846095494662802d2f0fd01c9", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.20.1%2B1/OpenJDK11U-jdk_arm_linux_hotspot_11.0.20.1_1.tar.gz", + "version": "11.0.20" }, "armv7l": { - "build": "7", - "sha256": "be07af349f0d2e1ffb7e01e1e8bac8bffd76e22f6cc1354e5b627222e3395f41", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jdk_arm_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "1", + "sha256": "e83674aee238ebb5f359b9395b3c5e3fad5b645846095494662802d2f0fd01c9", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.20.1%2B1/OpenJDK11U-jdk_arm_linux_hotspot_11.0.20.1_1.tar.gz", + "version": "11.0.20" }, "packageType": "jdk", "powerpc64le": { - "build": "7", - "sha256": "1e3704c8e155f8f894953c2a6708a52e6f449bbf5a85450be6fbb2ec76581700", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jdk_ppc64le_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "262ff98d6d88a7c7cc522cb4ec4129491a0eb04f5b17dcca0da57cfcdcf3830d", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jdk_ppc64le_linux_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" }, "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "5f19fb28aea3e28fcc402b73ce72f62b602992d48769502effe81c52ca39a581", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jdk_x64_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "60ea98daa09834fdd3162ca91ddc8d92a155ab3121204f6f643176ee0c2d0d5e", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jdk_x64_linux_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" } }, "openjdk16": { @@ -208,36 +240,36 @@ }, "openjdk17": { "aarch64": { - "build": "7", - "sha256": "0084272404b89442871e0a1f112779844090532978ad4d4191b8d03fc6adfade", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jdk_aarch64_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "e2c5e26f8572544b201bc22a9b28f2b1a3147ab69be111cea07c7f52af252e75", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jdk_aarch64_linux_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" }, "armv6l": { - "build": "7", - "sha256": "e7a84c3e59704588510d7e6cce1f732f397b54a3b558c521912a18a1b4d0abdc", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jdk_arm_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "1", + "sha256": "b1f1d8b7fcb159a0a8029b6c3106d1d16207cecbb2047f9a4be2a64d29897da5", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.8.1%2B1/OpenJDK17U-jdk_arm_linux_hotspot_17.0.8.1_1.tar.gz", + "version": "17.0.8" }, "armv7l": { - "build": "7", - "sha256": "e7a84c3e59704588510d7e6cce1f732f397b54a3b558c521912a18a1b4d0abdc", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jdk_arm_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "1", + "sha256": "b1f1d8b7fcb159a0a8029b6c3106d1d16207cecbb2047f9a4be2a64d29897da5", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.8.1%2B1/OpenJDK17U-jdk_arm_linux_hotspot_17.0.8.1_1.tar.gz", + "version": "17.0.8" }, "packageType": "jdk", "powerpc64le": { - "build": "7", - "sha256": "8f4366ff1eddb548b1744cd82a1a56ceee60abebbcbad446bfb3ead7ac0f0f85", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jdk_ppc64le_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "3ae4b254d5b720f94f986481e787fbd67f0667571140ba2e2ae5020ceddbc826", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jdk_ppc64le_linux_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" }, "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "e9458b38e97358850902c2936a1bb5f35f6cffc59da9fcd28c63eab8dbbfbc3b", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jdk_x64_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "7b175dbe0d6e3c9c23b6ed96449b018308d8fc94a5ecd9c0df8b8bc376c3c18a", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jdk_x64_linux_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" } }, "openjdk18": { @@ -311,9 +343,9 @@ "openjdk20": { "aarch64": { "build": "9", - "sha256": "b16c0271899de1f0e277dc0398bfff11b54511765f104fa938929ac484dc926d", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jdk_aarch64_linux_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "b475bcc23db0bd618c815bb8f11d8e084dc58288ea3bcdf4e7f389ed41c89f56", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jdk_aarch64_linux_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" }, "packageType": "jdk", "powerpc64le": { @@ -325,113 +357,135 @@ "vmType": "hotspot", "x86_64": { "build": "9", - "sha256": "43ad054f135a7894dc87ad5d10ad45d8e82846186515892acdbc17c2c5cd27e4", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jdk_x64_linux_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "3d91842e9c172967ac397076523249d05a82ead51b0006838f5f0315ad52222c", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jdk_x64_linux_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" + } + }, + "openjdk21": { + "aarch64": { + "build": "12", + "sha256": "e184dc29a6712c1f78754ab36fb48866583665fa345324f1a79e569c064f95e9", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jdk_aarch64_linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" + }, + "packageType": "jdk", + "powerpc64le": { + "build": "12", + "sha256": "9574828ef3d735a25404ced82e09bf20e1614f7d6403956002de9cfbfcb8638f", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jdk_ppc64le_linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" + }, + "vmType": "hotspot", + "x86_64": { + "build": "12", + "sha256": "1a6fa8abda4c5caed915cfbeeb176e7fbd12eb6b222f26e290ee45808b529aa1", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jdk_x64_linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" } }, "openjdk8": { "aarch64": { - "build": "7", - "sha256": "195808eb42ab73535c84de05188914a52a47c1ac784e4bf66de95fe1fd315a5a", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jdk_aarch64_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "8", + "sha256": "70636c2fa4927913e9e869d471607a99d3a521c1fa3f3687b889c2acba67c493", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u392-b08/OpenJDK8U-jdk_aarch64_linux_hotspot_8u392b08.tar.gz", + "version": "8.0.392" }, "armv6l": { - "build": "7", - "sha256": "3f4848700a4bf856d3c138dc9c2b305b978879c8fbef5aa7df34a7c2fe1b64b8", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jdk_arm_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "5", + "sha256": "5d805ff157f272acf0f7d192f21af4a3b68c840333ca95568e4e07142efc369d", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u382-b05/OpenJDK8U-jdk_arm_linux_hotspot_8u382b05.tar.gz", + "version": "8.0.382" }, "armv7l": { - "build": "7", - "sha256": "3f4848700a4bf856d3c138dc9c2b305b978879c8fbef5aa7df34a7c2fe1b64b8", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jdk_arm_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "5", + "sha256": "5d805ff157f272acf0f7d192f21af4a3b68c840333ca95568e4e07142efc369d", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u382-b05/OpenJDK8U-jdk_arm_linux_hotspot_8u382b05.tar.gz", + "version": "8.0.382" }, "packageType": "jdk", "powerpc64le": { - "build": "7", - "sha256": "bb85303848fe402d4f1004f748f80ccb39cb11f356f50a513555d1083c3913b8", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jdk_ppc64le_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "8", + "sha256": "9d9813d2840360ffdbc449c45e71124e8170c31a3b6cce9151fbb31352064406", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u392-b08/OpenJDK8U-jdk_ppc64le_linux_hotspot_8u392b08.tar.gz", + "version": "8.0.392" }, "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "78a0b3547d6f3d46227f2ad8c774248425f20f1cd63f399b713f0cdde2cc376c", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jdk_x64_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "8", + "sha256": "15d091e22aa0cad12a241acff8c1634e7228b9740f8d19634250aa6fe0c19a33", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u392-b08/OpenJDK8U-jdk_x64_linux_hotspot_8u392b08.tar.gz", + "version": "8.0.392" } } }, "jre": { "openjdk11": { "aarch64": { - "build": "7", - "sha256": "1fe4b20d808f393422610818711c728331992a4455eeeb061d3d05b45412771d", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jre_aarch64_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "8dc527e5c5da62f80ad3b6a2cd7b1789f745b1d90d5e83faba45f7a1d0b6cab8", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jre_aarch64_linux_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" }, "armv6l": { - "build": "7", - "sha256": "cb754b055177381f9f6852b7e5469904a15edddd7f8e136043c28b1e33aee47c", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jre_arm_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "1", + "sha256": "2fc1cc935897312c0bc2515b2e7ea1fa3b267e77305a1b51a8c3917d92af380f", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.20.1%2B1/OpenJDK11U-jre_arm_linux_hotspot_11.0.20.1_1.tar.gz", + "version": "11.0.20" }, "armv7l": { - "build": "7", - "sha256": "cb754b055177381f9f6852b7e5469904a15edddd7f8e136043c28b1e33aee47c", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jre_arm_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "1", + "sha256": "2fc1cc935897312c0bc2515b2e7ea1fa3b267e77305a1b51a8c3917d92af380f", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.20.1%2B1/OpenJDK11U-jre_arm_linux_hotspot_11.0.20.1_1.tar.gz", + "version": "11.0.20" }, "packageType": "jre", "powerpc64le": { - "build": "7", - "sha256": "8019d938e5525938ec8e68e2989c4413263b0d9b7b3f20fe0c45f6d967919cfb", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jre_ppc64le_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "286e37ce06316185377eea847d2aa9f1523b9f1428684e59e772f2f6055e89b9", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jre_ppc64le_linux_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" }, "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "32dcf760664f93531594b72ce9226e9216567de5705a23c9ff5a77c797948054", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jre_x64_linux_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "156861bb901ef18759e05f6f008595220c7d1318a46758531b957b0c950ef2c3", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jre_x64_linux_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" } }, "openjdk17": { "aarch64": { - "build": "7", - "sha256": "2ff6a4fd1fa354047c93ba8c3179967156162f27bd683aee1f6e52a480bcbe6a", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jre_aarch64_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "05b192f81ed478178ba953a2a779b67fc5a810acadb633ad69f8c4412399edb8", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jre_aarch64_linux_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" }, "armv6l": { - "build": "7", - "sha256": "5b0401199c7c9163b8395ebf25195ed395fec7b7ef7158c36302420cf993825a", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jre_arm_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "1", + "sha256": "8af898c5d356f0b2cee2db67ff9c8e7a8e738c0f6b3a61c383150b3168b9ea58", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.8.1%2B1/OpenJDK17U-jre_arm_linux_hotspot_17.0.8.1_1.tar.gz", + "version": "17.0.8" }, "armv7l": { - "build": "7", - "sha256": "5b0401199c7c9163b8395ebf25195ed395fec7b7ef7158c36302420cf993825a", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jre_arm_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "1", + "sha256": "8af898c5d356f0b2cee2db67ff9c8e7a8e738c0f6b3a61c383150b3168b9ea58", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.8.1%2B1/OpenJDK17U-jre_arm_linux_hotspot_17.0.8.1_1.tar.gz", + "version": "17.0.8" }, "packageType": "jre", "powerpc64le": { - "build": "7", - "sha256": "cc25e74c0817cd4d943bba056b256b86e0e9148bf41d7600c5ec2e1eadb2e470", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jre_ppc64le_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "79c85ecf1320c67b828310167e1ced62e402bc86a5d47ca9cc7bfa3b708cb07a", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jre_ppc64le_linux_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" }, "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "bb025133b96266f6415d5084bb9b260340a813968007f1d2d14690f20bd021ca", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jre_x64_linux_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "c37f729200b572884b8f8e157852c739be728d61d9a1da0f920104876d324733", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jre_x64_linux_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" } }, "openjdk18": { @@ -505,9 +559,9 @@ "openjdk20": { "aarch64": { "build": "9", - "sha256": "4b04fcfabf833403cc74dd19105a387563f9ff0fef975c4101f3d74c53eb7745", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jre_aarch64_linux_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "63a730d5a3b6d21d31f7cba15dc44b019a8a4d8652e13acec45040f98584112c", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jre_aarch64_linux_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" }, "packageType": "jre", "powerpc64le": { @@ -519,43 +573,65 @@ "vmType": "hotspot", "x86_64": { "build": "9", - "sha256": "daacf24c15bf7f38a957a98a312911a36ba7f7d97004920a7875791f20e8e1ed", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jre_x64_linux_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "e3592e86290c192804d9c6b5035d42cc32cf04141d1c0b9d1ecb67739826c8c5", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jre_x64_linux_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" + } + }, + "openjdk21": { + "aarch64": { + "build": "12", + "sha256": "4582c4cc0c6d498ba7a23fdb0a5179c9d9c0d7a26f2ee8610468d5c2954fcf2f", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jre_aarch64_linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" + }, + "packageType": "jre", + "powerpc64le": { + "build": "12", + "sha256": "05cc9b7bfbe246c27d307783b3d5095797be747184b168018ae3f7cc55608db2", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jre_ppc64le_linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" + }, + "vmType": "hotspot", + "x86_64": { + "build": "12", + "sha256": "277f4084bee875f127a978253cfbaad09c08df597feaf5ccc82d2206962279a3", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jre_x64_linux_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" } }, "openjdk8": { "aarch64": { - "build": "7", - "sha256": "f8e440273c8feb3fcfaca88ba18fec291deae18a548adde8a37cd1db08107b95", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jre_aarch64_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "8", + "sha256": "37b997f12cd572da979283fccafec9ba903041a209605b50fcb46cc34f1a9917", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u392-b08/OpenJDK8U-jre_aarch64_linux_hotspot_8u392b08.tar.gz", + "version": "8.0.392" }, "armv6l": { - "build": "7", - "sha256": "e58e017012838ae4f0db78293e3246cc09958e6ea9a2393c5947ec003bf736dd", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jre_arm_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "5", + "sha256": "b92fb3972372b5d1f9fb51815def903105722b747f680b7ecf2ba2ba863ab156", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u382-b05/OpenJDK8U-jre_arm_linux_hotspot_8u382b05.tar.gz", + "version": "8.0.382" }, "armv7l": { - "build": "7", - "sha256": "e58e017012838ae4f0db78293e3246cc09958e6ea9a2393c5947ec003bf736dd", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jre_arm_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "5", + "sha256": "b92fb3972372b5d1f9fb51815def903105722b747f680b7ecf2ba2ba863ab156", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u382-b05/OpenJDK8U-jre_arm_linux_hotspot_8u382b05.tar.gz", + "version": "8.0.382" }, "packageType": "jre", "powerpc64le": { - "build": "7", - "sha256": "ba5f8141a16722e39576bf42b69d2b8ebf95fc2c05441e3200f609af4dd9f1ea", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jre_ppc64le_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "8", + "sha256": "0ecb0aeb54fb9d3c9e1a7ea411490127e8e298d93219fafc4dd6051a5b74671f", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u392-b08/OpenJDK8U-jre_ppc64le_linux_hotspot_8u392b08.tar.gz", + "version": "8.0.392" }, "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "b6fdfe32085a884c11b31f66aa67ac62811df7112fb6fb08beea61376a86fbb4", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jre_x64_linux_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "8", + "sha256": "91d31027da0d985be3549714389593d9e0da3da5057d87e3831c7c538b9a2a0f", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u392-b08/OpenJDK8U-jre_x64_linux_hotspot_8u392b08.tar.gz", + "version": "8.0.392" } } } @@ -564,18 +640,18 @@ "jdk": { "openjdk11": { "aarch64": { - "build": "7", - "sha256": "f3b416ecccf51f45cc8c986975eb7bd35e7e1ad953656ab0a807125963fcf73b", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jdk_aarch64_mac_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "3be236f2cf9612cd38cd6b7cfa4b8eef642a88beab0cd37c6ccf1766d755b4cc", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jdk_aarch64_mac_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" }, "packageType": "jdk", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "fc34c4f0e590071dcd65a0f93540913466ccac3aa8caa984826713b67afb696d", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jdk_x64_mac_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "39e30e333d01f70765f0fdc57332bc2c5ae101392bcc315ef06f472d80d8e2d7", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jdk_x64_mac_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" } }, "openjdk16": { @@ -590,18 +666,18 @@ }, "openjdk17": { "aarch64": { - "build": "7", - "sha256": "1d6aeb55b47341e8ec33cc1644d58b88dfdcce17aa003a858baa7460550e6ff9", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jdk_aarch64_mac_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "823777266415347983bbd87ccd8136537242ff27e62f307b7e8521494c665f0d", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jdk_aarch64_mac_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" }, "packageType": "jdk", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "50d0e9840113c93916418068ba6c845f1a72ed0dab80a8a1f7977b0e658b65fb", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jdk_x64_mac_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "c69b37ea72136df49ce54972408803584b49b2c91b0fbc876d7125e963c7db37", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jdk_x64_mac_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" } }, "openjdk18": { @@ -639,61 +715,77 @@ "openjdk20": { "aarch64": { "build": "9", - "sha256": "e743f7a4aebb46bfb02e164c7aa009a29bcce1d7dd0c4926541893ea6ed21d82", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jdk_aarch64_mac_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "6ef42b63581c0265c5a6b734e203bb922ee720571a8de46532ecca50a804c596", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jdk_aarch64_mac_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" }, "packageType": "jdk", "vmType": "hotspot", "x86_64": { "build": "9", - "sha256": "7cccfc4fb9f63410b7fdc315fd1c7739cf61888930d7f88f3eee6589d14e861f", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jdk_x64_mac_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "bdeb37322a7c9292434e417d4db9f5debd7477cf413335d3a653a4e5e50a2473", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jdk_x64_mac_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" + } + }, + "openjdk21": { + "aarch64": { + "build": "12", + "sha256": "0d29257c9bcb5f20f5c4643ef9437f36b10376863eddaf6248d09093796c6b30", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jdk_aarch64_mac_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" + }, + "packageType": "jdk", + "vmType": "hotspot", + "x86_64": { + "build": "12", + "sha256": "35f3cbc86d7ff0a01facefd741d5cfb675867e0a5ec137f62ba071d2511a45c9", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jdk_x64_mac_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" } }, "openjdk8": { "packageType": "jdk", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "9c33db312cc46b6bfe705770fdc5c08edb7d790ba70be4e8b12a98e79da5f4a1", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jdk_x64_mac_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "8", + "sha256": "d152f5b2ed8473ee0eb29c7ee134958d75ea86c8ccbafb5ee04a5545dd76108f", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u392-b08/OpenJDK8U-jdk_x64_mac_hotspot_8u392b08.tar.gz", + "version": "8.0.392" } } }, "jre": { "openjdk11": { "aarch64": { - "build": "7", - "sha256": "78a07bd60c278f65bafd0df93890d909ff60259ccbd22ad71a1c3b312906508e", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jre_aarch64_mac_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "bcac3231195a95cac397a35410bfa3f0945ec03e5194e7b0c1d0e785a48f8b76", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jre_aarch64_mac_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" }, "packageType": "jre", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "87e439b2193e1a2cf1a8782168bba83b558f54e2708f88ea8296184ea2735c89", - "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.19%2B7/OpenJDK11U-jre_x64_mac_hotspot_11.0.19_7.tar.gz", - "version": "11.0.19" + "build": "9", + "sha256": "43d29affe994a09de31bf2fb6f8ab6d6792ba4267b9a2feacaa1f6e042481b9b", + "url": "https://github.com/adoptium/temurin11-binaries/releases/download/jdk-11.0.21%2B9/OpenJDK11U-jre_x64_mac_hotspot_11.0.21_9.tar.gz", + "version": "11.0.21" } }, "openjdk17": { "aarch64": { - "build": "7", - "sha256": "625d070a297a3c856badbaa5c65adaaa1adb3ea3813363fb8335c47709b69140", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jre_aarch64_mac_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "89831d03b7cd9922bd178f1a9c8544a36c54d52295366db4e6628454b01acaef", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jre_aarch64_mac_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" }, "packageType": "jre", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "62559a927a8dbac2ea1d7879f590a62fea87d61bfaa92894e578d2045b8d921b", - "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.7%2B7/OpenJDK17U-jre_x64_mac_hotspot_17.0.7_7.tar.gz", - "version": "17.0.7" + "build": "9", + "sha256": "ba214f2217dc134e94432085cff4fc5a97e964ffc211d343725fd535f3cd98a0", + "url": "https://github.com/adoptium/temurin17-binaries/releases/download/jdk-17.0.9%2B9/OpenJDK17U-jre_x64_mac_hotspot_17.0.9_9.tar.gz", + "version": "17.0.9" } }, "openjdk18": { @@ -731,27 +823,43 @@ "openjdk20": { "aarch64": { "build": "9", - "sha256": "ee8be9190324285ebc7e9bd47b948eec349221845fa48f1e673e5a1489708750", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jre_aarch64_mac_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "81b475ab029ab224b2c711ccdfa9c25e0300539faad342a4ceefd33772fb38b4", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jre_aarch64_mac_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" }, "packageType": "jre", "vmType": "hotspot", "x86_64": { "build": "9", - "sha256": "b59a5f8b7f8fd1502df274e8ba58215b06934c8261413cb40e344f6ad81e7f1f", - "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.1%2B9/OpenJDK20U-jre_x64_mac_hotspot_20.0.1_9.tar.gz", - "version": "20.0.1" + "sha256": "565d62faac325c098670705fb26a5cc3d4af0a25e86444ddd643f779ad2a3417", + "url": "https://github.com/adoptium/temurin20-binaries/releases/download/jdk-20.0.2%2B9/OpenJDK20U-jre_x64_mac_hotspot_20.0.2_9.tar.gz", + "version": "20.0.2" + } + }, + "openjdk21": { + "aarch64": { + "build": "12", + "sha256": "bc384961d3a866198b1055a80fdff7fb6946aa6823b3ce624cc8c3125a26bed5", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jre_aarch64_mac_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" + }, + "packageType": "jre", + "vmType": "hotspot", + "x86_64": { + "build": "12", + "sha256": "c21a2648ec21bc4701acfb6b7a1fd90aca001db1efb8454e2980d4c8dcd9e310", + "url": "https://github.com/adoptium/temurin21-binaries/releases/download/jdk-21.0.1%2B12/OpenJDK21U-jre_x64_mac_hotspot_21.0.1_12.tar.gz", + "version": "21.0.1" } }, "openjdk8": { "packageType": "jre", "vmType": "hotspot", "x86_64": { - "build": "7", - "sha256": "6c876ea7bfa778ae78ec5a976e557b2b981a592a3639eb0d3dc3c8d3dda8d321", - "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u372-b07/OpenJDK8U-jre_x64_mac_hotspot_8u372b07.tar.gz", - "version": "8.0.372" + "build": "8", + "sha256": "f1f15920ed299e10c789aef6274d88d45eb21b72f9a7b0d246a352107e344e6a", + "url": "https://github.com/adoptium/temurin8-binaries/releases/download/jdk8u392-b08/OpenJDK8U-jre_x64_mac_hotspot_8u392b08.tar.gz", + "version": "8.0.392" } } } diff --git a/pkgs/development/coq-modules/coqeal/default.nix b/pkgs/development/coq-modules/coqeal/default.nix index 0f1f84dceab90..a6ef9e0b8a32d 100644 --- a/pkgs/development/coq-modules/coqeal/default.nix +++ b/pkgs/development/coq-modules/coqeal/default.nix @@ -8,6 +8,7 @@ inherit version; defaultVersion = with lib.versions; lib.switch [ coq.version mathcomp.version ] [ + { cases = [ (range "8.16" "8.18") (isGe "2.0.0") ]; out = "2.0.0"; } { cases = [ (range "8.15" "8.18") (isGe "1.15.0") ]; out = "1.1.3"; } { cases = [ (range "8.13" "8.17") (isGe "1.13.0") ]; out = "1.1.1"; } { cases = [ (range "8.10" "8.15") (isGe "1.12.0") ]; out = "1.1.0"; } @@ -16,6 +17,7 @@ { cases = [ (isGe "8.7") "1.10.0" ]; out = "1.0.3"; } ] null; + release."2.0.0".sha256 = "sha256-SG/KVnRJz2P+ZxkWVp1dDOnc/JVgigoexKfRUh1Y0GM"; release."1.1.3".sha256 = "sha256-xhqWpg86xbU1GbDtXXInNCTArjjPnWZctWiiasq1ScU="; release."1.1.1".sha256 = "sha256-ExAdC3WuArNxS+Sa1r4x5aT7ylbCvP/BZXfkdQNAvZ8="; release."1.1.0".sha256 = "1vyhfna5frkkq2fl1fkg2mwzpg09k3sbzxxpyp14fjay81xajrxr"; diff --git a/pkgs/development/coq-modules/fourcolor/default.nix b/pkgs/development/coq-modules/fourcolor/default.nix index 195b73dea6fe6..7d22abad7c7f7 100644 --- a/pkgs/development/coq-modules/fourcolor/default.nix +++ b/pkgs/development/coq-modules/fourcolor/default.nix @@ -10,10 +10,12 @@ mkCoqDerivation { release."1.2.4".sha256 = "sha256-iSW2O1kuunvOqTolmGGXmsYTxo2MJYCdW3BnEhp6Ksg="; release."1.2.5".sha256 = "sha256-3qOPNCRjGK2UdHGMSqElpIXhAPVCklpeQgZwf9AFals="; release."1.3.0".sha256 = "sha256-h9pa6vaKT6jCEaIdEdcu0498Ou5kEXtZdb9P7WXK1DQ="; + release."1.3.1".sha256 = "sha256-wBizm1hJXPYBu0tHFNScQHd22FebsJYoggT5OlhY/zM="; inherit version; defaultVersion = with lib.versions; lib.switch [ coq.version mathcomp.version ] [ - { cases = [ (isGe "8.16") (isGe "2.0") ]; out = "1.3.0"; } + { cases = [ (isGe "8.16") (isGe "2.0") ]; out = "1.3.1"; } + { cases = [ (isGe "8.16") "2.0.0" ]; out = "1.3.0"; } { cases = [ (isGe "8.11") (range "1.12" "1.17") ]; out = "1.2.5"; } { cases = [ (isGe "8.11") (range "1.11" "1.14") ]; out = "1.2.4"; } { cases = [ (isLe "8.13") (lib.pred.inter (isGe "1.11.0") (isLt "1.13")) ]; out = "1.2.3"; } diff --git a/pkgs/development/coq-modules/mathcomp-algebra-tactics/default.nix b/pkgs/development/coq-modules/mathcomp-algebra-tactics/default.nix index bfdd3e9b60141..a665ea0db30ac 100644 --- a/pkgs/development/coq-modules/mathcomp-algebra-tactics/default.nix +++ b/pkgs/development/coq-modules/mathcomp-algebra-tactics/default.nix @@ -9,12 +9,14 @@ mkCoqDerivation { defaultVersion = with lib.versions; lib.switch [ coq.coq-version mathcomp-algebra.version ] [ + { cases = [ (range "8.16" "8.18") (isGe "2.0") ]; out = "1.2.2"; } { cases = [ (range "8.16" "8.18") (isGe "1.15") ]; out = "1.1.1"; } { cases = [ (range "8.13" "8.16") (isGe "1.12") ]; out = "1.0.0"; } ] null; release."1.0.0".sha256 = "sha256-kszARPBizWbxSQ/Iqpf2vLbxYc6AjpUCLnSNlPcNfls="; release."1.1.1".sha256 = "sha256-5wItMeeTRoJlRBH3zBNc2VUZn6pkDde60YAvXTx+J3U="; + release."1.2.2".sha256 = "sha256-EU9RJGV3BvnmsX+mGH+6+MDXiGHgDI7aP5sIYiMUXTs="; propagatedBuildInputs = [ mathcomp-algebra coq-elpi mathcomp-zify ]; diff --git a/pkgs/development/coq-modules/mathcomp-real-closed/default.nix b/pkgs/development/coq-modules/mathcomp-real-closed/default.nix index cbc6b8cc7115d..5746c9c6387d0 100644 --- a/pkgs/development/coq-modules/mathcomp-real-closed/default.nix +++ b/pkgs/development/coq-modules/mathcomp-real-closed/default.nix @@ -8,6 +8,7 @@ mkCoqDerivation { owner = "math-comp"; inherit version; release = { + "2.0.0".sha256 = "sha256-sZvfiC5+5Lg4nRhfKKqyFzovCj2foAhqaq/w9F2bdU8="; "1.1.4".sha256 = "sha256-8Hs6XfowbpeRD8RhMRf4ZJe2xf8kE0e8m7bPUzR/IM4="; "1.1.3".sha256 = "1vwmmnzy8i4f203i2s60dn9i0kr27lsmwlqlyyzdpsghvbr8h5b7"; "1.1.2".sha256 = "0907x4nf7nnvn764q3x9lx41g74rilvq5cki5ziwgpsdgb98pppn"; @@ -19,6 +20,7 @@ mkCoqDerivation { }; defaultVersion = with lib.versions; lib.switch [ coq.version mathcomp.version ] [ + { cases = [ (isGe "8.16") (isGe "2.0.0") ]; out = "2.0.0"; } { cases = [ (isGe "8.13") (isGe "1.13.0") ]; out = "1.1.4"; } { cases = [ (isGe "8.13") (isGe "1.12.0") ]; out = "1.1.3"; } { cases = [ (isGe "8.10") (isGe "1.12.0") ]; out = "1.1.2"; } diff --git a/pkgs/development/coq-modules/multinomials/default.nix b/pkgs/development/coq-modules/multinomials/default.nix index b11283e8c5873..bffc169a1e99c 100644 --- a/pkgs/development/coq-modules/multinomials/default.nix +++ b/pkgs/development/coq-modules/multinomials/default.nix @@ -8,8 +8,9 @@ owner = "math-comp"; inherit version; - defaultVersion = with lib.versions; lib.switch [ coq.version mathcomp.version ] [ - { cases = [ (isGe "8.16") (isGe "2.0.0") ]; out = "2.0.0"; } + defaultVersion = with lib.versions; lib.switch [ coq.version mathcomp.version ] [ + { cases = [ (isGe "8.16") (isGe "2.1.0") ]; out = "2.1.0"; } + { cases = [ (isGe "8.16") "2.0.0" ]; out = "2.0.0"; } { cases = [ (isGe "8.15") (range "1.15.0" "1.17.0") ]; out = "1.6.0"; } { cases = [ (isGe "8.10") (range "1.13.0" "1.17.0") ]; out = "1.5.6"; } { cases = [ (range "8.10" "8.16") (range "1.12.0" "1.15.0") ]; out = "1.5.5"; } @@ -20,6 +21,7 @@ { cases = [ "8.6" (range "1.6" "1.7") ]; out = "1.1"; } ] null; release = { + "2.1.0".sha256 = "sha256-QT91SBJ6DXhyg4j/okTvPP6yj2DnnPbnSlJ/p8pvZbY="; "2.0.0".sha256 = "sha256-2zWHzMBsO2j8EjN7CgCmKQcku9Be8aVlme0LD5p4ab8="; "1.6.0".sha256 = "sha256-lEM+sjqajIOm1c3lspHqcSIARgMR9RHbTQH4veHLJfU="; "1.5.6".sha256 = "sha256-cMixgc34T9Ic6v+tYmL49QUNpZpPV5ofaNuHqblX6oY="; diff --git a/pkgs/development/coq-modules/reglang/default.nix b/pkgs/development/coq-modules/reglang/default.nix index 2fc26cbfef8f9..fd5a37c677e26 100644 --- a/pkgs/development/coq-modules/reglang/default.nix +++ b/pkgs/development/coq-modules/reglang/default.nix @@ -1,20 +1,22 @@ -{ lib, mkCoqDerivation, coq, ssreflect, version ? null }: +{ lib, mkCoqDerivation, coq, mathcomp, version ? null }: mkCoqDerivation { pname = "reglang"; releaseRev = v: "v${v}"; + release."1.2.0".sha256 = "sha256-gSqQ7D2HLwM4oYopTWkMFYfYXxsH/7VxI3AyrLwNf3o="; release."1.1.3".sha256 = "sha256-kaselYm8K0JBsTlcI6K24m8qpv8CZ9+VNDJrOtFaExg="; release."1.1.2".sha256 = "sha256-SEnMilLNxh6a3oiDNGLaBr8quQ/nO2T9Fwdf/1il2Yk="; inherit version; - defaultVersion = with lib.versions; lib.switch coq.coq-version [ - { case = range "8.10" "8.18"; out = "1.1.3"; } + defaultVersion = with lib.versions; lib.switch [ coq.coq-version mathcomp.version ] [ + { cases = [ (range "8.16" "8.18") (isGe "2.0.0") ]; out = "1.2.0"; } + { cases = [ (range "8.10" "8.18") (isLt "2.0.0") ]; out = "1.1.3"; } ] null; - propagatedBuildInputs = [ ssreflect ]; + propagatedBuildInputs = [ mathcomp.ssreflect ]; meta = with lib; { description = "Regular Language Representations in Coq"; diff --git a/pkgs/development/interpreters/joker/default.nix b/pkgs/development/interpreters/joker/default.nix index 30b7aabbcdcd8..1bafd6cb728e8 100644 --- a/pkgs/development/interpreters/joker/default.nix +++ b/pkgs/development/interpreters/joker/default.nix @@ -2,16 +2,16 @@ buildGoModule rec { pname = "joker"; - version = "1.3.0"; + version = "1.3.1"; src = fetchFromGitHub { rev = "v${version}"; owner = "candid82"; repo = "joker"; - sha256 = "sha256-D9maTCNNJ9ivj76SEjddFSYNu+RLEZG+3SgOWEAD7aU="; + sha256 = "sha256-9SsSXLZFwqsAeWFGsba8OG9bdmfQjn6qQHHQK6IdHK8="; }; - vendorHash = "sha256-ioC7R5Pm2nmHXI+/ko1UoNJCvEFzvhZcAcVtaFECz2c="; + vendorHash = "sha256-VRQUbGJTC2v8w/l4iaNn3vPX3AdV9Likp2nuG0PQieU="; doCheck = false; diff --git a/pkgs/development/interpreters/zuo/default.nix b/pkgs/development/interpreters/zuo/default.nix index f0d71673c2fbb..95c05c3cf63cf 100644 --- a/pkgs/development/interpreters/zuo/default.nix +++ b/pkgs/development/interpreters/zuo/default.nix @@ -1,18 +1,20 @@ -{ lib, stdenv, fetchFromGitHub }: +{ lib, stdenv, fetchFromGitHub, unstableGitUpdater }: stdenv.mkDerivation rec { pname = "zuo"; - version = "unstable-2023-01-02"; + version = "unstable-2023-10-17"; src = fetchFromGitHub { owner = "racket"; repo = "zuo"; - rev = "464aae9ae90dcb43ab003b922e4ae4d08611c55b"; - hash = "sha256-O8p3dEXqAP2UNPNBla9AtkndxgL8UoVp/QygXOmcgWg="; + rev = "493e9cd08147add01bba9247f36759f095b87678"; + hash = "sha256-gsCjB3V+A0kMZJZ9onZ57R6b1Ha0K+Q383DQoVGfY7I="; }; doCheck = true; + passthru.updateScript = unstableGitUpdater { }; + meta = with lib; { description = "A Tiny Racket for Scripting"; homepage = "https://github.com/racket/zuo"; diff --git a/pkgs/development/libraries/clap/default.nix b/pkgs/development/libraries/clap/default.nix index 832ca66d6d78a..dd4d410bb874c 100644 --- a/pkgs/development/libraries/clap/default.nix +++ b/pkgs/development/libraries/clap/default.nix @@ -6,13 +6,13 @@ stdenv.mkDerivation rec { pname = "clap"; - version = "1.1.8"; + version = "1.1.9"; src = fetchFromGitHub { owner = "free-audio"; repo = "clap"; rev = version; - hash = "sha256-UY6HSth3xuXVfiKolttpYf19rZ2c/X1FXHV7TA/hAiM="; + hash = "sha256-z2P0U2NkDK1/5oDV35jn/pTXCcspuM1y2RgZyYVVO3w="; }; postPatch = '' diff --git a/pkgs/development/libraries/ctranslate2/default.nix b/pkgs/development/libraries/ctranslate2/default.nix index f9408818e37fe..04bbcf6e6b10b 100644 --- a/pkgs/development/libraries/ctranslate2/default.nix +++ b/pkgs/development/libraries/ctranslate2/default.nix @@ -5,6 +5,9 @@ , darwin # Accelerate , llvmPackages # openmp , withMkl ? false, mkl +, withCUDA ? false +, withCuDNN ? false +, cudaPackages # Enabling both withOneDNN and withOpenblas is broken # https://github.com/OpenNMT/CTranslate2/issues/1294 , withOneDNN ? false, oneDNN @@ -33,6 +36,8 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ cmake + ] ++ lib.optionals withCUDA [ + cudaPackages.cuda_nvcc ]; cmakeFlags = [ @@ -40,6 +45,8 @@ stdenv.mkDerivation rec { # https://github.com/OpenNMT/CTranslate2/blob/54810350e662ebdb01ecbf8e4a746f02aeff1dd7/python/tools/prepare_build_environment_linux.sh#L53 # https://github.com/OpenNMT/CTranslate2/blob/59d223abcc7e636c1c2956e62482bc3299cc7766/python/tools/prepare_build_environment_macos.sh#L12 "-DOPENMP_RUNTIME=COMP" + "-DWITH_CUDA=${cmakeBool withCUDA}" + "-DWITH_CUDNN=${cmakeBool withCuDNN}" "-DWITH_DNNL=${cmakeBool withOneDNN}" "-DWITH_OPENBLAS=${cmakeBool withOpenblas}" "-DWITH_RUY=${cmakeBool withRuy}" @@ -49,6 +56,12 @@ stdenv.mkDerivation rec { buildInputs = lib.optionals withMkl [ mkl + ] ++ lib.optionals withCUDA [ + cudaPackages.cuda_cudart + cudaPackages.libcublas + cudaPackages.libcurand + ] ++ lib.optionals withCuDNN [ + cudaPackages.cudnn ] ++ lib.optionals withOneDNN [ oneDNN ] ++ lib.optionals withOpenblas [ diff --git a/pkgs/development/libraries/enchant/2.x.nix b/pkgs/development/libraries/enchant/2.x.nix index 8d25e36ad7342..1b31cef96550f 100644 --- a/pkgs/development/libraries/enchant/2.x.nix +++ b/pkgs/development/libraries/enchant/2.x.nix @@ -13,13 +13,13 @@ stdenv.mkDerivation rec { pname = "enchant"; - version = "2.6.1"; + version = "2.6.2"; outputs = [ "out" "dev" ]; src = fetchurl { url = "https://github.com/AbiWord/${pname}/releases/download/v${version}/${pname}-${version}.tar.gz"; - hash = "sha256-8k4SRpE3rh0DFAu5AypHpZR8NvTR4vErkpBhAF6xUnk="; + hash = "sha256-ZoanKOVudg+N7gmiLw+1O0bunb59ZM+eW7NaZYv/fh0="; }; nativeBuildInputs = [ diff --git a/pkgs/development/libraries/java/jffi/default.nix b/pkgs/development/libraries/java/jffi/default.nix index 9bbd2135e0b2d..b4351f4e9df9f 100644 --- a/pkgs/development/libraries/java/jffi/default.nix +++ b/pkgs/development/libraries/java/jffi/default.nix @@ -2,13 +2,13 @@ stdenv.mkDerivation rec { pname = "jffi"; - version = "1.3.11"; + version = "1.3.12"; src = fetchFromGitHub { owner = "jnr"; repo = "jffi"; rev = "jffi-${version}"; - sha256 = "sha256-fZnZH2j/IXbfsJkJG8s2ArOrWwVE2kgvSREVaSVoDyo="; + sha256 = "sha256-U0pBoKewZEen7aH3rIvZ8dKKeXKE1+Z5WtfM0HK6/LQ="; }; nativeBuildInputs = [ jdk ant texinfo pkg-config ]; diff --git a/pkgs/development/libraries/libbap/default.nix b/pkgs/development/libraries/libbap/default.nix index 0b378c583ad16..ebbf02603cbb5 100644 --- a/pkgs/development/libraries/libbap/default.nix +++ b/pkgs/development/libraries/libbap/default.nix @@ -3,20 +3,15 @@ stdenv.mkDerivation { pname = "libbap"; - version = "master-2020-11-25"; + version = "master-2022-07-13"; src = fetchFromGitHub { owner = "BinaryAnalysisPlatform"; repo = "bap-bindings"; - rev = "3193cb31e1b1f2455406ea0c819dad9dfa2ba10d"; - sha256 = "0m4spva3z6fgbwlg4zq53l5p227dic893q2qq65pvzxyf7k7nmil"; + rev = "4d324dd794f8e022e8eddecbb2ae2e7b28173947"; + hash = "sha256-la47HR+i99ueDEWR91YIXGdKflpE1E0qmmJjeowmGSI="; }; - postPatch = '' - substituteInPlace Makefile.in \ - --replace "-linkpkg" "-thread -linkpkg" - ''; - nativeBuildInputs = [ autoreconfHook which ocaml findlib ]; buildInputs = [ bap ctypes ]; diff --git a/pkgs/development/libraries/libcxxrt/default.nix b/pkgs/development/libraries/libcxxrt/default.nix index e981945ccbd35..be8be13602afe 100644 --- a/pkgs/development/libraries/libcxxrt/default.nix +++ b/pkgs/development/libraries/libcxxrt/default.nix @@ -2,13 +2,13 @@ stdenv.mkDerivation { pname = "libcxxrt"; - version = "unstable-2022-08-08"; + version = "unstable-2023-10-11"; src = fetchFromGitHub { owner = "libcxxrt"; repo = "libcxxrt"; - rev = "a0f7f5c139a7daf71de0de201b6c405d852b1dc1"; - sha256 = "6ErOhlD6pOudbTkFTlI2hjBuYT3QuzEiL33/mLnw1aI="; + rev = "03c83f5a57be8c5b1a29a68de5638744f17d28ba"; + sha256 = "ldwE0j9P9h5urWIUCRdY6qrJqKe45hid+NrSNeKEixE="; }; nativeBuildInputs = [ cmake ]; diff --git a/pkgs/development/libraries/libhugetlbfs/default.nix b/pkgs/development/libraries/libhugetlbfs/default.nix index 2ad7539ef1fdc..ff83b1835b500 100644 --- a/pkgs/development/libraries/libhugetlbfs/default.nix +++ b/pkgs/development/libraries/libhugetlbfs/default.nix @@ -40,10 +40,13 @@ stdenv.mkDerivation rec { installTargets = [ "install" "install-docs" ]; meta = with lib; { - broken = (stdenv.isLinux && stdenv.isAarch64); description = "library and utilities for Linux hugepages"; maintainers = with maintainers; [ qyliss ]; license = licenses.lgpl21Plus; platforms = platforms.linux; + badPlatforms = flatten [ + systems.inspect.platformPatterns.isStatic + systems.inspect.patterns.isMusl + ]; }; } diff --git a/pkgs/development/libraries/miniaudio/default.nix b/pkgs/development/libraries/miniaudio/default.nix index f49a17a67f93a..2df349b83dcc6 100644 --- a/pkgs/development/libraries/miniaudio/default.nix +++ b/pkgs/development/libraries/miniaudio/default.nix @@ -4,13 +4,13 @@ }: stdenv.mkDerivation rec { pname = "miniaudio"; - version = "0.11.17"; + version = "0.11.18"; src = fetchFromGitHub { owner = "mackron"; repo = "miniaudio"; rev = version; - hash = "sha256-nPQ53+9CDEn91LZgF5RkVur+XckTDcS38FHomPXbtMI="; + hash = "sha256-y0o33hnKoZ8gWWFNFIOUJcXMWENaYzMLZzeTOoVETOY="; }; installPhase = '' diff --git a/pkgs/development/libraries/minizip-ng/default.nix b/pkgs/development/libraries/minizip-ng/default.nix index 33126eeb60d6d..2606edc760988 100644 --- a/pkgs/development/libraries/minizip-ng/default.nix +++ b/pkgs/development/libraries/minizip-ng/default.nix @@ -14,13 +14,13 @@ stdenv.mkDerivation (finalAttrs: { pname = "minizip-ng"; - version = "4.0.1"; + version = "4.0.2"; src = fetchFromGitHub { owner = "zlib-ng"; repo = finalAttrs.pname; rev = finalAttrs.version; - sha256 = "sha256-3bCGZupdJWcwp2d+XeqKZG3GxzXFm1UftV/PiN0u5iA="; + hash = "sha256-aJ6KYR9DazVQoPuc4w/gClKH9ditNE1JDU/F9dCJOsw="; }; nativeBuildInputs = [ cmake pkg-config ]; diff --git a/pkgs/development/libraries/mm-common/default.nix b/pkgs/development/libraries/mm-common/default.nix index 225ce967080d4..a8afd6e038f8e 100644 --- a/pkgs/development/libraries/mm-common/default.nix +++ b/pkgs/development/libraries/mm-common/default.nix @@ -1,5 +1,7 @@ -{ lib, stdenv +{ lib +, stdenv , fetchurl +, bash , gnome , meson , python3 @@ -15,12 +17,20 @@ stdenv.mkDerivation rec { sha256 = "cFxtKfQRaim95ONs/BsEbJK274xtrk6uyFAYdH5tpao="; }; + strictDeps = true; + nativeBuildInputs = [ meson python3 ninja ]; + # for shebangs + buildInputs = [ + python3 + bash + ]; + passthru = { updateScript = gnome.updateScript { packageName = pname; diff --git a/pkgs/development/libraries/physics/clhep/default.nix b/pkgs/development/libraries/physics/clhep/default.nix index b3ba508220f50..589233a195931 100644 --- a/pkgs/development/libraries/physics/clhep/default.nix +++ b/pkgs/development/libraries/physics/clhep/default.nix @@ -6,11 +6,11 @@ stdenv.mkDerivation rec { pname = "clhep"; - version = "2.4.6.4"; + version = "2.4.7.1"; src = fetchurl { url = "https://proj-clhep.web.cern.ch/proj-clhep/dist1/clhep-${version}.tgz"; - hash = "sha256-SciTMPGQPvcH08XXnBanxabyyQ/CkOIDTuODSAlInlc="; + hash = "sha256-HIMEp3cqxrmRlfEwA3jG4930rQfIXWSgRQVlKruKVfk="; }; prePatch = '' diff --git a/pkgs/development/libraries/science/math/bonmin/default.nix b/pkgs/development/libraries/science/math/bonmin/default.nix index 7f494b245c304..5a736f976957d 100644 --- a/pkgs/development/libraries/science/math/bonmin/default.nix +++ b/pkgs/development/libraries/science/math/bonmin/default.nix @@ -17,13 +17,13 @@ assert (!blas.isILP64) && (!lapack.isILP64); stdenv.mkDerivation rec { pname = "bonmin"; - version = "1.8.8"; + version = "1.8.9"; src = fetchFromGitHub { owner = "coin-or"; repo = "Bonmin"; rev = "releases/${version}"; - sha256 = "sha256-HU25WjvG01oL3U1wG6ivTcYaN51MMxgLdKZ3AkDNe2Y="; + sha256 = "sha256-nqjAQ1NdNJ/T4p8YljEWRt/uy2aDwyBeAsag0TmRc5Q="; }; nativeBuildInputs = [ diff --git a/pkgs/development/libraries/vapoursynth/default.nix b/pkgs/development/libraries/vapoursynth/default.nix index 652833a39367c..242294462ed6b 100644 --- a/pkgs/development/libraries/vapoursynth/default.nix +++ b/pkgs/development/libraries/vapoursynth/default.nix @@ -6,13 +6,13 @@ stdenv.mkDerivation rec { pname = "vapoursynth"; - version = "64"; + version = "65"; src = fetchFromGitHub { owner = "vapoursynth"; repo = "vapoursynth"; rev = "R${version}"; - sha256 = "sha256-EdIe0hWsx0W9+03O0Avk4DV2jKv8s4wGAKk0NxIAuTU="; + sha256 = "sha256-HrTXhRoKSFeLXYQM7W2FvYf7yCD1diSZGtPop9urrSk="; }; patches = [ diff --git a/pkgs/development/lua-modules/updater/default.nix b/pkgs/development/lua-modules/updater/default.nix new file mode 100644 index 0000000000000..40c93b21e8318 --- /dev/null +++ b/pkgs/development/lua-modules/updater/default.nix @@ -0,0 +1,49 @@ +{ buildPythonApplication +, nix +, makeWrapper +, python3Packages +, lib +# , nix-prefetch-git +, nix-prefetch-scripts +, luarocks-nix +}: +let + + path = lib.makeBinPath [ nix nix-prefetch-scripts luarocks-nix ]; +in +buildPythonApplication { + pname = "luarocks-packages-updater"; + version = "0.1"; + + format = "other"; + + nativeBuildInputs = [ + makeWrapper + python3Packages.wrapPython + ]; + propagatedBuildInputs = [ + python3Packages.gitpython + ]; + + dontUnpack = true; + + installPhase = + '' + mkdir -p $out/bin $out/lib + cp ${./updater.py} $out/bin/luarocks-packages-updater + cp ${../../../../maintainers/scripts/pluginupdate.py} $out/lib/pluginupdate.py + + # wrap python scripts + makeWrapperArgs+=( --prefix PATH : "${path}" --prefix PYTHONPATH : "$out/lib" ) + wrapPythonProgramsIn "$out" + ''; + + shellHook = '' + export PYTHONPATH="maintainers/scripts:$PYTHONPATH" + export PATH="${path}:$PATH" + ''; + + meta.mainProgram = "luarocks-packages-updater"; +} + + diff --git a/pkgs/development/lua-modules/updater/updater.py b/pkgs/development/lua-modules/updater/updater.py new file mode 100755 index 0000000000000..89a9bd9823a72 --- /dev/null +++ b/pkgs/development/lua-modules/updater/updater.py @@ -0,0 +1,217 @@ +#!/usr/bin/env python +# format: +# $ nix run nixpkgs#python3Packages.black -- update.py +# type-check: +# $ nix run nixpkgs#python3Packages.mypy -- update.py +# linted: +# $ nix run nixpkgs#python3Packages.flake8 -- --ignore E501,E265,E402 update.py + +import inspect +import os +import tempfile +import shutil +from dataclasses import dataclass +import subprocess +import csv +import logging +import textwrap +from multiprocessing.dummy import Pool + +from typing import List, Tuple, Optional +from pathlib import Path + +log = logging.getLogger() +log.addHandler(logging.StreamHandler()) + +ROOT = Path(os.path.dirname(os.path.abspath(inspect.getfile(inspect.currentframe())))).parent.parent # type: ignore +import pluginupdate +from pluginupdate import update_plugins, FetchConfig, CleanEnvironment + +PKG_LIST = "maintainers/scripts/luarocks-packages.csv" +TMP_FILE = "$(mktemp)" +GENERATED_NIXFILE = "pkgs/development/lua-modules/generated-packages.nix" + +HEADER = """/* {GENERATED_NIXFILE} is an auto-generated file -- DO NOT EDIT! +Regenerate it with: nix run nixpkgs#update-luarocks-packages +You can customize the generated packages in pkgs/development/lua-modules/overrides.nix +*/ +""".format( + GENERATED_NIXFILE=GENERATED_NIXFILE +) + +FOOTER = """ +} +/* GENERATED - do not edit this file */ +""" + + +@dataclass +class LuaPlugin: + name: str + """Name of the plugin, as seen on luarocks.org""" + src: str + """address to the git repository""" + ref: Optional[str] + """git reference (branch name/tag)""" + version: Optional[str] + """Set it to pin a package """ + server: Optional[str] + """luarocks.org registers packages under different manifests. + Its value can be 'http://luarocks.org/dev' + """ + luaversion: Optional[str] + """Attribue of the lua interpreter if a package is available only for a specific lua version""" + maintainers: Optional[str] + """ Optional string listing maintainers separated by spaces""" + + @property + def normalized_name(self) -> str: + return self.name.replace(".", "-") + + +# rename Editor to LangUpdate/ EcosystemUpdater +class LuaEditor(pluginupdate.Editor): + + def create_parser(self): + parser = super().create_parser() + parser.set_defaults(proc=1) + return parser + + def get_current_plugins(self): + return [] + + def load_plugin_spec(self, input_file) -> List[LuaPlugin]: + luaPackages = [] + csvfilename = input_file + log.info("Loading package descriptions from %s", csvfilename) + + with open(csvfilename, newline="") as csvfile: + reader = csv.DictReader( + csvfile, + ) + for row in reader: + # name,server,version,luaversion,maintainers + plugin = LuaPlugin(**row) + luaPackages.append(plugin) + return luaPackages + + def update(self, args): + update_plugins(self, args) + + def generate_nix(self, results: List[Tuple[LuaPlugin, str]], outfilename: str): + with tempfile.NamedTemporaryFile("w+") as f: + f.write(HEADER) + header2 = textwrap.dedent( + """ + { stdenv, lib, fetchurl, fetchgit, callPackage, ... } @ args: + final: prev: + { + """ + ) + f.write(header2) + for plugin, nix_expr in results: + f.write(f"{plugin.normalized_name} = {nix_expr}") + f.write(FOOTER) + f.flush() + + # if everything went fine, move the generated file to its destination + # using copy since move doesn't work across disks + shutil.copy(f.name, outfilename) + + print(f"updated {outfilename}") + + @property + def attr_path(self): + return "luaPackages" + + def get_update(self, input_file: str, outfile: str, config: FetchConfig): + _prefetch = generate_pkg_nix + + def update() -> dict: + plugin_specs = self.load_plugin_spec(input_file) + sorted_plugin_specs = sorted(plugin_specs, key=lambda v: v.name.lower()) + + try: + pool = Pool(processes=config.proc) + results = pool.map(_prefetch, sorted_plugin_specs) + finally: + pass + + self.generate_nix(results, outfile) + + redirects = {} + return redirects + + return update + + def rewrite_input(self, input_file: str, *args, **kwargs): + # vim plugin reads the file before update but that shouldn't be our case + # not implemented yet + # fieldnames = ['name', 'server', 'version', 'luaversion', 'maintainers'] + # input_file = "toto.csv" + # with open(input_file, newline='') as csvfile: + # writer = csv.DictWriter(csvfile, fieldnames=fieldnames) + # writer.writeheader() + # for row in reader: + # # name,server,version,luaversion,maintainers + # plugin = LuaPlugin(**row) + # luaPackages.append(plugin) + pass + + +def generate_pkg_nix(plug: LuaPlugin): + """ + Generate nix expression for a luarocks package + Our cache key associates "p.name-p.version" to its rockspec + """ + log.debug("Generating nix expression for %s", plug.name) + + cmd = ["luarocks", "nix"] + + if plug.maintainers: + cmd.append(f"--maintainers={plug.maintainers}") + + # if plug.server == "src": + if plug.src != "": + if plug.src is None: + msg = ( + "src must be set when 'version' is set to \"src\" for package %s" + % plug.name + ) + log.error(msg) + raise RuntimeError(msg) + log.debug("Updating from source %s", plug.src) + cmd.append(plug.src) + # update the plugin from luarocks + else: + cmd.append(plug.name) + if plug.version and plug.version != "src": + cmd.append(plug.version) + + if plug.server != "src" and plug.server: + cmd.append(f"--only-server={plug.server}") + + if plug.luaversion: + cmd.append(f"--lua-version={plug.luaversion}") + + log.debug("running %s", " ".join(cmd)) + + output = subprocess.check_output(cmd, text=True) + output = "callPackage(" + output.strip() + ") {};\n\n" + return (plug, output) + + +def main(): + editor = LuaEditor( + "lua", + ROOT, + "", + default_in=PKG_LIST, + default_out=GENERATED_NIXFILE, + ) + + editor.run() + + +if __name__ == "__main__": + main() diff --git a/pkgs/development/ocaml-modules/wayland/default.nix b/pkgs/development/ocaml-modules/wayland/default.nix index 9dea4a64a5082..6c60458f966dd 100644 --- a/pkgs/development/ocaml-modules/wayland/default.nix +++ b/pkgs/development/ocaml-modules/wayland/default.nix @@ -2,28 +2,28 @@ , buildDunePackage , fetchurl , xmlm -, lwt +, eio , logs , fmt , cstruct , cmdliner -, alcotest-lwt +, alcotest +, eio_main }: buildDunePackage rec { pname = "wayland"; - version = "1.1"; + version = "2.0"; - minimalOCamlVersion = "4.08"; - duneVersion = "3"; + minimalOCamlVersion = "5.0"; src = fetchurl { url = "https://github.com/talex5/ocaml-wayland/releases/download/v${version}/wayland-${version}.tbz"; - sha256 = "0b7czgh08i6xcx3fsz6vd19sfyngwi0i27jdzg8cnjgrgwnagv6d"; + hash = "sha256-iCG1zk1tA7gdGGt78c3sQi0NN9Fh3HsCP4cy7Y3pg0s="; }; propagatedBuildInputs = [ - lwt + eio logs fmt cstruct @@ -35,7 +35,8 @@ buildDunePackage rec { ]; checkInputs = [ - alcotest-lwt + alcotest + eio_main ]; doCheck = true; diff --git a/pkgs/development/python-modules/aemet-opendata/default.nix b/pkgs/development/python-modules/aemet-opendata/default.nix index 947f6d3d121f5..b238f184f0c11 100644 --- a/pkgs/development/python-modules/aemet-opendata/default.nix +++ b/pkgs/development/python-modules/aemet-opendata/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "aemet-opendata"; - version = "0.4.5"; + version = "0.4.6"; format = "pyproject"; disabled = pythonOlder "3.11"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "Noltari"; repo = "AEMET-OpenData"; rev = "refs/tags/${version}"; - hash = "sha256-rjHiDn8//zjFR27RTGGWZCxKI6pDXu47DFINV8Tq7ZM="; + hash = "sha256-eAHj37d0akxSz4rnf9f0tDknJQe//cMg0Korp1rtxfQ="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/aioesphomeapi/default.nix b/pkgs/development/python-modules/aioesphomeapi/default.nix index c6e7ce228e1b0..de5d1184b2b79 100644 --- a/pkgs/development/python-modules/aioesphomeapi/default.nix +++ b/pkgs/development/python-modules/aioesphomeapi/default.nix @@ -1,21 +1,29 @@ { lib , buildPythonPackage , fetchFromGitHub +, pythonOlder + +# build-system +, cython_3 +, setuptools + +# dependencies , async-timeout , chacha20poly1305-reuseable -, mock , noiseprotocol , protobuf +, zeroconf + +# tests +, mock , pytest-asyncio , pytestCheckHook -, pythonOlder -, zeroconf }: buildPythonPackage rec { pname = "aioesphomeapi"; version = "18.2.0"; - format = "setuptools"; + pyproject = true; disabled = pythonOlder "3.9"; @@ -26,28 +34,33 @@ buildPythonPackage rec { hash = "sha256-uOF9VSASzGA4pVW3puQtGrr2dy7sRESa1a6DPUsMmL4="; }; + nativeBuildInputs = [ + setuptools + cython_3 + ]; + propagatedBuildInputs = [ - async-timeout chacha20poly1305-reuseable noiseprotocol protobuf zeroconf + ] ++ lib.optionals (pythonOlder "3.11") [ + async-timeout ]; + pythonImportsCheck = [ + "aioesphomeapi" + ]; nativeCheckInputs = [ mock pytest-asyncio pytestCheckHook ]; - pythonImportsCheck = [ - "aioesphomeapi" - ]; - meta = with lib; { + changelog = "https://github.com/esphome/aioesphomeapi/releases/tag/v${version}"; description = "Python Client for ESPHome native API"; homepage = "https://github.com/esphome/aioesphomeapi"; - changelog = "https://github.com/esphome/aioesphomeapi/releases/tag/v${version}"; license = licenses.mit; maintainers = with maintainers; [ fab hexa ]; }; diff --git a/pkgs/development/python-modules/aiowithings/default.nix b/pkgs/development/python-modules/aiowithings/default.nix index 19d9997ed8d7c..acb6d6bf1e6cc 100644 --- a/pkgs/development/python-modules/aiowithings/default.nix +++ b/pkgs/development/python-modules/aiowithings/default.nix @@ -13,7 +13,7 @@ buildPythonPackage rec { pname = "aiowithings"; - version = "1.0.0"; + version = "1.0.2"; pyproject = true; disabled = pythonOlder "3.11"; @@ -22,7 +22,7 @@ buildPythonPackage rec { owner = "joostlek"; repo = "python-withings"; rev = "refs/tags/v${version}"; - hash = "sha256-3necwO/EpjWD1fAItqsZJKgv0CIBklxcM1jNRPxhSVY="; + hash = "sha256-6yfhAMQIwhjKXlnN58bL9It8q6CXH9RxKBkB8BfSY1o="; }; postPatch = '' diff --git a/pkgs/development/python-modules/androidtv/default.nix b/pkgs/development/python-modules/androidtv/default.nix index 8ea691eb485ca..0516388b3f89f 100644 --- a/pkgs/development/python-modules/androidtv/default.nix +++ b/pkgs/development/python-modules/androidtv/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "androidtv"; - version = "0.0.72"; + version = "0.0.73"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "JeffLIrion"; repo = "python-androidtv"; rev = "v${version}"; - hash = "sha256-oDC5NWmdo6Ijxz2ER9CjtCZxWkancUNyxVe2ofH4c+Q="; + hash = "sha256-FJUTJfS9jiC7KDf6XcGVRNXf75bVUOBPZe8y9M39Uak="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/asciimatics/default.nix b/pkgs/development/python-modules/asciimatics/default.nix index 5d138ae856670..c990c9477bbf8 100644 --- a/pkgs/development/python-modules/asciimatics/default.nix +++ b/pkgs/development/python-modules/asciimatics/default.nix @@ -12,11 +12,11 @@ buildPythonPackage rec { pname = "asciimatics"; - version = "1.14.0"; + version = "1.15.0"; src = fetchPypi { inherit pname version; - hash = "sha256-FtIM5CIQtDTrBbpGns24KTrH7TwM4N1PcOMNctdgIic="; + hash = "sha256-z905gEJydRnYtz5iuO+CwL7P7U60IImcO5bJjQuWgho="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/azure-mgmt-containerregistry/default.nix b/pkgs/development/python-modules/azure-mgmt-containerregistry/default.nix index f75b262df3a09..bc20dcdfb6020 100644 --- a/pkgs/development/python-modules/azure-mgmt-containerregistry/default.nix +++ b/pkgs/development/python-modules/azure-mgmt-containerregistry/default.nix @@ -4,29 +4,25 @@ , pythonOlder , azure-common , azure-mgmt-core -, msrest -, typing-extensions +, isodate }: buildPythonPackage rec { pname = "azure-mgmt-containerregistry"; - version = "10.1.0"; + version = "10.2.0"; format = "setuptools"; - disabled = pythonOlder "3.7"; + disabled = pythonOlder "3.8"; src = fetchPypi { inherit pname version; - hash = "sha256-VrX9YfYNvlA8+eNqHCp35BAeQZzQKakZs7ZZKwT8oYc="; - extension = "zip"; + hash = "sha256-i7i/5ofGxiF9/wTAPnUOaZ6FAgK3EaBqoHeSC8HuXCo="; }; propagatedBuildInputs = [ azure-common azure-mgmt-core - msrest - ] ++ lib.optionals (pythonOlder "3.8") [ - typing-extensions + isodate ]; # no tests included @@ -40,6 +36,7 @@ buildPythonPackage rec { meta = with lib; { description = "Microsoft Azure Container Registry Client Library for Python"; homepage = "https://github.com/Azure/azure-sdk-for-python"; + changelog = "https://github.com/Azure/azure-sdk-for-python/blob/azure-mgmt-containerregistry_${version}/sdk/containerregistry/azure-mgmt-containerregistry/CHANGELOG.md"; license = licenses.mit; maintainers = with maintainers; [ jonringer ]; }; diff --git a/pkgs/development/python-modules/azure-mgmt-netapp/default.nix b/pkgs/development/python-modules/azure-mgmt-netapp/default.nix index 46061f5a00285..8b5ae2435d0db 100644 --- a/pkgs/development/python-modules/azure-mgmt-netapp/default.nix +++ b/pkgs/development/python-modules/azure-mgmt-netapp/default.nix @@ -4,28 +4,25 @@ , pythonOlder , azure-common , azure-mgmt-core -, msrest -, msrestazure +, isodate }: buildPythonPackage rec { pname = "azure-mgmt-netapp"; - version = "10.1.0"; + version = "11.0.0"; format = "setuptools"; - disabled = pythonOlder "3.7"; + disabled = pythonOlder "3.8"; src = fetchPypi { inherit pname version; - hash = "sha256-eJiWTOCk2C79Jotku9bKlu3vU6H8004hWrX+h76MjQM="; - extension = "zip"; + hash = "sha256-00cDFHpaEciRQLHM+Kt3uOtw/geOn5+onrY7lav6EeU="; }; propagatedBuildInputs = [ azure-common azure-mgmt-core - msrest - msrestazure + isodate ]; # no tests included @@ -39,6 +36,7 @@ buildPythonPackage rec { meta = with lib; { description = "Microsoft Azure NetApp Files Management Client Library for Python"; homepage = "https://github.com/Azure/azure-sdk-for-python"; + changelog = "https://github.com/Azure/azure-sdk-for-python/blob/azure-mgmt-netapp_${version}/sdk/netapp/azure-mgmt-netapp/CHANGELOG.md"; license = licenses.mit; maintainers = with maintainers; [ jonringer ]; }; diff --git a/pkgs/development/python-modules/complycube/default.nix b/pkgs/development/python-modules/complycube/default.nix new file mode 100644 index 0000000000000..ee99ae8d28bd3 --- /dev/null +++ b/pkgs/development/python-modules/complycube/default.nix @@ -0,0 +1,39 @@ +{ lib +, buildPythonPackage +, fetchPypi +, pyhumps +, requests +, setuptools +}: + +buildPythonPackage rec { + pname = "complycube"; + version = "1.1.6"; + pyproject = true; + + src = fetchPypi rec { + inherit version; + pname = "complycube"; + hash = "sha256-hetcn5RX582CRVmtG5dAvr+NXD+7NKJjaqgOo8LlpqM="; + }; + + nativeBuildInputs = [ + setuptools + ]; + + propagatedBuildInputs = [ + pyhumps + requests + ]; + + pythonImportsCheck = [ + "complycube" + ]; + + meta = { + homepage = "https://complycube.com"; + description = "Official Python client for the ComplyCube API"; + license = lib.licenses.mit; + maintainers = with lib.maintainers; [ derdennisop ]; + }; +} diff --git a/pkgs/development/python-modules/cryptoparser/default.nix b/pkgs/development/python-modules/cryptoparser/default.nix index 1eab372381bc0..d0a9c3d7eb9f8 100644 --- a/pkgs/development/python-modules/cryptoparser/default.nix +++ b/pkgs/development/python-modules/cryptoparser/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "cryptoparser"; - version = "0.10.0"; + version = "0.10.3"; format = "pyproject"; src = fetchPypi { pname = "CryptoParser"; inherit version; - hash = "sha256-43V82/nxtOa9y4fVOMsxhoSQpDxTyOcHIGsbRr0euAk="; + hash = "sha256-FvSs0LeyuobkJhJd5vlR+Bm4LqGxPvPTogsYKtHOpVw="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/cwcwidth/default.nix b/pkgs/development/python-modules/cwcwidth/default.nix index 1959794fcc693..85d20fc6f464b 100644 --- a/pkgs/development/python-modules/cwcwidth/default.nix +++ b/pkgs/development/python-modules/cwcwidth/default.nix @@ -2,12 +2,12 @@ buildPythonPackage rec { pname = "cwcwidth"; - version = "0.1.8"; + version = "0.1.9"; format = "pyproject"; src = fetchPypi { inherit pname version; - hash = "sha256-WtwDS3yQ5qhYa9BGvL9gBONeFrDX4x3jlVE6UNcpu/Y="; + hash = "sha256-8Z0RoBSNSoys0GTJbpO8qM40FaGGroIEA49F4Qjbdrg="; }; nativeBuildInputs = [ cython setuptools ]; diff --git a/pkgs/development/python-modules/dns-lexicon/default.nix b/pkgs/development/python-modules/dns-lexicon/default.nix index e8763988fdb95..6cc982c5df532 100644 --- a/pkgs/development/python-modules/dns-lexicon/default.nix +++ b/pkgs/development/python-modules/dns-lexicon/default.nix @@ -22,7 +22,7 @@ buildPythonPackage rec { pname = "dns_lexicon"; - version = "3.16.0"; + version = "3.16.1"; pyproject = true; disabled = pythonOlder "3.8"; @@ -31,7 +31,7 @@ buildPythonPackage rec { owner = "Analogj"; repo = "lexicon"; rev = "refs/tags/v${version}"; - hash = "sha256-GUYsTZPvsqGemViSqgEvYhyjTEut42akMq2ZK2P1fX0="; + hash = "sha256-79/zz0TOCpx26TEo6gi9JDBQeVW2azWnxAjWr/FGRLA="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/dvc-data/default.nix b/pkgs/development/python-modules/dvc-data/default.nix index 81d4719db1df8..4645293981bb3 100644 --- a/pkgs/development/python-modules/dvc-data/default.nix +++ b/pkgs/development/python-modules/dvc-data/default.nix @@ -14,7 +14,7 @@ buildPythonPackage rec { pname = "dvc-data"; - version = "2.18.2"; + version = "2.19.0"; format = "pyproject"; disabled = pythonOlder "3.8"; @@ -23,7 +23,7 @@ buildPythonPackage rec { owner = "iterative"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-gfb4FtuaOEtzOwNcBPa/KM6dMI8ckf91ch1TZOxFHck="; + hash = "sha256-8VjKuYI4/IyQSMM/He5dQv5edoWChfB5+LLkLsjVSm0="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/dvclive/default.nix b/pkgs/development/python-modules/dvclive/default.nix index a07eb1c2d07cd..d0c3e46dcc669 100644 --- a/pkgs/development/python-modules/dvclive/default.nix +++ b/pkgs/development/python-modules/dvclive/default.nix @@ -14,7 +14,7 @@ buildPythonPackage rec { pname = "dvclive"; - version = "3.0.1"; + version = "3.1.0"; format = "pyproject"; disabled = pythonOlder "3.8"; @@ -23,7 +23,7 @@ buildPythonPackage rec { owner = "iterative"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-jcgNNraMgsqTPNCbBcqEewe3jAXer4wn0aKqiUos+k8="; + hash = "sha256-qPGtYMpUFGQfSYEPabn4eC74lmr8xvet07RR5brV5No="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/enhancements/default.nix b/pkgs/development/python-modules/enhancements/default.nix deleted file mode 100644 index c9042e3d085ee..0000000000000 --- a/pkgs/development/python-modules/enhancements/default.nix +++ /dev/null @@ -1,43 +0,0 @@ -{ lib -, argcomplete -, buildPythonPackage -, fetchFromGitHub -, pytestCheckHook -, pythonOlder -, typeguard -}: - -buildPythonPackage rec { - pname = "enhancements"; - version = "0.4.0"; - format = "setuptools"; - - disabled = pythonOlder "3.7"; - - src = fetchFromGitHub { - owner = "ssh-mitm"; - repo = "python-enhancements"; - rev = version; - hash = "sha256-Nff44WAQwSbkRpUHb9ANsQWWH2B819gtwQdXAjWJJls="; - }; - - propagatedBuildInputs = [ - argcomplete - typeguard - ]; - - nativeCheckInputs = [ - pytestCheckHook - ]; - - pythonImportsCheck = [ - "enhancements" - ]; - - meta = with lib; { - description = "Library which extends various Python classes"; - homepage = "https://enhancements.readthedocs.io"; - license = licenses.lgpl3Only; - maintainers = with maintainers; [ fab ]; - }; -} diff --git a/pkgs/development/python-modules/flask-security-too/default.nix b/pkgs/development/python-modules/flask-security-too/default.nix index 529a1a63913aa..81abf369a8a41 100644 --- a/pkgs/development/python-modules/flask-security-too/default.nix +++ b/pkgs/development/python-modules/flask-security-too/default.nix @@ -2,6 +2,7 @@ , buildPythonPackage , fetchPypi , pythonOlder +, setuptools # extras: babel , babel @@ -11,7 +12,6 @@ , bcrypt , bleach , flask-mailman -, qrcode # extras: fsqla , flask-sqlalchemy @@ -21,20 +21,21 @@ # extras: mfa , cryptography , phonenumbers +, webauthn +, qrcode # propagates -, blinker , email-validator , flask , flask-login , flask-principal , flask-wtf -, itsdangerous , passlib +, importlib-resources +, wtforms # tests , argon2-cffi -, flask-mongoengine , mongoengine , mongomock , peewee @@ -46,31 +47,30 @@ buildPythonPackage rec { pname = "flask-security-too"; - version = "5.3.0"; - format = "setuptools"; + version = "5.3.2"; + pyproject = true; disabled = pythonOlder "3.7"; src = fetchPypi { pname = "Flask-Security-Too"; inherit version; - hash = "sha256-n12DCRPqxm8YhFeVrl99BEvdDYNq6rzP662rain3k1Q="; + hash = "sha256-wLUHXfDWSp7zWwTIjTH79AWlkkNzb21tChpLSEWr8+U="; }; - postPatch = '' - # This should be removed after updating to version 5.3.0. - sed -i '/filterwarnings =/a ignore:pkg_resources is deprecated:DeprecationWarning' pytest.ini - ''; + nativeBuildInputs = [ + setuptools + ]; propagatedBuildInputs = [ - blinker email-validator flask flask-login flask-principal flask-wtf - itsdangerous passlib + importlib-resources + wtforms ]; passthru.optional-dependencies = { @@ -82,7 +82,6 @@ buildPythonPackage rec { bcrypt bleach flask-mailman - qrcode ]; fsqla = [ flask-sqlalchemy @@ -92,12 +91,13 @@ buildPythonPackage rec { mfa = [ cryptography phonenumbers + webauthn + qrcode ]; }; nativeCheckInputs = [ argon2-cffi - flask-mongoengine mongoengine mongomock peewee @@ -112,6 +112,11 @@ buildPythonPackage rec { ++ passthru.optional-dependencies.mfa; + disabledTests = [ + # needs /etc/resolv.conf + "test_login_email_whatever" + ]; + pythonImportsCheck = [ "flask_security" ]; diff --git a/pkgs/development/python-modules/garminconnect/default.nix b/pkgs/development/python-modules/garminconnect/default.nix index aff899a188786..423cfd34a70f8 100644 --- a/pkgs/development/python-modules/garminconnect/default.nix +++ b/pkgs/development/python-modules/garminconnect/default.nix @@ -1,25 +1,25 @@ { lib , buildPythonPackage -, cloudscraper , fetchFromGitHub , garth , pdm-backend , pythonOlder , requests +, withings-sync }: buildPythonPackage rec { pname = "garminconnect"; - version = "0.2.8"; + version = "0.2.9"; format = "pyproject"; - disabled = pythonOlder "3.7"; + disabled = pythonOlder "3.10"; src = fetchFromGitHub { owner = "cyberjunky"; repo = "python-garminconnect"; rev = "refs/tags/${version}"; - hash = "sha256-jNDFSA6Mz0+7UhEVrCKcKDEX3B7yk6igBf59A6YlW2M="; + hash = "sha256-wQWOksI0nfzIMdxgZehMmNytuXWD22GLUNoI7Ki0C3s="; }; nativeBuildInputs = [ @@ -27,9 +27,9 @@ buildPythonPackage rec { ]; propagatedBuildInputs = [ - cloudscraper garth requests + withings-sync ]; # Tests require a token diff --git a/pkgs/development/python-modules/geniushub-client/default.nix b/pkgs/development/python-modules/geniushub-client/default.nix index 7ba15e9234752..54b36c7de608f 100644 --- a/pkgs/development/python-modules/geniushub-client/default.nix +++ b/pkgs/development/python-modules/geniushub-client/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { pname = "geniushub-client"; - version = "0.7.0"; + version = "0.7.1"; format = "setuptools"; disabled = pythonOlder "3.9"; @@ -17,7 +17,7 @@ buildPythonPackage rec { owner = "manzanotti"; repo = pname; rev = "refs/tags/v${version}"; - hash = "sha256-amsMZjCsPI8CUfSct4uumn8nVZDESlQFh19LXu3yb7o="; + hash = "sha256-Gq2scYos7E8me1a4x7NanHRq2eYWuU2uSUwM+O1TPb8="; }; postPatch = '' diff --git a/pkgs/development/python-modules/google-cloud-firestore/default.nix b/pkgs/development/python-modules/google-cloud-firestore/default.nix index 0869a6e7f221c..fee868f6f0cee 100644 --- a/pkgs/development/python-modules/google-cloud-firestore/default.nix +++ b/pkgs/development/python-modules/google-cloud-firestore/default.nix @@ -15,14 +15,14 @@ buildPythonPackage rec { pname = "google-cloud-firestore"; - version = "2.12.0"; + version = "2.13.0"; format = "setuptools"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-Pu3JsiONj9tsJkXaRV3nuo3wqaHSU4FZMqw6mMXuyc0="; + hash = "sha256-QKI6rrgJeC93AGL8JTWZMqbj4P/2WPs+LP0VunrQnlk="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/google-cloud-vision/default.nix b/pkgs/development/python-modules/google-cloud-vision/default.nix index 91d97e68b096b..95c2ed0662cae 100644 --- a/pkgs/development/python-modules/google-cloud-vision/default.nix +++ b/pkgs/development/python-modules/google-cloud-vision/default.nix @@ -12,14 +12,14 @@ buildPythonPackage rec { pname = "google-cloud-vision"; - version = "3.4.4"; + version = "3.4.5"; format = "setuptools"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-QFdErlCFIDTMR7MqmxuuUNP7Cc0eIWABQYKJHvV2ZpU="; + hash = "sha256-DfgkGrJ3GZuRnKODen3oUFk2P+oOPWYAYIcL587/wEc="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/griffe/default.nix b/pkgs/development/python-modules/griffe/default.nix index 91b83b0f4eaaa..314a2249cdbd1 100644 --- a/pkgs/development/python-modules/griffe/default.nix +++ b/pkgs/development/python-modules/griffe/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "griffe"; - version = "0.36.8"; + version = "0.36.9"; format = "pyproject"; disabled = pythonOlder "3.8"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "mkdocstrings"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-2lpmEfHUsnqoEXXyVZqly5ADxaqk+n5GsFTemAuwokU="; + hash = "sha256-5j6boIy2LnB3Y0ZzheTdflON8KaQkeQS5vkaPIsETGk="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/hahomematic/default.nix b/pkgs/development/python-modules/hahomematic/default.nix index 97a7a55b26a4f..77d57a0a500bc 100644 --- a/pkgs/development/python-modules/hahomematic/default.nix +++ b/pkgs/development/python-modules/hahomematic/default.nix @@ -18,7 +18,7 @@ buildPythonPackage rec { pname = "hahomematic"; - version = "2023.10.12"; + version = "2023.10.13"; format = "pyproject"; disabled = pythonOlder "3.11"; @@ -27,7 +27,7 @@ buildPythonPackage rec { owner = "danielperna84"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-mlZlaUcpVflz1mTiI0rIAOnJD5+NqXjsb1xp+wvoQvs="; + hash = "sha256-7zJhdFgEP/QSX78XMt+dxt0x7gUj011LHGi/+grPux0="; }; postPatch = '' diff --git a/pkgs/development/python-modules/hap-python/default.nix b/pkgs/development/python-modules/hap-python/default.nix index cb7e154887e04..0bb7f35e288f9 100644 --- a/pkgs/development/python-modules/hap-python/default.nix +++ b/pkgs/development/python-modules/hap-python/default.nix @@ -17,7 +17,7 @@ buildPythonPackage rec { pname = "hap-python"; - version = "4.9.0"; + version = "4.9.1"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -26,7 +26,7 @@ buildPythonPackage rec { owner = "ikalchev"; repo = "HAP-python"; rev = "refs/tags/${version}"; - hash = "sha256-bFSqMAZWE3xTfnc7FSQMfAhxhKlYm65VFpm+q3yrqpE="; + hash = "sha256-nnh8PSEcuPN1qGuInJ7uYe83zdne8axbTrHd4g1xoJs="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/heatzypy/default.nix b/pkgs/development/python-modules/heatzypy/default.nix index 7cb1daa10cf2e..ed9ea595a1af2 100644 --- a/pkgs/development/python-modules/heatzypy/default.nix +++ b/pkgs/development/python-modules/heatzypy/default.nix @@ -5,28 +5,34 @@ , requests , pytestCheckHook , pythonOlder +, setuptools +, wheel }: buildPythonPackage rec { pname = "heatzypy"; - version = "2.1.5"; - format = "setuptools"; + version = "2.1.7"; + pyproject = true; - disabled = pythonOlder "3.8"; + disabled = pythonOlder "3.11"; src = fetchFromGitHub { owner = "Cyr-ius"; - repo = pname; + repo = "heatzypy"; rev = "refs/tags/${version}"; - hash = "sha256-Z60apquRzhkPbxgGKgDswtW9GUXGt9MbdAsh3Yh31b0="; + hash = "sha256-bMhxxVZs6fTKlUWtSO0jfzYCHa1WPf2faEjfrmfUg8E="; }; postPatch = '' - # https://github.com/Cyr-ius/heatzypy/issues/7 - substituteInPlace setup.py \ - --replace 'version="replace_by_workflow"' 'version="${version}"' + substituteInPlace pyproject.toml \ + --replace "replace_by_workflow" "${version}" ''; + nativeBuildInputs = [ + setuptools + wheel + ]; + propagatedBuildInputs = [ aiohttp requests @@ -40,8 +46,9 @@ buildPythonPackage rec { ]; meta = with lib; { - description = "Python module to interact with Heatzy devices"; + description = "Module to interact with Heatzy devices"; homepage = "https://github.com/Cyr-ius/heatzypy"; + changelog = "https://github.com/cyr-ius/heatzypy/releases/tag/${version}"; license = licenses.gpl3Plus; maintainers = with maintainers; [ fab ]; }; diff --git a/pkgs/development/python-modules/home-assistant-chip-clusters/default.nix b/pkgs/development/python-modules/home-assistant-chip-clusters/default.nix index d91b01f52cc90..b7f08d38d6bfc 100644 --- a/pkgs/development/python-modules/home-assistant-chip-clusters/default.nix +++ b/pkgs/development/python-modules/home-assistant-chip-clusters/default.nix @@ -7,7 +7,7 @@ buildPythonPackage rec { pname = "home-assistant-chip-clusters"; - version = "2023.6.0"; + version = "2023.10.1"; format = "wheel"; src = fetchPypi { @@ -15,7 +15,7 @@ buildPythonPackage rec { pname = "home_assistant_chip_clusters"; dist = "py3"; python = "py3"; - hash = "sha256-8LYB3BEDHOj6ItfFRK7ewbhjN604xXKY0YlymNjEO+g="; + hash = "sha256-KI5idrD8SIpzSYopELYWJJaaiAFQzwRwhFBfb4BEw2o="; }; propagatedBuildInputs = [ @@ -25,6 +25,8 @@ buildPythonPackage rec { pythonImportsCheck = [ "chip.clusters" + "chip.clusters.ClusterObjects" + "chip.tlv" ]; doCheck = false; # no tests diff --git a/pkgs/development/python-modules/home-assistant-chip-core/default.nix b/pkgs/development/python-modules/home-assistant-chip-core/default.nix index ea6dc79d51d99..939457aa9d7b1 100644 --- a/pkgs/development/python-modules/home-assistant-chip-core/default.nix +++ b/pkgs/development/python-modules/home-assistant-chip-core/default.nix @@ -28,7 +28,7 @@ buildPythonPackage rec { pname = "home-assistant-chip-core"; - version = "2023.6.0"; + version = "2023.10.1"; format = "wheel"; disabled = pythonOlder "3.7"; @@ -37,11 +37,11 @@ buildPythonPackage rec { system = { "aarch64-linux" = { name = "aarch64"; - hash = "sha256-fR+ea25SqOMksBJXgSjuVvv2xSBoadZmPWP0IwxpiMA="; + hash = "sha256-wmavXr7WL9q7u8lnOaEWbRs3rlagBd9ovhxzRbjnrwY="; }; "x86_64-linux" = { name = "x86_64"; - hash = "sha256-bRP82jTVSJS46WuO8MVWFvte+2mCOSsGFDBaXdmdPHI="; + hash = "sha256-mffjJtn0LmRz9DOWMMw9soYDDm/M1C5Tdj6YbWHaq2o="; }; }.${stdenv.system} or (throw "Unsupported system"); in fetchPypi { @@ -78,12 +78,17 @@ buildPythonPackage rec { pygobject3 ]; + pythonNamespaces = [ + "chip" + "chip.clusters" + ]; + pythonImportsCheck = [ "chip" "chip.ble" - # https://github.com/project-chip/connectedhomeip/pull/24376 - #"chip.configuration" + "chip.configuration" "chip.discovery" + "chip.exceptions" "chip.native" "chip.storage" ]; diff --git a/pkgs/development/python-modules/identify/default.nix b/pkgs/development/python-modules/identify/default.nix index 891d03cfc04c7..d53408aa1aca2 100644 --- a/pkgs/development/python-modules/identify/default.nix +++ b/pkgs/development/python-modules/identify/default.nix @@ -9,7 +9,7 @@ buildPythonPackage rec { pname = "identify"; - version = "2.5.30"; + version = "2.5.31"; format = "setuptools"; disabled = pythonOlder "3.8"; @@ -18,7 +18,7 @@ buildPythonPackage rec { owner = "pre-commit"; repo = pname; rev = "refs/tags/v${version}"; - hash = "sha256-e3+yjd3jrcv4hU+0vCTl+bAzlYcfTdhLHr93briFxdI="; + hash = "sha256-rov80COnU8e6NXwHkafGGbJyhDTMLUSwxkmjmlw8QYU="; }; nativeCheckInputs = [ diff --git a/pkgs/development/python-modules/jaxlib/default.nix b/pkgs/development/python-modules/jaxlib/default.nix index d02cb0aa5dee2..82ef5a953d8f4 100644 --- a/pkgs/development/python-modules/jaxlib/default.nix +++ b/pkgs/development/python-modules/jaxlib/default.nix @@ -264,10 +264,10 @@ let ]; sha256 = (if cudaSupport then { - x86_64-linux = "sha256-Z5cSgdRxdKxidaz4b1RlUF4rVcQiUTmQ1OorlBWlpt0="; + x86_64-linux = "sha256-Hw4uFvltH7nlNN3qAEcQ+IR2FAOjRkvwyWA3rCPi7Vo="; } else { - x86_64-linux = "sha256-sn7p8FFHWIVdBWnsLsVj5jLiSaTlRm7s/qj2RqvQ3jU="; - aarch64-linux = "sha256-oAYF5AeuPHTlwtpDMs2+tAhRAJH0yeSVnB7Ni7wmzS8="; + x86_64-linux = "sha256-LEugnFwTV3EyeTZWgMvXzHbgeDPdmuT3daXCXJRMYVY="; + aarch64-linux = "sha256-0AYF5AeuPHTlwtpDMs2+tAhRAJH0yeSVnB7Ni7wmzS8="; }).${stdenv.system} or (throw "jaxlib: unsupported system: ${stdenv.system}"); }; diff --git a/pkgs/development/python-modules/langchain/default.nix b/pkgs/development/python-modules/langchain/default.nix index a2d00f4ba836e..e14f008d0cb79 100644 --- a/pkgs/development/python-modules/langchain/default.nix +++ b/pkgs/development/python-modules/langchain/default.nix @@ -11,16 +11,13 @@ , dataclasses-json , jsonpatch , langsmith -, numexpr , numpy -, openapi-schema-pydantic , pydantic , pyyaml , requests , sqlalchemy , tenacity # optional dependencies -, anthropic , atlassian-python-api , azure-core , azure-cosmos @@ -56,6 +53,7 @@ , pgvector , pinecone-client , psycopg2 +, pymongo , pyowm , pypdf , pytesseract @@ -65,11 +63,10 @@ , redis , requests-toolbelt , sentence-transformers -, spacy -, steamship , tiktoken , torch , transformers +, typer , weaviate-client , wikipedia # test dependencies @@ -88,8 +85,8 @@ buildPythonPackage rec { pname = "langchain"; - version = "0.0.320"; - format = "pyproject"; + version = "0.0.325"; + pyproject = true; disabled = pythonOlder "3.8"; @@ -97,7 +94,7 @@ buildPythonPackage rec { owner = "hwchase17"; repo = "langchain"; rev = "refs/tags/v${version}"; - hash = "sha256-Yw3gGt/OvrQ4IYauFUt6pBWOecy+PaWiGXoo5dWev5M="; + hash = "sha256-/bk4RafDDL4nozyFOiikyU4auBSftej21m5/FnEtDog="; }; sourceRoot = "${src.name}/libs/langchain"; @@ -117,11 +114,9 @@ buildPythonPackage rec { requests pyyaml numpy - openapi-schema-pydantic dataclasses-json tenacity aiohttp - numexpr langsmith anyio jsonpatch @@ -131,18 +126,15 @@ buildPythonPackage rec { passthru.optional-dependencies = { llms = [ - anthropic clarifai cohere openai - # openllm # openlm nlpcloud huggingface-hub manifest-ml torch transformers - # xinference ]; qdrant = [ qdrant-client @@ -180,13 +172,11 @@ buildPythonPackage rec { # azure-search-documents ]; all = [ - anthropic clarifai cohere openai nlpcloud huggingface-hub - # jina manifest-ml elasticsearch opensearch-py @@ -194,7 +184,6 @@ buildPythonPackage rec { faiss sentence-transformers transformers - spacy nltk wikipedia beautifulsoup4 @@ -203,6 +192,8 @@ buildPythonPackage rec { jinja2 pinecone-client # pinecone-text + # marqo + pymongo weaviate-client redis google-api-python-client @@ -236,7 +227,6 @@ buildPythonPackage rec { # O365 jq # docarray - steamship pdfminer-six lxml requests-toolbelt @@ -250,14 +240,15 @@ buildPythonPackage rec { # tigrisdb # nebula3-python # awadb - # esprima - # octoai-sdk + esprima rdflib # amadeus - # xinference librosa python-arango ]; + cli = [ + typer + ]; }; nativeCheckInputs = [ diff --git a/pkgs/development/python-modules/langsmith/default.nix b/pkgs/development/python-modules/langsmith/default.nix index 5d85b5d695016..bf3230c910bdc 100644 --- a/pkgs/development/python-modules/langsmith/default.nix +++ b/pkgs/development/python-modules/langsmith/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "langsmith"; - version = "0.0.49"; + version = "0.0.53"; format = "pyproject"; disabled = pythonOlder "3.8"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "langchain-ai"; repo = "langsmith-sdk"; rev = "refs/tags/v${version}"; - hash = "sha256-vOa9FNzeJB8QgJ6FW+4vxNfDnBbrKtByIwW3sGP8/ho="; + hash = "sha256-5w6bCNYoZAIrFkruw7E3Tw0G0no05x/g2hHESC3T2lw="; }; sourceRoot = "${src.name}/python"; @@ -44,6 +44,11 @@ buildPythonPackage rec { disabledTests = [ # These tests require network access "integration_tests" + # due to circular import + "test_as_runnable" + "test_as_runnable_batch" + "test_as_runnable_async" + "test_as_runnable_async_batch" ]; disabledTestPaths = [ diff --git a/pkgs/development/python-modules/libusb1/default.nix b/pkgs/development/python-modules/libusb1/default.nix index 80ad5590d995b..bdafac9426363 100644 --- a/pkgs/development/python-modules/libusb1/default.nix +++ b/pkgs/development/python-modules/libusb1/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "libusb1"; - version = "3.0.0"; + version = "3.1.0"; src = fetchPypi { inherit pname version; - sha256 = "5792a9defee40f15d330a40d9b1800545c32e47ba7fc66b6f28f133c9fcc8538"; + sha256 = "4ee9b0a55f8bd0b3ea7017ae919a6c1f439af742c4a4b04543c5fd7af89b828c"; }; postPatch = '' diff --git a/pkgs/development/python-modules/mpris-server/default.nix b/pkgs/development/python-modules/mpris-server/default.nix new file mode 100644 index 0000000000000..783fc6aab959f --- /dev/null +++ b/pkgs/development/python-modules/mpris-server/default.nix @@ -0,0 +1,41 @@ +{ lib +, buildPythonPackage +, fetchPypi +, emoji +, pydbus +, pygobject3 +, unidecode +, setuptools +}: +buildPythonPackage rec { + pname = "mpris-server"; + version = "0.4.2"; + pyproject = true; + + src = fetchPypi { + pname = "mpris_server"; + inherit version; + hash = "sha256-p3nM80fOMtRmeKvOXuX40Fu9xH8gPgYyneXbUS678fE="; + }; + + nativeBuildInputs = [ setuptools ]; + + propagatedBuildInputs = [ + emoji + pydbus + pygobject3 + unidecode + ]; + + pythonImportsCheck = [ "mpris_server" ]; + + # upstream has no tests + doCheck = false; + + meta = with lib; { + description = "Publish a MediaPlayer2 MPRIS device to D-Bus"; + homepage = "https://pypi.org/project/mpris-server/"; + license = licenses.agpl3Only; + maintainers = with maintainers; [ quadradical ]; + }; +} diff --git a/pkgs/development/python-modules/nats-py/default.nix b/pkgs/development/python-modules/nats-py/default.nix index 7df0e1a6f0e06..5028ab345f03c 100644 --- a/pkgs/development/python-modules/nats-py/default.nix +++ b/pkgs/development/python-modules/nats-py/default.nix @@ -13,7 +13,7 @@ buildPythonPackage rec { pname = "nats-py"; - version = "2.5.0"; + version = "2.6.0"; format = "pyproject"; disabled = pythonOlder "3.7"; @@ -22,7 +22,7 @@ buildPythonPackage rec { owner = "nats-io"; repo = "nats.py"; rev = "refs/tags/v${version}"; - hash = "sha256-BTGq1m1kkWk2CxDYh+jZZIf89ZoQjSTcvloBg9vq4p8="; + hash = "sha256-gpQXCihKvuXzCt1WNOd5W7RxxfVAvpaVP6OuHUiAQkw="; }; postPatch = '' diff --git a/pkgs/development/python-modules/notmuch2/default.nix b/pkgs/development/python-modules/notmuch2/default.nix index b8ed00ca2579f..9bb930d6cfa4b 100644 --- a/pkgs/development/python-modules/notmuch2/default.nix +++ b/pkgs/development/python-modules/notmuch2/default.nix @@ -16,9 +16,11 @@ buildPythonPackage { cffi ]; buildInputs = [ - python notmuch cffi + python notmuch ]; + propagatedBuildInputs = [ cffi ]; + # since notmuch 0.35, this package expects _notmuch_config.py that is # generated by notmuch's configure script. We write one which references our # built libraries. diff --git a/pkgs/development/python-modules/nuitka/darwin-lto.patch b/pkgs/development/python-modules/nuitka/darwin-lto.patch new file mode 100644 index 0000000000000..bd3a659054980 --- /dev/null +++ b/pkgs/development/python-modules/nuitka/darwin-lto.patch @@ -0,0 +1,15 @@ +diff --git a/nuitka/build/SconsCompilerSettings.py b/nuitka/build/SconsCompilerSettings.py +index 319b72c4e..89d40f2a2 100644 +--- a/nuitka/build/SconsCompilerSettings.py ++++ b/nuitka/build/SconsCompilerSettings.py +@@ -173,8 +173,8 @@ def _enableLtoSettings( + lto_mode = False + reason = "known to be not supported (CondaCC)" + elif isMacOS() and env.gcc_mode and env.clang_mode: +- lto_mode = True +- reason = "known to be supported (macOS clang)" ++ lto_mode = False ++ reason = "known to not be supported (macOS nix clang)" + elif env.mingw_mode and env.clang_mode: + lto_mode = False + reason = "known to not be supported (new MinGW64 Clang)" diff --git a/pkgs/development/python-modules/nuitka/default.nix b/pkgs/development/python-modules/nuitka/default.nix index ca2272ac1bd52..fee04a0e40f43 100644 --- a/pkgs/development/python-modules/nuitka/default.nix +++ b/pkgs/development/python-modules/nuitka/default.nix @@ -1,44 +1,46 @@ -{ lib, stdenv +{ lib , buildPythonPackage +, ccache , fetchFromGitHub -, vmprof , isPyPy -, pkgs -, scons -, chrpath +, ordered-set +, python3 +, setuptools +, zstandard }: buildPythonPackage rec { pname = "nuitka"; - version = "1.1.5"; - format = "setuptools"; + version = "1.8.4"; + pyproject = true; src = fetchFromGitHub { owner = "Nuitka"; repo = "Nuitka"; rev = version; - hash = "sha256-8eWOcxATVS866nlN39b2VU1CuXAfcn0yQsDweHS2yDU="; + hash = "sha256-spa3V9KEjqmwnHSuxLLIu9hJk5PrRwNyOw72sfxBVKo="; }; - nativeCheckInputs = [ vmprof ]; - nativeBuildInputs = [ scons ]; - propagatedBuildInputs = [ chrpath ]; + # default lto off for darwin + patches = [ ./darwin-lto.patch ]; - postPatch = '' - patchShebangs tests/run-tests - '' + lib.optionalString stdenv.isLinux '' - substituteInPlace nuitka/plugins/standard/ImplicitImports.py --replace 'locateDLL("uuid")' '"${lib.getLib pkgs.util-linux}/lib/libuuid.so"' - ''; + nativeBuildInputs = [ setuptools ]; + nativeCheckInputs = [ ccache ]; - # We do not want any wrappers here. - postFixup = ""; + propagatedBuildInputs = [ + ordered-set + zstandard + ]; checkPhase = '' - tests/run-tests + runHook preCheck + + ${python3.interpreter} tests/basics/run_all.py search + + runHook postCheck ''; - # Problem with a subprocess (parts) - doCheck = false; + pythonImportsCheck = [ "nuitka" ]; # Requires CPython disabled = isPyPy; diff --git a/pkgs/development/python-modules/nunavut/default.nix b/pkgs/development/python-modules/nunavut/default.nix index d2b341f5e3bc4..e6e6f42aaafab 100644 --- a/pkgs/development/python-modules/nunavut/default.nix +++ b/pkgs/development/python-modules/nunavut/default.nix @@ -9,14 +9,14 @@ buildPythonPackage rec { pname = "nunavut"; - version = "2.1.1"; + version = "2.3.0"; format = "setuptools"; - disabled = pythonOlder "3.6"; + disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-ENP1uhzQwFEk990b1RX2wNVpInaSSH80KNihX6XpQtU="; + hash = "sha256-+wqQ7JKC4aSgdM8YcYlO289CRpwX4VPxVqNlSABJJ0U="; }; postPatch = '' diff --git a/pkgs/development/python-modules/objsize/default.nix b/pkgs/development/python-modules/objsize/default.nix index 18efa2b3494a9..a002597da50a2 100644 --- a/pkgs/development/python-modules/objsize/default.nix +++ b/pkgs/development/python-modules/objsize/default.nix @@ -1,20 +1,43 @@ { lib -, python , buildPythonPackage , fetchFromGitHub +, pytestCheckHook +, pythonOlder +, setuptools +, wheel }: buildPythonPackage rec { pname = "objsize"; - version = "0.6.1"; + version = "0.7.0"; + pyproject= true; + + disabled = pythonOlder "3.7"; src = fetchFromGitHub { owner = "liran-funaro"; - repo = pname; - rev = version; - hash = "sha256-FgRB7EENwNOlC7ynIRxcwucoywNjko494s75kOp5O+w="; + repo = "objsize"; + rev = "refs/tags/${version}"; + hash = "sha256-wy4Tj+Q+4zymRdoN8Z7wcazJTb2lQ+XHY1Kta02R3R0="; }; + nativeBuildInputs = [ + setuptools + wheel + ]; + + nativeCheckInputs = [ + pytestCheckHook + ]; + + pythonImportsCheck = [ + "objsize" + ]; + + pytestFlagsArray = [ + "test_objsize.py" + ]; + meta = with lib; { description = "Traversal over objects subtree and calculate the total size"; homepage = "https://github.com/liran-funaro/objsize"; diff --git a/pkgs/development/python-modules/ocrmypdf/default.nix b/pkgs/development/python-modules/ocrmypdf/default.nix index fc6aeb0401202..05b71d2b45208 100644 --- a/pkgs/development/python-modules/ocrmypdf/default.nix +++ b/pkgs/development/python-modules/ocrmypdf/default.nix @@ -31,7 +31,7 @@ buildPythonPackage rec { pname = "ocrmypdf"; - version = "15.2.0"; + version = "15.3.1"; disabled = pythonOlder "3.9"; @@ -47,7 +47,7 @@ buildPythonPackage rec { postFetch = '' rm "$out/.git_archival.txt" ''; - hash = "sha256-XeO/obDP2tv/HKZLa0Absv26m+oUIup/IBMFZP8/1VQ="; + hash = "sha256-Yngx9hH/4yftClNqM/yyrOCPH0+4Bl9GIEGjawLdy0s="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/openapi-schema-pydantic/default.nix b/pkgs/development/python-modules/openapi-schema-pydantic/default.nix deleted file mode 100644 index 1930dc237f058..0000000000000 --- a/pkgs/development/python-modules/openapi-schema-pydantic/default.nix +++ /dev/null @@ -1,44 +0,0 @@ -{ lib -, buildPythonPackage -, fetchPypi -, pythonOlder -, pydantic -, pytestCheckHook -}: - -buildPythonPackage rec { - pname = "openapi-schema-pydantic"; - version = "1.2.4"; - format = "setuptools"; - - disabled = pythonOlder "3.6"; - - src = fetchPypi { - inherit pname version; - hash = "sha256-PiLPWLdKafdSzH5fFTf25EFkKC2ycAy7zTu5nd0GUZY="; - }; - - propagatedBuildInputs = [ - pydantic - ]; - - nativeCheckInputs = [ - pytestCheckHook - ]; - - disabledTests = [ - # these tests are broken with `pydantic >= 1.10` - # but this library seems to work fine. - # e.g. https://github.com/hwchase17/langchain/blob/d86ed15d8884d5a3f120a433b9dda065647e4534/poetry.lock#L6011-L6012 - "test_pydantic_discriminator_schema_generation" - "test_pydantic_discriminator_openapi_generation" - ]; - - meta = with lib; { - description = "OpenAPI (v3) specification schema as pydantic class"; - homepage = "https://github.com/kuimono/openapi-schema-pydantic"; - changelog = "https://github.com/kuimono/openapi-schema-pydantic/releases/tag/v${version}"; - license = licenses.mit; - maintainers = with maintainers; [ natsukium ]; - }; -} diff --git a/pkgs/development/python-modules/openrazer/common.nix b/pkgs/development/python-modules/openrazer/common.nix index d62c8450cda4b..5b7a0bc0f8f21 100644 --- a/pkgs/development/python-modules/openrazer/common.nix +++ b/pkgs/development/python-modules/openrazer/common.nix @@ -1,14 +1,14 @@ { lib , fetchFromGitHub }: rec { - version = "3.5.1"; + version = "3.6.1"; format = "setuptools"; src = fetchFromGitHub { owner = "openrazer"; repo = "openrazer"; rev = "v${version}"; - hash = "sha256-6YU2tl17LpDZe9pQ1a+B2SGIhqGdwME3Db6umVz7RLc="; + hash = "sha256-bboTRZqJq5tKeBQuiEQAXxTHYvoldDQlwbfehjDA8EE="; }; meta = with lib; { diff --git a/pkgs/development/python-modules/opower/default.nix b/pkgs/development/python-modules/opower/default.nix index c221f942a2b20..3a9b516c2daf7 100644 --- a/pkgs/development/python-modules/opower/default.nix +++ b/pkgs/development/python-modules/opower/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "opower"; - version = "0.0.37"; + version = "0.0.38"; format = "pyproject"; disabled = pythonOlder "3.9"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "tronikos"; repo = "opower"; rev = "refs/tags/v${version}"; - hash = "sha256-hfHKn3A1Uo0GAHOwzCuOM2FlIyyGBUefQAKX9TJZzHw="; + hash = "sha256-NX4w5id/XJfleHJd1fa1XcvekwhtWMaEyhbY253SMOo="; }; pythonRemoveDeps = [ diff --git a/pkgs/development/python-modules/peaqevcore/default.nix b/pkgs/development/python-modules/peaqevcore/default.nix index 9fe9539bf8100..cc2d71914dc62 100644 --- a/pkgs/development/python-modules/peaqevcore/default.nix +++ b/pkgs/development/python-modules/peaqevcore/default.nix @@ -6,14 +6,14 @@ buildPythonPackage rec { pname = "peaqevcore"; - version = "19.5.10"; + version = "19.5.12"; format = "setuptools"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-izw41TUmqKOy34/RMHjBROQr88SChheKJVpPMaOubnE="; + hash = "sha256-NsQrfJQ1+WZ4wNBH8ZGGo9IMJ+yvWrVQmesDBQrfRKg="; }; postPatch = '' diff --git a/pkgs/development/python-modules/pgcli/default.nix b/pkgs/development/python-modules/pgcli/default.nix index 9ed6cd9b52495..f5de2371e01ef 100644 --- a/pkgs/development/python-modules/pgcli/default.nix +++ b/pkgs/development/python-modules/pgcli/default.nix @@ -22,11 +22,11 @@ # integrating with ipython-sql buildPythonPackage rec { pname = "pgcli"; - version = "3.5.0"; + version = "4.0.0"; src = fetchPypi { inherit pname version; - hash = "sha256-zESNlRWfwJA9NhgpkneKCW7aV1LWYNR2cTg8jiv2M/E="; + hash = "sha256-C/X427yQR+BkbQFqQhMoomDEbP8hCJCLEbtVyWR17o0="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pgvector/default.nix b/pkgs/development/python-modules/pgvector/default.nix index 03fbef0bd48b2..389a917668bff 100644 --- a/pkgs/development/python-modules/pgvector/default.nix +++ b/pkgs/development/python-modules/pgvector/default.nix @@ -17,7 +17,7 @@ buildPythonPackage rec { pname = "pgvector"; - version = "0.2.2"; + version = "0.2.3"; format = "setuptools"; disabled = pythonOlder "3.8"; @@ -26,7 +26,7 @@ buildPythonPackage rec { owner = "pgvector"; repo = "pgvector-python"; rev = "refs/tags/v${version}"; - hash = "sha256-qvLDFnrTYibdhjSeeIFI4YdpPRsvNBnQ23uqsLCblEo="; + hash = "sha256-KQROG0cHvKmdWssr7Git3JH0YguRPno/ZzYiQL7VhwU="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/plugwise/default.nix b/pkgs/development/python-modules/plugwise/default.nix index 22e0a62827620..5ca8bf74a56ec 100644 --- a/pkgs/development/python-modules/plugwise/default.nix +++ b/pkgs/development/python-modules/plugwise/default.nix @@ -20,7 +20,7 @@ buildPythonPackage rec { pname = "plugwise"; - version = "0.33.2"; + version = "0.34.4"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -29,7 +29,7 @@ buildPythonPackage rec { owner = pname; repo = "python-plugwise"; rev = "refs/tags/v${version}"; - hash = "sha256-WTgv0bEkhLMoRCw6Xh5SlYLxnlQCv603lKTajjCETT4="; + hash = "sha256-lyQE3+ZRZgKTZiv6p+cLZRe26M9BnM59fvLjWwFiE8E="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/prophet/default.nix b/pkgs/development/python-modules/prophet/default.nix index 889f835861ed5..5a8e2dfc1fc6d 100644 --- a/pkgs/development/python-modules/prophet/default.nix +++ b/pkgs/development/python-modules/prophet/default.nix @@ -2,71 +2,58 @@ , buildPythonPackage , pythonOlder , fetchFromGitHub -, fetchpatch - , setuptools , cmdstanpy , numpy , matplotlib , pandas -, lunarcalendar -, convertdate , holidays -, python-dateutil , tqdm , importlib-resources +, dask +, distributed + , pytestCheckHook }: buildPythonPackage rec { pname = "prophet"; - version = "1.1.4"; - format = "pyproject"; + version = "1.1.5"; + pyproject = true; disabled = pythonOlder "3.7"; src = fetchFromGitHub { owner = "facebook"; repo = "prophet"; - rev = "refs/tags/v${version}"; - hash = "sha256-pbJ0xL5wDZ+rKgtQQTJPsB1Mu2QXo3S9MMpiYkURsz0="; + rev = version; + hash = "sha256-liTg5Hm+FPpRQajBnnJKBh3JPGyu0Hflntf0isj1FiQ="; }; - patches = [ - # TODO: remove when bumping version from 1.1.4 - (fetchpatch { - name = "fix-stan-file-temp-dest.patch"; - url = "https://github.com/facebook/prophet/commit/374676500795aec9d5cbc7fe5f7a96bf00489809.patch"; - hash = "sha256-sfiQ2V3ZEF0WM9oM1FkL/fhZesQJ1i2EUPYJMdDA2UM="; - relative = "python"; - }) - ]; - - sourceRoot = "${src.name}/python"; + sourceRoot = "source/python"; env.PROPHET_REPACKAGE_CMDSTAN = "false"; nativeBuildInputs = [ setuptools ]; - # TODO: update when bumping version from 1.1.4 propagatedBuildInputs = [ cmdstanpy numpy matplotlib pandas - lunarcalendar - convertdate holidays - python-dateutil tqdm importlib-resources ]; + passthru.optional-dependencies.parallel = [ dask distributed ] ++ dask.optional-dependencies.dataframe; + preCheck = '' - # the generated stan_model directory only exists in build/lib* - cd build/lib* + # use the generated files from $out for testing + mv prophet/tests . + rm -r prophet ''; nativeCheckInputs = [ pytestCheckHook ]; @@ -74,11 +61,11 @@ buildPythonPackage rec { pythonImportsCheck = [ "prophet" ]; meta = { - homepage = "https://facebook.github.io/prophet/"; + changelog = "https://github.com/facebook/prophet/releases/tag/${src.rev}"; description = "A tool for producing high quality forecasts for time series data that has multiple seasonality with linear or non-linear growth"; - changelog = "https://github.com/facebook/prophet/releases/tag/v${version}"; + homepage = "https://facebook.github.io/prophet/"; license = lib.licenses.mit; - platforms = lib.platforms.linux; maintainers = with lib.maintainers; [ tomasajt ]; + platforms = lib.platforms.linux; # cmdstanpy doesn't currently build on darwin }; } diff --git a/pkgs/development/python-modules/publicsuffixlist/default.nix b/pkgs/development/python-modules/publicsuffixlist/default.nix index 12e67d554eb41..00edd1433813f 100644 --- a/pkgs/development/python-modules/publicsuffixlist/default.nix +++ b/pkgs/development/python-modules/publicsuffixlist/default.nix @@ -5,20 +5,25 @@ , pytestCheckHook , pythonOlder , requests +, setuptools }: buildPythonPackage rec { pname = "publicsuffixlist"; - version = "0.10.0.20231026"; - format = "setuptools"; + version = "0.10.0.20231030"; + pyproject = true; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-q2rUBjbue3I3VnRLTF7UscBs51bGxUGjMYwAkgX5UMs="; + hash = "sha256-1yRv6zg9mKJTinR57QHvCx/0mi0b2O3CkcoH1v4QuNo="; }; + nativeBuildInputs = [ + setuptools + ]; + passthru.optional-dependencies = { update = [ requests diff --git a/pkgs/development/python-modules/pycfmodel/default.nix b/pkgs/development/python-modules/pycfmodel/default.nix index 4147e01668a39..e8d33c9390124 100644 --- a/pkgs/development/python-modules/pycfmodel/default.nix +++ b/pkgs/development/python-modules/pycfmodel/default.nix @@ -9,7 +9,7 @@ buildPythonPackage rec { pname = "pycfmodel"; - version = "0.20.3"; + version = "0.21.0"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -18,7 +18,7 @@ buildPythonPackage rec { owner = "Skyscanner"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-dHgd6vnmlg+VXMp7QUZoT2aic1X05lJGm8hDrowALvk="; + hash = "sha256-5KgZnph9BAE2w3Y93abDHQWmxnFdyVOuW/NdzN66hgA="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pydata-sphinx-theme/default.nix b/pkgs/development/python-modules/pydata-sphinx-theme/default.nix index c9a3f9a409c2c..5cfd38ff37d36 100644 --- a/pkgs/development/python-modules/pydata-sphinx-theme/default.nix +++ b/pkgs/development/python-modules/pydata-sphinx-theme/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "pydata-sphinx-theme"; - version = "0.14.2"; + version = "0.14.3"; format = "wheel"; @@ -23,7 +23,7 @@ buildPythonPackage rec { dist = "py3"; python = "py3"; pname = "pydata_sphinx_theme"; - hash = "sha256-CYGEyTLDcQZzfhixUnt0GlPhkyfsBLXLxWQlml6ydlA="; + hash = "sha256-t+QM11ogRJrf4tdSW+N5uf6S9tMeUjPkSfo03c1DmNk="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pydbus/default.nix b/pkgs/development/python-modules/pydbus/default.nix index 64dafa97db7ce..fc8965fd3538e 100644 --- a/pkgs/development/python-modules/pydbus/default.nix +++ b/pkgs/development/python-modules/pydbus/default.nix @@ -1,13 +1,14 @@ { lib , buildPythonPackage , fetchFromGitHub +, setuptools , pygobject3 }: buildPythonPackage rec { pname = "pydbus"; version = "0.6.0"; - pyproejct = true; + pyproject = true; src = fetchFromGitHub { owner = "LEW21"; @@ -21,6 +22,10 @@ buildPythonPackage rec { --replace "getargspec" "getfullargspec" ''; + nativeBuildInputs = [ + setuptools + ]; + propagatedBuildInputs = [ pygobject3 ]; diff --git a/pkgs/development/python-modules/pymongo-inmemory/default.nix b/pkgs/development/python-modules/pymongo-inmemory/default.nix index 98cbf453e554d..f0930c8c54c02 100644 --- a/pkgs/development/python-modules/pymongo-inmemory/default.nix +++ b/pkgs/development/python-modules/pymongo-inmemory/default.nix @@ -10,7 +10,7 @@ buildPythonPackage rec { pname = "pymongo-inmemory"; - version = "0.3.1"; + version = "0.4.0"; format = "pyproject"; disabled = pythonOlder "3.7"; @@ -19,7 +19,7 @@ buildPythonPackage rec { owner = "kaizendorks"; repo = "pymongo_inmemory"; rev = "refs/tags/v${version}"; - hash = "sha256-1v36cI6JjDZA/uJE85NSMNnoyKI1VCgDrymfnCkpVqU="; + hash = "sha256-h6/yKvAHqvw0L3Z1+PUQi36Ja6yvFiaX7Cn5Ypcg1Zs="; }; postPatch = '' @@ -48,6 +48,11 @@ buildPythonPackage rec { pytestCheckHook ]; + disabledTestPaths = [ + # new test with insufficient monkey patching, try to remove on next bump + "tests/unit/test_mongod.py" + ]; + preCheck = '' export HOME="$(mktemp -d)" ''; diff --git a/pkgs/development/python-modules/pyschlage/default.nix b/pkgs/development/python-modules/pyschlage/default.nix index 886747e3161b9..ed2659fad6ca9 100644 --- a/pkgs/development/python-modules/pyschlage/default.nix +++ b/pkgs/development/python-modules/pyschlage/default.nix @@ -11,7 +11,7 @@ buildPythonPackage rec { pname = "pyschlage"; - version = "2023.9.1"; + version = "2023.10.0"; format = "pyproject"; disabled = pythonOlder "3.7"; @@ -20,7 +20,7 @@ buildPythonPackage rec { owner = "dknowles2"; repo = "pyschlage"; rev = "refs/tags/${version}"; - hash = "sha256-HFgQXMUmjWW5syBwtCunQ/TeulPwtF48Nesy9iZ3hlU="; + hash = "sha256-9RXk3wDDX0sGNsci8EClfj17VCYwtUiMyNJj1FLLJKk="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/pysignalclirestapi/default.nix b/pkgs/development/python-modules/pysignalclirestapi/default.nix index 023b6dde3eb82..0e033ad99ff8f 100644 --- a/pkgs/development/python-modules/pysignalclirestapi/default.nix +++ b/pkgs/development/python-modules/pysignalclirestapi/default.nix @@ -1,23 +1,28 @@ { lib , buildPythonPackage , fetchFromGitHub +, setuptools , requests , future }: buildPythonPackage rec { pname = "pysignalclirestapi"; - version = "0.3.18"; + version = "0.3.21"; - format = "setuptools"; + pyproject = true; src = fetchFromGitHub { owner = "bbernhard"; repo = "pysignalclirestapi"; rev = version; - hash = "sha256-BF4BmnQVfrj7f0N+TN/d7GNuDTbDQfwsCkUn2pVmMWo="; + hash = "sha256-CAZ6UgGz7ZDXlQlngi+hEhczOphvAT/Yl9vLqnrS1Qc="; }; + nativeBuildInputs = [ + setuptools + ]; + propagatedBuildInputs = [ requests future diff --git a/pkgs/development/python-modules/python-kasa/default.nix b/pkgs/development/python-modules/python-kasa/default.nix index 78f97117f89f7..dd2b641737943 100644 --- a/pkgs/development/python-modules/python-kasa/default.nix +++ b/pkgs/development/python-modules/python-kasa/default.nix @@ -17,7 +17,7 @@ buildPythonPackage rec { pname = "python-kasa"; - version = "0.5.3"; + version = "0.5.4"; format = "pyproject"; disabled = pythonOlder "3.8"; @@ -26,7 +26,7 @@ buildPythonPackage rec { owner = pname; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-7GJnkT7FOYzytQyOCP8zU5hUk4SbeC7gc1qkhl5eXGo="; + hash = "sha256-wGPMrYaTtKkkNW88eyiiciFcBSTRqqChYi6e15WUCHo="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/python-matter-server/default.nix b/pkgs/development/python-modules/python-matter-server/default.nix index ccb013d14e548..1c65a6de3220a 100644 --- a/pkgs/development/python-modules/python-matter-server/default.nix +++ b/pkgs/development/python-modules/python-matter-server/default.nix @@ -1,7 +1,6 @@ { lib , buildPythonPackage , fetchFromGitHub -, fetchpatch , pythonOlder # build @@ -29,7 +28,7 @@ buildPythonPackage rec { pname = "python-matter-server"; - version = "3.7.0"; + version = "4.0.0"; format = "pyproject"; disabled = pythonOlder "3.10"; @@ -38,18 +37,9 @@ buildPythonPackage rec { owner = "home-assistant-libs"; repo = "python-matter-server"; rev = "refs/tags/${version}"; - hash = "sha256-t++7jQreibGpJRjJawicxjFIye5X6R1dpFqiM6yvRf0="; + hash = "sha256-7MBQo4jzBU/n7gVdGzVHlQl8Vj3OjfK4gk1vhLQQUE0="; }; - patches = [ - # https://github.com/home-assistant-libs/python-matter-server/pull/379 - (fetchpatch { - name = "relax-setuptools-dependency.patch"; - url = "https://github.com/home-assistant-libs/python-matter-server/commit/1bbc945634db92ea081051645b03c3d9c358fb15.patch"; - hash = "sha256-kTu1+IwDrcdqelyK/vfhxw8MQBis5I1jag7YTytKQhs="; - }) - ]; - nativeBuildInputs = [ setuptools wheel diff --git a/pkgs/development/python-modules/python-on-whales/default.nix b/pkgs/development/python-modules/python-on-whales/default.nix new file mode 100644 index 0000000000000..c2484a8857dde --- /dev/null +++ b/pkgs/development/python-modules/python-on-whales/default.nix @@ -0,0 +1,45 @@ +{ lib +, buildPythonPackage +, fetchFromGitHub +, setuptools +, pythonOlder +, pydantic +, requests +, tqdm +, typer +}: + +buildPythonPackage rec { + pname = "python-on-whales"; + version = "0.65.0"; + pyproject = true; + + disabled = pythonOlder "3.8"; + + src = fetchFromGitHub { + owner = "gabrieldemarmiesse"; + repo = "python-on-whales"; + rev = "refs/tags/v${version}"; + hash = "sha256-aFE4qeNMSxhHs7IAjYQYl15s4NkHH8balTV3N0obNPs="; + }; + + nativeBuildInputs = [ setuptools ]; + + propagatedBuildInputs = [ + pydantic + requests + tqdm + typer + ]; + + doCheck = false; # majority of tests require Docker and/or network access + pythonImportsCheck = [ "python_on_whales" ]; + + meta = with lib; { + description = "Docker client for Python, designed to be fun and intuitive"; + homepage = "https://github.com/gabrieldemarmiesse/python-on-whales"; + changelog = "https://github.com/gabrieldemarmiesse/python-on-whales/releases/tag/v${version}"; + license = licenses.mit; + maintainers = with maintainers; [ bcdarwin ]; + }; +} diff --git a/pkgs/development/python-modules/python-roborock/default.nix b/pkgs/development/python-modules/python-roborock/default.nix index 167331e05f1af..3fa39b27fba57 100644 --- a/pkgs/development/python-modules/python-roborock/default.nix +++ b/pkgs/development/python-modules/python-roborock/default.nix @@ -20,7 +20,7 @@ buildPythonPackage rec { pname = "python-roborock"; - version = "0.35.0"; + version = "0.35.3"; format = "pyproject"; disabled = pythonOlder "3.10"; @@ -29,7 +29,7 @@ buildPythonPackage rec { owner = "humbertogontijo"; repo = "python-roborock"; rev = "refs/tags/v${version}"; - hash = "sha256-tZUsDBEvcLGTw/CqcxVWlrXwxlGsGdDeQzSym9BurxM="; + hash = "sha256-3XTVHs+mLePudLnr+bAN4pHvHtUcE0D5Hw+50Vxhlzw="; }; postPatch = '' diff --git a/pkgs/development/python-modules/pytrafikverket/default.nix b/pkgs/development/python-modules/pytrafikverket/default.nix index d8365a034ebc3..20b08ebd44314 100644 --- a/pkgs/development/python-modules/pytrafikverket/default.nix +++ b/pkgs/development/python-modules/pytrafikverket/default.nix @@ -9,14 +9,14 @@ buildPythonPackage rec { pname = "pytrafikverket"; - version = "0.3.7"; + version = "0.3.8"; format = "setuptools"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-9s4KbYFhQVf+16GT4hbGkmwxQhtMu60SwrLWHbdJXAY="; + hash = "sha256-3p2tKFuzgl+VFRRXV66MRgcL1XS8xxDqMOUZw+Ql/5E="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/qcodes-loop/default.nix b/pkgs/development/python-modules/qcodes-loop/default.nix index 80355c1b53412..93f452786512b 100644 --- a/pkgs/development/python-modules/qcodes-loop/default.nix +++ b/pkgs/development/python-modules/qcodes-loop/default.nix @@ -1,34 +1,33 @@ { lib , stdenv -, fetchpatch -, fetchPypi -, pythonOlder , buildPythonPackage -, qcodes +, fetchPypi , h5py +, hickle +, hypothesis +, ipython , lazy-loader , matplotlib , numpy , pandas +, pyqt5 +, pyqtgraph +, pytest-mock +, pytest-xdist +, pytestCheckHook +, pythonOlder +, qcodes , setuptools +, slack-sdk , versioningit , wheel , xarray -, hickle -, ipython -, slack-sdk -, hypothesis -, pytest-xdist -, pytest-mock -, pyqtgraph -, pyqt5 -, pytestCheckHook }: buildPythonPackage rec { pname = "qcodes-loop"; version = "0.1.2"; - format = "pyproject"; + pyproject = true; disabled = pythonOlder "3.8"; @@ -38,15 +37,6 @@ buildPythonPackage rec { hash = "sha256-TizNSC49n4Xc2BmJNziARlVXYQxp/LtwmKpgqQkQ3a8="; }; - patches = [ - # https://github.com/QCoDeS/Qcodes_loop/pull/39 - (fetchpatch { - name = "relax-versioningit-dependency.patch"; - url = "https://github.com/QCoDeS/Qcodes_loop/commit/58006d3fb57344ae24dd44bceca98004617b5b57.patch"; - hash = "sha256-mSlm/Ql8e5xPL73ifxSoVc9+U58AAcAmBkdW5P6zEsg="; - }) - ]; - nativeBuildInputs = [ setuptools versioningit @@ -82,11 +72,8 @@ buildPythonPackage rec { pyqt5 ]; - pythonImportsCheck = [ "qcodes_loop" ]; - - disabledTestPaths = [ - # test broken in 0.1.1, see https://github.com/QCoDeS/Qcodes_loop/pull/25 - "src/qcodes_loop/tests/test_hdf5formatter.py" + pythonImportsCheck = [ + "qcodes_loop" ]; postInstall = '' @@ -96,6 +83,7 @@ buildPythonPackage rec { meta = with lib; { description = "Features previously in QCoDeS"; homepage = "https://github.com/QCoDeS/Qcodes_loop"; + changelog = "https://github.com/QCoDeS/Qcodes_loop/releases/tag/v${version}"; license = licenses.mit; maintainers = with maintainers; [ evilmav ]; # Some tests fail on this platform diff --git a/pkgs/development/python-modules/rotary-embedding-torch/default.nix b/pkgs/development/python-modules/rotary-embedding-torch/default.nix index 450fa9c8bee21..8a65e0249e703 100644 --- a/pkgs/development/python-modules/rotary-embedding-torch/default.nix +++ b/pkgs/development/python-modules/rotary-embedding-torch/default.nix @@ -13,14 +13,14 @@ buildPythonPackage rec { pname = "rotary-embedding-torch"; - version = "0.3.3"; + version = "0.3.5"; pyproject = true; src = fetchFromGitHub { owner = "lucidrains"; repo = "rotary-embedding-torch"; rev = version; - hash = "sha256-uTOKdxqbSLRJl0gnz3TvpVwhrfqflAp0wfn6d13+YrM="; + hash = "sha256-dST3eJnOcG2s9tiD/Fb9BvLS6nIpE8RXly92PK/gCC8="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/scmrepo/default.nix b/pkgs/development/python-modules/scmrepo/default.nix index 4b608dfed3b52..fb650d2d95acb 100644 --- a/pkgs/development/python-modules/scmrepo/default.nix +++ b/pkgs/development/python-modules/scmrepo/default.nix @@ -17,7 +17,7 @@ buildPythonPackage rec { pname = "scmrepo"; - version = "1.4.0"; + version = "1.4.1"; format = "pyproject"; disabled = pythonOlder "3.7"; @@ -26,7 +26,7 @@ buildPythonPackage rec { owner = "iterative"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-3fU4BT0AwyFTg15Oca95JgDrHxIqKJOpJolDRvo7hxc="; + hash = "sha256-ZK3M689vv3Kr2OoNdxaCs9Spo6h6xJmhTsPajKHYtkA="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/scrapy/default.nix b/pkgs/development/python-modules/scrapy/default.nix index c0ec21bf6afde..88ecd6f2be8a6 100644 --- a/pkgs/development/python-modules/scrapy/default.nix +++ b/pkgs/development/python-modules/scrapy/default.nix @@ -14,6 +14,7 @@ , lxml , packaging , parsel +, pexpect , protego , pydispatcher , pyopenssl @@ -42,6 +43,18 @@ buildPythonPackage rec { hash = "sha256-PL3tzgw/DgSC1hvi10WGg758188UsO5q37rduA9bNqU="; }; + patches = [ + # Fix compatiblity with Twisted>=23.8. Remove with the next release. + (fetchpatch { + url = "https://github.com/scrapy/scrapy/commit/aa95ada42cdf570f840f55c463375f8a81b303f8.patch"; + hash = "sha256-LuhA5BqtjSUgkotplvUCtvGNYOTrl0MJRCXiSBMDFzY="; + excludes = [ + "tests/CrawlerProcess/sleeping.py" + "tests/test_crawler.py" + ]; + }) + ]; + nativeBuildInputs = [ installShellFiles ]; @@ -69,6 +82,7 @@ buildPythonPackage rec { botocore glibcLocales jmespath + pexpect pytestCheckHook sybil testfixtures diff --git a/pkgs/development/python-modules/sphinx-thebe/default.nix b/pkgs/development/python-modules/sphinx-thebe/default.nix index d2e05c755a252..d6d150d6e92bf 100644 --- a/pkgs/development/python-modules/sphinx-thebe/default.nix +++ b/pkgs/development/python-modules/sphinx-thebe/default.nix @@ -1,29 +1,42 @@ { lib , buildPythonPackage -, pythonOlder , fetchPypi +, hatch-vcs +, hatchling +, pythonOlder , sphinx }: buildPythonPackage rec { pname = "sphinx-thebe"; - version = "0.2.1"; - format = "pyproject"; + version = "0.3.0"; + pyproject = true; - disabled = pythonOlder "3.6"; + disabled = pythonOlder "3.8"; src = fetchPypi { - inherit pname version; - sha256 = "f4c8c1542054f991b73fcb28c4cf21697e42aba2f83f22348c1c851b82766583"; + inherit version; + pname = "sphinx_thebe"; + hash = "sha256-xg2rG1m5LWouq41xGeh8BzBHDaYvPIS/bKdWkEh9BQU="; }; - propagatedBuildInputs = [ sphinx ]; + nativeBuildInputs = [ + hatch-vcs + hatchling + ]; + + propagatedBuildInputs = [ + sphinx + ]; - pythonImportsCheck = [ "sphinx_thebe" ]; + pythonImportsCheck = [ + "sphinx_thebe" + ]; meta = with lib; { description = "Integrate interactive code blocks into your documentation with Thebe and Binder"; homepage = "https://github.com/executablebooks/sphinx-thebe"; + changelog = "https://github.com/executablebooks/sphinx-thebe/releases/tag/v${version}"; license = licenses.mit; maintainers = with maintainers; [ marsam ]; }; diff --git a/pkgs/development/python-modules/streamlit/default.nix b/pkgs/development/python-modules/streamlit/default.nix index b764d95734513..c770cce0fdffc 100644 --- a/pkgs/development/python-modules/streamlit/default.nix +++ b/pkgs/development/python-modules/streamlit/default.nix @@ -18,7 +18,7 @@ , pympler , python-dateutil , pythonOlder -, pythonRelaxDepsHook +, setuptools , requests , rich , tenacity @@ -32,21 +32,18 @@ buildPythonPackage rec { pname = "streamlit"; - version = "1.27.2"; - format = "setuptools"; + version = "1.28.0"; + pyproject = true; disabled = pythonOlder "3.8"; src = fetchPypi { - inherit pname version format; - hash = "sha256-M/muDeW31ZzX2rqHdUxU7IN6dsJKz8QdH45RSPIJA+4="; + inherit pname version; + hash = "sha256-vm/SQOKQvip5hXsa14IrU6PJDxXPbOl9iev02ALX7bE="; }; - nativeBuildInputs = [ pythonRelaxDepsHook ]; - - pythonRelaxDeps = [ - "pillow" - "pydeck" + nativeBuildInputs = [ + setuptools ]; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/subarulink/default.nix b/pkgs/development/python-modules/subarulink/default.nix index d08fe36473ac8..92fe9124bf714 100644 --- a/pkgs/development/python-modules/subarulink/default.nix +++ b/pkgs/development/python-modules/subarulink/default.nix @@ -11,7 +11,7 @@ buildPythonPackage rec { pname = "subarulink"; - version = "0.7.7"; + version = "0.7.8"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -20,7 +20,7 @@ buildPythonPackage rec { owner = "G-Two"; repo = pname; rev = "refs/tags/v${version}"; - hash = "sha256-SrOFKXh/wG2+HKaLvyNP6/Le9R3Ri7+/xsUBAazo7js="; + hash = "sha256-lBAel9ueuyr6AFNCYk1nHRvf8KvtiszESzRIOqjBjHQ="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/tensorflow-probability/default.nix b/pkgs/development/python-modules/tensorflow-probability/default.nix index 677afda4f1ff2..8e017cc55b0f2 100644 --- a/pkgs/development/python-modules/tensorflow-probability/default.nix +++ b/pkgs/development/python-modules/tensorflow-probability/default.nix @@ -54,7 +54,8 @@ let LIBTOOL = lib.optionalString stdenv.isDarwin "${cctools}/bin/libtool"; fetchAttrs = { - sha256 = "sha256-XChXujA2XpnkybrraN3FIJA/QkxLCfX97id2jMFzFJk="; + # FIXME: tensorflow is currently marked as broken, update the hash once it's fixed + sha256 = "sha256-0ChXujA2XpnkybrraN3FIJA/QkxLCfX97id2jMFzFJk="; }; buildAttrs = { diff --git a/pkgs/development/python-modules/torch/default.nix b/pkgs/development/python-modules/torch/default.nix index 765a8d9468bc9..59396d421ed93 100644 --- a/pkgs/development/python-modules/torch/default.nix +++ b/pkgs/development/python-modules/torch/default.nix @@ -145,10 +145,8 @@ in buildPythonPackage rec { ./pthreadpool-disable-gcd.diff ] ++ lib.optionals stdenv.isLinux [ # Propagate CUPTI to Kineto by overriding the search path with environment variables. - (fetchpatch { - url = "https://github.com/pytorch/pytorch/pull/108847/commits/7ae4d7c0e2dec358b4fe81538efe9da5eb580ec9.patch"; - hash = "sha256-skFaDg98xcJqJfzxWk+qhUxPLHDStqvd0mec3PgksIg="; - }) + # https://github.com/pytorch/pytorch/pull/108847 + ./pytorch-pr-108847.patch ]; postPatch = lib.optionalString rocmSupport '' diff --git a/pkgs/development/python-modules/torch/pytorch-pr-108847.patch b/pkgs/development/python-modules/torch/pytorch-pr-108847.patch new file mode 100644 index 0000000000000..9511191ca926a --- /dev/null +++ b/pkgs/development/python-modules/torch/pytorch-pr-108847.patch @@ -0,0 +1,31 @@ +From bf4050edab9f294a8e0060c47f906cd7a80f25a2 Mon Sep 17 00:00:00 2001 +From: Samuel Ainsworth <skainsworth@gmail.com> +Date: Sat, 9 Sep 2023 02:04:09 +0000 +Subject: [PATCH] Dependencies.cmake: support building against CUPTI outside of + CUDA_SOURCE_DIR + +Limitation discovered in https://github.com/NixOS/nixpkgs/pull/249259. +--- + cmake/Dependencies.cmake | 2 ++ + 1 file changed, 2 insertions(+) + +diff --git a/cmake/Dependencies.cmake b/cmake/Dependencies.cmake +index 0602d534dc4c14..5f6a5f79f3e3dc 100644 +--- a/cmake/Dependencies.cmake ++++ b/cmake/Dependencies.cmake +@@ -1879,6 +1879,7 @@ if(USE_KINETO) + ${CUDA_SOURCE_DIR}/extras/CUPTI/lib64 + ${CUDA_SOURCE_DIR}/lib + ${CUDA_SOURCE_DIR}/lib64 ++ $ENV{CUPTI_LIBRARY_DIR} + NO_DEFAULT_PATH) + + find_path(CUPTI_INCLUDE_DIR cupti.h PATHS +@@ -1886,6 +1887,7 @@ if(USE_KINETO) + ${CUDA_INCLUDE_DIRS} + ${CUDA_SOURCE_DIR} + ${CUDA_SOURCE_DIR}/include ++ $ENV{CUPTI_INCLUDE_DIR} + NO_DEFAULT_PATH) + + if(CUPTI_LIBRARY_PATH AND CUPTI_INCLUDE_DIR) diff --git a/pkgs/development/python-modules/unearth/default.nix b/pkgs/development/python-modules/unearth/default.nix index 2352416014d83..7af5740fe3154 100644 --- a/pkgs/development/python-modules/unearth/default.nix +++ b/pkgs/development/python-modules/unearth/default.nix @@ -15,14 +15,14 @@ buildPythonPackage rec { pname = "unearth"; - version = "0.11.2"; + version = "0.12.1"; format = "pyproject"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-DrWogA/aBhDglf73aLSNR8hYybhBenha9kcEbC317Ss="; + hash = "sha256-TKrZQbYPUeUP3BCYZiNNQHkQrvd/EjOqG2tdFox0J+4="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/withings-sync/default.nix b/pkgs/development/python-modules/withings-sync/default.nix new file mode 100644 index 0000000000000..60cce387fa626 --- /dev/null +++ b/pkgs/development/python-modules/withings-sync/default.nix @@ -0,0 +1,48 @@ +{ lib +, buildPythonPackage +, fetchFromGitHub +, garth +, lxml +, pythonOlder +, requests +, setuptools +, wheel +}: + +buildPythonPackage rec { + pname = "withings-sync"; + version = "4.2.1"; + pyproject = true; + + disabled = pythonOlder "3.10"; + + src = fetchFromGitHub { + owner = "jaroslawhartman"; + repo = "withings-sync"; + rev = "refs/tags/v${version}"; + hash = "sha256-6igjUmgIA077/1SQMt10tRpnLVKxGFNJN1GeLhQLROg="; + }; + + nativeBuildInputs = [ + setuptools + wheel + ]; + + propagatedBuildInputs = [ + garth + lxml + requests + ]; + + pythonImportsCheck = [ + "withings_sync" + ]; + + meta = with lib; { + description = "Synchronisation of Withings weight"; + homepage = "https://github.com/jaroslawhartman/withings-sync"; + changelog = "https://github.com/jaroslawhartman/withings-sync/releases/tag/v${version}"; + license = licenses.mit; + maintainers = with maintainers; [ fab ]; + }; +} diff --git a/pkgs/development/tools/analysis/rr/default.nix b/pkgs/development/tools/analysis/rr/default.nix index 94e1d704b275b..d5bcd116dc203 100644 --- a/pkgs/development/tools/analysis/rr/default.nix +++ b/pkgs/development/tools/analysis/rr/default.nix @@ -4,23 +4,17 @@ }: stdenv.mkDerivation rec { - version = "5.6.0"; + version = "5.7.0"; pname = "rr"; src = fetchFromGitHub { owner = "mozilla"; repo = "rr"; rev = version; - sha256 = "H39HPkAQGubXVQV3jCpH4Pz+7Q9n03PrS70utk7Tt2k="; + hash = "sha256-n1Jbhr77bI0AXncY/RquNVSwwnnAXt31RmKtAa1/oHg="; }; - patches = [ - (fetchpatch { - name = "fix-flexible-array-member.patch"; - url = "https://github.com/rr-debugger/rr/commit/2979c60ef8bbf7c940afd90172ddc5d8863f766e.diff"; - sha256 = "cmdCJetQr3ELPOyWl37h1fGfG/xvaiJpywxIAnqb5YY="; - }) - ]; + patches = [ ]; postPatch = '' substituteInPlace src/Command.cc --replace '_BSD_SOURCE' '_DEFAULT_SOURCE' @@ -54,7 +48,7 @@ stdenv.mkDerivation rec { hardeningDisable = [ "fortify" ]; # FIXME - #doCheck = true; + doCheck = false; preCheck = "export HOME=$TMPDIR"; diff --git a/pkgs/development/tools/analysis/valgrind/default.nix b/pkgs/development/tools/analysis/valgrind/default.nix index bd56eb539e002..a43520ecb4b79 100644 --- a/pkgs/development/tools/analysis/valgrind/default.nix +++ b/pkgs/development/tools/analysis/valgrind/default.nix @@ -58,7 +58,7 @@ stdenv.mkDerivation rec { preConfigure = lib.optionalString stdenv.isFreeBSD '' substituteInPlace configure --replace '`uname -r`' \ - ${toString stdenv.hostPlatform.parsed.kernel.version}.0 + ${toString stdenv.hostPlatform.parsed.kernel.version}.0- '' + lib.optionalString stdenv.isDarwin ( let OSRELEASE = '' $(awk -F '"' '/#define OSRELEASE/{ print $2 }' \ diff --git a/pkgs/development/tools/bloom/default.nix b/pkgs/development/tools/bloom/default.nix new file mode 100644 index 0000000000000..dc0a35d065421 --- /dev/null +++ b/pkgs/development/tools/bloom/default.nix @@ -0,0 +1,55 @@ +{ lib +, stdenv +, fetchFromGitHub +, cmake +, yaml-cpp +, qtbase +, qtsvg +, wrapQtAppsHook +, qttools +, libusb1 +, php +, hidapi +, procps +}: + +stdenv.mkDerivation rec { + pname = "bloom"; + version = "1.0.0"; + + src = fetchFromGitHub { + owner = "bloombloombloom"; + repo = "Bloom"; + rev = "v${version}"; + hash = "sha256-ZZfclZwxsCgApUII79bJVyT5V/dF9jm7l8ynRWCh0UU="; + }; + + nativeBuildInputs = [ + cmake + php + wrapQtAppsHook + ]; + + buildInputs = [ + hidapi + libusb1 + procps + qtbase + qtsvg + qttools + yaml-cpp + ]; + + postPatch = '' + sed -i 's|/usr|${placeholder "out"}|' cmake/Installing.cmake + ''; + + meta = { + description = "Debug interface for AVR-based embedded systems development on GNU/Linux"; + homepage = "https://bloom.oscillate.io/"; + license = lib.licenses.lgpl3Only; + maintainers = with lib.maintainers; [ eclairevoyant ]; + mainProgram = "bloom"; + platforms = lib.platforms.linux; + }; +} diff --git a/pkgs/development/tools/build-managers/bazel/bazel_6/default.nix b/pkgs/development/tools/build-managers/bazel/bazel_6/default.nix index 545236b561c8e..8fb37a9f666f2 100644 --- a/pkgs/development/tools/build-managers/bazel/bazel_6/default.nix +++ b/pkgs/development/tools/build-managers/bazel/bazel_6/default.nix @@ -25,12 +25,12 @@ }: let - version = "6.3.2"; + version = "6.4.0"; sourceRoot = "."; src = fetchurl { url = "https://github.com/bazelbuild/bazel/releases/download/${version}/bazel-${version}-dist.zip"; - hash = "sha256-jNf+rFgZO+K8ukUbpmiKRoJNN8pjWf9Y4NROuY8EKUg="; + hash = "sha256-vYj/YCyLuynugroqaxKtCS1R7GaMZXf5Yo8Y5I/05R4="; }; # Update with @@ -330,6 +330,8 @@ stdenv.mkDerivation rec { installPhase = '' runHook preInstall + # prevent bazel version check failing in the updater + rm .bazelversion cp -r . "$out" runHook postInstall diff --git a/pkgs/development/tools/build-managers/bazel/bazel_6/src-deps.json b/pkgs/development/tools/build-managers/bazel/bazel_6/src-deps.json index e407902f79499..c294c1f22419c 100644 --- a/pkgs/development/tools/build-managers/bazel/bazel_6/src-deps.json +++ b/pkgs/development/tools/build-managers/bazel/bazel_6/src-deps.json @@ -7,6 +7,13 @@ "https://github.com/bazelbuild/rules_sass/archive/1.25.0.zip" ] }, + "1.3.3.zip": { + "name": "1.3.3.zip", + "sha256": "bb529ba133c0256df49139bd403c17835edbf60d2ecd6463549c6a5fe279364d", + "urls": [ + "https://github.com/BLAKE3-team/BLAKE3/archive/refs/tags/1.3.3.zip" + ] + }, "1ef781ced3b1443dca3ed05dec1989eca1a4e1cd.tar.gz": { "name": "1ef781ced3b1443dca3ed05dec1989eca1a4e1cd.tar.gz", "sha256": "5a725b777976b77aa122b707d1b6f0f39b6020f66cd427bb111a585599c857b1", @@ -55,14 +62,6 @@ "https://github.com/c-ares/c-ares/archive/6654436a307a5a686b008c1d4c93b0085da6e6d8.tar.gz" ] }, - "7cf3cefd652008d0a64a419c34c13bdca6c8f178.zip": { - "name": "7cf3cefd652008d0a64a419c34c13bdca6c8f178.zip", - "sha256": "bc81f1ba47ef5cc68ad32225c3d0e70b8c6f6077663835438da8d5733f917598", - "urls": [ - "https://mirror.bazel.build/github.com/bazelbuild/rules_java/archive/7cf3cefd652008d0a64a419c34c13bdca6c8f178.zip", - "https://github.com/bazelbuild/rules_java/archive/7cf3cefd652008d0a64a419c34c13bdca6c8f178.zip" - ] - }, "7e4afce6fe62dbff0a4a03450143146f9f2d7488.tar.gz": { "name": "7e4afce6fe62dbff0a4a03450143146f9f2d7488.tar.gz", "sha256": "8e7d59a5b12b233be5652e3d29f42fba01c7cbab09f6b3a8d0a57ed6d1e9a0da", @@ -207,6 +206,25 @@ "https://github.com/bazelbuild/continuous-integration/releases/download/rules-1.0.0/bazelci_rules-1.0.0.tar.gz" ] }, + "blake3": { + "build_file": "//third_party:blake3/blake3.BUILD", + "generator_function": "dist_http_archive", + "generator_name": "blake3", + "name": "blake3", + "patch_cmds": [ + "test -f BUILD.bazel && chmod u+w BUILD.bazel || true", + "echo >> BUILD.bazel", + "echo 'exports_files([\"WORKSPACE\"], visibility = [\"//visibility:public\"])' >> BUILD.bazel" + ], + "patch_cmds_win": [ + "Add-Content -Path BUILD.bazel -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" + ], + "sha256": "bb529ba133c0256df49139bd403c17835edbf60d2ecd6463549c6a5fe279364d", + "strip_prefix": "BLAKE3-1.3.3", + "urls": [ + "https://github.com/BLAKE3-team/BLAKE3/archive/refs/tags/1.3.3.zip" + ] + }, "boringssl": { "generator_function": "grpc_deps", "generator_name": "boringssl", @@ -538,44 +556,44 @@ "https://github.com/census-instrumentation/opencensus-cpp/archive/c9a4da319bc669a772928ffc55af4a61be1a1176.tar.gz" ] }, - "java_tools-v12.6.zip": { - "name": "java_tools-v12.6.zip", - "sha256": "f58a358ca694a41416a9b6a92b852935ad301d8882e5d22f4f11134f035317d5", + "java_tools-v12.7.zip": { + "name": "java_tools-v12.7.zip", + "sha256": "aa11ecd5fc0af2769f0f2bdd25e2f4de7c1291ed24326fb23fa69bdd5dcae2b5", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools-v12.7.zip" ] }, - "java_tools_darwin_arm64-v12.6.zip": { - "name": "java_tools_darwin_arm64-v12.6.zip", - "sha256": "c6ffcaf87965c436cc86fc0e9673dafc97c0761efae8225ad2691cf6cfe3d87a", + "java_tools_darwin_arm64-v12.7.zip": { + "name": "java_tools_darwin_arm64-v12.7.zip", + "sha256": "ecedf6305768dfd51751d0ad732898af092bd7710d497c6c6c3214af7e49395f", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_darwin_arm64-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_darwin_arm64-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_darwin_arm64-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_darwin_arm64-v12.7.zip" ] }, - "java_tools_darwin_x86_64-v12.6.zip": { - "name": "java_tools_darwin_x86_64-v12.6.zip", - "sha256": "c6545e82e543cb5775d3b8909d6270b5f481864b5ff083d20bfa5dcf77ac3ef7", + "java_tools_darwin_x86_64-v12.7.zip": { + "name": "java_tools_darwin_x86_64-v12.7.zip", + "sha256": "e116c649c0355ab57ffcc870ce1139e5e1528cabac458bd50263d2b84ea4ffb2", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_darwin_x86_64-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_darwin_x86_64-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_darwin_x86_64-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_darwin_x86_64-v12.7.zip" ] }, - "java_tools_linux-v12.6.zip": { - "name": "java_tools_linux-v12.6.zip", - "sha256": "64294e91fe940c77e6d35818b4c3a1f07d78e33add01e330188d907032687066", + "java_tools_linux-v12.7.zip": { + "name": "java_tools_linux-v12.7.zip", + "sha256": "a346b9a291b6db1bb06f7955f267e47522d99963fe14e337da1d75d125a8599f", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_linux-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_linux-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_linux-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_linux-v12.7.zip" ] }, - "java_tools_windows-v12.6.zip": { - "name": "java_tools_windows-v12.6.zip", - "sha256": "63f727d44011b8c504bb4e6d89c2cd982278efb34dae8629687e9483d8f7d62d", + "java_tools_windows-v12.7.zip": { + "name": "java_tools_windows-v12.7.zip", + "sha256": "bae6a03b5aeead5804ba7bcdcc8b14ec3ed05b37f3db5519f788ab060bc53b05", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_windows-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_windows-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_windows-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_windows-v12.7.zip" ] }, "microsoft-jdk-11.0.13.8.1-windows-aarch64.zip": { @@ -1076,18 +1094,18 @@ "generator_function": "dist_http_archive", "generator_name": "platforms", "name": "platforms", - "sha256": "379113459b0feaf6bfbb584a91874c065078aa673222846ac765f86661c27407", + "sha256": "3a561c99e7bdbe9173aa653fd579fe849f1d8d67395780ab4770b1f381431d51", "urls": [ - "https://mirror.bazel.build/github.com/bazelbuild/platforms/releases/download/0.0.5/platforms-0.0.5.tar.gz", - "https://github.com/bazelbuild/platforms/releases/download/0.0.5/platforms-0.0.5.tar.gz" + "https://mirror.bazel.build/github.com/bazelbuild/platforms/releases/download/0.0.7/platforms-0.0.7.tar.gz", + "https://github.com/bazelbuild/platforms/releases/download/0.0.7/platforms-0.0.7.tar.gz" ] }, - "platforms-0.0.5.tar.gz": { - "name": "platforms-0.0.5.tar.gz", - "sha256": "379113459b0feaf6bfbb584a91874c065078aa673222846ac765f86661c27407", + "platforms-0.0.7.tar.gz": { + "name": "platforms-0.0.7.tar.gz", + "sha256": "3a561c99e7bdbe9173aa653fd579fe849f1d8d67395780ab4770b1f381431d51", "urls": [ - "https://mirror.bazel.build/github.com/bazelbuild/platforms/releases/download/0.0.5/platforms-0.0.5.tar.gz", - "https://github.com/bazelbuild/platforms/releases/download/0.0.5/platforms-0.0.5.tar.gz" + "https://mirror.bazel.build/github.com/bazelbuild/platforms/releases/download/0.0.7/platforms-0.0.7.tar.gz", + "https://github.com/bazelbuild/platforms/releases/download/0.0.7/platforms-0.0.7.tar.gz" ] }, "python-3.7.0": { @@ -1159,10 +1177,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "c6ffcaf87965c436cc86fc0e9673dafc97c0761efae8225ad2691cf6cfe3d87a", + "sha256": "ecedf6305768dfd51751d0ad732898af092bd7710d497c6c6c3214af7e49395f", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_darwin_arm64-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_darwin_arm64-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_darwin_arm64-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_darwin_arm64-v12.7.zip" ] }, "remote_java_tools_darwin_x86_64": { @@ -1187,10 +1205,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "c6545e82e543cb5775d3b8909d6270b5f481864b5ff083d20bfa5dcf77ac3ef7", + "sha256": "e116c649c0355ab57ffcc870ce1139e5e1528cabac458bd50263d2b84ea4ffb2", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_darwin_x86_64-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_darwin_x86_64-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_darwin_x86_64-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_darwin_x86_64-v12.7.zip" ] }, "remote_java_tools_for_testing": { @@ -1205,10 +1223,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "f58a358ca694a41416a9b6a92b852935ad301d8882e5d22f4f11134f035317d5", + "sha256": "aa11ecd5fc0af2769f0f2bdd25e2f4de7c1291ed24326fb23fa69bdd5dcae2b5", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools-v12.7.zip" ] }, "remote_java_tools_linux": { @@ -1233,10 +1251,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "64294e91fe940c77e6d35818b4c3a1f07d78e33add01e330188d907032687066", + "sha256": "a346b9a291b6db1bb06f7955f267e47522d99963fe14e337da1d75d125a8599f", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_linux-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_linux-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_linux-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_linux-v12.7.zip" ] }, "remote_java_tools_test": { @@ -1251,10 +1269,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "f58a358ca694a41416a9b6a92b852935ad301d8882e5d22f4f11134f035317d5", + "sha256": "aa11ecd5fc0af2769f0f2bdd25e2f4de7c1291ed24326fb23fa69bdd5dcae2b5", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools-v12.7.zip" ] }, "remote_java_tools_test_darwin_arm64": { @@ -1269,10 +1287,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "c6ffcaf87965c436cc86fc0e9673dafc97c0761efae8225ad2691cf6cfe3d87a", + "sha256": "ecedf6305768dfd51751d0ad732898af092bd7710d497c6c6c3214af7e49395f", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_darwin_arm64-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_darwin_arm64-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_darwin_arm64-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_darwin_arm64-v12.7.zip" ] }, "remote_java_tools_test_darwin_x86_64": { @@ -1287,10 +1305,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "c6545e82e543cb5775d3b8909d6270b5f481864b5ff083d20bfa5dcf77ac3ef7", + "sha256": "e116c649c0355ab57ffcc870ce1139e5e1528cabac458bd50263d2b84ea4ffb2", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_darwin_x86_64-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_darwin_x86_64-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_darwin_x86_64-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_darwin_x86_64-v12.7.zip" ] }, "remote_java_tools_test_linux": { @@ -1305,10 +1323,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "64294e91fe940c77e6d35818b4c3a1f07d78e33add01e330188d907032687066", + "sha256": "a346b9a291b6db1bb06f7955f267e47522d99963fe14e337da1d75d125a8599f", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_linux-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_linux-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_linux-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_linux-v12.7.zip" ] }, "remote_java_tools_test_windows": { @@ -1323,10 +1341,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "63f727d44011b8c504bb4e6d89c2cd982278efb34dae8629687e9483d8f7d62d", + "sha256": "bae6a03b5aeead5804ba7bcdcc8b14ec3ed05b37f3db5519f788ab060bc53b05", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_windows-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_windows-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_windows-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_windows-v12.7.zip" ] }, "remote_java_tools_windows": { @@ -1351,10 +1369,10 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "63f727d44011b8c504bb4e6d89c2cd982278efb34dae8629687e9483d8f7d62d", + "sha256": "bae6a03b5aeead5804ba7bcdcc8b14ec3ed05b37f3db5519f788ab060bc53b05", "urls": [ - "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.6/java_tools_windows-v12.6.zip", - "https://github.com/bazelbuild/java_tools/releases/download/java_v12.6/java_tools_windows-v12.6.zip" + "https://mirror.bazel.build/bazel_java_tools/releases/java/v12.7/java_tools_windows-v12.7.zip", + "https://github.com/bazelbuild/java_tools/releases/download/java_v12.7/java_tools_windows-v12.7.zip" ] }, "remotejdk11_linux": { @@ -1991,11 +2009,17 @@ "patch_cmds_win": [ "Add-Content -Path BUILD -Value \"`nexports_files([`\"WORKSPACE`\"], visibility = [`\"//visibility:public`\"])`n\" -Force" ], - "sha256": "bc81f1ba47ef5cc68ad32225c3d0e70b8c6f6077663835438da8d5733f917598", - "strip_prefix": "rules_java-7cf3cefd652008d0a64a419c34c13bdca6c8f178", + "sha256": "73b88f34dc251bce7bc6c472eb386a6c2b312ed5b473c81fe46855c248f792e0", + "strip_prefix": "", + "urls": [ + "https://github.com/bazelbuild/rules_java/releases/download/5.5.1/rules_java-5.5.1.tar.gz" + ] + }, + "rules_java-5.5.1.tar.gz": { + "name": "rules_java-5.5.1.tar.gz", + "sha256": "73b88f34dc251bce7bc6c472eb386a6c2b312ed5b473c81fe46855c248f792e0", "urls": [ - "https://mirror.bazel.build/github.com/bazelbuild/rules_java/archive/7cf3cefd652008d0a64a419c34c13bdca6c8f178.zip", - "https://github.com/bazelbuild/rules_java/archive/7cf3cefd652008d0a64a419c34c13bdca6c8f178.zip" + "https://github.com/bazelbuild/rules_java/releases/download/5.5.1/rules_java-5.5.1.tar.gz" ] }, "rules_jvm_external": { diff --git a/pkgs/development/tools/build-managers/bazel/python-bin-path-test.nix b/pkgs/development/tools/build-managers/bazel/python-bin-path-test.nix index d560b0af848c3..1ab073a64c858 100644 --- a/pkgs/development/tools/build-managers/bazel/python-bin-path-test.nix +++ b/pkgs/development/tools/build-managers/bazel/python-bin-path-test.nix @@ -51,6 +51,7 @@ let py_binary( name = "bin", srcs = [ "bin.py" ], + imports = [ "." ], deps = [ ":lib" ], ) ''; diff --git a/pkgs/development/tools/build-managers/scala-cli/sources.json b/pkgs/development/tools/build-managers/scala-cli/sources.json index f248e9c1123b0..8d1af88a84156 100644 --- a/pkgs/development/tools/build-managers/scala-cli/sources.json +++ b/pkgs/development/tools/build-managers/scala-cli/sources.json @@ -1,21 +1,21 @@ { - "version": "1.0.4", + "version": "1.0.5", "assets": { "aarch64-darwin": { "asset": "scala-cli-aarch64-apple-darwin.gz", - "sha256": "1gqnsm8pcwrk1v1v4xaj0j0w5xsmh3xv61h6sv72297illxxkbgq" + "sha256": "1p2ibii71digdz7qqqyahvdmmxyx19crwgn4bmas0hahl6mz553x" }, "aarch64-linux": { "asset": "scala-cli-aarch64-pc-linux.gz", - "sha256": "124xqn18xyn35pg18p0rz40d8vjgijp6sc6wg4i81ih2mrxqxsbc" + "sha256": "1y9ghb829jz9yg4l7bgwnbl3cm7z7c20cyfc71v9iz8bq5ns9akr" }, "x86_64-darwin": { "asset": "scala-cli-x86_64-apple-darwin.gz", - "sha256": "0r581a1zzlk7qbcsfbv79asj5y56zzx9249h099k29rbdjc3ya26" + "sha256": "12qjrm979pfbr0j7s59dyn7xkk585av7l0qxf77rz71009kvql0a" }, "x86_64-linux": { "asset": "scala-cli-x86_64-pc-linux.gz", - "sha256": "018cmr71qhdqvmprrfb8clsj718gfkdvyw48dqkf2jsafq0kglk2" + "sha256": "17x4nv5f8g1kx8l4n8ncxf60zwhwpqg8fh5cl8qy9s5h9h81n0rz" } } } diff --git a/pkgs/development/tools/changie/default.nix b/pkgs/development/tools/changie/default.nix index a14fd890526f7..b8ab1367ab1c9 100644 --- a/pkgs/development/tools/changie/default.nix +++ b/pkgs/development/tools/changie/default.nix @@ -6,16 +6,16 @@ buildGoModule rec { pname = "changie"; - version = "1.15.0"; + version = "1.15.1"; src = fetchFromGitHub { owner = "miniscruff"; repo = "changie"; rev = "v${version}"; - hash = "sha256-jMpOSAmjJKDG8uvjjwZ03cu+5JmFzYMuNieotjvgnME="; + hash = "sha256-pjeqaLCxWq2maz+C4jCNNRhYhclvcABi6zC+Qxy2GPw="; }; - vendorHash = "sha256-UAMhQK2Sw7W6RfkSPD2P0dGc0bimAL8jD/gEc/hRaD0="; + vendorHash = "sha256-pBRU/eWuI14uDmTPo593hW0YAye5Y1Fm1axd/+X7nS8="; nativeBuildInputs = [ installShellFiles diff --git a/pkgs/development/tools/circup/default.nix b/pkgs/development/tools/circup/default.nix index 71b5864fdb6e9..f960106629147 100644 --- a/pkgs/development/tools/circup/default.nix +++ b/pkgs/development/tools/circup/default.nix @@ -5,14 +5,14 @@ python3.pkgs.buildPythonApplication rec { pname = "circup"; - version = "1.2.3"; + version = "1.4.0"; format = "setuptools"; src = fetchFromGitHub { owner = "adafruit"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-6RjZHMZBL8p72+JeZOzyD/x1qiZay2ApJEmp9IXXpDA="; + hash = "sha256-kax4gnvRkHSqj0Y6Rk8eyPpT7Wia2QngCQtxpqWSl9s="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/tools/continuous-integration/buildbot/master.nix b/pkgs/development/tools/continuous-integration/buildbot/master.nix index b89f4e4d28839..d14486f8aeda2 100644 --- a/pkgs/development/tools/continuous-integration/buildbot/master.nix +++ b/pkgs/development/tools/continuous-integration/buildbot/master.nix @@ -31,6 +31,8 @@ , parameterized , git , openssh +, setuptools +, pythonRelaxDepsHook , glibcLocales , nixosTests , callPackage @@ -88,6 +90,7 @@ let autobahn pyjwt pyyaml + setuptools ] # tls ++ twisted.optional-dependencies.tls; @@ -108,8 +111,11 @@ let git openssh glibcLocales + pythonRelaxDepsHook ]; + pythonRelaxDeps = [ "Twisted" ]; + patches = [ # This patch disables the test that tries to read /etc/os-release which # is not accessible in sandboxed builds. diff --git a/pkgs/development/tools/fsautocomplete/default.nix b/pkgs/development/tools/fsautocomplete/default.nix index 21ab0a93ab201..a8d8c7348b0f9 100644 --- a/pkgs/development/tools/fsautocomplete/default.nix +++ b/pkgs/development/tools/fsautocomplete/default.nix @@ -5,13 +5,13 @@ let in buildDotnetModule rec { pname = "fsautocomplete"; - version = "0.66.1"; + version = "0.67.0"; src = fetchFromGitHub { owner = "fsharp"; repo = "FsAutoComplete"; rev = "v${version}"; - sha256 = "sha256-9kuGteoWbYoqgFA11qH+MEjhLMk/23bXXiGG8Lsr1MA="; + sha256 = "sha256-txHkQDLyIejsEZGpfIGqeiJ8EUePZq1btxfd+EZD4aM="; }; nugetDeps = ./deps.nix; diff --git a/pkgs/development/tools/fsautocomplete/deps.nix b/pkgs/development/tools/fsautocomplete/deps.nix index ecf2396eb9d00..dab6f0aa4fbfe 100644 --- a/pkgs/development/tools/fsautocomplete/deps.nix +++ b/pkgs/development/tools/fsautocomplete/deps.nix @@ -70,7 +70,7 @@ (fetchNuGet { pname = "IcedTasks"; version = "0.5.4"; sha256 = "0584bbld25f6hzglzsah1n215658d4lwnzwxcazrwzyy25rmansl"; }) (fetchNuGet { pname = "ICSharpCode.Decompiler"; version = "7.2.1.6856"; sha256 = "19z68rgzl93lh1h8anbgzw119mhvcgr9nh5q2nxk6qihl2mx97ba"; }) (fetchNuGet { pname = "Ionide.KeepAChangelog.Tasks"; version = "0.1.8"; sha256 = "066zla2rp1sal6by3h3sg6ibpkk52kbhn30bzk58l6ym7q1kqa6b"; }) - (fetchNuGet { pname = "Ionide.LanguageServerProtocol"; version = "0.4.17"; sha256 = "14h8rkc9q6shh9fqa640bzfs1k1y5nfriwviwjynpjf79xbbcpvs"; }) + (fetchNuGet { pname = "Ionide.LanguageServerProtocol"; version = "0.4.19"; sha256 = "1n910ipbscr7b3cr873cr5zh40ysn0n9z47dlqlndbq0g3kl6vi5"; }) (fetchNuGet { pname = "Ionide.ProjInfo"; version = "0.62.0"; sha256 = "1da6hhca9vd6hxbz9jmwxwx2pc7d5ayd41sp6mzzmbk4n3jk32q2"; }) (fetchNuGet { pname = "Ionide.ProjInfo.FCS"; version = "0.62.0"; sha256 = "1mkw4b1sawv1p0c4a1fidkw02bh9iik7fi80ffgqi0msc3ql8lmg"; }) (fetchNuGet { pname = "Ionide.ProjInfo.ProjectSystem"; version = "0.62.0"; sha256 = "0kj9h5gvvrl720kg5jylx8w1jjmcci7bdhabr57sbq31vbgav74d"; }) diff --git a/pkgs/development/tools/goimports-reviser/default.nix b/pkgs/development/tools/goimports-reviser/default.nix index 09bd1541775de..7f79d3b5fe33a 100644 --- a/pkgs/development/tools/goimports-reviser/default.nix +++ b/pkgs/development/tools/goimports-reviser/default.nix @@ -5,13 +5,13 @@ buildGoModule rec { pname = "goimports-reviser"; - version = "3.4.5"; + version = "3.5.6"; src = fetchFromGitHub { owner = "incu6us"; repo = "goimports-reviser"; rev = "v${version}"; - hash = "sha256-VsG3Y7V59tTh1XS45s3NKGwMxS/y6KbIxWbRK6bHdaw="; + hash = "sha256-OMCmW2GhByuVN8+Kuaw9o2oCrdA6C9fK/C7yl7wI2Ls="; }; vendorHash = "sha256-aYhUsO3Z0uue66XB+/oSVYLG9QGyVcFeZ0ngzhpBZxo="; diff --git a/pkgs/development/tools/hclfmt/default.nix b/pkgs/development/tools/hclfmt/default.nix index 368a1a6e5c5a8..03e934175c0f7 100644 --- a/pkgs/development/tools/hclfmt/default.nix +++ b/pkgs/development/tools/hclfmt/default.nix @@ -2,13 +2,13 @@ buildGoModule rec { pname = "hclfmt"; - version = "2.18.1"; + version = "2.19.1"; src = fetchFromGitHub { owner = "hashicorp"; repo = "hcl"; rev = "v${version}"; - hash = "sha256-31Xqgzd208ypK8u1JV5Rh5cCqGr1MJkLP490nIeovsE="; + hash = "sha256-A7YfjXdblFGBABD/PeJMzh9WdPeIUWOWAr/UlD3ki28="; }; vendorHash = "sha256-DA1IKaC+YSBzCfEMqHsHfwu1o5qvYFaFgDoGG0RZnoo="; diff --git a/pkgs/development/tools/infisical/default.nix b/pkgs/development/tools/infisical/default.nix index a12142d2b7339..5c4b4ca9e3e44 100644 --- a/pkgs/development/tools/infisical/default.nix +++ b/pkgs/development/tools/infisical/default.nix @@ -1,59 +1,87 @@ -{ stdenv, lib, callPackage, fetchurl }: +{ stdenv, lib, fetchurl, testers, infisical, installShellFiles }: + +# this expression is mostly automated, and you are STRONGLY +# RECOMMENDED to use to nix-update for updating this expression when new +# releases come out, which runs the sibling `update.sh` script. +# +# from the root of the nixpkgs git repository, run: +# +# nix-shell maintainers/scripts/update.nix \ +# --argstr commit true \ +# --argstr package infisical let - inherit (stdenv.hostPlatform) system; - throwSystem = throw "Unsupported system: ${system}"; - - plat = { - x86_64-linux = "linux_amd64"; - x86_64-darwin = "darwin_amd64"; - aarch64-linux = "linux_arm64"; - aarch64-darwin = "darwin_arm64"; - }.${system} or throwSystem; - - archive_fmt = "tar.gz"; - - sha256 = { - x86_64-linux = "e85c5f2ddca89caa6b44c61554c1dffeacdabc96c25a7e6881dc5722515270d1"; - x86_64-darwin = "eddbcde10271f791eb1473ba00b85b442aa059cdfee38021b8f8880f33754821"; - aarch64-linux = "9793a6db476492802ffec7f933d7f8f107a1c89fee09c8eb6bdb975b1fccecea"; - aarch64-darwin = "46c8a82a71da5731c108d24b4a960a507af66d91bba7b7246dd3a3415afaf7d3"; - }.${system} or throwSystem; + # build hashes, which correspond to the hashes of the precompiled binaries procured by GitHub Actions. + buildHashes = builtins.fromJSON (builtins.readFile ./hashes.json); + + # the version of infisical + version = "0.14.3"; + + # the platform-specific, statically linked binary + src = + let + suffix = { + # map the platform name to the golang toolchain suffix + # NOTE: must be synchronized with update.sh! + x86_64-linux = "linux_amd64"; + x86_64-darwin = "darwin_amd64"; + aarch64-linux = "linux_arm64"; + aarch64-darwin = "darwin_arm64"; + }."${stdenv.hostPlatform.system}" or (throw "Unsupported system: ${stdenv.hostPlatform.system}"); + + name = "infisical_${version}_${suffix}.tar.gz"; + hash = buildHashes."${stdenv.hostPlatform.system}"; + url = "https://github.com/Infisical/infisical/releases/download/infisical-cli%2Fv${version}/${name}"; + in + fetchurl { inherit name url hash; }; + in - stdenv.mkDerivation (finalAttrs: { - pname = "infisical"; - version = "0.14.2"; - - src = fetchurl { - url = "https://github.com/Infisical/infisical/releases/download/infisical-cli%2Fv${finalAttrs.version}/infisical_${finalAttrs.version}_${plat}.tar.gz"; - inherit sha256; - }; - - sourceRoot = "."; - installPhase = '' - mkdir -p $out/bin/ $out/share/completions/ $out/share/man/ - cp completions/* $out/share/completions/ - cp manpages/* $out/share/man/ - cp infisical $out/bin - ''; +stdenv.mkDerivation { + pname = "infisical"; + version = version; + inherit src; - postInstall = '' - installManPage share/man/infisical.1.gz - installShellCompletion share/completions/infisical.{bash,fish,zsh} - chmod +x bin/infisical - ''; + nativeBuildInputs = [ installShellFiles ]; + + doCheck = true; + dontConfigure = true; + dontStrip = true; + + sourceRoot = "."; + buildPhase = "chmod +x ./infisical"; + checkPhase = "./infisical --version"; + installPhase = '' + mkdir -p $out/bin/ $out/share/completions/ $out/share/man/ + cp infisical $out/bin + cp completions/* $out/share/completions/ + cp manpages/* $out/share/man/ + ''; + postInstall = '' + installManPage share/man/infisical.1.gz + installShellCompletion share/completions/infisical.{bash,fish,zsh} + ''; - meta = with lib; { - description = "The official Infisical CLI"; - longDescription = '' - Infisical is an Open Source, End-to-End encrypted platform that lets you - securely sync secrets and configs across your team, devices, and infrastructure - ''; - mainProgram = "infisical"; - homepage = "https://infisical.com/"; - downloadPage = "https://github.com/Infisical/infisical/releases/"; - license = licenses.mit; - maintainers = [ maintainers.ivanmoreau maintainers.jgoux ]; - platforms = [ "x86_64-linux" "x86_64-darwin" "aarch64-darwin" "aarch64-linux" ]; - }; - }) + passthru = { + updateScript = ./update.sh; + tests.version = testers.testVersion { package = infisical; }; + }; + + meta = with lib; { + description = "The official Infisical CLI"; + longDescription = '' + Infisical is the open-source secret management platform: + Sync secrets across your team/infrastructure and prevent secret leaks. + ''; + homepage = "https://infisical.com"; + changelog = "https://github.com/infisical/infisical/releases/tag/infisical-cli%2Fv${version}"; + license = licenses.mit; + mainProgram = "infisical"; + maintainers = [ maintainers.ivanmoreau maintainers.jgoux ]; + platforms = [ + "x86_64-linux" + "aarch64-linux" + "aarch64-darwin" + "x86_64-darwin" + ]; + }; +} diff --git a/pkgs/development/tools/infisical/hashes.json b/pkgs/development/tools/infisical/hashes.json new file mode 100644 index 0000000000000..0e79f2a1e00c1 --- /dev/null +++ b/pkgs/development/tools/infisical/hashes.json @@ -0,0 +1,6 @@ +{ "_comment": "@generated by pkgs/development/tools/infisical/update.sh" +, "x86_64-linux": "sha256-sTfwooMN5ckdaxpd4R3yQvDEYT7muYZTyFEm0exM33M=" +, "x86_64-darwin": "sha256-B94+mF5Wu0pHKIo8CuHAbrorzIxK2U64Np3JFlTc1kk=" +, "aarch64-linux": "sha256-eGuKnC6h1YPW0UdY5wcChbiSzATAcSmHZ6mKBI2sR80=" +, "aarch64-darwin": "sha256-s4s1la165cQ5I296ZCeW3ZIyYapTfRxa20QdZmXvido=" +} diff --git a/pkgs/development/tools/infisical/update.sh b/pkgs/development/tools/infisical/update.sh new file mode 100755 index 0000000000000..5810d2ee48b40 --- /dev/null +++ b/pkgs/development/tools/infisical/update.sh @@ -0,0 +1,41 @@ +#!/usr/bin/env nix-shell +#!nix-shell -I nixpkgs=./. -i bash -p curl jq nix-prefetch common-updater-scripts nix coreutils +# shellcheck shell=bash +set -euo pipefail + +RELEASE_NAME=$(curl -s https://api.github.com/repos/infisical/infisical/releases \ + | jq -r 'sort_by(.created_at) | reverse | + (map + (select ((.prerelease == false) and (.draft == false))) | + first + ) | .name') +VERSION=$(echo "$RELEASE_NAME" | sed -E 's/^infisical-cli\/v//') + +echo "Latest infisical release: $VERSION" + +ARCHS=( + "x86_64-linux:linux_amd64" + "x86_64-darwin:darwin_amd64" + "aarch64-linux:linux_arm64" + "aarch64-darwin:darwin_arm64" +) + +NFILE=pkgs/development/tools/infisical/default.nix +HFILE=pkgs/development/tools/infisical/hashes.json +rm -f "$HFILE" && touch "$HFILE" + +printf "{ \"_comment\": \"@generated by pkgs/development/tools/infisical/update.sh\"\n" >> "$HFILE" + +for arch in "${ARCHS[@]}"; do + IFS=: read -r arch_name arch_target <<< "$arch" + sha256hash="$(nix-prefetch-url --type sha256 "https://github.com/infisical/infisical/releases/download/${RELEASE_NAME}/infisical_${VERSION}_${arch_target}.tar.gz")" + srihash="$(nix hash to-sri --type sha256 "$sha256hash")" + echo ", \"$arch_name\": \"$srihash\"" >> "$HFILE" +done +echo "}" >> "$HFILE" + +sed -i \ + '0,/version\s*=\s*".*";/s//version = "'"$VERSION"'";/' \ + "$NFILE" + +echo "Done; wrote $HFILE and updated version in $NFILE." diff --git a/pkgs/development/tools/language-servers/kotlin-language-server/default.nix b/pkgs/development/tools/language-servers/kotlin-language-server/default.nix index 790718125613d..8ec9ebb8f30a4 100644 --- a/pkgs/development/tools/language-servers/kotlin-language-server/default.nix +++ b/pkgs/development/tools/language-servers/kotlin-language-server/default.nix @@ -2,10 +2,10 @@ stdenv.mkDerivation rec { pname = "kotlin-language-server"; - version = "1.3.5"; + version = "1.3.7"; src = fetchzip { url = "https://github.com/fwcd/kotlin-language-server/releases/download/${version}/server.zip"; - hash = "sha256-hoZDbhedauW1TK78rX37Gwn/6OWLXZzy8wKsUrbTmKI="; + hash = "sha256-BEQywg3ZU4LtF9trntGbDp64SIWH4y93o/VVMSRP+cc="; }; dontBuild = true; diff --git a/pkgs/development/tools/language-servers/postgres-lsp/default.nix b/pkgs/development/tools/language-servers/postgres-lsp/default.nix index 167b86216f300..f4bda019b815e 100644 --- a/pkgs/development/tools/language-servers/postgres-lsp/default.nix +++ b/pkgs/development/tools/language-servers/postgres-lsp/default.nix @@ -6,25 +6,17 @@ rustPlatform.buildRustPackage rec { pname = "postgres-lsp"; - version = "unstable-2023-09-21"; + version = "unstable-2023-10-20"; - src = (fetchFromGitHub { + src = fetchFromGitHub { owner = "supabase"; repo = "postgres_lsp"; - rev = "f25f23a683c4e14dea52e3e423584588ab349081"; - hash = "sha256-z8WIUfgnPYdzhBit1V6A5UktjoYCblTKXxwpbHOmFJA="; + rev = "88901a987de9a2d8db05c36bcd87c5c877b51460"; + hash = "sha256-HY83SO2dlXKamIqFEz53A8YDYx9EynX8FCX9EjF+tdw="; fetchSubmodules = true; - }).overrideAttrs { - # workaround to be able to fetch git@github.com submodules - # https://github.com/NixOS/nixpkgs/issues/195117 - env = { - GIT_CONFIG_COUNT = 1; - GIT_CONFIG_KEY_0 = "url.https://github.com/.insteadOf"; - GIT_CONFIG_VALUE_0 = "git@github.com:"; - }; }; - cargoHash = "sha256-Nyxiere6/e5Y7YcgHitVkaiS1w3JXkbohIcBNc00YXY="; + cargoHash = "sha256-m8m0Q3UAq6kV2IoXMFTkP0WKzSXiWPkfOkta639dcj0="; nativeBuildInputs = [ protobuf diff --git a/pkgs/development/tools/misc/nxpmicro-mfgtools/default.nix b/pkgs/development/tools/misc/nxpmicro-mfgtools/default.nix index 2145c9a249a0a..cfcd86f9dc2b1 100644 --- a/pkgs/development/tools/misc/nxpmicro-mfgtools/default.nix +++ b/pkgs/development/tools/misc/nxpmicro-mfgtools/default.nix @@ -1,6 +1,5 @@ { lib, stdenv , fetchFromGitHub -, fetchpatch , cmake , pkg-config , bzip2 @@ -22,16 +21,6 @@ stdenv.mkDerivation rec { sha256 = "sha256-f9Nt303xXZzLSu3GtOEpyaL91WVFUmKO7mxi8UNX3go="; }; - patches = [ - # Backport upstream fix for gcc-13 support: - # https://github.com/nxp-imx/mfgtools/pull/360 - (fetchpatch { - name = "gcc-13.patch"; - url = "https://github.com/nxp-imx/mfgtools/commit/24fd043225903247f71ac10666d820277c0b10b1.patch"; - hash = "sha256-P7n6+Tiz10GIQ7QOd/qQ3BI7Wo5/66b0EwjFSpOUSJg="; - }) - ]; - nativeBuildInputs = [ cmake pkg-config installShellFiles ]; buildInputs = [ bzip2 libusb1 libzip openssl zstd ]; diff --git a/pkgs/development/tools/misc/rsonpath/default.nix b/pkgs/development/tools/misc/rsonpath/default.nix index fc9b48793faf4..76d6e4d4291ca 100644 --- a/pkgs/development/tools/misc/rsonpath/default.nix +++ b/pkgs/development/tools/misc/rsonpath/default.nix @@ -5,16 +5,16 @@ rustPlatform.buildRustPackage rec { pname = "rsonpath"; - version = "0.8.3"; + version = "0.8.4"; src = fetchFromGitHub { owner = "v0ldek"; repo = "rsonpath"; rev = "v${version}"; - hash = "sha256-gAoxWdczeaN4VqeQY0qJeLK8aABGhuwXf41QFKUxAG0="; + hash = "sha256-V7Ir1FGKjKYu/J2KSBaDwLdH/MHTS+aChHWcrVTu4dY="; }; - cargoHash = "sha256-UXPVqc4RNIFKx0f/BPCfkJxilioXbRZSAgqQv1MzK7k="; + cargoHash = "sha256-eiYUlHA4vK/zhfULwekt3dRVx//u5mrQ6tRdQh0tmTc="; cargoBuildFlags = [ "-p=rsonpath" ]; cargoTestFlags = cargoBuildFlags; diff --git a/pkgs/development/tools/mysql-shell/default.nix b/pkgs/development/tools/mysql-shell/default.nix index b12e13d28011a..ba362d65a237c 100644 --- a/pkgs/development/tools/mysql-shell/default.nix +++ b/pkgs/development/tools/mysql-shell/default.nix @@ -5,7 +5,6 @@ , fetchurl , git , cctools -, developer_cmds , DarwinTools , makeWrapper , CoreServices @@ -38,16 +37,16 @@ let in stdenv.mkDerivation (finalAttrs: { pname = "mysql-shell"; - version = "8.0.34"; + version = "8.0.35"; srcs = [ (fetchurl { url = "https://cdn.mysql.com//Downloads/MySQL-${lib.versions.majorMinor finalAttrs.version}/mysql-${finalAttrs.version}.tar.gz"; - hash = "sha256-5l0Do8QmGLX7+ZBCrtMyCUAumyeqYsfIdD/9R4jY2x0="; + hash = "sha256-kXxe04cE6ZIRGFzkviTjOowZyRJB7XOvQYGm840VdMI="; }) (fetchurl { url = "https://cdn.mysql.com//Downloads/MySQL-Shell/mysql-shell-${finalAttrs.version}-src.tar.gz"; - hash = "sha256-QY1PmhGw3PhqZ79+H/Xbb9uOvmrBlFQRS7idnV5OXF0="; + hash = "sha256-2Dn/RR5BWHMsD/QzKYPo8tqyAQGmHCGwVl2+bzNfy5I="; }) ]; @@ -66,7 +65,7 @@ stdenv.mkDerivation (finalAttrs: { nativeBuildInputs = [ pkg-config cmake git bison makeWrapper ] ++ lib.optionals (!stdenv.isDarwin) [ rpcsvc-proto ] - ++ lib.optionals stdenv.isDarwin [ cctools developer_cmds DarwinTools ]; + ++ lib.optionals stdenv.isDarwin [ cctools DarwinTools ]; buildInputs = [ boost diff --git a/pkgs/development/tools/mysql-shell/innovation.nix b/pkgs/development/tools/mysql-shell/innovation.nix index dda169be32dab..e7a12deb3ee40 100644 --- a/pkgs/development/tools/mysql-shell/innovation.nix +++ b/pkgs/development/tools/mysql-shell/innovation.nix @@ -5,7 +5,6 @@ , fetchurl , git , cctools -, developer_cmds , DarwinTools , makeWrapper , CoreServices @@ -36,8 +35,8 @@ let pythonDeps = with python3.pkgs; [ certifi paramiko pyyaml ]; - mysqlShellVersion = "8.1.1"; - mysqlServerVersion = "8.1.0"; + mysqlShellVersion = "8.2.0"; + mysqlServerVersion = "8.2.0"; in stdenv.mkDerivation (finalAttrs: { pname = "mysql-shell-innovation"; @@ -46,11 +45,11 @@ stdenv.mkDerivation (finalAttrs: { srcs = [ (fetchurl { url = "https://cdn.mysql.com//Downloads/MySQL-${lib.versions.majorMinor mysqlServerVersion}/mysql-${mysqlServerVersion}.tar.gz"; - hash = "sha256-PdAXqUBzSqkHlqTGXhJeZxL2S7u+M4jTZGneqoe1mes="; + hash = "sha256-itPj8cWuIVS+Y4rPVW6JgfcC0FKsxZV+d23xciwhGXk="; }) (fetchurl { url = "https://cdn.mysql.com//Downloads/MySQL-Shell/mysql-shell-${finalAttrs.version}-src.tar.gz"; - hash = "sha256-X7A2h9PWgQgNg7h64oD+Th/KsqP3UGpJ2etaP2B0VuY="; + hash = "sha256-kuRo+3vcDtc9aOgAuxJTy0e6E85iOFfCx/ZHtrNg08k="; }) ]; @@ -69,7 +68,7 @@ stdenv.mkDerivation (finalAttrs: { nativeBuildInputs = [ pkg-config cmake git bison makeWrapper ] ++ lib.optionals (!stdenv.isDarwin) [ rpcsvc-proto ] - ++ lib.optionals stdenv.isDarwin [ cctools developer_cmds DarwinTools ]; + ++ lib.optionals stdenv.isDarwin [ cctools DarwinTools ]; buildInputs = [ boost diff --git a/pkgs/development/tools/oxlint/default.nix b/pkgs/development/tools/oxlint/default.nix index 79afce5dd8301..48c7cbba56798 100644 --- a/pkgs/development/tools/oxlint/default.nix +++ b/pkgs/development/tools/oxlint/default.nix @@ -7,16 +7,16 @@ rustPlatform.buildRustPackage rec { pname = "oxlint"; - version = "0.0.14"; + version = "0.0.15"; src = fetchFromGitHub { owner = "web-infra-dev"; repo = "oxc"; rev = "oxlint_v${version}"; - hash = "sha256-qvUVS/PjocMX57z27Xu6tlqz5bXpvlTuC9ZF+ndfkW8="; + hash = "sha256-zjTJF8yU3Hb8CTzzsPdo2EJI7QriEsjUyXVwprb22xQ="; }; - cargoHash = "sha256-KGs9cEDvLXO26oNv867jMzaQs5I9+8go00FFSH6qexY="; + cargoHash = "sha256-mRmoCH0VVO9LhFfEd4VfDbCfl5VCpcIKBkaNzU0+9SU="; buildInputs = lib.optionals stdenv.isDarwin [ darwin.apple_sdk.frameworks.Security diff --git a/pkgs/development/tools/rust/cargo-dist/default.nix b/pkgs/development/tools/rust/cargo-dist/default.nix index 075363057bc81..95458eda9d461 100644 --- a/pkgs/development/tools/rust/cargo-dist/default.nix +++ b/pkgs/development/tools/rust/cargo-dist/default.nix @@ -13,16 +13,16 @@ rustPlatform.buildRustPackage rec { pname = "cargo-dist"; - version = "0.4.0"; + version = "0.4.1"; src = fetchFromGitHub { owner = "axodotdev"; repo = "cargo-dist"; rev = "v${version}"; - hash = "sha256-Y4dCkyOAOQRnaHWMuPTpjgIqlnzYw+sQbTyxp1pO7oo="; + hash = "sha256-P1wDsCMg0CfGZ9px1SiEDNT9plYlcrl9UrCLJ0pOra0="; }; - cargoHash = "sha256-Fuc5lToojwcRbcKrApQ8vxd8ZdjEJTDQULYfzV4K4GA="; + cargoHash = "sha256-sIFe5/2/FZA+vTYxo6wZ0w655ZjB8EThsEP7q1PaJjQ="; nativeBuildInputs = [ pkg-config @@ -33,7 +33,7 @@ rustPlatform.buildRustPackage rec { xz zstd ] ++ lib.optionals stdenv.isDarwin [ - darwin.apple_sdk.frameworks.Security + darwin.apple_sdk.frameworks.SystemConfiguration ]; nativeCheckInputs = [ diff --git a/pkgs/development/tools/rust/cargo-insta/default.nix b/pkgs/development/tools/rust/cargo-insta/default.nix index 18842a94a9976..36f13c7fc8900 100644 --- a/pkgs/development/tools/rust/cargo-insta/default.nix +++ b/pkgs/development/tools/rust/cargo-insta/default.nix @@ -5,18 +5,18 @@ rustPlatform.buildRustPackage rec { pname = "cargo-insta"; - version = "1.32.0"; + version = "1.33.0"; src = fetchFromGitHub { owner = "mitsuhiko"; repo = "insta"; rev = "refs/tags/${version}"; - hash = "sha256-s6d0q4K2UTG+BWzvH5KOAllzYAkEapEuDoiI9KQW31I="; + hash = "sha256-w/dxIQ7KRrn86PwiE/g5L9Gn8KszPF9u/zlwE/FYDu4="; }; sourceRoot = "${src.name}/cargo-insta"; - cargoHash = "sha256-ZQUzoKE3OGaY22VYiku7GqjGN9jUNx09a0EcgCRzzcM="; + cargoHash = "sha256-mEtmZ+wFo1WI1IMNYsVqSVScFDLdiXBbghH7c0l/3NQ="; meta = with lib; { description = "A Cargo subcommand for snapshot testing"; diff --git a/pkgs/development/tools/rust/cargo-make/default.nix b/pkgs/development/tools/rust/cargo-make/default.nix index f057155988c8a..fe02f0b78e0a7 100644 --- a/pkgs/development/tools/rust/cargo-make/default.nix +++ b/pkgs/development/tools/rust/cargo-make/default.nix @@ -10,16 +10,16 @@ rustPlatform.buildRustPackage rec { pname = "cargo-make"; - version = "0.37.2"; + version = "0.37.3"; src = fetchFromGitHub { owner = "sagiegurari"; repo = "cargo-make"; rev = version; - hash = "sha256-uYMPRbh2stIkNxehPnJPryIo+bGxDG7g+l4bTkEQWoY="; + hash = "sha256-7xWxIvMaoKZ1TVgfdBUDvK8VJzW6alrO8xFvSlMusOY="; }; - cargoHash = "sha256-CXGar3Xp6iBldBGOxjXRBGBwjNh4Kv6SwIkaNKEnkQs="; + cargoHash = "sha256-2I+VZD4KLTtoTIb2NNpfLcFH/lmD6Z/TTPJrr3FcZzI="; nativeBuildInputs = [ pkg-config ]; diff --git a/pkgs/development/tools/rust/cargo-modules/default.nix b/pkgs/development/tools/rust/cargo-modules/default.nix index 8b902499bf737..7712e9c9ffe53 100644 --- a/pkgs/development/tools/rust/cargo-modules/default.nix +++ b/pkgs/development/tools/rust/cargo-modules/default.nix @@ -2,16 +2,16 @@ rustPlatform.buildRustPackage rec { pname = "cargo-modules"; - version = "0.9.4"; + version = "0.10.2"; src = fetchFromGitHub { owner = "regexident"; repo = pname; rev = version; - hash = "sha256-BFASEf9WUVJHsakujjeBBxfxPYlsuzonqFuDLXmLgwc="; + hash = "sha256-71NRaIDWPbhDn6cfYhyZZzO2huQlj1vkKdBV6WJqI9s="; }; - cargoHash = "sha256-FojpC4RMrW0hZ0jvXxznxR6rKDDxrNMPoLoHEscOPEo="; + cargoHash = "sha256-lgqe9pXg/PE9WrXVpSJWYE6FUMGBgUDpEyJ31RSEj5A="; buildInputs = lib.optionals stdenv.isDarwin [ darwin.apple_sdk.frameworks.CoreServices diff --git a/pkgs/development/tools/rust/cargo-run-bin/default.nix b/pkgs/development/tools/rust/cargo-run-bin/default.nix index aa710f493cd9c..91d914422277e 100644 --- a/pkgs/development/tools/rust/cargo-run-bin/default.nix +++ b/pkgs/development/tools/rust/cargo-run-bin/default.nix @@ -5,14 +5,14 @@ rustPlatform.buildRustPackage rec { pname = "cargo-run-bin"; - version = "1.4.1"; + version = "1.5.0"; src = fetchCrate { inherit pname version; - hash = "sha256-imp7TzSVWo6l23tQu2oMMdVj/3sT9mU+lIBc0cVwO+s="; + hash = "sha256-FPkZk5qKHrRR3V8s04yLgOVOKj+Rln3Cu/VW2bnr2fE="; }; - cargoHash = "sha256-TQOFXFdfD4iVy4K9IjcX0L7zLeNw9RAHb2WE5rERP/0="; + cargoHash = "sha256-aFHuIEDpGCel1FC7D0hTUmzHbEj7wVarsE0wNZ/3Khw="; # multiple impurities in tests doCheck = false; diff --git a/pkgs/development/tools/rust/cargo-semver-checks/default.nix b/pkgs/development/tools/rust/cargo-semver-checks/default.nix index 00976e8b015d3..4143c08da5e72 100644 --- a/pkgs/development/tools/rust/cargo-semver-checks/default.nix +++ b/pkgs/development/tools/rust/cargo-semver-checks/default.nix @@ -10,16 +10,16 @@ rustPlatform.buildRustPackage rec { pname = "cargo-semver-checks"; - version = "0.24.1"; + version = "0.24.2"; src = fetchFromGitHub { owner = "obi1kenobi"; repo = pname; rev = "v${version}"; - hash = "sha256-RElxCmffF1PKSgg9ATI7zY/lqD+vUaW/rnKtk7VEa+c="; + hash = "sha256-bfkRuFVlKfzyTomFhgnxbDj76Mfq/Q/Y3ZQUuMpkYQ0="; }; - cargoHash = "sha256-ozd8bjsVCmUunFLXb/bdeMQZ1VjNPLnccO1fxp0N3m4="; + cargoHash = "sha256-poPTFF+XCAHhHftxOOPaN+dixX2uqtZVfn20DB+cZ5o="; nativeBuildInputs = [ cmake diff --git a/pkgs/development/web/lucky-cli/default.nix b/pkgs/development/web/lucky-cli/default.nix index 44b4af440800d..3d420158caf01 100644 --- a/pkgs/development/web/lucky-cli/default.nix +++ b/pkgs/development/web/lucky-cli/default.nix @@ -2,13 +2,13 @@ crystal.buildCrystalPackage rec { pname = "lucky-cli"; - version = "1.0.0"; + version = "1.1.0"; src = fetchFromGitHub { owner = "luckyframework"; repo = "lucky_cli"; rev = "v${version}"; - hash = "sha256-Ky4DmClSyAVBAetpZM5tFnQZ74fchCOgcxBftd+gwlE="; + hash = "sha256-mDUx9cQoYpU9kSAls36kzNVYZ8a4aqHEMIWfzS41NBk="; }; # the integration tests will try to clone a remote repos @@ -39,6 +39,6 @@ crystal.buildCrystalPackage rec { maintainers = with maintainers; [ peterhoeg ]; mainProgram = "lucky"; platforms = platforms.unix; - broken = lib.versionOlder crystal.version "0.35.1"; + broken = lib.versionOlder crystal.version "1.6.0"; }; } diff --git a/pkgs/development/web/lucky-cli/shard.lock b/pkgs/development/web/lucky-cli/shard.lock index 9bf2212760ad1..b9956fd780df3 100644 --- a/pkgs/development/web/lucky-cli/shard.lock +++ b/pkgs/development/web/lucky-cli/shard.lock @@ -2,17 +2,17 @@ version: 2.0 shards: ameba: git: https://github.com/crystal-ameba/ameba.git - version: 1.1.0 + version: 1.5.0 lucky_task: git: https://github.com/luckyframework/lucky_task.git - version: 0.1.1 + version: 0.3.0 + + lucky_template: + git: https://github.com/luckyframework/lucky_template.git + version: 0.2.0 nox: - git: https://github.com/matthewmcgarvey/nox.git + git: https://github.com/crystal-loot/nox.git version: 0.2.2 - teeplate: - git: https://github.com/luckyframework/teeplate.git - version: 0.8.5 - diff --git a/pkgs/development/web/lucky-cli/shards.nix b/pkgs/development/web/lucky-cli/shards.nix index fef8c1602ba14..a06b87c5029ae 100644 --- a/pkgs/development/web/lucky-cli/shards.nix +++ b/pkgs/development/web/lucky-cli/shards.nix @@ -1,22 +1,22 @@ { ameba = { url = "https://github.com/crystal-ameba/ameba.git"; - rev = "v1.1.0"; - sha256 = "0famv413myrshgv6y24mr84ny53rcsr777x323jlaf2isnhdd0b8"; + rev = "v1.5.0"; + sha256 = "1idivsbpmi40aqvs82fsv37nrgikirprxrj3ls9chsb876fq9p2d"; }; lucky_task = { url = "https://github.com/luckyframework/lucky_task.git"; - rev = "v0.1.1"; - sha256 = "0w0rnf22pvj3lp5z8c4sshzwhqgwpbjpm7nry9mf0iz3fa0v48f7"; + rev = "v0.3.0"; + sha256 = "0lp2wv01wdcfr3h43n3dqgaymvypy0i6kbffb4mg4l30lijgpfb6"; + }; + lucky_template = { + url = "https://github.com/luckyframework/lucky_template.git"; + rev = "v0.2.0"; + sha256 = "1xix82d0xanq4xkcv83hm56nj5f2rsbrqhk70j5zr37d3kydfypl"; }; nox = { - url = "https://github.com/matthewmcgarvey/nox.git"; + url = "https://github.com/crystal-loot/nox.git"; rev = "v0.2.2"; sha256 = "1dfq0aknrxwp9wc0glri4w5j8pfbc6b1xrsxkahci109p6dhcna5"; }; - teeplate = { - url = "https://github.com/luckyframework/teeplate.git"; - rev = "v0.8.5"; - sha256 = "1kr05qrp674rph1324wry57gzvgvcvlz0w27brlvdgd3gi4s8sdj"; - }; } diff --git a/pkgs/development/web/minify/default.nix b/pkgs/development/web/minify/default.nix index 86ef8a4759f2f..5abee5df3fd83 100644 --- a/pkgs/development/web/minify/default.nix +++ b/pkgs/development/web/minify/default.nix @@ -9,16 +9,16 @@ buildGoModule rec { pname = "minify"; - version = "2.19.10"; + version = "2.20.1"; src = fetchFromGitHub { owner = "tdewolff"; repo = pname; rev = "v${version}"; - hash = "sha256-/OfNHhWbRZI7nRhBnjXfxL4Gf011ydlwEMDadCptFJY="; + hash = "sha256-NcvgY3Aw3v8JpVc3Sfe2mFi6FFCojnUlhORgOElIaiM="; }; - vendorHash = "sha256-ZtQbhhdt9mGRbTpgm6O4wnSPoKF9bAEswppmK+Urqhs="; + vendorHash = "sha256-oTdHfvLGekcdppn9w1gZ18CY0vuuf9z6GsNUHncDFFs="; nativeBuildInputs = [ installShellFiles ]; diff --git a/pkgs/games/brogue-ce/default.nix b/pkgs/games/brogue-ce/default.nix index 0691d82f175a2..7532be8d1957f 100644 --- a/pkgs/games/brogue-ce/default.nix +++ b/pkgs/games/brogue-ce/default.nix @@ -9,13 +9,13 @@ stdenv.mkDerivation rec { pname = "brogue-ce"; - version = "1.12"; + version = "1.13"; src = fetchFromGitHub { owner = "tmewett"; repo = "BrogueCE"; rev = "v${version}"; - hash = "sha256-bGAE0hRiKBo3ikyObGxAiPRRO24KtC+upO3XLj+f4yo="; + hash = "sha256-FUIdi1Ytn+INeD9550MW41qXtLb6in0QS3Snt8QaXUA="; }; postPatch = '' diff --git a/pkgs/games/doom-ports/slade/git.nix b/pkgs/games/doom-ports/slade/git.nix index 1df734af5e009..7ecc5d5d1b6a1 100644 --- a/pkgs/games/doom-ports/slade/git.nix +++ b/pkgs/games/doom-ports/slade/git.nix @@ -15,17 +15,18 @@ , glew , lua , mpg123 +, unstableGitUpdater }: stdenv.mkDerivation rec { pname = "slade"; - version = "unstable-2022-08-15"; + version = "unstable-2023-09-30"; src = fetchFromGitHub { owner = "sirjuddington"; repo = "SLADE"; - rev = "1a0d25eec54f9ca2eb3667676d93fb0b6b6aea26"; - sha256 = "sha256-mtaJr4HJbp2UnzwaLq12V69DqPYDmSNqMGiuPpMlznI="; + rev = "d05af4bd3a9a655dfe17d02760bab3542cc0b909"; + sha256 = "sha256-lzTSE0WH+4fOad9E/pL3LDc4L151W0hFEmD0zsS0gpQ="; }; postPatch = lib.optionalString (!stdenv.hostPlatform.isx86) '' @@ -58,6 +59,10 @@ stdenv.mkDerivation rec { env.NIX_CFLAGS_COMPILE = "-Wno-narrowing"; + passthru.updateScript = unstableGitUpdater { + url = "https://github.com/sirjuddington/SLADE.git"; + }; + meta = with lib; { description = "Doom editor"; homepage = "http://slade.mancubus.net/"; diff --git a/pkgs/games/minecraft-servers/versions.json b/pkgs/games/minecraft-servers/versions.json index 142ef4e51c5d3..67d2f4cab635a 100644 --- a/pkgs/games/minecraft-servers/versions.json +++ b/pkgs/games/minecraft-servers/versions.json @@ -1,8 +1,8 @@ { "1.20": { - "url": "https://piston-data.mojang.com/v1/objects/84194a2f286ef7c14ed7ce0090dba59902951553/server.jar", - "sha1": "84194a2f286ef7c14ed7ce0090dba59902951553", - "version": "1.20.1", + "url": "https://piston-data.mojang.com/v1/objects/5b868151bd02b41319f54c8d4061b8cae84e665c/server.jar", + "sha1": "5b868151bd02b41319f54c8d4061b8cae84e665c", + "version": "1.20.2", "javaVersion": 17 }, "1.19": { diff --git a/pkgs/misc/vencord/default.nix b/pkgs/misc/vencord/default.nix index 02c4025ba463e..34cd82b552920 100644 --- a/pkgs/misc/vencord/default.nix +++ b/pkgs/misc/vencord/default.nix @@ -5,8 +5,8 @@ , buildWebExtension ? false }: let - version = "1.6.0"; - gitHash = "ffe6bb1"; + version = "1.6.1"; + gitHash = "a9e67e2"; in buildNpmPackage rec { pname = "vencord"; @@ -34,7 +34,7 @@ buildNpmPackage rec { npmRebuildFlags = [ "|| true" ]; makeCacheWritable = true; - npmDepsHash = "sha256-H2f6xdAa7fNETbQhIv+InCB7+O4nq0bx+RILjGjqXdY="; + npmDepsHash = "sha256-PWasfMX75emOwOtHd4FrVA6TDfFcOowXsAxgZqMsgP8="; npmFlags = [ "--legacy-peer-deps" ]; npmBuildScript = if buildWebExtension then "buildWeb" else "build"; npmBuildFlags = [ "--" "--standalone" "--disable-updater" ]; diff --git a/pkgs/misc/vencord/package-lock.json b/pkgs/misc/vencord/package-lock.json index ad21cfc0c8581..933bf6d638858 100644 --- a/pkgs/misc/vencord/package-lock.json +++ b/pkgs/misc/vencord/package-lock.json @@ -1,12 +1,12 @@ { "name": "vencord", - "version": "1.6.0", + "version": "1.6.1", "lockfileVersion": 3, "requires": true, "packages": { "": { "name": "vencord", - "version": "1.6.0", + "version": "1.6.1", "license": "GPL-3.0-or-later", "dependencies": { "@sapphi-red/web-noise-suppressor": "0.3.3", @@ -1177,9 +1177,9 @@ } }, "node_modules/acorn": { - "version": "8.10.0", - "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.10.0.tgz", - "integrity": "sha512-F0SAmZ8iUtS//m8DmCTA0jlh6TDKkHQyK6xc6V4KDTyZKA9dnvX9/3sRTVQrWm79glUAZbnmmNcdYwUIHWVybw==", + "version": "8.11.2", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.11.2.tgz", + "integrity": "sha512-nc0Axzp/0FILLEVsm4fNwLCwMttvhEI263QtVPQcbpfZZ3ts0hLsZGOpE6czNlid7CJ9MlyH8reXkpsf3YUY4w==", "dev": true, "bin": { "acorn": "bin/acorn" @@ -1596,75 +1596,17 @@ "node": ">=0.10.0" } }, - "node_modules/class-utils/node_modules/is-accessor-descriptor": { - "version": "0.1.6", - "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", - "integrity": "sha512-e1BM1qnDbMRG3ll2U9dSK0UMHuWOs3pY3AtcFsmvwPtKL3MML/Q86i+GilLfvqEs4GW+ExB91tQ3Ig9noDIZ+A==", - "dev": true, - "dependencies": { - "kind-of": "^3.0.2" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/class-utils/node_modules/is-accessor-descriptor/node_modules/kind-of": { - "version": "3.2.2", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", - "integrity": "sha512-NOW9QQXMoZGg/oqnVNoNTTIFEIid1627WCffUBJEdMxYApq7mNE7CpzucIPc+ZQg25Phej7IJSmX3hO+oblOtQ==", - "dev": true, - "dependencies": { - "is-buffer": "^1.1.5" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/class-utils/node_modules/is-data-descriptor": { - "version": "0.1.4", - "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", - "integrity": "sha512-+w9D5ulSoBNlmw9OHn3U2v51SyoCd0he+bB3xMl62oijhrspxowjU+AIcDY0N3iEJbUEkB15IlMASQsxYigvXg==", - "dev": true, - "dependencies": { - "kind-of": "^3.0.2" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/class-utils/node_modules/is-data-descriptor/node_modules/kind-of": { - "version": "3.2.2", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", - "integrity": "sha512-NOW9QQXMoZGg/oqnVNoNTTIFEIid1627WCffUBJEdMxYApq7mNE7CpzucIPc+ZQg25Phej7IJSmX3hO+oblOtQ==", - "dev": true, - "dependencies": { - "is-buffer": "^1.1.5" - }, - "engines": { - "node": ">=0.10.0" - } - }, "node_modules/class-utils/node_modules/is-descriptor": { - "version": "0.1.6", - "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", - "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.7.tgz", + "integrity": "sha512-C3grZTvObeN1xud4cRWl366OMXZTj0+HGyk4hvfpx4ZHt1Pb60ANSXqCK7pdOTeUQpRzECBSTphqvD7U+l22Eg==", "dev": true, "dependencies": { - "is-accessor-descriptor": "^0.1.6", - "is-data-descriptor": "^0.1.4", - "kind-of": "^5.0.0" + "is-accessor-descriptor": "^1.0.1", + "is-data-descriptor": "^1.0.1" }, "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/class-utils/node_modules/kind-of": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", - "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", - "dev": true, - "engines": { - "node": ">=0.10.0" + "node": ">= 0.4" } }, "node_modules/cliui": { @@ -3261,15 +3203,15 @@ "dev": true }, "node_modules/is-accessor-descriptor": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", - "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.1.tgz", + "integrity": "sha512-YBUanLI8Yoihw923YeFUS5fs0fF2f5TSFTNiYAAzhhDscDa3lEqYuz1pDOEP5KvX94I9ey3vsqjJcLVFVU+3QA==", "dev": true, "dependencies": { - "kind-of": "^6.0.0" + "hasown": "^2.0.0" }, "engines": { - "node": ">=0.10.0" + "node": ">= 0.10" } }, "node_modules/is-arrayish": { @@ -3297,29 +3239,28 @@ } }, "node_modules/is-data-descriptor": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", - "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.1.tgz", + "integrity": "sha512-bc4NlCDiCr28U4aEsQ3Qs2491gVq4V8G7MQyws968ImqjKuYtTJXrl7Vq7jsN7Ly/C3xj5KWFrY7sHNeDkAzXw==", "dev": true, "dependencies": { - "kind-of": "^6.0.0" + "hasown": "^2.0.0" }, "engines": { - "node": ">=0.10.0" + "node": ">= 0.4" } }, "node_modules/is-descriptor": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", - "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.3.tgz", + "integrity": "sha512-JCNNGbwWZEVaSPtS45mdtrneRWJFp07LLmykxeFV5F6oBvNF8vHSfJuJgoT472pSfk+Mf8VnlrspaFBHWM8JAw==", "dev": true, "dependencies": { - "is-accessor-descriptor": "^1.0.0", - "is-data-descriptor": "^1.0.0", - "kind-of": "^6.0.2" + "is-accessor-descriptor": "^1.0.1", + "is-data-descriptor": "^1.0.1" }, "engines": { - "node": ">=0.10.0" + "node": ">= 0.4" } }, "node_modules/is-extendable": { @@ -3896,51 +3837,17 @@ "node": ">=0.10.0" } }, - "node_modules/object-copy/node_modules/is-accessor-descriptor": { - "version": "0.1.6", - "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", - "integrity": "sha512-e1BM1qnDbMRG3ll2U9dSK0UMHuWOs3pY3AtcFsmvwPtKL3MML/Q86i+GilLfvqEs4GW+ExB91tQ3Ig9noDIZ+A==", - "dev": true, - "dependencies": { - "kind-of": "^3.0.2" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/object-copy/node_modules/is-data-descriptor": { - "version": "0.1.4", - "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", - "integrity": "sha512-+w9D5ulSoBNlmw9OHn3U2v51SyoCd0he+bB3xMl62oijhrspxowjU+AIcDY0N3iEJbUEkB15IlMASQsxYigvXg==", - "dev": true, - "dependencies": { - "kind-of": "^3.0.2" - }, - "engines": { - "node": ">=0.10.0" - } - }, "node_modules/object-copy/node_modules/is-descriptor": { - "version": "0.1.6", - "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", - "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.7.tgz", + "integrity": "sha512-C3grZTvObeN1xud4cRWl366OMXZTj0+HGyk4hvfpx4ZHt1Pb60ANSXqCK7pdOTeUQpRzECBSTphqvD7U+l22Eg==", "dev": true, "dependencies": { - "is-accessor-descriptor": "^0.1.6", - "is-data-descriptor": "^0.1.4", - "kind-of": "^5.0.0" + "is-accessor-descriptor": "^1.0.1", + "is-data-descriptor": "^1.0.1" }, "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/object-copy/node_modules/is-descriptor/node_modules/kind-of": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", - "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", - "dev": true, - "engines": { - "node": ">=0.10.0" + "node": ">= 0.4" } }, "node_modules/object-copy/node_modules/kind-of": { @@ -4735,66 +4642,17 @@ "node": ">=0.10.0" } }, - "node_modules/snapdragon/node_modules/is-accessor-descriptor": { - "version": "0.1.6", - "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", - "integrity": "sha512-e1BM1qnDbMRG3ll2U9dSK0UMHuWOs3pY3AtcFsmvwPtKL3MML/Q86i+GilLfvqEs4GW+ExB91tQ3Ig9noDIZ+A==", - "dev": true, - "dependencies": { - "kind-of": "^3.0.2" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/snapdragon/node_modules/is-accessor-descriptor/node_modules/kind-of": { - "version": "3.2.2", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", - "integrity": "sha512-NOW9QQXMoZGg/oqnVNoNTTIFEIid1627WCffUBJEdMxYApq7mNE7CpzucIPc+ZQg25Phej7IJSmX3hO+oblOtQ==", - "dev": true, - "dependencies": { - "is-buffer": "^1.1.5" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/snapdragon/node_modules/is-data-descriptor": { - "version": "0.1.4", - "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", - "integrity": "sha512-+w9D5ulSoBNlmw9OHn3U2v51SyoCd0he+bB3xMl62oijhrspxowjU+AIcDY0N3iEJbUEkB15IlMASQsxYigvXg==", - "dev": true, - "dependencies": { - "kind-of": "^3.0.2" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/snapdragon/node_modules/is-data-descriptor/node_modules/kind-of": { - "version": "3.2.2", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", - "integrity": "sha512-NOW9QQXMoZGg/oqnVNoNTTIFEIid1627WCffUBJEdMxYApq7mNE7CpzucIPc+ZQg25Phej7IJSmX3hO+oblOtQ==", - "dev": true, - "dependencies": { - "is-buffer": "^1.1.5" - }, - "engines": { - "node": ">=0.10.0" - } - }, "node_modules/snapdragon/node_modules/is-descriptor": { - "version": "0.1.6", - "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", - "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.7.tgz", + "integrity": "sha512-C3grZTvObeN1xud4cRWl366OMXZTj0+HGyk4hvfpx4ZHt1Pb60ANSXqCK7pdOTeUQpRzECBSTphqvD7U+l22Eg==", "dev": true, "dependencies": { - "is-accessor-descriptor": "^0.1.6", - "is-data-descriptor": "^0.1.4", - "kind-of": "^5.0.0" + "is-accessor-descriptor": "^1.0.1", + "is-data-descriptor": "^1.0.1" }, "engines": { - "node": ">=0.10.0" + "node": ">= 0.4" } }, "node_modules/snapdragon/node_modules/is-extendable": { @@ -4806,15 +4664,6 @@ "node": ">=0.10.0" } }, - "node_modules/snapdragon/node_modules/kind-of": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", - "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", - "dev": true, - "engines": { - "node": ">=0.10.0" - } - }, "node_modules/snapdragon/node_modules/ms": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", @@ -4957,75 +4806,17 @@ "node": ">=0.10.0" } }, - "node_modules/static-extend/node_modules/is-accessor-descriptor": { - "version": "0.1.6", - "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", - "integrity": "sha512-e1BM1qnDbMRG3ll2U9dSK0UMHuWOs3pY3AtcFsmvwPtKL3MML/Q86i+GilLfvqEs4GW+ExB91tQ3Ig9noDIZ+A==", - "dev": true, - "dependencies": { - "kind-of": "^3.0.2" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/static-extend/node_modules/is-accessor-descriptor/node_modules/kind-of": { - "version": "3.2.2", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", - "integrity": "sha512-NOW9QQXMoZGg/oqnVNoNTTIFEIid1627WCffUBJEdMxYApq7mNE7CpzucIPc+ZQg25Phej7IJSmX3hO+oblOtQ==", - "dev": true, - "dependencies": { - "is-buffer": "^1.1.5" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/static-extend/node_modules/is-data-descriptor": { - "version": "0.1.4", - "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", - "integrity": "sha512-+w9D5ulSoBNlmw9OHn3U2v51SyoCd0he+bB3xMl62oijhrspxowjU+AIcDY0N3iEJbUEkB15IlMASQsxYigvXg==", - "dev": true, - "dependencies": { - "kind-of": "^3.0.2" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/static-extend/node_modules/is-data-descriptor/node_modules/kind-of": { - "version": "3.2.2", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", - "integrity": "sha512-NOW9QQXMoZGg/oqnVNoNTTIFEIid1627WCffUBJEdMxYApq7mNE7CpzucIPc+ZQg25Phej7IJSmX3hO+oblOtQ==", - "dev": true, - "dependencies": { - "is-buffer": "^1.1.5" - }, - "engines": { - "node": ">=0.10.0" - } - }, "node_modules/static-extend/node_modules/is-descriptor": { - "version": "0.1.6", - "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", - "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.7.tgz", + "integrity": "sha512-C3grZTvObeN1xud4cRWl366OMXZTj0+HGyk4hvfpx4ZHt1Pb60ANSXqCK7pdOTeUQpRzECBSTphqvD7U+l22Eg==", "dev": true, "dependencies": { - "is-accessor-descriptor": "^0.1.6", - "is-data-descriptor": "^0.1.4", - "kind-of": "^5.0.0" + "is-accessor-descriptor": "^1.0.1", + "is-data-descriptor": "^1.0.1" }, "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/static-extend/node_modules/kind-of": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", - "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", - "dev": true, - "engines": { - "node": ">=0.10.0" + "node": ">= 0.4" } }, "node_modules/string_decoder": { diff --git a/pkgs/os-specific/darwin/sketchybar/default.nix b/pkgs/os-specific/darwin/sketchybar/default.nix index 60eb45558469c..702da5a1718b7 100644 --- a/pkgs/os-specific/darwin/sketchybar/default.nix +++ b/pkgs/os-specific/darwin/sketchybar/default.nix @@ -2,6 +2,7 @@ , stdenv , fetchFromGitHub , AppKit +, Carbon , CoreAudio , CoreWLAN , CoreVideo @@ -21,17 +22,18 @@ let in stdenv.mkDerivation (finalAttrs: { pname = "sketchybar"; - version = "2.17.1"; + version = "2.18.0"; src = fetchFromGitHub { owner = "FelixKratz"; repo = "SketchyBar"; rev = "v${finalAttrs.version}"; - hash = "sha256-QilZurp4QkwOo4jbYXMs4SesqyXXsEgF8dDwt/Kv94s="; + hash = "sha256-GeFB+eE/NW9ZopwVSmSfMK3WiJLCJNXOdmQpYc3m8WE="; }; buildInputs = [ AppKit + Carbon CoreAudio CoreWLAN CoreVideo diff --git a/pkgs/os-specific/linux/firmware/linux-firmware/source.nix b/pkgs/os-specific/linux/firmware/linux-firmware/source.nix index 09f14bc729bc9..722970e8945c1 100644 --- a/pkgs/os-specific/linux/firmware/linux-firmware/source.nix +++ b/pkgs/os-specific/linux/firmware/linux-firmware/source.nix @@ -1,7 +1,7 @@ # This file is autogenerated! Run ./update.sh to regenerate. { - version = "20230919"; - revision = "20230919"; - sourceHash = "sha256-xcGEaWCcCAhN4gnnaj03u7LekP4+cRtcioTYhvAOQtg="; - outputHash = "sha256-6W9QTShp/UzlcILwyyn56wppQORUGPff2TodEt4qhwQ="; + version = "20231030"; + revision = "20231030"; + sourceHash = "sha256-ocqikHJfvs4gWqnBeLgSnXHzUTPi8l8cSfNarhD8G3w="; + outputHash = "sha256-vaMYuAqkkuyY+bAxAe0uAokWZ7HlaR62UTu4L8yOofs="; } diff --git a/pkgs/os-specific/linux/hd-idle/default.nix b/pkgs/os-specific/linux/hd-idle/default.nix index 77caa13159841..13cb397b17980 100644 --- a/pkgs/os-specific/linux/hd-idle/default.nix +++ b/pkgs/os-specific/linux/hd-idle/default.nix @@ -2,13 +2,13 @@ buildGoModule rec { pname = "hd-idle"; - version = "1.20"; + version = "1.21"; src = fetchFromGitHub { owner = "adelolmo"; repo = pname; rev = "v${version}"; - sha256 = "sha256-7EXfI3E83ltpjq2M/qZX2P/bNtQQBWZRBCD7i5uit0I="; + sha256 = "sha256-WHJcysTN9LHI1WnDuFGTyTirxXirpLpJIeNDj4sZGY0="; }; vendorHash = null; diff --git a/pkgs/os-specific/linux/kernel/common-config.nix b/pkgs/os-specific/linux/kernel/common-config.nix index ceb34fe0c76fa..0f59d3ac7aad7 100644 --- a/pkgs/os-specific/linux/kernel/common-config.nix +++ b/pkgs/os-specific/linux/kernel/common-config.nix @@ -558,6 +558,8 @@ let PERSISTENT_KEYRINGS = yes; # enable temporary caching of the last request_key() result KEYS_REQUEST_CACHE = whenAtLeast "5.3" yes; + # randomized slab caches + RANDOM_KMALLOC_CACHES = whenAtLeast "6.6" yes; } // optionalAttrs stdenv.hostPlatform.isx86_64 { # Enable Intel SGX X86_SGX = whenAtLeast "5.11" yes; @@ -572,6 +574,8 @@ let KVM_AMD_SEV = yes; # AMD SEV-SNP SEV_GUEST = whenAtLeast "5.19" module; + # Shadow stacks + X86_USER_SHADOW_STACK = whenAtLeast "6.6" yes; }; microcode = { diff --git a/pkgs/os-specific/linux/kernel/kernels-org.json b/pkgs/os-specific/linux/kernel/kernels-org.json index 926a172a72405..ab2775ab922d7 100644 --- a/pkgs/os-specific/linux/kernel/kernels-org.json +++ b/pkgs/os-specific/linux/kernel/kernels-org.json @@ -34,5 +34,9 @@ "4.14": { "version": "4.14.328", "hash": "sha256:1igcpvnhwwrczfdsafmszvi0456k7f6j4cgpfw6v6afw09p95d8x" + }, + "6.6": { + "version": "6.6", + "hash": "sha256:1l2nisx9lf2vdgkq910n5ldbi8z25ky1zvl67zgwg2nxcdna09nr" } } diff --git a/pkgs/os-specific/linux/kernel/xanmod-kernels.nix b/pkgs/os-specific/linux/kernel/xanmod-kernels.nix index 336c8c7fc3254..43969919fb0fc 100644 --- a/pkgs/os-specific/linux/kernel/xanmod-kernels.nix +++ b/pkgs/os-specific/linux/kernel/xanmod-kernels.nix @@ -3,14 +3,14 @@ let # These names are how they are designated in https://xanmod.org. ltsVariant = { - version = "6.1.58"; - hash = "sha256-Lnp1CSh1jLbIkEx9hLfxhdIA12iQZmywhOec9uZ7UjI="; + version = "6.1.60"; + hash = "sha256-KYCeONJxyFPee4pvBLRw/MBTzPU7D2oZCrAVr3t/yPM="; variant = "lts"; }; mainVariant = { - version = "6.5.8"; - hash = "sha256-lHi+O7RE6YdiqPmuxHajGkc7jS9F5cB89+JbTVKkB/c="; + version = "6.5.9"; + hash = "sha256-5SFPBsDTmq7tA6pyM7rbIjBPAtPbqhUl6VfA2z5baPA="; variant = "main"; }; diff --git a/pkgs/os-specific/linux/lenovo-legion/app.nix b/pkgs/os-specific/linux/lenovo-legion/app.nix index fe5535eea8db9..a409ad2fbf4d7 100644 --- a/pkgs/os-specific/linux/lenovo-legion/app.nix +++ b/pkgs/os-specific/linux/lenovo-legion/app.nix @@ -2,13 +2,13 @@ python3.pkgs.buildPythonApplication rec { pname = "lenovo-legion-app"; - version = "0.0.5"; + version = "0.0.9"; src = fetchFromGitHub { owner = "johnfanv2"; repo = "LenovoLegionLinux"; - rev = "v${version}-prerelease"; - sha256 = "sha256-s4JFFmawokdC4qoqNvZDhuJSinhQ3YKSIfAYi79VTTA="; + rev = "v${version}-prerelese"; + hash = "sha256-P4vqzNX2nF4LnoQDOV8WEiXAICQCyjj9xPpFNvMu93k="; }; sourceRoot = "${src.name}/python/legion_linux"; @@ -19,15 +19,22 @@ python3.pkgs.buildPythonApplication rec { pyqt5 argcomplete pyyaml + darkdetect xorg.libxcb libsForQt5.qtbase ]; - postInstall = '' - cp -r ./{legion.py,legion_cli.py,legion_gui.py} $out/${python3.sitePackages} - cp ./legion_logo.png $out/${python3.sitePackages}/legion_logo.png + postPatch = '' + substituteInPlace ./setup.cfg \ + --replace "_VERSION" "${version}" + substituteInPlace ../../extra/service/fancurve-set \ + --replace "FOLDER=/etc/legion_linux/" "FOLDER=$out/share/legion_linux" + substituteInPlace ./legion_linux/legion.py \ + --replace "/etc/legion_linux" "$out/share/legion_linux" + ''; - rm -rf $out/data + postInstall = '' + cp ./legion_linux/legion_logo.png $out/${python3.sitePackages}/legion_logo.png ''; dontWrapQtApps = true; diff --git a/pkgs/os-specific/linux/nvme-cli/default.nix b/pkgs/os-specific/linux/nvme-cli/default.nix index 425fd1cc61e5f..e0d0372fd6ff2 100644 --- a/pkgs/os-specific/linux/nvme-cli/default.nix +++ b/pkgs/os-specific/linux/nvme-cli/default.nix @@ -33,7 +33,7 @@ stdenv.mkDerivation rec { libnvme json_c zlib - ] ++ lib.optionals (!(stdenv.hostPlatform.isStatic || stdenv.hostPlatform.isMusl)) [ + ] ++ lib.optionals (lib.meta.availableOn stdenv.hostPlatform libhugetlbfs) [ libhugetlbfs ]; diff --git a/pkgs/pkgs-lib/formats.nix b/pkgs/pkgs-lib/formats.nix index 3a47d3dc849ce..3cbda3a7ebdd9 100644 --- a/pkgs/pkgs-lib/formats.nix +++ b/pkgs/pkgs-lib/formats.nix @@ -28,12 +28,19 @@ rec { generate = ...; }); + + Please note that `pkgs` may not always be available for use due to the split + options doc build introduced in fc614c37c653, so lazy evaluation of only the + 'type' field is required. + */ inherit (import ./formats/java-properties/default.nix { inherit lib pkgs; }) javaProperties; + libconfig = (import ./formats/libconfig/default.nix { inherit lib pkgs; }).format; + json = {}: { type = with lib.types; let diff --git a/pkgs/pkgs-lib/formats/libconfig/default.nix b/pkgs/pkgs-lib/formats/libconfig/default.nix new file mode 100644 index 0000000000000..7433a72853533 --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/default.nix @@ -0,0 +1,121 @@ +{ lib +, pkgs +}: +let + inherit (pkgs) buildPackages callPackage; + # Implementation notes: + # Libconfig spec: https://hyperrealm.github.io/libconfig/libconfig_manual.html + # + # Since libconfig does not allow setting names to start with an underscore, + # this is used as a prefix for both special types and include directives. + # + # The difference between 32bit and 64bit values became optional in libconfig + # 1.5, so we assume 64bit values for all numbers. + + libconfig-generator = buildPackages.rustPlatform.buildRustPackage { + name = "libconfig-generator"; + version = "0.1.0"; + src = ./src; + + passthru.updateScript = ./update.sh; + + cargoLock.lockFile = ./src/Cargo.lock; + }; + + libconfig-validator = buildPackages.runCommandCC "libconfig-validator" + { + buildInputs = with buildPackages; [ libconfig ]; + } + '' + mkdir -p "$out/bin" + $CC -lconfig -x c - -o "$out/bin/libconfig-validator" ${./validator.c} + ''; +in +{ + format = { generator ? libconfig-generator, validator ? libconfig-validator }: { + inherit generator; + + type = with lib.types; + let + valueType = (oneOf [ + bool + int + float + str + path + (attrsOf valueType) + (listOf valueType) + ]) // { + description = "libconfig value"; + }; + in + attrsOf valueType; + + lib = { + mkHex = value: { + _type = "hex"; + inherit value; + }; + mkOctal = value: { + _type = "octal"; + inherit value; + }; + mkFloat = value: { + _type = "float"; + inherit value; + }; + mkArray = value: { + _type = "array"; + inherit value; + }; + mkList = value: { + _type = "list"; + inherit value; + }; + }; + + generate = name: value: + callPackage + ({ + stdenvNoCC + , libconfig-generator + , libconfig-validator + , writeText + }: stdenvNoCC.mkDerivation rec { + inherit name; + + dontUnpack = true; + + json = builtins.toJSON value; + passAsFile = [ "json" ]; + + strictDeps = true; + nativeBuildInputs = [ libconfig-generator ]; + buildPhase = '' + runHook preBuild + libconfig-generator < $jsonPath > output.cfg + runHook postBuild + ''; + + doCheck = true; + nativeCheckInputs = [ libconfig-validator ]; + checkPhase = '' + runHook preCheck + libconfig-validator output.cfg + runHook postCheck + ''; + + installPhase = '' + runHook preInstall + mv output.cfg $out + runHook postInstall + ''; + + passthru.json = writeText "${name}.json" json; + }) + { + libconfig-generator = generator; + libconfig-validator = validator; + }; + }; +} diff --git a/pkgs/pkgs-lib/formats/libconfig/src/Cargo.lock b/pkgs/pkgs-lib/formats/libconfig/src/Cargo.lock new file mode 100644 index 0000000000000..f8f921f996f92 --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/src/Cargo.lock @@ -0,0 +1,40 @@ +# This file is automatically @generated by Cargo. +# It is not intended for manual editing. +version = 3 + +[[package]] +name = "itoa" +version = "1.0.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "af150ab688ff2122fcef229be89cb50dd66af9e01a4ff320cc137eecc9bacc38" + +[[package]] +name = "libconfig-generator" +version = "0.1.0" +dependencies = [ + "serde", + "serde_json", +] + +[[package]] +name = "ryu" +version = "1.0.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1ad4cc8da4ef723ed60bced201181d83791ad433213d8c24efffda1eec85d741" + +[[package]] +name = "serde" +version = "1.0.183" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "32ac8da02677876d532745a130fc9d8e6edfa81a269b107c5b00829b91d8eb3c" + +[[package]] +name = "serde_json" +version = "1.0.104" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "076066c5f1078eac5b722a31827a8832fe108bed65dfa75e233c89f8206e976c" +dependencies = [ + "itoa", + "ryu", + "serde", +] diff --git a/pkgs/pkgs-lib/formats/libconfig/src/Cargo.toml b/pkgs/pkgs-lib/formats/libconfig/src/Cargo.toml new file mode 100644 index 0000000000000..20ad44d221945 --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/src/Cargo.toml @@ -0,0 +1,10 @@ +[package] +name = "libconfig-generator" +version = "0.1.0" +edition = "2021" + +# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html + +[dependencies] +serde = "1.0.178" +serde_json = "1.0.104" diff --git a/pkgs/pkgs-lib/formats/libconfig/src/src/main.rs b/pkgs/pkgs-lib/formats/libconfig/src/src/main.rs new file mode 100644 index 0000000000000..4da45f647d46f --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/src/src/main.rs @@ -0,0 +1,271 @@ +use serde_json::Value; +use std::mem::discriminant; + +#[derive(Debug)] +enum LibConfigIntNumber { + Oct(i64), + Hex(i64), + Int(i64), +} + +#[derive(Debug)] +enum LibConfigValue { + Bool(bool), + Int(LibConfigIntNumber), + Float(f64), + String(String), + Array(Vec<LibConfigValue>), + List(Vec<LibConfigValue>), + Group(Vec<String>, Vec<(String, LibConfigValue)>), +} + +fn validate_setting_name(key: &str) -> bool { + let first_char = key.chars().next().expect("Empty setting name"); + (first_char.is_alphabetic() || first_char == '*') + && key[1..] + .chars() + .all(|c| c.is_alphanumeric() || c == '_' || c == '*') +} + +const SPECIAL_TYPES: [&str; 5] = ["octal", "hex", "float", "list", "array"]; + +fn object_is_special_type(o: &serde_json::Map<String, Value>) -> Option<&str> { + o.get("_type").and_then(|x| x.as_str()).and_then(|x| { + if SPECIAL_TYPES.contains(&x) { + Some(x) + } else { + None + } + }) +} + +fn vec_is_array(v: &Vec<LibConfigValue>) -> bool { + if v.is_empty() { + return true; + } + + let first_item = v.first().unwrap(); + + if match first_item { + LibConfigValue::Array(_) => true, + LibConfigValue::List(_) => true, + LibConfigValue::Group(_, _) => true, + _ => false, + } { + return false; + }; + + v[1..] + .iter() + .all(|item| discriminant(first_item) == discriminant(item)) +} + +fn json_to_libconfig(v: &Value) -> LibConfigValue { + match v { + Value::Null => panic!("Null value not allowed in libconfig"), + Value::Bool(b) => LibConfigValue::Bool(b.clone()), + Value::Number(n) => { + if n.is_i64() { + LibConfigValue::Int(LibConfigIntNumber::Int(n.as_i64().unwrap())) + } else if n.is_f64() { + LibConfigValue::Float(n.as_f64().unwrap()) + } else { + panic!("{} is not i64 or f64, cannot be represented as number in libconfig", n); + } + } + Value::String(s) => LibConfigValue::String(s.to_string()), + Value::Array(a) => { + let items = a + .iter() + .map(|item| json_to_libconfig(item)) + .collect::<Vec<LibConfigValue>>(); + LibConfigValue::List(items) + } + Value::Object(o) => { + if let Some(_type) = object_is_special_type(o) { + let value = o + .get("value") + .expect(format!("Missing value for special type: {}", &_type).as_str()); + + return match _type { + "octal" => { + let str_value = value + .as_str() + .expect( + format!("Value is not a string for special type: {}", &_type) + .as_str(), + ) + .to_owned(); + + LibConfigValue::Int(LibConfigIntNumber::Oct( + i64::from_str_radix(&str_value, 8) + .expect(format!("Invalid octal value: {}", value).as_str()), + )) + } + "hex" => { + let str_value = value + .as_str() + .expect( + format!("Value is not a string for special type: {}", &_type) + .as_str(), + ) + .to_owned(); + + LibConfigValue::Int(LibConfigIntNumber::Hex( + i64::from_str_radix(&str_value[2..], 16) + .expect(format!("Invalid hex value: {}", value).as_str()), + )) + } + "float" => { + let str_value = value + .as_str() + .expect( + format!("Value is not a string for special type: {}", &_type) + .as_str(), + ) + .to_owned(); + + LibConfigValue::Float( + str_value + .parse::<f64>() + .expect(format!("Invalid float value: {}", value).as_str()), + ) + } + "list" => { + let items = value + .as_array() + .expect( + format!("Value is not an array for special type: {}", &_type) + .as_str(), + ) + .to_owned() + .iter() + .map(|item| json_to_libconfig(item)) + .collect::<Vec<LibConfigValue>>(); + + LibConfigValue::List(items) + } + "array" => { + let items = value + .as_array() + .expect( + format!("Value is not an array for special type: {}", &_type) + .as_str(), + ) + .to_owned() + .iter() + .map(|item| json_to_libconfig(item)) + .collect::<Vec<LibConfigValue>>(); + + if !vec_is_array(&items) { + panic!( + "This can not be an array because of its contents: {:#?}", + items + ); + } + + LibConfigValue::Array(items) + } + _ => panic!("Invalid type: {}", _type), + }; + } + + let mut items = o + .iter() + .filter(|(key, _)| key.as_str() != "_includes") + .map(|(key, value)| (key.clone(), json_to_libconfig(value))) + .collect::<Vec<(String, LibConfigValue)>>(); + items.sort_by(|(a,_),(b,_)| a.partial_cmp(b).unwrap()); + + let includes = o + .get("_includes") + .map(|x| { + x.as_array() + .expect("_includes is not an array") + .iter() + .map(|x| { + x.as_str() + .expect("_includes item is not a string") + .to_owned() + }) + .collect::<Vec<String>>() + }) + .unwrap_or(vec![]); + + for (key,_) in items.iter() { + if !validate_setting_name(key) { + panic!("Invalid setting name: {}", key); + } + } + LibConfigValue::Group(includes, items) + } + } +} + +impl ToString for LibConfigValue { + fn to_string(&self) -> String { + match self { + LibConfigValue::Bool(b) => b.to_string(), + LibConfigValue::Int(i) => match i { + LibConfigIntNumber::Oct(n) => format!("0{:o}", n), + LibConfigIntNumber::Hex(n) => format!("0x{:x}", n), + LibConfigIntNumber::Int(n) => n.to_string(), + }, + LibConfigValue::Float(n) => format!("{:?}", n), + LibConfigValue::String(s) => { + format!("\"{}\"", s.replace("\\", "\\\\").replace("\"", "\\\"")) + } + LibConfigValue::Array(a) => { + let items = a + .iter() + .map(|item| item.to_string()) + .collect::<Vec<String>>() + .join(", "); + format!("[{}]", items) + } + LibConfigValue::List(a) => { + let items = a + .iter() + .map(|item| item.to_string()) + .collect::<Vec<String>>() + .join(", "); + format!("({})", items) + } + LibConfigValue::Group(i, o) => { + let includes = i + .iter() + .map(|x| x.replace("\\", "\\\\").replace("\"", "\\\"")) + .map(|x| format!("@include \"{}\"", x)) + .collect::<Vec<String>>() + .join("\n"); + let items = o + .iter() + .map(|(key, value)| format!("{}={};", key, value.to_string())) + .collect::<Vec<String>>() + .join(""); + if includes.is_empty() { + format!("{{{}}}", items) + } else { + format!("{{\n{}\n{}}}", includes, items) + } + } + } + } +} + +fn main() { + let stdin = std::io::stdin().lock(); + let json = serde_json::Deserializer::from_reader(stdin) + .into_iter::<Value>() + .next() + .expect("Could not read content from stdin") + .expect("Could not parse JSON from stdin"); + + for (key, value) in json + .as_object() + .expect("Top level of JSON file is not an object") + { + print!("{}={};", key, json_to_libconfig(value).to_string()); + } + print!("\n\n"); +} diff --git a/pkgs/pkgs-lib/formats/libconfig/test/comprehensive/default.nix b/pkgs/pkgs-lib/formats/libconfig/test/comprehensive/default.nix new file mode 100644 index 0000000000000..3715e2e840d26 --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/test/comprehensive/default.nix @@ -0,0 +1,76 @@ +{ lib, formats, stdenvNoCC, writeText, ... }: +let + libconfig = formats.libconfig { }; + + include_expr = { + val = 1; + }; + + include_file = (writeText "libconfig-test-include" '' + val=1; + '').overrideAttrs { + outputHashAlgo = "sha256"; + outputHashMode = "flat"; + }; + + expression = { + simple_top_level_attr = "1.0"; + nested.attrset.has.a.integer.value = 100; + some_floaty = 29.95; + ## Same syntax here on these two, but they should get serialized differently: + # > A list may have zero or more elements, each of which can be a scalar value, an array, a group, or another list. + list1d = libconfig.lib.mkList [ 1 "mixed!" 5 2 ]; + # You might also omit the mkList, as a list will be a list (in contrast to an array) by default. + list2d = [ 1 [ 1 1.2 "foo" ] [ "bar" 1.2 1 ] ]; + # > An array may have zero or more elements, but the elements must all be scalar values of the same type. + array1d = libconfig.lib.mkArray [ 1 5 2 ]; + array2d = [ + (libconfig.lib.mkArray [ 1 2 ]) + (libconfig.lib.mkArray [ 2 1 ]) + ]; + nasty_string = "\"@\n\\\t^*\b\f\n\0\";'''$"; + + weirderTypes = { + _includes = [ include_file ]; + pi = 3.141592654; + bigint = 9223372036854775807; + hex = libconfig.lib.mkHex "0x1FC3"; + octal = libconfig.lib.mkOctal "0027"; + float = libconfig.lib.mkFloat "1.2E-3"; + array_of_ints = libconfig.lib.mkArray [ + (libconfig.lib.mkOctal "0732") + (libconfig.lib.mkHex "0xA3") + 1234 + ]; + list_of_weird_types = [ + 3.141592654 + 9223372036854775807 + (libconfig.lib.mkHex "0x1FC3") + (libconfig.lib.mkOctal "0027") + (libconfig.lib.mkFloat "1.2E-32") + (libconfig.lib.mkFloat "1") + ]; + }; + }; + + libconfig-test-cfg = libconfig.generate "libconfig-test.cfg" expression; +in + stdenvNoCC.mkDerivation { + name = "pkgs.formats.libconfig-test-comprehensive"; + + dontUnpack = true; + dontBuild = true; + + doCheck = true; + checkPhase = '' + diff -U3 ${./expected.txt} ${libconfig-test-cfg} + ''; + + installPhase = '' + mkdir $out + cp ${./expected.txt} $out/expected.txt + cp ${libconfig-test-cfg} $out/libconfig-test.cfg + cp ${libconfig-test-cfg.passthru.json} $out/libconfig-test.json + ''; + } + diff --git a/pkgs/pkgs-lib/formats/libconfig/test/comprehensive/expected.txt b/pkgs/pkgs-lib/formats/libconfig/test/comprehensive/expected.txt new file mode 100644 index 0000000000000..3e9b1af821f18 --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/test/comprehensive/expected.txt @@ -0,0 +1,6 @@ +array1d=[1, 5, 2];array2d=([1, 2], [2, 1]);list1d=(1, "mixed!", 5, 2);list2d=(1, (1, 1.2, "foo"), ("bar", 1.2, 1));nasty_string="\"@ +\\ ^*bf +0\";'''$";nested={attrset={has={a={integer={value=100;};};};};};simple_top_level_attr="1.0";some_floaty=29.95;weirderTypes={ +@include "/nix/store/jdz5yhzbbj4j77yrr7l20x1cs4kbwkj2-libconfig-test-include" +array_of_ints=[0732, 0xa3, 1234];bigint=9223372036854775807;float=0.0012;hex=0x1fc3;list_of_weird_types=(3.141592654, 9223372036854775807, 0x1fc3, 027, 1.2e-32, 1.0);octal=027;pi=3.141592654;}; + diff --git a/pkgs/pkgs-lib/formats/libconfig/test/default.nix b/pkgs/pkgs-lib/formats/libconfig/test/default.nix new file mode 100644 index 0000000000000..6cd03fe4854f5 --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/test/default.nix @@ -0,0 +1,4 @@ +{ pkgs, ... }: +{ + comprehensive = pkgs.callPackage ./comprehensive { }; +} diff --git a/pkgs/pkgs-lib/formats/libconfig/update.sh b/pkgs/pkgs-lib/formats/libconfig/update.sh new file mode 100755 index 0000000000000..ffc5ad3917f71 --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/update.sh @@ -0,0 +1,4 @@ +#!/usr/bin/env nix-shell +#!nix-shell -p cargo -i bash +cd "$(dirname "$0")" +cargo update diff --git a/pkgs/pkgs-lib/formats/libconfig/validator.c b/pkgs/pkgs-lib/formats/libconfig/validator.c new file mode 100644 index 0000000000000..738be0b774b5a --- /dev/null +++ b/pkgs/pkgs-lib/formats/libconfig/validator.c @@ -0,0 +1,21 @@ +// Copyright (C) 2005-2023 Mark A Lindner, ckie +// SPDX-License-Identifier: LGPL-2.1-or-later +#include <stdio.h> +#include <libconfig.h> +int main(int argc, char **argv) +{ + config_t cfg; + config_init(&cfg); + if (argc != 2) + { + fprintf(stderr, "USAGE: validator <path-to-validate>"); + } + if(! config_read_file(&cfg, argv[1])) + { + fprintf(stderr, "[libconfig] %s:%d - %s\n", config_error_file(&cfg), + config_error_line(&cfg), config_error_text(&cfg)); + config_destroy(&cfg); + return 1; + } + printf("[libconfig] validation ok\n"); +} \ No newline at end of file diff --git a/pkgs/pkgs-lib/tests/default.nix b/pkgs/pkgs-lib/tests/default.nix index ae91e15aa9efa..289780f57650a 100644 --- a/pkgs/pkgs-lib/tests/default.nix +++ b/pkgs/pkgs-lib/tests/default.nix @@ -17,6 +17,7 @@ let jdk11 = pkgs.callPackage ../formats/java-properties/test { jdk = pkgs.jdk11_headless; }; jdk17 = pkgs.callPackage ../formats/java-properties/test { jdk = pkgs.jdk17_headless; }; }; + libconfig = recurseIntoAttrs (import ../formats/libconfig/test { inherit pkgs; }); }; flatten = prefix: as: diff --git a/pkgs/servers/calibre-web/default.nix b/pkgs/servers/calibre-web/default.nix index f59ebb6fe20fa..160435802957c 100644 --- a/pkgs/servers/calibre-web/default.nix +++ b/pkgs/servers/calibre-web/default.nix @@ -25,13 +25,13 @@ let in python.pkgs.buildPythonApplication rec { pname = "calibre-web"; - version = "0.6.20"; + version = "0.6.21"; src = fetchFromGitHub { owner = "janeczku"; repo = "calibre-web"; rev = version; - hash = "sha256-0lArY1aTpO4sgIVDSqClYMGlip92f9hE/L2UouTLK8Q="; + hash = "sha256-tRrOquetn3P2NmrXq7DQHRGP1sWnLR7bV2Lw0W/lUPQ="; }; propagatedBuildInputs = with python.pkgs; [ @@ -64,8 +64,6 @@ python.pkgs.buildPythonApplication rec { # and exit. This is gonna be used to configure calibre-web declaratively, as most of its configuration parameters # are stored in the DB. ./db-migrations.patch - # environ in tornado.wsgi.WSGIContainer no longer a static method from 6.3 version - ./static_environ.patch ]; # calibre-web doesn't follow setuptools directory structure. The following is taken from the script diff --git a/pkgs/servers/calibre-web/static_environ.patch b/pkgs/servers/calibre-web/static_environ.patch deleted file mode 100644 index 4f94283a4e664..0000000000000 --- a/pkgs/servers/calibre-web/static_environ.patch +++ /dev/null @@ -1,25 +0,0 @@ -diff --git a/cps/tornado_wsgi.py b/cps/tornado_wsgi.py -index af93219c..cf302042 100644 ---- a/cps/tornado_wsgi.py -+++ b/cps/tornado_wsgi.py -@@ -53,7 +53,7 @@ class MyWSGIContainer(WSGIContainer): - return response.append - - app_response = self.wsgi_application( -- MyWSGIContainer.environ(request), start_response -+ self.environ(request), start_response - ) - try: - response.extend(app_response) -@@ -86,9 +86,8 @@ class MyWSGIContainer(WSGIContainer): - request.connection.finish() - self._log(status_code, request) - -- @staticmethod -- def environ(request: httputil.HTTPServerRequest) -> Dict[Text, Any]: -- environ = WSGIContainer.environ(request) -+ def environ(self, request: httputil.HTTPServerRequest) -> Dict[Text, Any]: -+ environ = super().environ(request) - environ['RAW_URI'] = request.path - return environ - diff --git a/pkgs/servers/dendrite/default.nix b/pkgs/servers/dendrite/default.nix index 82ee6d59547a2..d722f6beb0ab1 100644 --- a/pkgs/servers/dendrite/default.nix +++ b/pkgs/servers/dendrite/default.nix @@ -3,16 +3,16 @@ buildGoModule rec { pname = "matrix-dendrite"; - version = "0.13.3"; + version = "0.13.4"; src = fetchFromGitHub { owner = "matrix-org"; repo = "dendrite"; rev = "v${version}"; - hash = "sha256-wM9ayB3L9pc3696Ze5hVZPKGwrB5fD+64Wf8DUIjf1k="; + hash = "sha256-Hy3QuwAHmZSsjy5A/1mrmrxdtle466HsQtDat3tYS8s="; }; - vendorHash = "sha256-COljILLiAFoX8IShpAmLrxkw6yw7YQE4lpe8IR92j6g="; + vendorHash = "sha256-M7ogR1ya+sqlWVQpaXlvJy9YwhdM4XBDw8e2ZBPvEGY="; subPackages = [ # The server diff --git a/pkgs/servers/home-automation/evcc/default.nix b/pkgs/servers/home-automation/evcc/default.nix index 8666f906fa958..ac49da29b5402 100644 --- a/pkgs/servers/home-automation/evcc/default.nix +++ b/pkgs/servers/home-automation/evcc/default.nix @@ -1,5 +1,5 @@ { lib -, buildGo121Module +, buildGoModule , fetchFromGitHub , fetchNpmDeps , cacert @@ -14,15 +14,15 @@ , stdenv }: -buildGo121Module rec { +buildGoModule rec { pname = "evcc"; - version = "0.121.2"; + version = "0.121.5"; src = fetchFromGitHub { owner = "evcc-io"; repo = pname; rev = version; - hash = "sha256-WGce6HszjS/AVwlEmT8KZnFHZieaGzT+yyzxOtqf/zg="; + hash = "sha256-KEJh/JhTlSrio4JRQwxz8NbmjzaqW4MUlzAXGvanMmo="; }; vendorHash = "sha256-dBJsPv3tOWxLvVlkTG0npKalH2RWfwR3vJRjqb4TYQE="; diff --git a/pkgs/servers/http/envoy/default.nix b/pkgs/servers/http/envoy/default.nix index cda0d0a4daeb6..0b1d88e43e0d9 100644 --- a/pkgs/servers/http/envoy/default.nix +++ b/pkgs/servers/http/envoy/default.nix @@ -14,7 +14,7 @@ , linuxHeaders , nixosTests -# v8 (upstream default), wavm, wamr, wasmtime, disabled + # v8 (upstream default), wavm, wamr, wasmtime, disabled , wasmRuntime ? "wamr" }: @@ -83,8 +83,8 @@ buildBazelPackage rec { fetchAttrs = { sha256 = { - x86_64-linux = "sha256-bBi+3sAwtj5qu1npFpNMK2C99Q0ZI3zaSmMsTcreD8Y="; - aarch64-linux = "sha256-piIekotpxB02COglAon9w7a+1jXlHX29/VkrgKFsQ3c="; + x86_64-linux = "sha256-OQ4vg4S3DpM+Zo+igncx3AXJnL8FkJbwh7KnBhbnCUM="; + aarch64-linux = "sha256-/X8i1vzQ4QvFxi1+5rc1/CGHmRhhu5F3X5A3PgbW+Mc="; }.${stdenv.system} or (throw "unsupported system ${stdenv.system}"); dontUseCmakeConfigure = true; dontUseGnConfigure = true; diff --git a/pkgs/servers/jackett/default.nix b/pkgs/servers/jackett/default.nix index 057942259282f..e7df0fb7190f6 100644 --- a/pkgs/servers/jackett/default.nix +++ b/pkgs/servers/jackett/default.nix @@ -9,13 +9,13 @@ buildDotnetModule rec { pname = "jackett"; - version = "0.21.993"; + version = "0.21.1096"; src = fetchFromGitHub { owner = pname; repo = pname; rev = "v${version}"; - hash = "sha512-LpP4BH0EJxjy4pDYpIGs9l2obxfFMLMsTEn3weJPnPRgeeAlavkACCymQxrpfG3aP1oPbaZRn6Zs/9dyohV3kQ=="; + hash = "sha512-j9PQa54Gv6kdCHZ9/WPnKYkxD4N0eu0KtMPpATSYVDo0mP9pXdQxSoCrKdmW2gOveuo5Z/wPW4BB4r3gvFxcOg=="; }; projectFile = "src/Jackett.Server/Jackett.Server.csproj"; diff --git a/pkgs/servers/klipper/default.nix b/pkgs/servers/klipper/default.nix index 6428e7510c440..0a6f0f1391e27 100644 --- a/pkgs/servers/klipper/default.nix +++ b/pkgs/servers/klipper/default.nix @@ -8,13 +8,13 @@ stdenv.mkDerivation rec { pname = "klipper"; - version = "unstable-2023-09-10"; + version = "unstable-2023-10-21"; src = fetchFromGitHub { owner = "KevinOConnor"; repo = "klipper"; - rev = "8ef0f7d7e3d3b2ac7bc1e80ed3295ceca6bba4e7"; - sha256 = "sha256-f/fPnZvtnASphYtvM9NBae0on8GWSwQPykukZ3XCy3M="; + rev = "f7567a0db954eabe4c6b8da3f73ce68693698646"; + sha256 = "sha256-zOXoHTySTtq2fR7ujU6aiKAgvw11ogM8K+HJF1RoWEQ="; }; sourceRoot = "${src.name}/klippy"; diff --git a/pkgs/servers/komga/default.nix b/pkgs/servers/komga/default.nix index 1225fe4b360f1..fbb8b38d5ee0b 100644 --- a/pkgs/servers/komga/default.nix +++ b/pkgs/servers/komga/default.nix @@ -8,11 +8,11 @@ stdenvNoCC.mkDerivation rec { pname = "komga"; - version = "1.5.1"; + version = "1.6.4"; src = fetchurl { url = "https://github.com/gotson/${pname}/releases/download/v${version}/${pname}-${version}.jar"; - sha256 = "sha256-mEeeMMTZlAfBxp44gV8OLjyGrzcp+XCMPJLJ/sFELHs="; + sha256 = "sha256-tqrC3l2njYGRVIdvt86JVKTCVaAK7GPoYacx3hFRggg="; }; nativeBuildInputs = [ diff --git a/pkgs/servers/mail/mailpit/default.nix b/pkgs/servers/mail/mailpit/default.nix index 9c8b683373c31..69a2dc7ce6f25 100644 --- a/pkgs/servers/mail/mailpit/default.nix +++ b/pkgs/servers/mail/mailpit/default.nix @@ -11,13 +11,13 @@ let - version = "1.7.1"; + version = "1.9.9"; src = fetchFromGitHub { owner = "axllent"; repo = "mailpit"; rev = "v${version}"; - hash = "sha256-jT9QE0ikp9cJlT8qtfPPjKOUuqWyQk94D3UbkyaGXa8="; + hash = "sha256-WPfr1LHOgOFsF2g3junJ0km0gOk/LC52jekJ8BXlqP0="; }; # Separate derivation, because if we mix this in buildGoModule, the separate @@ -29,7 +29,7 @@ let npmDeps = fetchNpmDeps { inherit src; - hash = "sha256-6VCs8125fTJkZW+eZgK56j7ccK8tcGhIXiq2HkYp4XM="; + hash = "sha256-RaXD+WfNywItveKzc+KWOw38H1EZ2yukgbMrtOfPSJc="; }; nativeBuildInputs = [ nodejs python3 libtool npmHooks.npmConfigHook ]; @@ -49,7 +49,7 @@ buildGoModule { pname = "mailpit"; inherit src version; - vendorHash = "sha256-XBYIO7fdo5EahJB7EcAuY9SGKZb8dsvoJHp/D5LO5Qo="; + vendorHash = "sha256-akt72aBoiQKp1Hxf3NgzSmfgmsnjpheIh62lPCTyHBs="; CGO_ENABLED = 0; @@ -65,5 +65,6 @@ buildGoModule { changelog = "https://github.com/axllent/mailpit/releases/tag/v${version}"; maintainers = with maintainers; [ stephank ]; license = licenses.mit; + mainProgram = "mailpit"; }; } diff --git a/pkgs/servers/mail/rspamd/default.nix b/pkgs/servers/mail/rspamd/default.nix index 3d1afd389ee1d..180554acd7281 100644 --- a/pkgs/servers/mail/rspamd/default.nix +++ b/pkgs/servers/mail/rspamd/default.nix @@ -28,13 +28,13 @@ assert withHyperscan -> stdenv.isx86_64; stdenv.mkDerivation rec { pname = "rspamd"; - version = "3.7.2"; + version = "3.7.3"; src = fetchFromGitHub { owner = "rspamd"; repo = "rspamd"; rev = version; - hash = "sha256-Kr6Y1ePgBeH+WhkfEYqmoBZ9AJ54G+OVgrY73aV0+OU="; + hash = "sha256-TqsY0AUDEpFOGIAH6jDdofIJAYQYtj8Uk4djk5hYemo="; }; hardeningEnable = [ "pie" ]; diff --git a/pkgs/servers/mastodon/source.nix b/pkgs/servers/mastodon/source.nix index 995b58476d783..fc6c899e75691 100644 --- a/pkgs/servers/mastodon/source.nix +++ b/pkgs/servers/mastodon/source.nix @@ -8,7 +8,7 @@ applyPatches { src = fetchFromGitHub { owner = "mastodon"; repo = "mastodon"; - rev = "${version}"; + rev = "v${version}"; hash = "sha256-xpE/mg2AeioW6NThUjLS+SBxGavG4w1xtp3BOMADfYo="; }; patches = []; diff --git a/pkgs/servers/mastodon/update.sh b/pkgs/servers/mastodon/update.sh index 6955f9e618050..b79e8d3063100 100755 --- a/pkgs/servers/mastodon/update.sh +++ b/pkgs/servers/mastodon/update.sh @@ -90,7 +90,7 @@ applyPatches { src = fetchFromGitHub { owner = "$OWNER"; repo = "$REPO"; - rev = "\${version}"; + rev = "v\${version}"; hash = "$HASH"; }; patches = [$PATCHES]; diff --git a/pkgs/servers/matrix-hebbot/default.nix b/pkgs/servers/matrix-hebbot/default.nix index 83b1ff007032f..59e4ca1b19168 100644 --- a/pkgs/servers/matrix-hebbot/default.nix +++ b/pkgs/servers/matrix-hebbot/default.nix @@ -39,6 +39,7 @@ rustPlatform.buildRustPackage rec { homepage = "https://github.com/haecker-felix/hebbot"; changelog = "https://github.com/haecker-felix/hebbot/releases/tag/v${version}"; license = with licenses; [ agpl3 ]; + mainProgram = "hebbot"; maintainers = with maintainers; [ a-kenji ]; }; } diff --git a/pkgs/servers/mautrix-googlechat/default.nix b/pkgs/servers/mautrix-googlechat/default.nix index b522dc0636f63..41a72eec05956 100644 --- a/pkgs/servers/mautrix-googlechat/default.nix +++ b/pkgs/servers/mautrix-googlechat/default.nix @@ -7,13 +7,13 @@ , enableSqlite ? true }: python3.pkgs.buildPythonApplication rec { pname = "mautrix-googlechat"; - version = "unstable-2023-07-16"; + version = "0.5.1"; src = fetchFromGitHub { owner = "mautrix"; repo = "googlechat"; - rev = "f4cddafd474b12be09efd15c6652c04d0650458e"; - sha256 = "sha256-WMJVAX5oUdYYuXoJKk7OoERR0LJM0Er5444xwqIUTm8="; + rev = "refs/tags/v${version}"; + hash = "sha256-a/EWz/aCkBE6XdDpmZcx2Q7/xKNwGCiZUhZc9YIIDhU="; }; patches = [ diff --git a/pkgs/servers/monitoring/grafana/default.nix b/pkgs/servers/monitoring/grafana/default.nix index a496b578d88cc..c4c9c75903a2c 100644 --- a/pkgs/servers/monitoring/grafana/default.nix +++ b/pkgs/servers/monitoring/grafana/default.nix @@ -2,7 +2,7 @@ buildGoModule rec { pname = "grafana"; - version = "10.1.5"; + version = "10.2.0"; excludedPackages = [ "alert_webhook_listener" "clean-swagger" "release_publisher" "slow_proxy" "slow_proxy_mac" "macaron" "devenv" "modowners" ]; @@ -10,15 +10,15 @@ buildGoModule rec { rev = "v${version}"; owner = "grafana"; repo = "grafana"; - hash = "sha256-/caja157OKe9atqZLDzw2oTwhWLNa5DxcgO1iueKow4="; + hash = "sha256-PNKvu7DfVHzBaRGM/Zej0oI5pbi6gPta+ZzVEXXmTsI="; }; srcStatic = fetchurl { url = "https://dl.grafana.com/oss/release/grafana-${version}.linux-amd64.tar.gz"; - hash = "sha256-7LGs/8pbZMEwXHBSPac+guJ3GcYBS3qIRz7JeqZuVQ0="; + hash = "sha256-KE026VWxlJYzRqTqry4h8vm1NIXB7sJUucz+W/s1eoE="; }; - vendorHash = "sha256-KXgGtNHUi+k41GC3Wc5hbJw4k5fxq/p0Je6Q6UZwhtw="; + vendorHash = "sha256-Mybo7ZVP7fwmBwloC3jHJnqPmhbj1DQSwz8T2onkL3Y="; nativeBuildInputs = [ wire ]; diff --git a/pkgs/servers/monitoring/mimir/default.nix b/pkgs/servers/monitoring/mimir/default.nix index fbde71958f670..b54888cad96bd 100644 --- a/pkgs/servers/monitoring/mimir/default.nix +++ b/pkgs/servers/monitoring/mimir/default.nix @@ -1,13 +1,13 @@ { lib, buildGoModule, fetchFromGitHub, nixosTests, nix-update-script }: buildGoModule rec { pname = "mimir"; - version = "2.10.0"; + version = "2.10.3"; src = fetchFromGitHub { rev = "${pname}-${version}"; owner = "grafana"; repo = pname; - hash = "sha256-4UBbtJRQ6F3Dm+G4OWZeWtD4MJWtq91yiSZNW7EhEto="; + hash = "sha256-tVJcvxKcxhSeYyqBsBeG+OrWoD+hTDAoPuIXB72MMkY="; }; vendorHash = null; diff --git a/pkgs/servers/monitoring/telegraf/default.nix b/pkgs/servers/monitoring/telegraf/default.nix index ac13d678ff1fc..88d5befb19d4d 100644 --- a/pkgs/servers/monitoring/telegraf/default.nix +++ b/pkgs/servers/monitoring/telegraf/default.nix @@ -8,7 +8,7 @@ buildGoModule rec { pname = "telegraf"; - version = "1.28.2"; + version = "1.28.3"; subPackages = [ "cmd/telegraf" ]; @@ -16,10 +16,10 @@ buildGoModule rec { owner = "influxdata"; repo = "telegraf"; rev = "v${version}"; - hash = "sha256-gD4xdKjIx0zLKJySx8UdSKvMIZJaIXtubWQX/mLu+TI="; + hash = "sha256-9BwAsLk8pz1QharomkuQdsoNVQYzw+fSU3nDkw053JE="; }; - vendorHash = "sha256-OzAAchUHNno58Em2oDnMt9P1B03HtQylFBFEkv4bAkU="; + vendorHash = "sha256-EJ6NSc7vTnK6brhsBBplyuAjoTDSItswLA/2U1MrmFU="; proxyVendor = true; ldflags = [ diff --git a/pkgs/servers/nextcloud/default.nix b/pkgs/servers/nextcloud/default.nix index 37b01b7387355..6cfecd47a92c0 100644 --- a/pkgs/servers/nextcloud/default.nix +++ b/pkgs/servers/nextcloud/default.nix @@ -54,14 +54,14 @@ in { ''; nextcloud26 = generic { - version = "26.0.7"; - hash = "sha256-vtJEqLlNE7YWqSdAUhZwwdZ9Q8SAR3I/sTGAv/bUjpI="; + version = "26.0.8"; + hash = "sha256-ydCay0RuM2AZYIKRM/jzdutvJ5pN73CCF/xxWBiSiH8="; packages = nextcloud26Packages; }; nextcloud27 = generic { - version = "27.1.2"; - hash = "sha256-B0KyR6ruC3BE2wBi8KkUqnczjHp9j+faCRcUfXZolyE="; + version = "27.1.3"; + hash = "sha256-HWFJNSReSjdbSsmRwC8yNZK3U5cvhviHY/2A7X0nV5M="; packages = nextcloud27Packages; }; diff --git a/pkgs/servers/nextcloud/packages/26.json b/pkgs/servers/nextcloud/packages/26.json index 949191e55b4b6..10146a318324f 100644 --- a/pkgs/servers/nextcloud/packages/26.json +++ b/pkgs/servers/nextcloud/packages/26.json @@ -110,18 +110,18 @@ ] }, "mail": { - "sha256": "0p9iv172ivypyr6ccsmkfnb7b77nyghqbva24g8ymphw95pirwag", - "url": "https://github.com/nextcloud-releases/mail/releases/download/v3.4.1/mail-v3.4.1.tar.gz", - "version": "3.4.1", - "description": "**💌 A mail app for Nextcloud**\n\n- **🚀 Integration with other Nextcloud apps!** Currently Contacts, Calendar & Files – more to come.\n- **📥 Multiple mail accounts!** Personal and company account? No problem, and a nice unified inbox. Connect any IMAP account.\n- **🔒 Send & receive encrypted mails!** Using the great [Mailvelope](https://mailvelope.com) browser extension.\n- **🙈 We’re not reinventing the wheel!** Based on the great [Horde](https://horde.org) libraries.\n- **📬 Want to host your own mail server?** We do not have to reimplement this as you could set up [Mail-in-a-Box](https://mailinabox.email)!\n\n## Ethical AI Rating\n\n### Priority Inbox\n\nPositive:\n* The software for training and inferencing of this model is open source.\n* The model is created and trained on-premises based on the user's own data.\n* The training data is accessible to the user, making it possible to check or correct for bias or optimise the performance and CO2 usage.\n\n### Thread Summaries (opt-in)\n\n**Rating:** 🟢/🟡/🟠/🔴\n\nThe rating depends on the installed text processing backend. See [the rating overview](https://docs.nextcloud.com/server/latest/admin_manual/ai/index.html) for details.\n\nLearn more about the Nextcloud Ethical AI Rating [in our blog](https://nextcloud.com/blog/nextcloud-ethical-ai-rating/).", + "sha256": "0mr3npd48j444lalkph1z8rsz5jllpgdrcqsjdrqgmf70y0g55mh", + "url": "https://github.com/nextcloud-releases/mail/releases/download/v3.4.3/mail-v3.4.3.tar.gz", + "version": "3.4.3", + "description": "**💌 A mail app for Nextcloud**\n\n- **🚀 Integration with other Nextcloud apps!** Currently Contacts, Calendar & Files – more to come.\n- **📥 Multiple mail accounts!** Personal and company account? No problem, and a nice unified inbox. Connect any IMAP account.\n- **🔒 Send & receive encrypted mails!** Using the great [Mailvelope](https://mailvelope.com) browser extension.\n- **🙈 We’re not reinventing the wheel!** Based on the great [Horde](https://horde.org) libraries.\n- **📬 Want to host your own mail server?** We do not have to reimplement this as you could set up [Mail-in-a-Box](https://mailinabox.email)!", "homepage": "https://github.com/nextcloud/mail#readme", "licenses": [ "agpl" ] }, "maps": { - "sha256": "19zx3fhv8dil7vm84lhnhlxzd2zyab7h8j20hiwsd4rrj0gzhjdf", - "url": "https://github.com/nextcloud/maps/releases/download/v1.2.0-1-nightly/maps-1.2.0-1-nightly.tar.gz", + "sha256": "049hrp79fj1bp9nk9isjrk427k238974x7gsj68jplxfrgq3sdkz", + "url": "https://github.com/nextcloud/maps/releases/download/v1.2.0-2-nightly/maps-1.2.0-2-nightly.tar.gz", "version": "1.2.0", "description": "**The whole world fits inside your cloud!**\n\n- **🗺 Beautiful map:** Using [OpenStreetMap](https://www.openstreetmap.org) and [Leaflet](https://leafletjs.com), you can choose between standard map, satellite, topographical, dark mode or even watercolor! 🎨\n- **⭐ Favorites:** Save your favorite places, privately! Sync with [GNOME Maps](https://github.com/nextcloud/maps/issues/30) and mobile apps is planned.\n- **🧭 Routing:** Possible using either [OSRM](http://project-osrm.org), [GraphHopper](https://www.graphhopper.com) or [Mapbox](https://www.mapbox.com).\n- **🖼 Photos on the map:** No more boring slideshows, just show directly where you were!\n- **🙋 Contacts on the map:** See where your friends live and plan your next visit.\n- **📱 Devices:** Lost your phone? Check the map!\n- **〰 Tracks:** Load GPS tracks or past trips. Recording with [PhoneTrack](https://f-droid.org/en/packages/net.eneiluj.nextcloud.phonetrack/) or [OwnTracks](https://owntracks.org) is planned.", "homepage": "https://github.com/nextcloud/maps", @@ -130,9 +130,9 @@ ] }, "memories": { - "sha256": "10qd41lkvmgv5bw15gfzivjwf9asn22gv43f1k9l9158rrpzsgph", - "url": "https://github.com/pulsejet/memories/releases/download/v5.5.1/memories.tar.gz", - "version": "5.5.1", + "sha256": "0i146mlg27phs407clclksn1wjkyl0c5fb2zw0npbx5dvqnpglcd", + "url": "https://github.com/pulsejet/memories/releases/download/v6.0.1/memories.tar.gz", + "version": "6.0.1", "description": "# Memories: Photo Management for Nextcloud\n\nMemories is a *batteries-included* photo management solution for Nextcloud with advanced features including:\n\n- **📸 Timeline**: Sort photos and videos by date taken, parsed from Exif data.\n- **⏪ Rewind**: Jump to any time in the past instantly and relive your memories.\n- **🤖 AI Tagging**: Group photos by people and objects, powered by [recognize](https://github.com/nextcloud/recognize) and [facerecognition](https://github.com/matiasdelellis/facerecognition).\n- **🖼️ Albums**: Create albums to group photos and videos together. Then share these albums with others.\n- **🫱🏻🫲🏻 External Sharing**: Share photos and videos with people outside of your Nextcloud instance.\n- **📱 Mobile Support**: Work from any device, of any shape and size through the web app.\n- **✏️ Edit Metadata**: Edit dates and other metadata on photos quickly and in bulk.\n- **📦 Archive**: Store photos you don't want to see in your timeline in a separate folder.\n- **📹 Video Transcoding**: Transcode videos and use HLS for maximal performance.\n- **🗺️ Map**: View your photos on a map, tagged with accurate reverse geocoding.\n- **📦 Migration**: Migrate easily from Nextcloud Photos and Google Takeout.\n- **⚡️ Performance**: Do all this very fast.\n\n## 🚀 Installation\n\n1. Install the app from the Nextcloud app store (try a demo [here](https://demo.memories.gallery/apps/memories/)).\n1. Perform the recommended [configuration steps](https://memories.gallery/config/).\n1. Run `php occ memories:index` to generate metadata indices for existing photos.\n1. Open the 📷 Memories app in Nextcloud and set the directory containing your photos.", "homepage": "https://memories.gallery", "licenses": [ @@ -170,9 +170,9 @@ ] }, "onlyoffice": { - "sha256": "12hzmngps86ha4lcfwaf62svfz41aywykq0z419r644g5i4v7raq", - "url": "https://github.com/ONLYOFFICE/onlyoffice-nextcloud/releases/download/v7.9.0/onlyoffice.tar.gz", - "version": "7.9.0", + "sha256": "0hf015rvramksh7v06n7pn5kmyhgqzg17vmrgfqjbndg1r6rghpc", + "url": "https://github.com/ONLYOFFICE/onlyoffice-nextcloud/releases/download/v7.9.4/onlyoffice.tar.gz", + "version": "7.9.4", "description": "ONLYOFFICE connector allows you to view, edit and collaborate on text documents, spreadsheets and presentations within Nextcloud using ONLYOFFICE Docs. This will create a new Edit in ONLYOFFICE action within the document library for Office documents. This allows multiple users to co-author documents in real time from the familiar web interface and save the changes back to your file storage.", "homepage": "https://www.onlyoffice.com", "licenses": [ @@ -220,9 +220,9 @@ ] }, "spreed": { - "sha256": "1fnlilb9l4vfqdkyk0f3djzdkv0pw3yy30f7psfj6hh6y82pvfky", - "url": "https://github.com/nextcloud-releases/spreed/releases/download/v16.0.6/spreed-v16.0.6.tar.gz", - "version": "16.0.6", + "sha256": "06cixw0bbmz20fybdqq192bk11xraaaplqybbxa0xjs3x6pcw1na", + "url": "https://github.com/nextcloud-releases/spreed/releases/download/v16.0.7/spreed-v16.0.7.tar.gz", + "version": "16.0.7", "description": "Chat, video & audio-conferencing using WebRTC\n\n* 💬 **Chat integration!** Nextcloud Talk comes with a simple text chat. Allowing you to share files from your Nextcloud and mentioning other participants.\n* 👥 **Private, group, public and password protected calls!** Just invite somebody, a whole group or send a public link to invite to a call.\n* 💻 **Screen sharing!** Share your screen with participants of your call. You just need to use Firefox version 66 (or newer), latest Edge or Chrome 72 (or newer, also possible using Chrome 49 with this [Chrome extension](https://chrome.google.com/webstore/detail/screensharing-for-nextclo/kepnpjhambipllfmgmbapncekcmabkol)).\n* 🚀 **Integration with other Nextcloud apps** like Files, Contacts and Deck. More to come.\n\nAnd in the works for the [coming versions](https://github.com/nextcloud/spreed/milestones/):\n* ✋ [Federated calls](https://github.com/nextcloud/spreed/issues/21), to call people on other Nextclouds", "homepage": "https://github.com/nextcloud/spreed", "licenses": [ diff --git a/pkgs/servers/nextcloud/packages/27.json b/pkgs/servers/nextcloud/packages/27.json index 07071fc4fef07..257a773ecb76f 100644 --- a/pkgs/servers/nextcloud/packages/27.json +++ b/pkgs/servers/nextcloud/packages/27.json @@ -110,18 +110,18 @@ ] }, "mail": { - "sha256": "0p9iv172ivypyr6ccsmkfnb7b77nyghqbva24g8ymphw95pirwag", - "url": "https://github.com/nextcloud-releases/mail/releases/download/v3.4.1/mail-v3.4.1.tar.gz", - "version": "3.4.1", - "description": "**💌 A mail app for Nextcloud**\n\n- **🚀 Integration with other Nextcloud apps!** Currently Contacts, Calendar & Files – more to come.\n- **📥 Multiple mail accounts!** Personal and company account? No problem, and a nice unified inbox. Connect any IMAP account.\n- **🔒 Send & receive encrypted mails!** Using the great [Mailvelope](https://mailvelope.com) browser extension.\n- **🙈 We’re not reinventing the wheel!** Based on the great [Horde](https://horde.org) libraries.\n- **📬 Want to host your own mail server?** We do not have to reimplement this as you could set up [Mail-in-a-Box](https://mailinabox.email)!\n\n## Ethical AI Rating\n\n### Priority Inbox\n\nPositive:\n* The software for training and inferencing of this model is open source.\n* The model is created and trained on-premises based on the user's own data.\n* The training data is accessible to the user, making it possible to check or correct for bias or optimise the performance and CO2 usage.\n\n### Thread Summaries (opt-in)\n\n**Rating:** 🟢/🟡/🟠/🔴\n\nThe rating depends on the installed text processing backend. See [the rating overview](https://docs.nextcloud.com/server/latest/admin_manual/ai/index.html) for details.\n\nLearn more about the Nextcloud Ethical AI Rating [in our blog](https://nextcloud.com/blog/nextcloud-ethical-ai-rating/).", + "sha256": "0mr3npd48j444lalkph1z8rsz5jllpgdrcqsjdrqgmf70y0g55mh", + "url": "https://github.com/nextcloud-releases/mail/releases/download/v3.4.3/mail-v3.4.3.tar.gz", + "version": "3.4.3", + "description": "**💌 A mail app for Nextcloud**\n\n- **🚀 Integration with other Nextcloud apps!** Currently Contacts, Calendar & Files – more to come.\n- **📥 Multiple mail accounts!** Personal and company account? No problem, and a nice unified inbox. Connect any IMAP account.\n- **🔒 Send & receive encrypted mails!** Using the great [Mailvelope](https://mailvelope.com) browser extension.\n- **🙈 We’re not reinventing the wheel!** Based on the great [Horde](https://horde.org) libraries.\n- **📬 Want to host your own mail server?** We do not have to reimplement this as you could set up [Mail-in-a-Box](https://mailinabox.email)!", "homepage": "https://github.com/nextcloud/mail#readme", "licenses": [ "agpl" ] }, "maps": { - "sha256": "19zx3fhv8dil7vm84lhnhlxzd2zyab7h8j20hiwsd4rrj0gzhjdf", - "url": "https://github.com/nextcloud/maps/releases/download/v1.2.0-1-nightly/maps-1.2.0-1-nightly.tar.gz", + "sha256": "049hrp79fj1bp9nk9isjrk427k238974x7gsj68jplxfrgq3sdkz", + "url": "https://github.com/nextcloud/maps/releases/download/v1.2.0-2-nightly/maps-1.2.0-2-nightly.tar.gz", "version": "1.2.0", "description": "**The whole world fits inside your cloud!**\n\n- **🗺 Beautiful map:** Using [OpenStreetMap](https://www.openstreetmap.org) and [Leaflet](https://leafletjs.com), you can choose between standard map, satellite, topographical, dark mode or even watercolor! 🎨\n- **⭐ Favorites:** Save your favorite places, privately! Sync with [GNOME Maps](https://github.com/nextcloud/maps/issues/30) and mobile apps is planned.\n- **🧭 Routing:** Possible using either [OSRM](http://project-osrm.org), [GraphHopper](https://www.graphhopper.com) or [Mapbox](https://www.mapbox.com).\n- **🖼 Photos on the map:** No more boring slideshows, just show directly where you were!\n- **🙋 Contacts on the map:** See where your friends live and plan your next visit.\n- **📱 Devices:** Lost your phone? Check the map!\n- **〰 Tracks:** Load GPS tracks or past trips. Recording with [PhoneTrack](https://f-droid.org/en/packages/net.eneiluj.nextcloud.phonetrack/) or [OwnTracks](https://owntracks.org) is planned.", "homepage": "https://github.com/nextcloud/maps", @@ -130,9 +130,9 @@ ] }, "memories": { - "sha256": "10qd41lkvmgv5bw15gfzivjwf9asn22gv43f1k9l9158rrpzsgph", - "url": "https://github.com/pulsejet/memories/releases/download/v5.5.1/memories.tar.gz", - "version": "5.5.1", + "sha256": "0i146mlg27phs407clclksn1wjkyl0c5fb2zw0npbx5dvqnpglcd", + "url": "https://github.com/pulsejet/memories/releases/download/v6.0.1/memories.tar.gz", + "version": "6.0.1", "description": "# Memories: Photo Management for Nextcloud\n\nMemories is a *batteries-included* photo management solution for Nextcloud with advanced features including:\n\n- **📸 Timeline**: Sort photos and videos by date taken, parsed from Exif data.\n- **⏪ Rewind**: Jump to any time in the past instantly and relive your memories.\n- **🤖 AI Tagging**: Group photos by people and objects, powered by [recognize](https://github.com/nextcloud/recognize) and [facerecognition](https://github.com/matiasdelellis/facerecognition).\n- **🖼️ Albums**: Create albums to group photos and videos together. Then share these albums with others.\n- **🫱🏻🫲🏻 External Sharing**: Share photos and videos with people outside of your Nextcloud instance.\n- **📱 Mobile Support**: Work from any device, of any shape and size through the web app.\n- **✏️ Edit Metadata**: Edit dates and other metadata on photos quickly and in bulk.\n- **📦 Archive**: Store photos you don't want to see in your timeline in a separate folder.\n- **📹 Video Transcoding**: Transcode videos and use HLS for maximal performance.\n- **🗺️ Map**: View your photos on a map, tagged with accurate reverse geocoding.\n- **📦 Migration**: Migrate easily from Nextcloud Photos and Google Takeout.\n- **⚡️ Performance**: Do all this very fast.\n\n## 🚀 Installation\n\n1. Install the app from the Nextcloud app store (try a demo [here](https://demo.memories.gallery/apps/memories/)).\n1. Perform the recommended [configuration steps](https://memories.gallery/config/).\n1. Run `php occ memories:index` to generate metadata indices for existing photos.\n1. Open the 📷 Memories app in Nextcloud and set the directory containing your photos.", "homepage": "https://memories.gallery", "licenses": [ @@ -170,9 +170,9 @@ ] }, "onlyoffice": { - "sha256": "1872y2fpz3hrmafhcc6n84d63j5wgzx2plpirr91z3a8650frf3m", - "url": "https://github.com/ONLYOFFICE/onlyoffice-nextcloud/releases/download/v8.2.0/onlyoffice.tar.gz", - "version": "8.2.0", + "sha256": "0wnlm12wy7vsjmgh49ag7mm51mr2h8m05vdiwzkrfm7zazgdwadh", + "url": "https://github.com/ONLYOFFICE/onlyoffice-nextcloud/releases/download/v8.2.4/onlyoffice.tar.gz", + "version": "8.2.4", "description": "ONLYOFFICE connector allows you to view, edit and collaborate on text documents, spreadsheets and presentations within Nextcloud using ONLYOFFICE Docs. This will create a new Edit in ONLYOFFICE action within the document library for Office documents. This allows multiple users to co-author documents in real time from the familiar web interface and save the changes back to your file storage.", "homepage": "https://www.onlyoffice.com", "licenses": [ @@ -220,9 +220,9 @@ ] }, "spreed": { - "sha256": "07q6kxbvrg652px8a4wi1msxm2z7r7z7s8v4nnccvdcscv90d99d", - "url": "https://github.com/nextcloud-releases/spreed/releases/download/v17.1.1/spreed-v17.1.1.tar.gz", - "version": "17.1.1", + "sha256": "1hbgnz0zbhka82csh4rkr1p7zrgbc8wiznqmzh4w1q3d9pz47xis", + "url": "https://github.com/nextcloud-releases/spreed/releases/download/v17.1.2/spreed-v17.1.2.tar.gz", + "version": "17.1.2", "description": "Chat, video & audio-conferencing using WebRTC\n\n* 💬 **Chat integration!** Nextcloud Talk comes with a simple text chat. Allowing you to share files from your Nextcloud and mentioning other participants.\n* 👥 **Private, group, public and password protected calls!** Just invite somebody, a whole group or send a public link to invite to a call.\n* 💻 **Screen sharing!** Share your screen with participants of your call. You just need to use Firefox version 66 (or newer), latest Edge or Chrome 72 (or newer, also possible using Chrome 49 with this [Chrome extension](https://chrome.google.com/webstore/detail/screensharing-for-nextclo/kepnpjhambipllfmgmbapncekcmabkol)).\n* 🚀 **Integration with other Nextcloud apps** like Files, Contacts and Deck. More to come.\n\nAnd in the works for the [coming versions](https://github.com/nextcloud/spreed/milestones/):\n* ✋ [Federated calls](https://github.com/nextcloud/spreed/issues/21), to call people on other Nextclouds", "homepage": "https://github.com/nextcloud/spreed", "licenses": [ diff --git a/pkgs/servers/pr-tracker/default.nix b/pkgs/servers/pr-tracker/default.nix index 33ce80cdaaf59..1c07a56a7e3ae 100644 --- a/pkgs/servers/pr-tracker/default.nix +++ b/pkgs/servers/pr-tracker/default.nix @@ -1,6 +1,6 @@ { rustPlatform , lib -, fetchurl +, fetchzip , openssl , pkg-config , systemd @@ -8,14 +8,14 @@ rustPlatform.buildRustPackage rec { pname = "pr-tracker"; - version = "1.2.0"; + version = "1.3.0"; - src = fetchurl { + src = fetchzip { url = "https://git.qyliss.net/pr-tracker/snapshot/pr-tracker-${version}.tar.xz"; - sha256 = "sha256-Tru9DsitRQLiO4Ln70J9LvkEqcj2i4A+eArBvIhd/ls="; + hash = "sha256-JetfcA7Pn6nsCxCkgxP4jS6tijx89any/0GrmLa+DR0="; }; - cargoSha256 = "0q3ibxnzw8gngvrgfkv4m64dr411c511xkvb6j9k63vhy9vwarz7"; + cargoSha256 = "sha256-QUr0IHmzbhFNd6rBDEX8RZul/d1TLv0t+ySCQYMlpmE="; nativeBuildInputs = [ pkg-config ]; buildInputs = [ openssl systemd ]; diff --git a/pkgs/servers/prowlarr/default.nix b/pkgs/servers/prowlarr/default.nix index 7321c04700b36..9e43e30559dbe 100644 --- a/pkgs/servers/prowlarr/default.nix +++ b/pkgs/servers/prowlarr/default.nix @@ -21,15 +21,15 @@ let }.${stdenv.hostPlatform.system} or unsupported; hash = { - aarch64-darwin = "sha256-oYO6XXy+x4+YxgpwpiTG/3AxrEKQdBlWDZ7yDI1Q7iY="; - aarch64-linux = "sha256-5A7Rk/3U+GvDmAX/bWBRZCY2t2AFKGORlL60dtzuaOI="; - x86_64-darwin = "sha256-E4921TAKduFMph7I4uxL354G1dqO+Nb94W9nMmB3hKs="; - x86_64-linux = "sha256-KcFtQmmjfHfI38en83vTcIGXoli2S13JfO2U2tW01pc="; + aarch64-darwin = "sha256-5K18Vd0Ly/2YSmAvTbgiSQR8ifaz9wMs3vI0WFtB90g="; + aarch64-linux = "sha256-QI4+TVW/Zj1sI4yoxTGpzYNPufKnp68fLgDmajzD+6Y="; + x86_64-darwin = "sha256-qofWOMJIen8dI1wDFwNWeYuV9Ett3KvaTLfuK/v2USs="; + x86_64-linux = "sha256-qqAoXPdsjpn6Al5CLcvqfsZe9PRp8Swg1Wiy0w20hHs="; }.${stdenv.hostPlatform.system} or unsupported; in stdenv.mkDerivation rec { inherit pname; - version = "1.8.6.3946"; + version = "1.9.4.4039"; src = fetchurl { url = "https://github.com/Prowlarr/Prowlarr/releases/download/v${version}/Prowlarr.master.${version}.${os}-core-${arch}.tar.gz"; diff --git a/pkgs/servers/sozu/default.nix b/pkgs/servers/sozu/default.nix index a41de7bebc8be..d7ff34951c8b5 100644 --- a/pkgs/servers/sozu/default.nix +++ b/pkgs/servers/sozu/default.nix @@ -11,16 +11,16 @@ rustPlatform.buildRustPackage rec { pname = "sozu"; - version = "0.15.6"; + version = "0.15.13"; src = fetchFromGitHub { owner = "sozu-proxy"; repo = pname; rev = version; - hash = "sha256-8JvSVqU8JSf7VrHYxKTZWsX59gMW7eRg4WHrvemhUNU="; + hash = "sha256-egxeKwIgjpzF19ZunK9o2F/pjHWP8wva4KhGreXvR1w="; }; - cargoHash = "sha256-f4tteNovor8/YS71SbpD0GlHXEHfLmZmOLxn8impRj8="; + cargoHash = "sha256-q61HLKsF6h9/JPmggXHrCHXiFLYnWHtKayC/O0BAtA8="; nativeBuildInputs = [ protobuf ]; diff --git a/pkgs/servers/sql/postgresql/default.nix b/pkgs/servers/sql/postgresql/default.nix index 6bf881d52815e..427a394873fae 100644 --- a/pkgs/servers/sql/postgresql/default.nix +++ b/pkgs/servers/sql/postgresql/default.nix @@ -344,17 +344,6 @@ let }; mkPackages = self: { - # TODO: remove ahead of 23.11 branchoff - # "PostgreSQL 11 will stop receiving fixes on November 9, 2023" - postgresql_11 = self.callPackage generic { - version = "11.21"; - psqlSchema = "11.1"; # should be 11, but changing it is invasive - hash = "sha256-B7CDdHHV3XeyUWazRxjzuhCBa2rWHmkeb8VHzz/P+FA="; - this = self.postgresql_11; - thisAttr = "postgresql_11"; - inherit self; - }; - postgresql_12 = self.callPackage generic { version = "12.16"; psqlSchema = "12"; diff --git a/pkgs/servers/sql/postgresql/ext/age.nix b/pkgs/servers/sql/postgresql/ext/age.nix index c0de0c30d5a7b..3a1c1c8388bee 100644 --- a/pkgs/servers/sql/postgresql/ext/age.nix +++ b/pkgs/servers/sql/postgresql/ext/age.nix @@ -6,7 +6,6 @@ let "14" = "sha256-w93Q499sZRk4q85A9yqKQjGUd9Pl8UL8K1D3W7mHRTU="; "13" = "sha256-Sot7FR0oW7kWA680pNCMCmlflu4RfJTSWZn9mrXrpzw="; "12" = "sha256-XezcXoHHLCD1/2OHmKhxome2pdjOsYAfZlpvOoU3aS4="; - "11" = "sha256-ZkNAIMO69BxF3knQ+jcUBVuDgcoZXZccF5O+acpZ81M="; }; in stdenv.mkDerivation rec { diff --git a/pkgs/servers/sql/postgresql/ext/pg_hint_plan.nix b/pkgs/servers/sql/postgresql/ext/pg_hint_plan.nix index d0cf1193fb56d..afc5b9fe65065 100644 --- a/pkgs/servers/sql/postgresql/ext/pg_hint_plan.nix +++ b/pkgs/servers/sql/postgresql/ext/pg_hint_plan.nix @@ -22,10 +22,6 @@ let version = "1.3.9"; hash = "sha256-64/dlm6e4flCxMQ8efsxfKSlja+Tko0zsghTgLatN+Y="; }; - "11" = { - version = "1.3.9"; - hash = "sha256-8t/HhB/2Kjx4xMItmmKv3g9gba5VCBHdplYtYD/3UhA="; - }; }.${lib.versions.major postgresql.version} or (throw "Source for pg_hint_plan is not available for ${postgresql.version}"); in stdenv.mkDerivation { diff --git a/pkgs/servers/sql/postgresql/ext/pgaudit.nix b/pkgs/servers/sql/postgresql/ext/pgaudit.nix index 188451f1b8849..f4c03d611f503 100644 --- a/pkgs/servers/sql/postgresql/ext/pgaudit.nix +++ b/pkgs/servers/sql/postgresql/ext/pgaudit.nix @@ -22,10 +22,6 @@ let version = "1.4.3"; hash = "sha256-c8/xUFIHalu2bMCs57DeylK0oW0VnQwmUCpdp+tYqk4="; }; - "11" = { - version = "1.3.4"; - hash = "sha256-UEnwD36ejeYWyKRHZ4mPt6/Ru76Gy8s/rgIvmgermiM="; - }; }.${lib.versions.major postgresql.version} or (throw "Source for pgaudit is not available for ${postgresql.version}"); in stdenv.mkDerivation { diff --git a/pkgs/servers/sql/postgresql/ext/pipelinedb.nix b/pkgs/servers/sql/postgresql/ext/pipelinedb.nix deleted file mode 100644 index 6403138fd7047..0000000000000 --- a/pkgs/servers/sql/postgresql/ext/pipelinedb.nix +++ /dev/null @@ -1,39 +0,0 @@ -{ lib, stdenv, fetchFromGitHub, postgresql, zeromq, openssl, libsodium, libkrb5 }: - -stdenv.mkDerivation rec { - pname = "pipelinedb"; - version = "1.0.0-13"; - - src = fetchFromGitHub { - owner = "pipelinedb"; - repo = pname; - rev = version; - sha256 = "1mnqpvx6g1r2n4kjrrx01vbdx7kvndfsbmm7zbzizjnjlyixz75f"; - }; - - buildInputs = [ postgresql openssl zeromq libsodium libkrb5 ]; - - makeFlags = [ "USE_PGXS=1" ]; - - NIX_LDFLAGS = lib.optionalString stdenv.isDarwin "-lsodium"; - - preConfigure = '' - substituteInPlace Makefile \ - --replace "/usr/lib/libzmq.a" "${zeromq}/lib/libzmq.a" - ''; - - installPhase = '' - mkdir -p $out/bin - install -D -t $out/lib/ pipelinedb.so - install -D -t $out/share/postgresql/extension {pipelinedb-*.sql,pipelinedb.control} - ''; - - meta = with lib; { - description = "High-performance time-series aggregation for PostgreSQL"; - homepage = "https://www.pipelinedb.com/"; - license = licenses.asl20; - platforms = postgresql.meta.platforms; - maintainers = [ maintainers.marsam ]; - broken = versions.major postgresql.version != "11"; - }; -} diff --git a/pkgs/servers/sql/postgresql/packages.nix b/pkgs/servers/sql/postgresql/packages.nix index d9d9ce8b09d98..09cba4ea81aa8 100644 --- a/pkgs/servers/sql/postgresql/packages.nix +++ b/pkgs/servers/sql/postgresql/packages.nix @@ -56,8 +56,6 @@ self: super: { pgtap = super.callPackage ./ext/pgtap.nix { }; - pipelinedb = super.callPackage ./ext/pipelinedb.nix { }; - smlar = super.callPackage ./ext/smlar.nix { }; temporal_tables = super.callPackage ./ext/temporal_tables.nix { }; diff --git a/pkgs/servers/sslh/default.nix b/pkgs/servers/sslh/default.nix index 6add47454c2f6..97ec06306fc4a 100644 --- a/pkgs/servers/sslh/default.nix +++ b/pkgs/servers/sslh/default.nix @@ -1,22 +1,30 @@ -{ lib, stdenv, fetchFromGitHub, libcap, libconfig, perl, tcp_wrappers, pcre2, nixosTests }: +{ lib, stdenv, fetchFromGitHub, fetchpatch, libcap, libev, libconfig, perl, tcp_wrappers, pcre2, nixosTests }: stdenv.mkDerivation rec { pname = "sslh"; - version = "1.22c"; + version = "2.0.0"; src = fetchFromGitHub { owner = "yrutschle"; repo = pname; rev = "v${version}"; - sha256 = "sha256-A+nUWiOPoz/T5afZUzt5In01e049TgHisTF8P5Vj180="; + hash = "sha256-KfNQWSmAf86AFoInKlNZoiSuSwVLaJVnfo7SjZVY/VU="; }; postPatch = "patchShebangs *.sh"; - buildInputs = [ libcap libconfig perl tcp_wrappers pcre2 ]; + buildInputs = [ libcap libev libconfig perl tcp_wrappers pcre2 ]; makeFlags = [ "USELIBCAP=1" "USELIBWRAP=1" ]; + postInstall = '' + # install all flavours + install -p sslh-fork "$out/sbin/sslh-fork" + install -p sslh-select "$out/sbin/sslh-select" + install -p sslh-ev "$out/sbin/sslh-ev" + ln -sf sslh-fork "$out/sbin/sslh" + ''; + installFlags = [ "PREFIX=$(out)" ]; hardeningDisable = [ "format" ]; diff --git a/pkgs/servers/tailscale/default.nix b/pkgs/servers/tailscale/default.nix index abdeb97319aff..35335e5e58792 100644 --- a/pkgs/servers/tailscale/default.nix +++ b/pkgs/servers/tailscale/default.nix @@ -1,7 +1,7 @@ { lib, stdenv, buildGoModule, fetchFromGitHub, makeWrapper, iptables, iproute2, procps, shadow, getent }: let - version = "1.50.1"; + version = "1.52.0"; in buildGoModule { pname = "tailscale"; @@ -11,9 +11,9 @@ buildGoModule { owner = "tailscale"; repo = "tailscale"; rev = "v${version}"; - hash = "sha256-YosV9zyWbZ18xeiKJ6/4ZzSSfcoACWadZQsqGBD/hZ4="; + hash = "sha256-mvsDM1kOLP/1LbTzmojquEF8HGy6Kb2cqJu7EnxEHPU="; }; - vendorHash = "sha256-aVtlDzC+sbEWlUAzPkAryA/+dqSzoAFc02xikh6yhf8="; + vendorHash = "sha256-WGZkpffwe4I8FewdBHXGaLbKQP/kHr7UF2lCXBTcNb4="; nativeBuildInputs = lib.optionals stdenv.isLinux [ makeWrapper ]; diff --git a/pkgs/servers/web-apps/jitsi-meet/default.nix b/pkgs/servers/web-apps/jitsi-meet/default.nix index 73b66b3269ed7..d4d91a88c3473 100644 --- a/pkgs/servers/web-apps/jitsi-meet/default.nix +++ b/pkgs/servers/web-apps/jitsi-meet/default.nix @@ -2,11 +2,11 @@ stdenv.mkDerivation rec { pname = "jitsi-meet"; - version = "1.0.7322"; + version = "1.0.7531"; src = fetchurl { url = "https://download.jitsi.org/jitsi-meet/src/jitsi-meet-${version}.tar.bz2"; - sha256 = "BjoNu1cQOw9JjX6i2R/K8Txx6m6ndVRnWPjze9y14pQ="; + sha256 = "lSntX5MRnp0GuimiqYGiBwi5wI62omvAN1ioyIz+Upc="; }; dontBuild = true; diff --git a/pkgs/servers/web-apps/livebook/default.nix b/pkgs/servers/web-apps/livebook/default.nix index 4ee2899966fd5..dee6017624dc1 100644 --- a/pkgs/servers/web-apps/livebook/default.nix +++ b/pkgs/servers/web-apps/livebook/default.nix @@ -1,7 +1,7 @@ -{ lib, beamPackages, makeWrapper, rebar3, elixir, erlang, fetchFromGitHub }: +{ lib, beamPackages, makeWrapper, rebar3, elixir, erlang, fetchFromGitHub, nixosTests }: beamPackages.mixRelease rec { pname = "livebook"; - version = "0.11.1"; + version = "0.11.3"; inherit elixir; @@ -13,13 +13,13 @@ beamPackages.mixRelease rec { owner = "livebook-dev"; repo = "livebook"; rev = "v${version}"; - hash = "sha256-8td6BUaJiEPjABrfsJTvaA+PXZ+8PnRl2hj7Ft/kb+Q="; + hash = "sha256-zUJM6OcXhHW8e09h2EKnfI9voF2k4AZ75ulQErNqjD0="; }; mixFodDeps = beamPackages.fetchMixDeps { pname = "mix-deps-${pname}"; inherit src version; - hash = "sha256-+6lq0t9K6eIyGIFs+aI35v0T6W2DASOxA+tHtFL4u28="; + hash = "sha256-7GvtxEIEbC0QZEYIoARaX9uIsf/CoGE6dX60/mCvkYI="; }; installPhase = '' @@ -32,6 +32,10 @@ beamPackages.mixRelease rec { --set MIX_REBAR3 ${rebar3}/bin/rebar3 ''; + passthru.tests = { + livebook-service = nixosTests.livebook-service; + }; + meta = with lib; { license = licenses.asl20; homepage = "https://livebook.dev/"; diff --git a/pkgs/shells/carapace/default.nix b/pkgs/shells/carapace/default.nix index b94201c96d77b..0d50270dafdc8 100644 --- a/pkgs/shells/carapace/default.nix +++ b/pkgs/shells/carapace/default.nix @@ -2,16 +2,16 @@ buildGoModule rec { pname = "carapace"; - version = "0.28.0"; + version = "0.28.2"; src = fetchFromGitHub { owner = "rsteube"; repo = "${pname}-bin"; rev = "v${version}"; - hash = "sha256-0ubZt4KsjsoIcglo/lh9JDAZjuACBNdVLJazH0Csxl0="; + hash = "sha256-ojcQ69FxU7luxYzKxnblwQgX0sapFJS8YNalMdTuzCo="; }; - vendorHash = "sha256-35Gmye5NPOtUaW8zNkjK0cQ3FRB1fK7UyqT5c17rls4="; + vendorHash = "sha256-jbKF68fPwMigKSoSOP6pJMjn+PW2yeI/oZKv2ytoHuY="; ldflags = [ "-s" diff --git a/pkgs/test/nixpkgs-check-by-name/Cargo.lock b/pkgs/test/nixpkgs-check-by-name/Cargo.lock index aa4459c7cff8b..fc3aeb9fd79b4 100644 --- a/pkgs/test/nixpkgs-check-by-name/Cargo.lock +++ b/pkgs/test/nixpkgs-check-by-name/Cargo.lock @@ -163,6 +163,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "7704b5fdd17b18ae31c4c1da5a2e0305a2bf17b5249300a9ee9ed7b72114c636" [[package]] +name = "either" +version = "1.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a26ae43d7bcc3b814de94796a5e736d4029efb0ee900c12e2d54c993ad1a1e07" + +[[package]] name = "errno" version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -219,6 +225,15 @@ dependencies = [ ] [[package]] +name = "itertools" +version = "0.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b1c173a5686ce8bfa551b3563d0c2170bf24ca44da99c7ca4bfdab5418c3fe57" +dependencies = [ + "either", +] + +[[package]] name = "itoa" version = "1.0.9" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -274,6 +289,7 @@ dependencies = [ "anyhow", "clap", "colored", + "itertools", "lazy_static", "regex", "rnix", diff --git a/pkgs/test/nixpkgs-check-by-name/Cargo.toml b/pkgs/test/nixpkgs-check-by-name/Cargo.toml index 70b44d0482005..1e6eaa1106d54 100644 --- a/pkgs/test/nixpkgs-check-by-name/Cargo.toml +++ b/pkgs/test/nixpkgs-check-by-name/Cargo.toml @@ -13,6 +13,7 @@ serde = { version = "1.0.185", features = ["derive"] } anyhow = "1.0" lazy_static = "1.4.0" colored = "2.0.4" +itertools = "0.11.0" [dev-dependencies] temp-env = "0.3.5" diff --git a/pkgs/test/nixpkgs-check-by-name/README.md b/pkgs/test/nixpkgs-check-by-name/README.md index 2d2db9a58bc5f..146cea0a64ba1 100644 --- a/pkgs/test/nixpkgs-check-by-name/README.md +++ b/pkgs/test/nixpkgs-check-by-name/README.md @@ -1,6 +1,6 @@ # Nixpkgs pkgs/by-name checker -This directory implements a program to check the [validity](#validity-checks) of the `pkgs/by-name` Nixpkgs directory once introduced. +This directory implements a program to check the [validity](#validity-checks) of the `pkgs/by-name` Nixpkgs directory. It is being used by [this GitHub Actions workflow](../../../.github/workflows/check-by-name.yml). This is part of the implementation of [RFC 140](https://github.com/NixOS/rfcs/pull/140). @@ -24,7 +24,7 @@ This API may be changed over time if the CI workflow making use of it is adjuste - `2`: If an unexpected I/O error occurs - Standard error: - Informative messages - - Error messages if validation is not successful + - Detected problems if validation is not successful ## Validity checks diff --git a/pkgs/test/nixpkgs-check-by-name/src/eval.rs b/pkgs/test/nixpkgs-check-by-name/src/eval.rs index 26836501c97ad..e4f986748b4f4 100644 --- a/pkgs/test/nixpkgs-check-by-name/src/eval.rs +++ b/pkgs/test/nixpkgs-check-by-name/src/eval.rs @@ -1,12 +1,12 @@ +use crate::nixpkgs_problem::NixpkgsProblem; use crate::structure; -use crate::utils::ErrorWriter; +use crate::validation::{self, Validation::Success}; use crate::Version; use std::path::Path; use anyhow::Context; use serde::Deserialize; use std::collections::HashMap; -use std::io; use std::path::PathBuf; use std::process; use tempfile::NamedTempFile; @@ -40,12 +40,12 @@ const EXPR: &str = include_str!("eval.nix"); /// Check that the Nixpkgs attribute values corresponding to the packages in pkgs/by-name are /// of the form `callPackage <package_file> { ... }`. /// See the `eval.nix` file for how this is achieved on the Nix side -pub fn check_values<W: io::Write>( +pub fn check_values( version: Version, - error_writer: &mut ErrorWriter<W>, - nixpkgs: &structure::Nixpkgs, + nixpkgs_path: &Path, + package_names: Vec<String>, eval_accessible_paths: Vec<&Path>, -) -> anyhow::Result<()> { +) -> validation::Result<()> { // Write the list of packages we need to check into a temporary JSON file. // This can then get read by the Nix evaluation. let attrs_file = NamedTempFile::new().context("Failed to create a temporary file")?; @@ -55,7 +55,7 @@ pub fn check_values<W: io::Write>( // entry is needed. let attrs_file_path = attrs_file.path().canonicalize()?; - serde_json::to_writer(&attrs_file, &nixpkgs.package_names).context(format!( + serde_json::to_writer(&attrs_file, &package_names).context(format!( "Failed to serialise the package names to the temporary path {}", attrs_file_path.display() ))?; @@ -87,9 +87,9 @@ pub fn check_values<W: io::Write>( .arg(&attrs_file_path) // Same for the nixpkgs to test .args(["--arg", "nixpkgsPath"]) - .arg(&nixpkgs.path) + .arg(nixpkgs_path) .arg("-I") - .arg(&nixpkgs.path); + .arg(nixpkgs_path); // Also add extra paths that need to be accessible for path in eval_accessible_paths { @@ -111,52 +111,54 @@ pub fn check_values<W: io::Write>( String::from_utf8_lossy(&result.stdout) ))?; - for package_name in &nixpkgs.package_names { - let relative_package_file = structure::Nixpkgs::relative_file_for_package(package_name); - let absolute_package_file = nixpkgs.path.join(&relative_package_file); + Ok(validation::sequence_(package_names.iter().map( + |package_name| { + let relative_package_file = structure::relative_file_for_package(package_name); + let absolute_package_file = nixpkgs_path.join(&relative_package_file); - if let Some(attribute_info) = actual_files.get(package_name) { - let valid = match &attribute_info.variant { - AttributeVariant::AutoCalled => true, - AttributeVariant::CallPackage { path, empty_arg } => { - let correct_file = if let Some(call_package_path) = path { - absolute_package_file == *call_package_path - } else { - false - }; - // Only check for the argument to be non-empty if the version is V1 or - // higher - let non_empty = if version >= Version::V1 { - !empty_arg - } else { - true - }; - correct_file && non_empty - } - AttributeVariant::Other => false, - }; - - if !valid { - error_writer.write(&format!( - "pkgs.{package_name}: This attribute is manually defined (most likely in pkgs/top-level/all-packages.nix), which is only allowed if the definition is of the form `pkgs.callPackage {} {{ ... }}` with a non-empty second argument.", - relative_package_file.display() - ))?; - continue; - } + if let Some(attribute_info) = actual_files.get(package_name) { + let valid = match &attribute_info.variant { + AttributeVariant::AutoCalled => true, + AttributeVariant::CallPackage { path, empty_arg } => { + let correct_file = if let Some(call_package_path) = path { + absolute_package_file == *call_package_path + } else { + false + }; + // Only check for the argument to be non-empty if the version is V1 or + // higher + let non_empty = if version >= Version::V1 { + !empty_arg + } else { + true + }; + correct_file && non_empty + } + AttributeVariant::Other => false, + }; - if !attribute_info.is_derivation { - error_writer.write(&format!( - "pkgs.{package_name}: This attribute defined by {} is not a derivation", - relative_package_file.display() - ))?; + if !valid { + NixpkgsProblem::WrongCallPackage { + relative_package_file: relative_package_file.clone(), + package_name: package_name.clone(), + } + .into() + } else if !attribute_info.is_derivation { + NixpkgsProblem::NonDerivation { + relative_package_file: relative_package_file.clone(), + package_name: package_name.clone(), + } + .into() + } else { + Success(()) + } + } else { + NixpkgsProblem::UndefinedAttr { + relative_package_file: relative_package_file.clone(), + package_name: package_name.clone(), + } + .into() } - } else { - error_writer.write(&format!( - "pkgs.{package_name}: This attribute is not defined but it should be defined automatically as {}", - relative_package_file.display() - ))?; - continue; - } - } - Ok(()) + }, + ))) } diff --git a/pkgs/test/nixpkgs-check-by-name/src/main.rs b/pkgs/test/nixpkgs-check-by-name/src/main.rs index 5d28077ae4aec..4cabf8f446f56 100644 --- a/pkgs/test/nixpkgs-check-by-name/src/main.rs +++ b/pkgs/test/nixpkgs-check-by-name/src/main.rs @@ -1,16 +1,19 @@ mod eval; +mod nixpkgs_problem; mod references; mod structure; mod utils; +mod validation; +use crate::structure::check_structure; +use crate::validation::Validation::Failure; +use crate::validation::Validation::Success; use anyhow::Context; use clap::{Parser, ValueEnum}; use colored::Colorize; use std::io; use std::path::{Path, PathBuf}; use std::process::ExitCode; -use structure::Nixpkgs; -use utils::ErrorWriter; /// Program to check the validity of pkgs/by-name #[derive(Parser, Debug)] @@ -63,8 +66,8 @@ fn main() -> ExitCode { /// /// # Return value /// - `Err(e)` if an I/O-related error `e` occurred. -/// - `Ok(false)` if the structure is invalid, all the structural errors have been written to `error_writer`. -/// - `Ok(true)` if the structure is valid, nothing will have been written to `error_writer`. +/// - `Ok(false)` if there are problems, all of which will be written to `error_writer`. +/// - `Ok(true)` if there are no problems pub fn check_nixpkgs<W: io::Write>( nixpkgs_path: &Path, version: Version, @@ -76,31 +79,38 @@ pub fn check_nixpkgs<W: io::Write>( nixpkgs_path.display() ))?; - // Wraps the error_writer to print everything in red, and tracks whether anything was printed - // at all. Later used to figure out if the structure was valid or not. - let mut error_writer = ErrorWriter::new(error_writer); - - if !nixpkgs_path.join(structure::BASE_SUBPATH).exists() { + let check_result = if !nixpkgs_path.join(utils::BASE_SUBPATH).exists() { eprintln!( "Given Nixpkgs path does not contain a {} subdirectory, no check necessary.", - structure::BASE_SUBPATH + utils::BASE_SUBPATH ); + Success(()) } else { - let nixpkgs = Nixpkgs::new(&nixpkgs_path, &mut error_writer)?; + match check_structure(&nixpkgs_path)? { + Failure(errors) => Failure(errors), + Success(package_names) => + // Only if we could successfully parse the structure, we do the evaluation checks + { + eval::check_values(version, &nixpkgs_path, package_names, eval_accessible_paths)? + } + } + }; - if error_writer.empty { - // Only if we could successfully parse the structure, we do the semantic checks - eval::check_values(version, &mut error_writer, &nixpkgs, eval_accessible_paths)?; - references::check_references(&mut error_writer, &nixpkgs)?; + match check_result { + Failure(errors) => { + for error in errors { + writeln!(error_writer, "{}", error.to_string().red())? + } + Ok(false) } + Success(_) => Ok(true), } - Ok(error_writer.empty) } #[cfg(test)] mod tests { use crate::check_nixpkgs; - use crate::structure; + use crate::utils; use crate::Version; use anyhow::Context; use std::fs; @@ -145,7 +155,7 @@ mod tests { return Ok(()); } - let base = path.join(structure::BASE_SUBPATH); + let base = path.join(utils::BASE_SUBPATH); fs::create_dir_all(base.join("fo/foo"))?; fs::write(base.join("fo/foo/package.nix"), "{ someDrv }: someDrv")?; diff --git a/pkgs/test/nixpkgs-check-by-name/src/nixpkgs_problem.rs b/pkgs/test/nixpkgs-check-by-name/src/nixpkgs_problem.rs new file mode 100644 index 0000000000000..2344a8cc13253 --- /dev/null +++ b/pkgs/test/nixpkgs-check-by-name/src/nixpkgs_problem.rs @@ -0,0 +1,218 @@ +use crate::utils::PACKAGE_NIX_FILENAME; +use rnix::parser::ParseError; +use std::ffi::OsString; +use std::fmt; +use std::io; +use std::path::PathBuf; + +/// Any problem that can occur when checking Nixpkgs +pub enum NixpkgsProblem { + ShardNonDir { + relative_shard_path: PathBuf, + }, + InvalidShardName { + relative_shard_path: PathBuf, + shard_name: String, + }, + PackageNonDir { + relative_package_dir: PathBuf, + }, + CaseSensitiveDuplicate { + relative_shard_path: PathBuf, + first: OsString, + second: OsString, + }, + InvalidPackageName { + relative_package_dir: PathBuf, + package_name: String, + }, + IncorrectShard { + relative_package_dir: PathBuf, + correct_relative_package_dir: PathBuf, + }, + PackageNixNonExistent { + relative_package_dir: PathBuf, + }, + PackageNixDir { + relative_package_dir: PathBuf, + }, + UndefinedAttr { + relative_package_file: PathBuf, + package_name: String, + }, + WrongCallPackage { + relative_package_file: PathBuf, + package_name: String, + }, + NonDerivation { + relative_package_file: PathBuf, + package_name: String, + }, + OutsideSymlink { + relative_package_dir: PathBuf, + subpath: PathBuf, + }, + UnresolvableSymlink { + relative_package_dir: PathBuf, + subpath: PathBuf, + io_error: io::Error, + }, + CouldNotParseNix { + relative_package_dir: PathBuf, + subpath: PathBuf, + error: ParseError, + }, + PathInterpolation { + relative_package_dir: PathBuf, + subpath: PathBuf, + line: usize, + text: String, + }, + SearchPath { + relative_package_dir: PathBuf, + subpath: PathBuf, + line: usize, + text: String, + }, + OutsidePathReference { + relative_package_dir: PathBuf, + subpath: PathBuf, + line: usize, + text: String, + }, + UnresolvablePathReference { + relative_package_dir: PathBuf, + subpath: PathBuf, + line: usize, + text: String, + io_error: io::Error, + }, +} + +impl fmt::Display for NixpkgsProblem { + fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { + match self { + NixpkgsProblem::ShardNonDir { relative_shard_path } => + write!( + f, + "{}: This is a file, but it should be a directory.", + relative_shard_path.display(), + ), + NixpkgsProblem::InvalidShardName { relative_shard_path, shard_name } => + write!( + f, + "{}: Invalid directory name \"{shard_name}\", must be at most 2 ASCII characters consisting of a-z, 0-9, \"-\" or \"_\".", + relative_shard_path.display() + ), + NixpkgsProblem::PackageNonDir { relative_package_dir } => + write!( + f, + "{}: This path is a file, but it should be a directory.", + relative_package_dir.display(), + ), + NixpkgsProblem::CaseSensitiveDuplicate { relative_shard_path, first, second } => + write!( + f, + "{}: Duplicate case-sensitive package directories {first:?} and {second:?}.", + relative_shard_path.display(), + ), + NixpkgsProblem::InvalidPackageName { relative_package_dir, package_name } => + write!( + f, + "{}: Invalid package directory name \"{package_name}\", must be ASCII characters consisting of a-z, A-Z, 0-9, \"-\" or \"_\".", + relative_package_dir.display(), + ), + NixpkgsProblem::IncorrectShard { relative_package_dir, correct_relative_package_dir } => + write!( + f, + "{}: Incorrect directory location, should be {} instead.", + relative_package_dir.display(), + correct_relative_package_dir.display(), + ), + NixpkgsProblem::PackageNixNonExistent { relative_package_dir } => + write!( + f, + "{}: Missing required \"{PACKAGE_NIX_FILENAME}\" file.", + relative_package_dir.display(), + ), + NixpkgsProblem::PackageNixDir { relative_package_dir } => + write!( + f, + "{}: \"{PACKAGE_NIX_FILENAME}\" must be a file.", + relative_package_dir.display(), + ), + NixpkgsProblem::UndefinedAttr { relative_package_file, package_name } => + write!( + f, + "pkgs.{package_name}: This attribute is not defined but it should be defined automatically as {}", + relative_package_file.display() + ), + NixpkgsProblem::WrongCallPackage { relative_package_file, package_name } => + write!( + f, + "pkgs.{package_name}: This attribute is manually defined (most likely in pkgs/top-level/all-packages.nix), which is only allowed if the definition is of the form `pkgs.callPackage {} {{ ... }}` with a non-empty second argument.", + relative_package_file.display() + ), + NixpkgsProblem::NonDerivation { relative_package_file, package_name } => + write!( + f, + "pkgs.{package_name}: This attribute defined by {} is not a derivation", + relative_package_file.display() + ), + NixpkgsProblem::OutsideSymlink { relative_package_dir, subpath } => + write!( + f, + "{}: Path {} is a symlink pointing to a path outside the directory of that package.", + relative_package_dir.display(), + subpath.display(), + ), + NixpkgsProblem::UnresolvableSymlink { relative_package_dir, subpath, io_error } => + write!( + f, + "{}: Path {} is a symlink which cannot be resolved: {io_error}.", + relative_package_dir.display(), + subpath.display(), + ), + NixpkgsProblem::CouldNotParseNix { relative_package_dir, subpath, error } => + write!( + f, + "{}: File {} could not be parsed by rnix: {}", + relative_package_dir.display(), + subpath.display(), + error, + ), + NixpkgsProblem::PathInterpolation { relative_package_dir, subpath, line, text } => + write!( + f, + "{}: File {} at line {line} contains the path expression \"{}\", which is not yet supported and may point outside the directory of that package.", + relative_package_dir.display(), + subpath.display(), + text + ), + NixpkgsProblem::SearchPath { relative_package_dir, subpath, line, text } => + write!( + f, + "{}: File {} at line {line} contains the nix search path expression \"{}\" which may point outside the directory of that package.", + relative_package_dir.display(), + subpath.display(), + text + ), + NixpkgsProblem::OutsidePathReference { relative_package_dir, subpath, line, text } => + write!( + f, + "{}: File {} at line {line} contains the path expression \"{}\" which may point outside the directory of that package.", + relative_package_dir.display(), + subpath.display(), + text, + ), + NixpkgsProblem::UnresolvablePathReference { relative_package_dir, subpath, line, text, io_error } => + write!( + f, + "{}: File {} at line {line} contains the path expression \"{}\" which cannot be resolved: {io_error}.", + relative_package_dir.display(), + subpath.display(), + text, + ), + } + } +} diff --git a/pkgs/test/nixpkgs-check-by-name/src/references.rs b/pkgs/test/nixpkgs-check-by-name/src/references.rs index 16dc60729c420..0561a9b22e858 100644 --- a/pkgs/test/nixpkgs-check-by-name/src/references.rs +++ b/pkgs/test/nixpkgs-check-by-name/src/references.rs @@ -1,105 +1,98 @@ -use crate::structure::Nixpkgs; +use crate::nixpkgs_problem::NixpkgsProblem; use crate::utils; -use crate::utils::{ErrorWriter, LineIndex}; +use crate::utils::LineIndex; +use crate::validation::{self, ResultIteratorExt, Validation::Success}; use anyhow::Context; use rnix::{Root, SyntaxKind::NODE_PATH}; use std::ffi::OsStr; use std::fs::read_to_string; -use std::io; -use std::path::{Path, PathBuf}; - -/// Small helper so we don't need to pass in the same arguments to all functions -struct PackageContext<'a, W: io::Write> { - error_writer: &'a mut ErrorWriter<W>, - /// The package directory relative to Nixpkgs, such as `pkgs/by-name/fo/foo` - relative_package_dir: &'a PathBuf, - /// The absolute package directory - absolute_package_dir: &'a PathBuf, -} +use std::path::Path; /// Check that every package directory in pkgs/by-name doesn't link to outside that directory. /// Both symlinks and Nix path expressions are checked. -pub fn check_references<W: io::Write>( - error_writer: &mut ErrorWriter<W>, - nixpkgs: &Nixpkgs, -) -> anyhow::Result<()> { - // Check the directories for each package separately - for package_name in &nixpkgs.package_names { - let relative_package_dir = Nixpkgs::relative_dir_for_package(package_name); - let mut context = PackageContext { - error_writer, - relative_package_dir: &relative_package_dir, - absolute_package_dir: &nixpkgs.path.join(&relative_package_dir), - }; - - // The empty argument here is the subpath under the package directory to check - // An empty one means the package directory itself - check_path(&mut context, Path::new("")).context(format!( - "While checking the references in package directory {}", - relative_package_dir.display() - ))?; - } - Ok(()) +pub fn check_references( + relative_package_dir: &Path, + absolute_package_dir: &Path, +) -> validation::Result<()> { + // The empty argument here is the subpath under the package directory to check + // An empty one means the package directory itself + check_path(relative_package_dir, absolute_package_dir, Path::new("")).context(format!( + "While checking the references in package directory {}", + relative_package_dir.display() + )) } /// Checks for a specific path to not have references outside -fn check_path<W: io::Write>(context: &mut PackageContext<W>, subpath: &Path) -> anyhow::Result<()> { - let path = context.absolute_package_dir.join(subpath); +fn check_path( + relative_package_dir: &Path, + absolute_package_dir: &Path, + subpath: &Path, +) -> validation::Result<()> { + let path = absolute_package_dir.join(subpath); - if path.is_symlink() { + Ok(if path.is_symlink() { // Check whether the symlink resolves to outside the package directory match path.canonicalize() { Ok(target) => { // No need to handle the case of it being inside the directory, since we scan through the // entire directory recursively anyways - if let Err(_prefix_error) = target.strip_prefix(context.absolute_package_dir) { - context.error_writer.write(&format!( - "{}: Path {} is a symlink pointing to a path outside the directory of that package.", - context.relative_package_dir.display(), - subpath.display(), - ))?; + if let Err(_prefix_error) = target.strip_prefix(absolute_package_dir) { + NixpkgsProblem::OutsideSymlink { + relative_package_dir: relative_package_dir.to_path_buf(), + subpath: subpath.to_path_buf(), + } + .into() + } else { + Success(()) } } - Err(e) => { - context.error_writer.write(&format!( - "{}: Path {} is a symlink which cannot be resolved: {e}.", - context.relative_package_dir.display(), - subpath.display(), - ))?; + Err(io_error) => NixpkgsProblem::UnresolvableSymlink { + relative_package_dir: relative_package_dir.to_path_buf(), + subpath: subpath.to_path_buf(), + io_error, } + .into(), } } else if path.is_dir() { // Recursively check each entry - for entry in utils::read_dir_sorted(&path)? { - let entry_subpath = subpath.join(entry.file_name()); - check_path(context, &entry_subpath) - .context(format!("Error while recursing into {}", subpath.display()))? - } + validation::sequence_( + utils::read_dir_sorted(&path)? + .into_iter() + .map(|entry| { + let entry_subpath = subpath.join(entry.file_name()); + check_path(relative_package_dir, absolute_package_dir, &entry_subpath) + .context(format!("Error while recursing into {}", subpath.display())) + }) + .collect_vec()?, + ) } else if path.is_file() { // Only check Nix files if let Some(ext) = path.extension() { if ext == OsStr::new("nix") { - check_nix_file(context, subpath).context(format!( - "Error while checking Nix file {}", - subpath.display() - ))? + check_nix_file(relative_package_dir, absolute_package_dir, subpath).context( + format!("Error while checking Nix file {}", subpath.display()), + )? + } else { + Success(()) } + } else { + Success(()) } } else { // This should never happen, git doesn't support other file types anyhow::bail!("Unsupported file type for path {}", subpath.display()); - } - Ok(()) + }) } /// Check whether a nix file contains path expression references pointing outside the package /// directory -fn check_nix_file<W: io::Write>( - context: &mut PackageContext<W>, +fn check_nix_file( + relative_package_dir: &Path, + absolute_package_dir: &Path, subpath: &Path, -) -> anyhow::Result<()> { - let path = context.absolute_package_dir.join(subpath); +) -> validation::Result<()> { + let path = absolute_package_dir.join(subpath); let parent_dir = path.parent().context(format!( "Could not get parent of path {}", subpath.display() @@ -110,75 +103,73 @@ fn check_nix_file<W: io::Write>( let root = Root::parse(&contents); if let Some(error) = root.errors().first() { - context.error_writer.write(&format!( - "{}: File {} could not be parsed by rnix: {}", - context.relative_package_dir.display(), - subpath.display(), - error, - ))?; - return Ok(()); + return Ok(NixpkgsProblem::CouldNotParseNix { + relative_package_dir: relative_package_dir.to_path_buf(), + subpath: subpath.to_path_buf(), + error: error.clone(), + } + .into()); } let line_index = LineIndex::new(&contents); - for node in root.syntax().descendants() { - // We're only interested in Path expressions - if node.kind() != NODE_PATH { - continue; - } - - let text = node.text().to_string(); - let line = line_index.line(node.text_range().start().into()); - - // Filters out ./foo/${bar}/baz - // TODO: We can just check ./foo - if node.children().count() != 0 { - context.error_writer.write(&format!( - "{}: File {} at line {line} contains the path expression \"{}\", which is not yet supported and may point outside the directory of that package.", - context.relative_package_dir.display(), - subpath.display(), - text - ))?; - continue; - } - - // Filters out search paths like <nixpkgs> - if text.starts_with('<') { - context.error_writer.write(&format!( - "{}: File {} at line {line} contains the nix search path expression \"{}\" which may point outside the directory of that package.", - context.relative_package_dir.display(), - subpath.display(), - text - ))?; - continue; - } - - // Resolves the reference of the Nix path - // turning `../baz` inside `/foo/bar/default.nix` to `/foo/baz` - match parent_dir.join(Path::new(&text)).canonicalize() { - Ok(target) => { - // Then checking if it's still in the package directory - // No need to handle the case of it being inside the directory, since we scan through the - // entire directory recursively anyways - if let Err(_prefix_error) = target.strip_prefix(context.absolute_package_dir) { - context.error_writer.write(&format!( - "{}: File {} at line {line} contains the path expression \"{}\" which may point outside the directory of that package.", - context.relative_package_dir.display(), - subpath.display(), - text, - ))?; + Ok(validation::sequence_(root.syntax().descendants().map( + |node| { + let text = node.text().to_string(); + let line = line_index.line(node.text_range().start().into()); + + if node.kind() != NODE_PATH { + // We're only interested in Path expressions + Success(()) + } else if node.children().count() != 0 { + // Filters out ./foo/${bar}/baz + // TODO: We can just check ./foo + NixpkgsProblem::PathInterpolation { + relative_package_dir: relative_package_dir.to_path_buf(), + subpath: subpath.to_path_buf(), + line, + text, } - } - Err(e) => { - context.error_writer.write(&format!( - "{}: File {} at line {line} contains the path expression \"{}\" which cannot be resolved: {e}.", - context.relative_package_dir.display(), - subpath.display(), + .into() + } else if text.starts_with('<') { + // Filters out search paths like <nixpkgs> + NixpkgsProblem::SearchPath { + relative_package_dir: relative_package_dir.to_path_buf(), + subpath: subpath.to_path_buf(), + line, text, - ))?; + } + .into() + } else { + // Resolves the reference of the Nix path + // turning `../baz` inside `/foo/bar/default.nix` to `/foo/baz` + match parent_dir.join(Path::new(&text)).canonicalize() { + Ok(target) => { + // Then checking if it's still in the package directory + // No need to handle the case of it being inside the directory, since we scan through the + // entire directory recursively anyways + if let Err(_prefix_error) = target.strip_prefix(absolute_package_dir) { + NixpkgsProblem::OutsidePathReference { + relative_package_dir: relative_package_dir.to_path_buf(), + subpath: subpath.to_path_buf(), + line, + text, + } + .into() + } else { + Success(()) + } + } + Err(e) => NixpkgsProblem::UnresolvablePathReference { + relative_package_dir: relative_package_dir.to_path_buf(), + subpath: subpath.to_path_buf(), + line, + text, + io_error: e, + } + .into(), + } } - }; - } - - Ok(()) + }, + ))) } diff --git a/pkgs/test/nixpkgs-check-by-name/src/structure.rs b/pkgs/test/nixpkgs-check-by-name/src/structure.rs index ea80128e487ac..4051ca037c9a3 100644 --- a/pkgs/test/nixpkgs-check-by-name/src/structure.rs +++ b/pkgs/test/nixpkgs-check-by-name/src/structure.rs @@ -1,152 +1,170 @@ +use crate::nixpkgs_problem::NixpkgsProblem; +use crate::references; use crate::utils; -use crate::utils::ErrorWriter; +use crate::utils::{BASE_SUBPATH, PACKAGE_NIX_FILENAME}; +use crate::validation::{self, ResultIteratorExt, Validation::Success}; +use itertools::concat; use lazy_static::lazy_static; use regex::Regex; -use std::collections::HashMap; -use std::io; +use std::fs::DirEntry; use std::path::{Path, PathBuf}; -pub const BASE_SUBPATH: &str = "pkgs/by-name"; -pub const PACKAGE_NIX_FILENAME: &str = "package.nix"; - lazy_static! { static ref SHARD_NAME_REGEX: Regex = Regex::new(r"^[a-z0-9_-]{1,2}$").unwrap(); static ref PACKAGE_NAME_REGEX: Regex = Regex::new(r"^[a-zA-Z0-9_-]+$").unwrap(); } -/// Contains information about the structure of the pkgs/by-name directory of a Nixpkgs -pub struct Nixpkgs { - /// The path to nixpkgs - pub path: PathBuf, - /// The names of all packages declared in pkgs/by-name - pub package_names: Vec<String>, -} - -impl Nixpkgs { - // Some utility functions for the basic structure +// Some utility functions for the basic structure - pub fn shard_for_package(package_name: &str) -> String { - package_name.to_lowercase().chars().take(2).collect() - } - - pub fn relative_dir_for_shard(shard_name: &str) -> PathBuf { - PathBuf::from(format!("{BASE_SUBPATH}/{shard_name}")) - } +pub fn shard_for_package(package_name: &str) -> String { + package_name.to_lowercase().chars().take(2).collect() +} - pub fn relative_dir_for_package(package_name: &str) -> PathBuf { - Nixpkgs::relative_dir_for_shard(&Nixpkgs::shard_for_package(package_name)) - .join(package_name) - } +pub fn relative_dir_for_shard(shard_name: &str) -> PathBuf { + PathBuf::from(format!("{BASE_SUBPATH}/{shard_name}")) +} - pub fn relative_file_for_package(package_name: &str) -> PathBuf { - Nixpkgs::relative_dir_for_package(package_name).join(PACKAGE_NIX_FILENAME) - } +pub fn relative_dir_for_package(package_name: &str) -> PathBuf { + relative_dir_for_shard(&shard_for_package(package_name)).join(package_name) } -impl Nixpkgs { - /// Read the structure of a Nixpkgs directory, displaying errors on the writer. - /// May return early with I/O errors. - pub fn new<W: io::Write>( - path: &Path, - error_writer: &mut ErrorWriter<W>, - ) -> anyhow::Result<Nixpkgs> { - let base_dir = path.join(BASE_SUBPATH); +pub fn relative_file_for_package(package_name: &str) -> PathBuf { + relative_dir_for_package(package_name).join(PACKAGE_NIX_FILENAME) +} - let mut package_names = Vec::new(); +/// Check the structure of Nixpkgs, returning the attribute names that are defined in +/// `pkgs/by-name` +pub fn check_structure(path: &Path) -> validation::Result<Vec<String>> { + let base_dir = path.join(BASE_SUBPATH); - for shard_entry in utils::read_dir_sorted(&base_dir)? { + let shard_results = utils::read_dir_sorted(&base_dir)? + .into_iter() + .map(|shard_entry| -> validation::Result<_> { let shard_path = shard_entry.path(); let shard_name = shard_entry.file_name().to_string_lossy().into_owned(); - let relative_shard_path = Nixpkgs::relative_dir_for_shard(&shard_name); + let relative_shard_path = relative_dir_for_shard(&shard_name); - if shard_name == "README.md" { + Ok(if shard_name == "README.md" { // README.md is allowed to be a file and not checked - continue; - } - - if !shard_path.is_dir() { - error_writer.write(&format!( - "{}: This is a file, but it should be a directory.", - relative_shard_path.display(), - ))?; - // we can't check for any other errors if it's a file, since there's no subdirectories to check - continue; - } - - let shard_name_valid = SHARD_NAME_REGEX.is_match(&shard_name); - if !shard_name_valid { - error_writer.write(&format!( - "{}: Invalid directory name \"{shard_name}\", must be at most 2 ASCII characters consisting of a-z, 0-9, \"-\" or \"_\".", - relative_shard_path.display() - ))?; - } - - let mut unique_package_names = HashMap::new(); - - for package_entry in utils::read_dir_sorted(&shard_path)? { - let package_path = package_entry.path(); - let package_name = package_entry.file_name().to_string_lossy().into_owned(); - let relative_package_dir = - PathBuf::from(format!("{BASE_SUBPATH}/{shard_name}/{package_name}")); - - if !package_path.is_dir() { - error_writer.write(&format!( - "{}: This path is a file, but it should be a directory.", - relative_package_dir.display(), - ))?; - continue; - } - if let Some(duplicate_package_name) = - unique_package_names.insert(package_name.to_lowercase(), package_name.clone()) - { - error_writer.write(&format!( - "{}: Duplicate case-sensitive package directories \"{duplicate_package_name}\" and \"{package_name}\".", - relative_shard_path.display(), - ))?; + Success(vec![]) + } else if !shard_path.is_dir() { + NixpkgsProblem::ShardNonDir { + relative_shard_path: relative_shard_path.clone(), } - - let package_name_valid = PACKAGE_NAME_REGEX.is_match(&package_name); - if !package_name_valid { - error_writer.write(&format!( - "{}: Invalid package directory name \"{package_name}\", must be ASCII characters consisting of a-z, A-Z, 0-9, \"-\" or \"_\".", - relative_package_dir.display(), - ))?; - } - - let correct_relative_package_dir = Nixpkgs::relative_dir_for_package(&package_name); - if relative_package_dir != correct_relative_package_dir { - // Only show this error if we have a valid shard and package name - // Because if one of those is wrong, you should fix that first - if shard_name_valid && package_name_valid { - error_writer.write(&format!( - "{}: Incorrect directory location, should be {} instead.", - relative_package_dir.display(), - correct_relative_package_dir.display(), - ))?; + .into() + // we can't check for any other errors if it's a file, since there's no subdirectories to check + } else { + let shard_name_valid = SHARD_NAME_REGEX.is_match(&shard_name); + let result = if !shard_name_valid { + NixpkgsProblem::InvalidShardName { + relative_shard_path: relative_shard_path.clone(), + shard_name: shard_name.clone(), } - } + .into() + } else { + Success(()) + }; + + let entries = utils::read_dir_sorted(&shard_path)?; + + let duplicate_results = entries + .iter() + .zip(entries.iter().skip(1)) + .filter(|(l, r)| { + l.file_name().to_ascii_lowercase() == r.file_name().to_ascii_lowercase() + }) + .map(|(l, r)| { + NixpkgsProblem::CaseSensitiveDuplicate { + relative_shard_path: relative_shard_path.clone(), + first: l.file_name(), + second: r.file_name(), + } + .into() + }); + + let result = result.and(validation::sequence_(duplicate_results)); + + let package_results = entries + .into_iter() + .map(|package_entry| { + check_package(path, &shard_name, shard_name_valid, package_entry) + }) + .collect_vec()?; + + result.and(validation::sequence(package_results)) + }) + }) + .collect_vec()?; - let package_nix_path = package_path.join(PACKAGE_NIX_FILENAME); - if !package_nix_path.exists() { - error_writer.write(&format!( - "{}: Missing required \"{PACKAGE_NIX_FILENAME}\" file.", - relative_package_dir.display(), - ))?; - } else if package_nix_path.is_dir() { - error_writer.write(&format!( - "{}: \"{PACKAGE_NIX_FILENAME}\" must be a file.", - relative_package_dir.display(), - ))?; - } + // Combine the package names conatained within each shard into a longer list + Ok(validation::sequence(shard_results).map(concat)) +} - package_names.push(package_name.clone()); - } +fn check_package( + path: &Path, + shard_name: &str, + shard_name_valid: bool, + package_entry: DirEntry, +) -> validation::Result<String> { + let package_path = package_entry.path(); + let package_name = package_entry.file_name().to_string_lossy().into_owned(); + let relative_package_dir = PathBuf::from(format!("{BASE_SUBPATH}/{shard_name}/{package_name}")); + + Ok(if !package_path.is_dir() { + NixpkgsProblem::PackageNonDir { + relative_package_dir: relative_package_dir.clone(), } - - Ok(Nixpkgs { - path: path.to_owned(), - package_names, - }) - } + .into() + } else { + let package_name_valid = PACKAGE_NAME_REGEX.is_match(&package_name); + let result = if !package_name_valid { + NixpkgsProblem::InvalidPackageName { + relative_package_dir: relative_package_dir.clone(), + package_name: package_name.clone(), + } + .into() + } else { + Success(()) + }; + + let correct_relative_package_dir = relative_dir_for_package(&package_name); + let result = result.and(if relative_package_dir != correct_relative_package_dir { + // Only show this error if we have a valid shard and package name + // Because if one of those is wrong, you should fix that first + if shard_name_valid && package_name_valid { + NixpkgsProblem::IncorrectShard { + relative_package_dir: relative_package_dir.clone(), + correct_relative_package_dir: correct_relative_package_dir.clone(), + } + .into() + } else { + Success(()) + } + } else { + Success(()) + }); + + let package_nix_path = package_path.join(PACKAGE_NIX_FILENAME); + let result = result.and(if !package_nix_path.exists() { + NixpkgsProblem::PackageNixNonExistent { + relative_package_dir: relative_package_dir.clone(), + } + .into() + } else if package_nix_path.is_dir() { + NixpkgsProblem::PackageNixDir { + relative_package_dir: relative_package_dir.clone(), + } + .into() + } else { + Success(()) + }); + + let result = result.and(references::check_references( + &relative_package_dir, + &path.join(&relative_package_dir), + )?); + + result.map(|_| package_name.clone()) + }) } diff --git a/pkgs/test/nixpkgs-check-by-name/src/utils.rs b/pkgs/test/nixpkgs-check-by-name/src/utils.rs index 325c736eca98b..5cc4a0863ba82 100644 --- a/pkgs/test/nixpkgs-check-by-name/src/utils.rs +++ b/pkgs/test/nixpkgs-check-by-name/src/utils.rs @@ -1,9 +1,11 @@ use anyhow::Context; -use colored::Colorize; use std::fs; use std::io; use std::path::Path; +pub const BASE_SUBPATH: &str = "pkgs/by-name"; +pub const PACKAGE_NIX_FILENAME: &str = "package.nix"; + /// Deterministic file listing so that tests are reproducible pub fn read_dir_sorted(base_dir: &Path) -> anyhow::Result<Vec<fs::DirEntry>> { let listing = base_dir @@ -47,26 +49,3 @@ impl LineIndex { } } } - -/// A small wrapper around a generic io::Write specifically for errors: -/// - Print everything in red to signal it's an error -/// - Keep track of whether anything was printed at all, so that -/// it can be queried whether any errors were encountered at all -pub struct ErrorWriter<W> { - pub writer: W, - pub empty: bool, -} - -impl<W: io::Write> ErrorWriter<W> { - pub fn new(writer: W) -> ErrorWriter<W> { - ErrorWriter { - writer, - empty: true, - } - } - - pub fn write(&mut self, string: &str) -> io::Result<()> { - self.empty = false; - writeln!(self.writer, "{}", string.red()) - } -} diff --git a/pkgs/test/nixpkgs-check-by-name/src/validation.rs b/pkgs/test/nixpkgs-check-by-name/src/validation.rs new file mode 100644 index 0000000000000..e727938515218 --- /dev/null +++ b/pkgs/test/nixpkgs-check-by-name/src/validation.rs @@ -0,0 +1,102 @@ +use crate::nixpkgs_problem::NixpkgsProblem; +use itertools::concat; +use itertools::{ + Either::{Left, Right}, + Itertools, +}; +use Validation::*; + +/// The validation result of a check. +/// Instead of exiting at the first failure, +/// this type can accumulate multiple failures. +/// This can be achieved using the functions `and`, `sequence` and `sequence_` +/// +/// This leans on https://hackage.haskell.org/package/validation +pub enum Validation<A> { + Failure(Vec<NixpkgsProblem>), + Success(A), +} + +impl<A> From<NixpkgsProblem> for Validation<A> { + /// Create a `Validation<A>` from a single check problem + fn from(value: NixpkgsProblem) -> Self { + Failure(vec![value]) + } +} + +/// A type alias representing the result of a check, either: +/// - Err(anyhow::Error): A fatal failure, typically I/O errors. +/// Such failures are not caused by the files in Nixpkgs. +/// This hints at a bug in the code or a problem with the deployment. +/// - Ok(Failure(Vec<NixpkgsProblem>)): A non-fatal validation problem with the Nixpkgs files. +/// Further checks can be run even with this result type. +/// Such problems can be fixed by changing the Nixpkgs files. +/// - Ok(Success(A)): A successful (potentially intermediate) result with an arbitrary value. +/// No fatal errors have occurred and no validation problems have been found with Nixpkgs. +pub type Result<A> = anyhow::Result<Validation<A>>; + +pub trait ResultIteratorExt<A, E>: Sized + Iterator<Item = std::result::Result<A, E>> { + fn collect_vec(self) -> std::result::Result<Vec<A>, E>; +} + +impl<I, A, E> ResultIteratorExt<A, E> for I +where + I: Sized + Iterator<Item = std::result::Result<A, E>>, +{ + /// A convenience version of `collect` specialised to a vector + fn collect_vec(self) -> std::result::Result<Vec<A>, E> { + self.collect() + } +} + +impl<A> Validation<A> { + /// Map a `Validation<A>` to a `Validation<B>` by applying a function to the + /// potentially contained value in case of success. + pub fn map<B>(self, f: impl FnOnce(A) -> B) -> Validation<B> { + match self { + Failure(err) => Failure(err), + Success(value) => Success(f(value)), + } + } +} + +impl Validation<()> { + /// Combine two validations, both of which need to be successful for the return value to be successful. + /// The `NixpkgsProblem`s of both sides are returned concatenated. + pub fn and<A>(self, other: Validation<A>) -> Validation<A> { + match (self, other) { + (Success(_), Success(right_value)) => Success(right_value), + (Failure(errors), Success(_)) => Failure(errors), + (Success(_), Failure(errors)) => Failure(errors), + (Failure(errors_l), Failure(errors_r)) => Failure(concat([errors_l, errors_r])), + } + } +} + +/// Combine many validations into a single one. +/// All given validations need to be successful in order for the returned validation to be successful, +/// in which case the returned validation value contains a `Vec` of each individual value. +/// Otherwise the `NixpkgsProblem`s of all validations are returned concatenated. +pub fn sequence<A>(check_results: impl IntoIterator<Item = Validation<A>>) -> Validation<Vec<A>> { + let (errors, values): (Vec<Vec<NixpkgsProblem>>, Vec<A>) = check_results + .into_iter() + .partition_map(|validation| match validation { + Failure(err) => Left(err), + Success(value) => Right(value), + }); + + // To combine the errors from the results we flatten all the error Vec's into a new Vec + // This is not very efficient, but doesn't matter because generally we should have no errors + let flattened_errors = errors.into_iter().concat(); + + if flattened_errors.is_empty() { + Success(values) + } else { + Failure(flattened_errors) + } +} + +/// Like `sequence`, but without any containing value, for convenience +pub fn sequence_(validations: impl IntoIterator<Item = Validation<()>>) -> Validation<()> { + sequence(validations).map(|_| ()) +} diff --git a/pkgs/tools/admin/azure-cli/default.nix b/pkgs/tools/admin/azure-cli/default.nix index 4205071c4a32e..87231b2277b5f 100644 --- a/pkgs/tools/admin/azure-cli/default.nix +++ b/pkgs/tools/admin/azure-cli/default.nix @@ -1,7 +1,5 @@ { lib -, stdenv -, python3 -, fetchPypi +, callPackage , fetchFromGitHub , installShellFiles }: @@ -18,9 +16,7 @@ let }; # put packages that needs to be overridden in the py package scope - py = import ./python-packages.nix { - inherit stdenv src version python3 fetchPypi; - }; + py = callPackage ./python-packages.nix { inherit src version; }; in py.pkgs.toPythonApplication (py.pkgs.buildAzureCliPackage { diff --git a/pkgs/tools/admin/azure-cli/python-packages.nix b/pkgs/tools/admin/azure-cli/python-packages.nix index d13dd28230104..fa7d84e511727 100644 --- a/pkgs/tools/admin/azure-cli/python-packages.nix +++ b/pkgs/tools/admin/azure-cli/python-packages.nix @@ -1,6 +1,7 @@ { stdenv , python3 , fetchPypi +, fetchpatch , src , version }: @@ -28,6 +29,20 @@ let pname = "azure-cli-core"; inherit version src; + patches = [ + (fetchpatch { + name = "fix-python311.patch"; + url = "https://github.com/Azure/azure-cli/commit/a5198b578b17de934e15b1c92e369e45323e9658.patch"; + hash = "sha256-qbyKF6Vvtz8QwY78sG7ptTVcbM2IR+phntOKqsrWetE="; + stripLen = 2; + includes = [ + "azure/cli/core/tests/test_command_registration.py" + "azure/cli/core/tests/test_help.py" + "azure/cli/core/tests/test_parser.py" + ]; + }) + ]; + sourceRoot = "${src.name}/src/azure-cli-core"; propagatedBuildInputs = with self; [ diff --git a/pkgs/tools/admin/pgadmin/default.nix b/pkgs/tools/admin/pgadmin/default.nix index beecd6412bcfb..117f02a593bac 100644 --- a/pkgs/tools/admin/pgadmin/default.nix +++ b/pkgs/tools/admin/pgadmin/default.nix @@ -9,6 +9,7 @@ , yarn , fixup_yarn_lock , nodejs +, fetchpatch , server-mode ? true }: @@ -26,7 +27,61 @@ let # keep the scope, as it is used throughout the derivation and tests # this also makes potential future overrides easier - pythonPackages = python3.pkgs.overrideScope (final: prev: rec { }); + pythonPackages = python3.pkgs.overrideScope (final: prev: rec { + # pgadmin 7.8 is incompatible with Flask >= 2.3 + flask = prev.flask.overridePythonAttrs (oldAttrs: rec { + version = "2.2.5"; + src = oldAttrs.src.override { + pname = "Flask"; + inherit version; + hash = "sha256-7e6bCn/yZiG9WowQ/0hK4oc3okENmbC7mmhQx/uXeqA="; + }; + format = "setuptools"; + }); + # downgrade needed for older Flask + httpbin = prev.httpbin.overridePythonAttrs (oldAttrs: rec { + version = "0.7.0"; + src = oldAttrs.src.override { + inherit version; + hash = "sha256-y7N3kMkVdfTxV1f0KtQdn3KesifV7b6J5OwXVIbbjfo="; + }; + format = "setuptools"; + patches = [ + (fetchpatch { + # Replaces BaseResponse class with Response class for Werkezug 2.1.0 compatibility + # https://github.com/postmanlabs/httpbin/pull/674 + url = "https://github.com/postmanlabs/httpbin/commit/5cc81ce87a3c447a127e4a1a707faf9f3b1c9b6b.patch"; + hash = "sha256-SbEWjiqayMFYrbgAPZtSsXqSyCDUz3z127XgcKOcrkE="; + }) + ]; + pytestFlagsArray = [ + "test_httpbin.py" + ]; + propagatedBuildInputs = oldAttrs.propagatedBuildInputs ++ [ final.pythonPackages.brotlipy ]; + }); + # downgrade needed for older httpbin + werkzeug = prev.werkzeug.overridePythonAttrs (oldAttrs: rec { + version = "2.2.3"; + format = "setuptools"; + src = oldAttrs.src.override { + pname = "Werkzeug"; + inherit version; + hash = "sha256-LhzMlBfU2jWLnebxdOOsCUOR6h1PvvLWZ4ZdgZ39Cv4="; + }; + }); + # Downgrade needed for older Flask + flask-security-too = prev.flask-security-too.overridePythonAttrs (oldAttrs: rec { + version = "5.1.2"; + src = oldAttrs.src.override { + inherit version; + hash = "sha256-lZzm43m30y+2qjxNddFEeg9HDlQP9afq5VtuR25zaLc="; + }; + postPatch = '' + # This should be removed after updating to version 5.3.0. + sed -i '/filterwarnings =/a ignore:pkg_resources is deprecated:DeprecationWarning' pytest.ini + ''; + }); + }); offlineCache = fetchYarnDeps { yarnLock = ./yarn.lock; diff --git a/pkgs/tools/admin/salt/default.nix b/pkgs/tools/admin/salt/default.nix index aa654d522a52b..e88f9aee40388 100644 --- a/pkgs/tools/admin/salt/default.nix +++ b/pkgs/tools/admin/salt/default.nix @@ -11,12 +11,12 @@ python3.pkgs.buildPythonApplication rec { pname = "salt"; - version = "3006.3"; + version = "3006.4"; format = "setuptools"; src = fetchPypi { inherit pname version; - hash = "sha256-flP7zETEn41uZ8sZytoGOADKKe1/Fa+XJSdTGqhW5Cs="; + hash = "sha256-0JeIXDPCz6oMzcYnylcNZ2kMjQN9x4Ab6IeIvMoQNq4="; }; patches = [ diff --git a/pkgs/tools/audio/kaldi/default.nix b/pkgs/tools/audio/kaldi/default.nix index 7ea5cf622b57e..c9dc204ad405d 100644 --- a/pkgs/tools/audio/kaldi/default.nix +++ b/pkgs/tools/audio/kaldi/default.nix @@ -19,13 +19,13 @@ assert blas.implementation == "openblas" && lapack.implementation == "openblas"; stdenv.mkDerivation (finalAttrs: { pname = "kaldi"; - version = "unstable-2023-05-02"; + version = "unstable-2023-10-13"; src = fetchFromGitHub { owner = "kaldi-asr"; repo = "kaldi"; - rev = "71f38e62cad01c3078555bfe78d0f3a527422d75"; - sha256 = "sha256-2xm0F80cjovy/G9Ytq/iwa1eexZk0mromv6PPuNIT8U="; + rev = "1b07b595b0bfd261c87f4efecd022481ed4a196f"; + sha256 = "sha256-S4UD/J28McnJjFu5FH3ElwzXapceUUezfBCgI91eIi0="; }; cmakeFlags = [ diff --git a/pkgs/tools/audio/tts/default.nix b/pkgs/tools/audio/tts/default.nix index d4147faf960f1..78adea9d222c9 100644 --- a/pkgs/tools/audio/tts/default.nix +++ b/pkgs/tools/audio/tts/default.nix @@ -16,14 +16,14 @@ let in python.pkgs.buildPythonApplication rec { pname = "tts"; - version = "0.18.2"; + version = "0.19.1"; format = "pyproject"; src = fetchFromGitHub { owner = "coqui-ai"; repo = "TTS"; rev = "refs/tags/v${version}"; - hash = "sha256-bTShJwzxff+R9GkR72qNzd22zY8LwUUsD8r30kZXAsI="; + hash = "sha256-GYVr/Wam1IGCSR2vHMAu5Fg/jRB333L6iNjltnRKh4E="; }; postPatch = let diff --git a/pkgs/tools/audio/video2midi/default.nix b/pkgs/tools/audio/video2midi/default.nix index f8c50fda29c37..2c2ea77de6e7d 100644 --- a/pkgs/tools/audio/video2midi/default.nix +++ b/pkgs/tools/audio/video2midi/default.nix @@ -1,7 +1,7 @@ -{ lib, fetchFromGitHub, pythonPackages, opencv3 }: +{ lib, fetchFromGitHub, pythonPackages, opencv4 }: let - opencv3_ = pythonPackages.toPythonModule (opencv3.override { + opencv4_ = pythonPackages.toPythonModule (opencv4.override { inherit pythonPackages; enablePython = true; enableFfmpeg = true; @@ -19,7 +19,7 @@ in pythonPackages.buildPythonApplication rec { sha256 = "0qzrxqhsxn0h71nfrsi9g78hx3pqm3b8sr6fjq01k4k6dd2nwfam"; }; - propagatedBuildInputs = with pythonPackages; [ opencv3_ midiutil pygame pyopengl ]; + propagatedBuildInputs = with pythonPackages; [ opencv4_ midiutil pygame pyopengl ]; installPhase = '' install -Dm755 v2m.py $out/bin/v2m.py diff --git a/pkgs/tools/audio/wyoming/openwakeword.nix b/pkgs/tools/audio/wyoming/openwakeword.nix index d8450dac69830..83da563f3b3b2 100644 --- a/pkgs/tools/audio/wyoming/openwakeword.nix +++ b/pkgs/tools/audio/wyoming/openwakeword.nix @@ -1,61 +1,51 @@ { lib -, python3 , python3Packages , fetchFromGitHub , fetchpatch }: -python3.pkgs.buildPythonApplication { +python3Packages.buildPythonApplication rec { pname = "wyoming-openwakeword"; - version = "1.5.1"; + version = "1.8.1"; pyproject = true; src = fetchFromGitHub { owner = "rhasspy"; - repo = "rhasspy3"; - rev = "e16d7d374a64f671db48142c7b635b327660ebcf"; - hash = "sha256-SbWsRmR1hfuU3yJbuu+r7M43ugHeNwLgu5S8MqkbCQA="; + repo = "wyoming-openwakeword"; + rev = "refs/tags/v${version}"; + hash = "sha256-N/EjdNQLsYLpJ4kOxY/z+/dMMmF1PPAIEEzSHfnZWaM="; }; patches = [ (fetchpatch { # import tflite entrypoint from tensorflow - url = "https://github.com/rhasspy/rhasspy3/commit/23b1bc9cf1e9aa78453feb11e27d5dafe26de068.patch"; - hash = "sha256-fjLJ+VI4c8ABBWx1IjZ6nS8MGqdry4rgcThKiaAvz+Q="; + url = "https://github.com/rhasspy/wyoming-openwakeword/commit/8f4ba2750d8c545e77549a7230cdee1301dac09a.patch"; + hash = "sha256-WPvywpGv0sYYVGc7he4bt7APIsa3ziKaWqpFlx3v+V8="; }) (fetchpatch { # add commandline entrypoint - url = "https://github.com/rhasspy/rhasspy3/commit/7662b82cd85e16817a3c6f4153e855bf57436ac3.patch"; - hash = "sha256-41CLkVDSAJJpZ5irwIf/Z4wHoCuKDrqFBAjKCx7ta50="; + url = "https://github.com/rhasspy/wyoming-openwakeword/commit/f40e5635543b2315217538dd89a9fe40fe817cfe.patch"; + hash = "sha256-HNlGqt7bMzwyvhx5Hw7mkTHeQmBpgDCU3pUbZzss1bY="; }) ]; - postPatch = '' - cd programs/wake/openwakeword-lite/server - ''; - nativeBuildInputs = with python3Packages; [ setuptools - wheel ]; propagatedBuildInputs = with python3Packages; [ - tensorflow-bin - webrtc-noise-gain + tensorflow wyoming ]; - passthru.optional-dependencies.webrtc = with python3Packages; [ - webrtc-noise-gain - ]; - pythonImportsCheck = [ "wyoming_openwakeword" ]; meta = with lib; { + changelog = "https://github.com/rhasspy/wyoming-openwakeword/blob/v${version}/CHANGELOG.md"; description = "An open source voice assistant toolkit for many human languages"; - homepage = "https://github.com/rhasspy/rhasspy3/commit/fe44635132079db74d0c76c6b3553b842aa1e318"; + homepage = "https://github.com/rhasspy/wyoming-openwakeword"; license = licenses.mit; maintainers = with maintainers; [ hexa ]; mainProgram = "wyoming-openwakeword"; diff --git a/pkgs/tools/graphics/gfxreconstruct/default.nix b/pkgs/tools/graphics/gfxreconstruct/default.nix index fe678ba06715e..633c1202fafca 100644 --- a/pkgs/tools/graphics/gfxreconstruct/default.nix +++ b/pkgs/tools/graphics/gfxreconstruct/default.nix @@ -17,13 +17,13 @@ stdenv.mkDerivation rec { pname = "gfxreconstruct"; - version = "1.0.0"; + version = "1.0.1"; src = fetchFromGitHub { owner = "LunarG"; repo = "gfxreconstruct"; rev = "v${version}"; - hash = "sha256-dOmkNKURYgphbDHOmzcWf9PsIKMkPyN7ve579BE7fR0="; + hash = "sha256-+h7r6uLRw08c1CHRHxGCdkPYqI10i2Q/Oep617rLhx0="; fetchSubmodules = true; }; diff --git a/pkgs/tools/graphics/gmic-qt/default.nix b/pkgs/tools/graphics/gmic-qt/default.nix index 0a2ebd7709940..fdff56a446dcd 100644 --- a/pkgs/tools/graphics/gmic-qt/default.nix +++ b/pkgs/tools/graphics/gmic-qt/default.nix @@ -17,7 +17,6 @@ , libtiff , ninja , nix-update -, opencv3 , openexr , pkg-config , qtbase @@ -78,7 +77,6 @@ stdenv.mkDerivation (finalAttrs: { libjpeg libtiff libpng - opencv3 openexr graphicsmagick curl diff --git a/pkgs/tools/graphics/waifu2x-converter-cpp/default.nix b/pkgs/tools/graphics/waifu2x-converter-cpp/default.nix index 56fe4e122e531..f936ab83fb560 100644 --- a/pkgs/tools/graphics/waifu2x-converter-cpp/default.nix +++ b/pkgs/tools/graphics/waifu2x-converter-cpp/default.nix @@ -1,4 +1,4 @@ -{ cmake, fetchFromGitHub, makeWrapper, opencv3, lib, stdenv, ocl-icd, opencl-headers, OpenCL +{ cmake, fetchFromGitHub, makeWrapper, opencv4, lib, stdenv, ocl-icd, opencl-headers, OpenCL , config , cudaSupport ? config.cudaSupport, cudatoolkit ? null }: @@ -20,7 +20,7 @@ stdenv.mkDerivation rec { ]; buildInputs = [ - opencv3 + opencv4 ] ++ lib.optional cudaSupport cudatoolkit ++ lib.optional stdenv.isDarwin OpenCL ++ lib.optionals stdenv.isLinux [ ocl-icd opencl-headers ]; diff --git a/pkgs/tools/inputmethods/ibus-engines/ibus-m17n/default.nix b/pkgs/tools/inputmethods/ibus-engines/ibus-m17n/default.nix index 19d5b1b96933b..cb19026173254 100644 --- a/pkgs/tools/inputmethods/ibus-engines/ibus-m17n/default.nix +++ b/pkgs/tools/inputmethods/ibus-engines/ibus-m17n/default.nix @@ -13,13 +13,13 @@ stdenv.mkDerivation rec { pname = "ibus-m17n"; - version = "1.4.22"; + version = "1.4.23"; src = fetchFromGitHub { owner = "ibus"; repo = "ibus-m17n"; rev = version; - sha256 = "sha256-wjWDqhhLqj77IxVpelChOEdUtneaGmL+IK2Sp3eObkA="; + sha256 = "sha256-7bmWyk7A+dXu1jjD5j9P/w88PVqPnNSxE1Kgj+Xpvyg="; }; nativeBuildInputs = [ diff --git a/pkgs/tools/misc/archi/default.nix b/pkgs/tools/misc/archi/default.nix index c9a647d000a0a..f74d1a8c803a5 100644 --- a/pkgs/tools/misc/archi/default.nix +++ b/pkgs/tools/misc/archi/default.nix @@ -65,6 +65,6 @@ stdenv.mkDerivation rec { sourceProvenance = with sourceTypes; [ binaryNativeCode ]; license = licenses.mit; platforms = platforms.linux ++ platforms.darwin; - maintainers = with maintainers; [ earldouglas ]; + maintainers = with maintainers; [ earldouglas paumr ]; }; } diff --git a/pkgs/tools/misc/atuin/default.nix b/pkgs/tools/misc/atuin/default.nix index 8d773f62a4ba1..61da92e88d84e 100644 --- a/pkgs/tools/misc/atuin/default.nix +++ b/pkgs/tools/misc/atuin/default.nix @@ -4,6 +4,7 @@ , installShellFiles , rustPlatform , libiconv +, AppKit , Security , SystemConfiguration , nixosTests @@ -11,24 +12,24 @@ rustPlatform.buildRustPackage rec { pname = "atuin"; - version = "16.0.0"; + version = "17.0.1"; src = fetchFromGitHub { owner = "atuinsh"; repo = "atuin"; rev = "v${version}"; - hash = "sha256-Kh6aaWYV+ZG7Asvw5JdGsV+nxD+xvvQab5wLIedcQcQ="; + hash = "sha256-HJRlZwvBra2D7TzVKvMWJ0Hf17QgIEcBDQEHhxdVLIM="; }; # TODO: unify this to one hash because updater do not support this cargoHash = if stdenv.isLinux - then "sha256-Ami88ScGj58jCCat4MMDvjZtV5WglmrlggpQfo+LPjs=" - else "sha256-HQMZ9w1C6go16XGrPNniQZliIQ/5yAp2w/uUwAOQTM0="; + then "sha256-AhoXmEjXsi/OgFX3htOA6A/lWegUFlsywdotX3PDwcs=" + else "sha256-/nCnZ64pM8oWVX9a4JCeCZRyuo7aVc8YaBVEMbiRsqE="; nativeBuildInputs = [ installShellFiles ]; - buildInputs = lib.optionals stdenv.isDarwin [ libiconv Security SystemConfiguration ]; + buildInputs = lib.optionals stdenv.isDarwin [ libiconv AppKit Security SystemConfiguration ]; postInstall = '' installShellCompletion --cmd atuin \ @@ -44,6 +45,8 @@ rustPlatform.buildRustPackage rec { checkFlags = [ # tries to make a network access "--skip=registration" + # No such file or directory (os error 2) + "--skip=sync" ]; meta = with lib; { diff --git a/pkgs/tools/misc/bdf2psf/default.nix b/pkgs/tools/misc/bdf2psf/default.nix index fdcdde0c04012..516e35a082ce1 100644 --- a/pkgs/tools/misc/bdf2psf/default.nix +++ b/pkgs/tools/misc/bdf2psf/default.nix @@ -2,11 +2,11 @@ stdenv.mkDerivation rec { pname = "bdf2psf"; - version = "1.222"; + version = "1.223"; src = fetchurl { url = "mirror://debian/pool/main/c/console-setup/bdf2psf_${version}_all.deb"; - sha256 = "sha256-zGd2t2Qtec8Up1SHAizZp8l/fhFpa0Y1UJbB8XanX6Q="; + sha256 = "sha256-T9tj91mLB3PNRmJs75ohGjvBt1C5wotQr++MCdmyWBI="; }; nativeBuildInputs = [ dpkg ]; diff --git a/pkgs/tools/misc/boxxy/default.nix b/pkgs/tools/misc/boxxy/default.nix index 27e3847597807..4a0a4fe0a99de 100644 --- a/pkgs/tools/misc/boxxy/default.nix +++ b/pkgs/tools/misc/boxxy/default.nix @@ -8,16 +8,16 @@ rustPlatform.buildRustPackage rec { pname = "boxxy"; - version = "0.8.1"; + version = "0.8.3"; src = fetchFromGitHub { owner = "queer"; repo = "boxxy"; rev = "v${version}"; - hash = "sha256-vggerp66ALH7aqC6daH1a82ajJg5ZmEZTqC98IHhzFU="; + hash = "sha256-BxI2Ju1I1IytCjx6vUoIy1jzebSeRmoObDEtN/sBEDg="; }; - cargoHash = "sha256-nKuxeVFCc4Etl5x5vgpCXbU7WkLVaL9wRCVSWhffPzU="; + cargoHash = "sha256-ZEQsCm13MoFtpIjjtD5UANH5zrPDX4IjEmqJLwnftps="; nativeBuildInputs = [ pkg-config diff --git a/pkgs/tools/misc/cf-terraforming/default.nix b/pkgs/tools/misc/cf-terraforming/default.nix index 70e6aa04e6f46..8ac51a4821d46 100644 --- a/pkgs/tools/misc/cf-terraforming/default.nix +++ b/pkgs/tools/misc/cf-terraforming/default.nix @@ -2,16 +2,16 @@ buildGoModule rec { pname = "cf-terraforming"; - version = "0.14.0"; + version = "0.15.0"; src = fetchFromGitHub { owner = "cloudflare"; repo = "cf-terraforming"; rev = "v${version}"; - sha256 = "sha256-9aGN3TP4bMz4V0MRrNFxMm16k9RfvU5iDVwe+Ws4Ask="; + sha256 = "sha256-4thb0AFlSYQ90SkdyTSiFUc6vTRpt6KX2nH/thMuv4o="; }; - vendorHash = "sha256-fswT6t2LP6gRmCHrSHVJGdNc6gic3rMSrE+STe5oiyQ="; + vendorHash = "sha256-bfxF0qlEbZDczEuFhckqsG00/IzuM18ut/AQ9EMwdh0="; ldflags = [ "-X github.com/cloudflare/cf-terraforming/internal/app/cf-terraforming/cmd.versionString=${version}" ]; # The test suite insists on downloading a binary release of Terraform from diff --git a/pkgs/tools/misc/chezmoi/default.nix b/pkgs/tools/misc/chezmoi/default.nix index 9f75753e89889..88812357a9c08 100644 --- a/pkgs/tools/misc/chezmoi/default.nix +++ b/pkgs/tools/misc/chezmoi/default.nix @@ -6,16 +6,16 @@ buildGoModule rec { pname = "chezmoi"; - version = "2.40.0"; + version = "2.40.4"; src = fetchFromGitHub { owner = "twpayne"; repo = "chezmoi"; rev = "v${version}"; - hash = "sha256-0FzhIsCsOVoQpxpxl83Ei8v8ANbanltLi5nvOt0kWsA="; + hash = "sha256-PtIT2PS88jkX/ERHYKRwhvCnCnlAP0lM0FDv74zi32M="; }; - vendorHash = "sha256-941uw/7NoVnW3Ul5bAJLyvQ+RrNoiUVJHpKlfkiGT8c="; + vendorHash = "sha256-O9Ywq8LunS/0yBX9p9M2mzm+auvX1ynYaAY4EoBaE94="; doCheck = false; diff --git a/pkgs/tools/misc/daktilo/default.nix b/pkgs/tools/misc/daktilo/default.nix new file mode 100644 index 0000000000000..b28f3b08f8cd9 --- /dev/null +++ b/pkgs/tools/misc/daktilo/default.nix @@ -0,0 +1,66 @@ +{ lib +, rustPlatform +, fetchFromGitHub +, installShellFiles +, stdenv +, darwin +, unixtools +, pkg-config +, alsa-lib +, xorg +}: + +rustPlatform.buildRustPackage rec { + pname = "daktilo"; + version = "0.5.0"; + + src = fetchFromGitHub { + owner = "orhun"; + repo = "daktilo"; + rev = "v${version}"; + hash = "sha256-kbJwBOUODtHdngbfa6HbbQJ0kgW6f64c0EG3y8wLymw="; + }; + + cargoHash = "sha256-u9vL2HAUgP43ZDwIEK2u/I+KUEjQsfXda03gnGJ1Krc="; + + nativeBuildInputs = [ + installShellFiles + pkg-config + ]; + + buildInputs = [ + alsa-lib + xorg.libX11 + xorg.libXi + xorg.libXtst + ] ++ lib.optionals stdenv.isDarwin [ + darwin.apple_sdk.frameworks.Security + ]; + + nativeCheckInputs = [ + unixtools.script + ]; + + postInstall = '' + mkdir -p man completions + + OUT_DIR=man $out/bin/daktilo-mangen + OUT_DIR=completions $out/bin/daktilo-completions + + installManPage man/daktilo.1 + installShellCompletion \ + completions/daktilo.{bash,fish} \ + --zsh completions/_daktilo + + rm $out/bin/daktilo-{completions,mangen} + ''; + + meta = with lib; { + description = "Turn your keyboard into a typewriter"; + homepage = "https://github.com/orhun/daktilo"; + changelog = "https://github.com/orhun/daktilo/blob/${src.rev}/CHANGELOG.md"; + license = with licenses; [ asl20 mit ]; + maintainers = with maintainers; [ orhun ]; + mainProgram = "daktilo"; + }; +} diff --git a/pkgs/tools/misc/ddcutil/default.nix b/pkgs/tools/misc/ddcutil/default.nix index 0a5bc1cec7ca0..903f923b5d8a0 100644 --- a/pkgs/tools/misc/ddcutil/default.nix +++ b/pkgs/tools/misc/ddcutil/default.nix @@ -4,9 +4,8 @@ , autoreconfHook , pkg-config , glib -, i2c-tools +, jansson , udev -, kmod , libgudev , libusb1 , libdrm @@ -15,23 +14,23 @@ stdenv.mkDerivation rec { pname = "ddcutil"; - version = "1.4.2"; + version = "2.0.0"; src = fetchurl { url = "https://www.ddcutil.com/tarballs/ddcutil-${version}.tar.gz"; - hash = "sha256-wGwTZheRHi5pGf6WB9hGd8m/pLOmnlYYrS5dd+QItAQ="; + hash = "sha256-CunFRQHKk3q8CU60TSRnRoCW7+9X1+JpJHm773HhmZs="; }; nativeBuildInputs = [ autoreconfHook pkg-config ]; buildInputs = [ glib - i2c-tools - kmod + jansson libdrm libgudev libusb1 udev + xorg.libXext xorg.libXrandr ]; diff --git a/pkgs/tools/misc/esphome/default.nix b/pkgs/tools/misc/esphome/default.nix index ef128ff264d0f..958738478baa2 100644 --- a/pkgs/tools/misc/esphome/default.nix +++ b/pkgs/tools/misc/esphome/default.nix @@ -16,14 +16,14 @@ let in python.pkgs.buildPythonApplication rec { pname = "esphome"; - version = "2023.10.3"; + version = "2023.10.4"; format = "setuptools"; src = fetchFromGitHub { owner = pname; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-rvU2eA9HEZv77cn2K4xEL/hqBk2hauFv7eUHZzR5Q5s="; + hash = "sha256-rDq6uudT1kW97TiE9FswfgzLlNPTo8+YjD7HEvbrMn0="; }; postPatch = '' diff --git a/pkgs/tools/misc/fclones/default.nix b/pkgs/tools/misc/fclones/default.nix index 563b35d665b53..01f35bd8c65b3 100644 --- a/pkgs/tools/misc/fclones/default.nix +++ b/pkgs/tools/misc/fclones/default.nix @@ -7,16 +7,16 @@ rustPlatform.buildRustPackage rec { pname = "fclones"; - version = "0.33.1"; + version = "0.34.0"; src = fetchFromGitHub { owner = "pkolaczk"; repo = pname; rev = "v${version}"; - hash = "sha256-MnsA7zZ3T0L80dgCUj4F/F9IKTzADs65esM1DdgQeSU="; + hash = "sha256-JgeajCubRz9hR6uvRAw1HXdKa6Ua+l/Im/bYXdx1gL0="; }; - cargoHash = "sha256-xBoTzDeMmkSExOjD588l1vy73lbkzb60V4Fd4zhrU8c="; + cargoHash = "sha256-mEgFfg8I+JJuUEvj+sia2aL3BVg3HteQorZ2EOiLo64="; buildInputs = lib.optionals stdenv.isDarwin [ darwin.apple_sdk_11_0.frameworks.AppKit diff --git a/pkgs/tools/misc/graylog/3.3.nix b/pkgs/tools/misc/graylog/3.3.nix deleted file mode 100644 index fc93b9fc5829a..0000000000000 --- a/pkgs/tools/misc/graylog/3.3.nix +++ /dev/null @@ -1,9 +0,0 @@ -{ callPackage, lib }: -let - buildGraylog = callPackage ./graylog.nix {}; -in buildGraylog { - version = "3.3.16"; - sha256 = "sha256-P/cnfYKnMSnDD4otEyirKlLaFduyfSO9sao4BY3c3Z4="; - maintainers = [ lib.maintainers.fadenb ]; - license = lib.licenses.gpl3; -} diff --git a/pkgs/tools/misc/graylog/4.0.nix b/pkgs/tools/misc/graylog/4.0.nix deleted file mode 100644 index cae23dd431d7c..0000000000000 --- a/pkgs/tools/misc/graylog/4.0.nix +++ /dev/null @@ -1,9 +0,0 @@ -{ callPackage, lib, ...}: -let - buildGraylog = callPackage ./graylog.nix {}; -in buildGraylog { - version = "4.0.8"; - sha256 = "sha256-1JlJNJSU1wJiztLhYD87YM/7p3YCBXBKerEo/xfumUg="; - maintainers = [ lib.maintainers.f2k1de ]; - license = lib.licenses.sspl; -} diff --git a/pkgs/tools/misc/graylog/4.3.nix b/pkgs/tools/misc/graylog/4.3.nix deleted file mode 100644 index 1bd2ed3ec70d4..0000000000000 --- a/pkgs/tools/misc/graylog/4.3.nix +++ /dev/null @@ -1,9 +0,0 @@ -{ callPackage, lib, ...}: -let - buildGraylog = callPackage ./graylog.nix {}; -in buildGraylog { - version = "4.3.9"; - sha256 = "sha256-BMw6U47LQQFFVM34rgadMetpYTtj6R3E+uU0dtTcH64="; - maintainers = [ lib.maintainers.f2k1de ]; - license = lib.licenses.sspl; -} diff --git a/pkgs/tools/misc/multitail/default.nix b/pkgs/tools/misc/multitail/default.nix index 6918e8fe3ecf0..75e5340c2613b 100644 --- a/pkgs/tools/misc/multitail/default.nix +++ b/pkgs/tools/misc/multitail/default.nix @@ -1,14 +1,14 @@ { lib, stdenv, fetchFromGitHub, ncurses, pkg-config, cmake }: stdenv.mkDerivation rec { - version = "7.0.0"; + version = "7.1.1"; pname = "multitail"; src = fetchFromGitHub { owner = "folkertvanheusden"; repo = pname; rev = version; - sha256 = "sha256-AMW55Bmwn0BsD36qGXI5WmEfydrMBob8NRY3Tyq92vA="; + sha256 = "sha256-qQc7FqpkAri/RE1hJIC4P6n1Jc6TJwBcR0Dp5n5QDQg="; }; nativeBuildInputs = [ pkg-config cmake ]; @@ -23,10 +23,10 @@ stdenv.mkDerivation rec { hardeningDisable = [ "format" ]; meta = { - homepage = "https://github.com/halturin/multitail"; + homepage = "https://github.com/folkertvanheusden/multitail"; description = "tail on Steroids"; maintainers = with lib.maintainers; [ matthiasbeyer ]; platforms = lib.platforms.unix; - license = lib.licenses.gpl2Plus; + license = lib.licenses.asl20; }; } diff --git a/pkgs/tools/misc/nomino/default.nix b/pkgs/tools/misc/nomino/default.nix index 1eb472ee8fa17..2ff9aac62fb59 100644 --- a/pkgs/tools/misc/nomino/default.nix +++ b/pkgs/tools/misc/nomino/default.nix @@ -2,16 +2,16 @@ rustPlatform.buildRustPackage rec { pname = "nomino"; - version = "1.3.2"; + version = "1.3.3"; src = fetchFromGitHub { owner = "yaa110"; repo = pname; rev = version; - hash = "sha256-pzAL7e72sO94qLEwsH/5RuiuzvnsSelIq47jdU8INDw="; + hash = "sha256-XT8+mwfDFsBVEcpttus1KeIS+4sKqJMJTwqYI3LfW5k="; }; - cargoHash = "sha256-gDOZ3nD7pTIRNXG3S+qTkl+HInBcAErvwPqa0NZWxY4="; + cargoHash = "sha256-KpjGwqjVORyxXJbMi2Ok7s6gRmM/aJRTsPtu/0PgGr8="; meta = with lib; { description = "Batch rename utility for developers"; diff --git a/pkgs/tools/misc/riemann-c-client/default.nix b/pkgs/tools/misc/riemann-c-client/default.nix index 0302a423a4fb7..7c744935064f6 100644 --- a/pkgs/tools/misc/riemann-c-client/default.nix +++ b/pkgs/tools/misc/riemann-c-client/default.nix @@ -1,4 +1,8 @@ -{ lib, stdenv, fetchFromGitea, autoreconfHook, pkg-config, file , protobufc }: +{ lib, stdenv, fetchFromGitea, autoreconfHook, check, pkg-config, file, protobufc +,withWolfSSL ? false, wolfssl +,withGnuTLS ? false, gnutls +,withJSON ? true, json_c +}: stdenv.mkDerivation rec { pname = "riemann-c-client"; @@ -9,20 +13,30 @@ stdenv.mkDerivation rec { owner = "algernon"; repo = "riemann-c-client"; rev = "riemann-c-client-${version}"; - sha256 = "sha256-FIhTT57g2uZBaH3EPNxNUNJn9n+0ZOhI6WMyF+xIr/Q="; + hash = "sha256-FIhTT57g2uZBaH3EPNxNUNJn9n+0ZOhI6WMyF+xIr/Q="; }; - nativeBuildInputs = [ autoreconfHook pkg-config ]; - buildInputs = [ file protobufc ]; + outputs = [ "bin" "dev" "out" ]; - preBuild = '' - make lib/riemann/proto/riemann.pb-c.h - ''; + nativeBuildInputs = [ autoreconfHook check pkg-config ]; + buildInputs = [ file protobufc ] + ++ lib.optional withWolfSSL wolfssl + ++ lib.optional withGnuTLS gnutls + ++ lib.optional withJSON json_c + ; + + configureFlags = [] + ++ lib.optional withWolfSSL "--with-tls=wolfssl" + ++ lib.optional withGnuTLS "--with-tls=gnutls" + ; + + doCheck = true; + enableParallelBuilding = true; meta = with lib; { homepage = "https://git.madhouse-project.org/algernon/riemann-c-client"; description = "A C client library for the Riemann monitoring system"; - license = licenses.gpl3; + license = licenses.lgpl3Plus; maintainers = with maintainers; [ pradeepchhetri ]; platforms = platforms.linux; }; diff --git a/pkgs/tools/networking/ddns-go/default.nix b/pkgs/tools/networking/ddns-go/default.nix index 1785eae4580cf..fb4adc99fa3c4 100644 --- a/pkgs/tools/networking/ddns-go/default.nix +++ b/pkgs/tools/networking/ddns-go/default.nix @@ -5,13 +5,13 @@ buildGoModule rec { pname = "ddns-go"; - version = "5.6.3"; + version = "5.6.4"; src = fetchFromGitHub { owner = "jeessy2"; repo = pname; rev = "v${version}"; - hash = "sha256-yOi2dowde2hTZOWq1Trpf3tAypA6bD6SawP5geqK7Ms="; + hash = "sha256-wE4xzAH31yQ8xrA0dI7f961KNwK84gRSit+XNoW37pc="; }; vendorHash = "sha256-e4mmUneFZCsteSrxfSeeky/pFc0sgNs0eRVnZQuG1ZI="; diff --git a/pkgs/tools/networking/findomain/Cargo.lock b/pkgs/tools/networking/findomain/Cargo.lock index 07b8e2894bb52..81f9d4667a655 100644 --- a/pkgs/tools/networking/findomain/Cargo.lock +++ b/pkgs/tools/networking/findomain/Cargo.lock @@ -609,7 +609,7 @@ dependencies = [ [[package]] name = "findomain" -version = "9.0.1" +version = "9.0.3" dependencies = [ "addr", "anyhow", diff --git a/pkgs/tools/networking/findomain/default.nix b/pkgs/tools/networking/findomain/default.nix index 1f5d4c8b01af8..636dcc7094620 100644 --- a/pkgs/tools/networking/findomain/default.nix +++ b/pkgs/tools/networking/findomain/default.nix @@ -10,13 +10,13 @@ rustPlatform.buildRustPackage rec { pname = "findomain"; - version = "9.0.2"; + version = "9.0.3"; src = fetchFromGitHub { owner = "findomain"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-CFnjZHTga70+b7XUdxGC/ycqY2snkLvFKPApTRlN11s="; + hash = "sha256-M6i62JI4HjaM0C2rSK8P5O19JeugFP5xIy1E6vE8KP4="; }; cargoLock = { diff --git a/pkgs/tools/networking/grpcui/default.nix b/pkgs/tools/networking/grpcui/default.nix index 820b7f202f14a..eb7400b41890a 100644 --- a/pkgs/tools/networking/grpcui/default.nix +++ b/pkgs/tools/networking/grpcui/default.nix @@ -2,16 +2,16 @@ buildGoModule rec { pname = "grpcui"; - version = "1.3.2"; + version = "1.3.3"; src = fetchFromGitHub { owner = "fullstorydev"; repo = pname; rev = "v${version}"; - sha256 = "sha256-ssKVgvMO6+7/FQFxbHVTipDFVXZZ/9Ww/kFTqxTgdLQ="; + sha256 = "sha256-G4lVYwx8fYxuyHI2CzAfBQHQV/G4lf7zBwL8JTpnscA="; }; - vendorHash = "sha256-ui/zaHwZH5zdrcKFXwIrJ3TCLUeONsjSexIHoa6hRH8="; + vendorHash = "sha256-lw8HildV1RFTGLOf6FaitbXPxr4FtVGg7GxdzBVFiTM="; doCheck = false; diff --git a/pkgs/tools/networking/grpcurl/default.nix b/pkgs/tools/networking/grpcurl/default.nix index a99f26effc13b..02ad218cbf17a 100644 --- a/pkgs/tools/networking/grpcurl/default.nix +++ b/pkgs/tools/networking/grpcurl/default.nix @@ -2,18 +2,18 @@ buildGoModule rec { pname = "grpcurl"; - version = "1.8.8"; + version = "1.8.9"; src = fetchFromGitHub { owner = "fullstorydev"; repo = "grpcurl"; rev = "v${version}"; - sha256 = "sha256-/GPFUMN6NQAoKOYJ6j9j0GmyEcYtYdOB7B8v2gNpNm8="; + sha256 = "sha256-zN/vleCph919HXZZ9wsXoJBXRT6y7gjyuQxnjRMzq00="; }; subPackages = [ "cmd/grpcurl" ]; - vendorHash = "sha256-8mGlmWuWae/NQ1aR0KVj0XS7rqROCs0PBDUkMAKijYU="; + vendorHash = "sha256-g5G966CuaVILGAgWunHAPrrkLjSv8pBj9R4bcLzyI+A="; ldflags = [ "-s" "-w" "-X main.version=${version}" ]; diff --git a/pkgs/tools/networking/gvpe/default.nix b/pkgs/tools/networking/gvpe/default.nix index 37f698386e240..5170df24b91ce 100644 --- a/pkgs/tools/networking/gvpe/default.nix +++ b/pkgs/tools/networking/gvpe/default.nix @@ -19,7 +19,7 @@ stdenv.mkDerivation rec { ]; postPatch = '' - sed -e 's@"/sbin/ifconfig.*"@"${iproute2}/sbin/ip link set $IFNAME address $MAC mtu $MTU"@' -i src/device-linux.C + sed -e 's@"/sbin/ifconfig.*"@"${iproute2}/sbin/ip link set dev $IFNAME address $MAC mtu $MTU"@' -i src/device-linux.C sed -e 's@/sbin/ifconfig@${nettools}/sbin/ifconfig@g' -i src/device-*.C ''; diff --git a/pkgs/tools/networking/hurl/default.nix b/pkgs/tools/networking/hurl/default.nix index d34d00f56b518..231a28f8935a4 100644 --- a/pkgs/tools/networking/hurl/default.nix +++ b/pkgs/tools/networking/hurl/default.nix @@ -11,16 +11,16 @@ rustPlatform.buildRustPackage rec { pname = "hurl"; - version = "4.0.0"; + version = "4.1.0"; src = fetchFromGitHub { owner = "Orange-OpenSource"; repo = pname; rev = version; - hash = "sha256-ubzcCY3ccjt2VSZNx9+l3M/z4o7wWcE7USAlA9BnQY0="; + hash = "sha256-JsgAdLjDQQkLyLFoZCVG2jZ8vQDaGUPtPmHYAcwADQg"; }; - cargoHash = "sha256-C8WeYFaqF748QZkp/CppqJjF3QW1k7OWXycxSoxKPOI="; + cargoHash = "sha256-IE9c57rj8EANyj4KmbyagafJyMovzHOhp0PFCQBzqdA="; nativeBuildInputs = [ pkg-config diff --git a/pkgs/tools/networking/kea/default.nix b/pkgs/tools/networking/kea/default.nix index 7c3cab0fe5a77..2e642b17f87cd 100644 --- a/pkgs/tools/networking/kea/default.nix +++ b/pkgs/tools/networking/kea/default.nix @@ -5,8 +5,11 @@ # build time , autoreconfHook , pkg-config +, python3Packages # runtime +, withMysql ? stdenv.buildPlatform.system == stdenv.hostPlatform.system +, withPostgres ? stdenv.buildPlatform.system == stdenv.hostPlatform.system , boost , libmysqlclient , log4cplus @@ -48,9 +51,10 @@ stdenv.mkDerivation rec { "--enable-shell" "--localstatedir=/var" "--with-openssl=${lib.getDev openssl}" - "--with-mysql=${lib.getDev libmysqlclient}/bin/mysql_config" - "--with-pgsql=${postgresql}/bin/pg_config" - ]; + ] + ++ lib.optional withPostgres "--with-pgsql=${postgresql}/bin/pg_config" + ++ lib.optional withMysql "--with-mysql=${lib.getDev libmysqlclient}/bin/mysql_config"; + postConfigure = '' # Mangle embedded paths to dev-only inputs. sed -e "s|$NIX_STORE/[a-z0-9]\{32\}-|$NIX_STORE/eeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee-|g" -i config.report @@ -59,7 +63,7 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ autoreconfHook pkg-config - ] ++ (with python3.pkgs; [ + ] ++ (with python3Packages; [ sphinxHook sphinx-rtd-theme ]); diff --git a/pkgs/tools/networking/openssh/common.nix b/pkgs/tools/networking/openssh/common.nix index 7d01deb36020c..bf645edec391c 100644 --- a/pkgs/tools/networking/openssh/common.nix +++ b/pkgs/tools/networking/openssh/common.nix @@ -18,11 +18,13 @@ , zlib , openssl , libedit +, ldns , pkg-config , pam , libredirect , etcDir ? null , withKerberos ? true +, withLdns ? true , libkrb5 , libfido2 , hostname @@ -64,6 +66,7 @@ stdenv.mkDerivation { buildInputs = [ zlib openssl libedit ] ++ lib.optional withFIDO libfido2 ++ lib.optional withKerberos libkrb5 + ++ lib.optional withLdns ldns ++ lib.optional withPAM pam; preConfigure = '' @@ -87,6 +90,7 @@ stdenv.mkDerivation { ++ lib.optional withKerberos (assert libkrb5 != null; "--with-kerberos5=${libkrb5}") ++ lib.optional stdenv.isDarwin "--disable-libutil" ++ lib.optional (!linkOpenssl) "--without-openssl" + ++ lib.optional withLdns "--with-ldns" ++ extraConfigureFlags; ${if stdenv.hostPlatform.isStatic then "NIX_LDFLAGS" else null}= [ "-laudit" ] ++ lib.optionals withKerberos [ "-lkeyutils" ]; diff --git a/pkgs/tools/networking/saldl/default.nix b/pkgs/tools/networking/saldl/default.nix index d02acb3100a7e..fb373fb5029e0 100644 --- a/pkgs/tools/networking/saldl/default.nix +++ b/pkgs/tools/networking/saldl/default.nix @@ -10,6 +10,7 @@ , libxslt , curl , libevent +, fetchpatch }: stdenv.mkDerivation rec { @@ -23,6 +24,14 @@ stdenv.mkDerivation rec { sha256 = "sha256-PAX2MUyBWWU8kGkaeoCJteidgszh7ipwDJbrLXzVsn0="; }; + patches = [ + (fetchpatch { + name = "update-waf-to-2-0-24.patch"; + url = "https://github.com/saldl/saldl/commit/360c29d6c8cee5f7e608af42237928be429c3407.patch"; + hash = "sha256-RBMnsUtd0BaZe/EXypDCK4gpUU0dgucWmOcJRn5/iTA="; + }) + ]; + nativeBuildInputs = [ pkg-config wafHook diff --git a/pkgs/tools/networking/sing-box/default.nix b/pkgs/tools/networking/sing-box/default.nix index 460f6f4e039e5..2218285c92635 100644 --- a/pkgs/tools/networking/sing-box/default.nix +++ b/pkgs/tools/networking/sing-box/default.nix @@ -11,16 +11,16 @@ buildGoModule rec { pname = "sing-box"; - version = "1.5.4"; + version = "1.5.5"; src = fetchFromGitHub { owner = "SagerNet"; repo = pname; rev = "v${version}"; - hash = "sha256-XOp8kdF5UcmWrU43WfHk0EI8E+dPxgR2Ck5yC2ANcWI="; + hash = "sha256-/8BeBBFbtVpqEVqlt3wNF5+qZvExtPngbic8kR7Gkck="; }; - vendorHash = "sha256-ng+6fxmwjRIXuH6xDY9JFefMtlMJqaNlfCET9YRuK3k="; + vendorHash = "sha256-xB0A3jbwNSISipKLB3WPuqM8mfjN4IYbiwhUs04K8VY="; tags = [ "with_quic" diff --git a/pkgs/tools/networking/speedtest-go/default.nix b/pkgs/tools/networking/speedtest-go/default.nix index 0d2be501fd143..2a74445ec270d 100644 --- a/pkgs/tools/networking/speedtest-go/default.nix +++ b/pkgs/tools/networking/speedtest-go/default.nix @@ -5,13 +5,13 @@ buildGoModule rec { pname = "speedtest-go"; - version = "1.6.6"; + version = "1.6.7"; src = fetchFromGitHub { owner = "showwin"; repo = pname; rev = "refs/tags/v${version}"; - hash = "sha256-aVvowxwP9Mr1hmcgwizXPfy5527iR7cjsNaND/nmXUw="; + hash = "sha256-7wUgmIScrj47QigIKHLMcvaJ/LTRHcMnJGKPBUTzVYo="; }; vendorHash = "sha256-wQqAX7YuxxTiMWmV9LRoXunGMMzs12UyHbf4VvbQF1E="; diff --git a/pkgs/tools/networking/yggdrasil/change-runtime-dir.patch b/pkgs/tools/networking/yggdrasil/change-runtime-dir.patch deleted file mode 100644 index b4edc6a838716..0000000000000 --- a/pkgs/tools/networking/yggdrasil/change-runtime-dir.patch +++ /dev/null @@ -1,12 +0,0 @@ -diff -ruN a/src/defaults/defaults_linux.go b/src/defaults/defaults_linux.go ---- a/src/defaults/defaults_linux.go 2019-06-17 10:23:09.495613784 -0700 -+++ b/src/defaults/defaults_linux.go 2019-07-01 10:17:11.295669440 -0700 -@@ -7,7 +7,7 @@ - func GetDefaults() platformDefaultParameters { - return platformDefaultParameters{ - // Admin -- DefaultAdminListen: "unix:///var/run/yggdrasil.sock", -+ DefaultAdminListen: "unix:///var/run/yggdrasil/yggdrasil.sock", - - // Configuration (used for yggdrasilctl) - DefaultConfigFile: "/etc/yggdrasil.conf", diff --git a/pkgs/tools/package-management/nfpm/default.nix b/pkgs/tools/package-management/nfpm/default.nix index 2f775a35627b6..9d04dd026404a 100644 --- a/pkgs/tools/package-management/nfpm/default.nix +++ b/pkgs/tools/package-management/nfpm/default.nix @@ -8,16 +8,16 @@ buildGoModule rec { pname = "nfpm"; - version = "2.33.1"; + version = "2.34.0"; src = fetchFromGitHub { owner = "goreleaser"; repo = pname; rev = "v${version}"; - hash = "sha256-5CNN0aKy9FnoqRwhbNVTUs04q+hkzoAWlDuDKMeT+1s="; + hash = "sha256-O7qxJ2TE62XDYljqvNsO3ssD/YhfOLfy9zF0W++T0Hw="; }; - vendorHash = "sha256-P96qMc9KHDMreuPI3xY/yI/+8qp/znQM/O2B6t6iFug="; + vendorHash = "sha256-qihPtpygHoIfGf2wj+klDWwL4sTHqDxi1jxjv57vUx4="; ldflags = [ "-s" "-w" "-X main.version=${version}" ]; diff --git a/pkgs/tools/package-management/pdm/default.nix b/pkgs/tools/package-management/pdm/default.nix index bc6c2be1060d0..dff2375199e97 100644 --- a/pkgs/tools/package-management/pdm/default.nix +++ b/pkgs/tools/package-management/pdm/default.nix @@ -31,13 +31,13 @@ in with python.pkgs; buildPythonApplication rec { pname = "pdm"; - version = "2.9.3"; + version = "2.10.0"; format = "pyproject"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-CxGVtR6WMLWgsGPyffywEgy26ihPGkzZdaOibwhW0lM="; + hash = "sha256-ziJJWVr59hsJJqCJljLfSbHHESYegFak+uFLU/k9kZM="; }; nativeBuildInputs = [ diff --git a/pkgs/tools/package-management/poetry/plugins/poetry-plugin-up.nix b/pkgs/tools/package-management/poetry/plugins/poetry-plugin-up.nix index b9ac5d4ada01f..e737173a857e9 100644 --- a/pkgs/tools/package-management/poetry/plugins/poetry-plugin-up.nix +++ b/pkgs/tools/package-management/poetry/plugins/poetry-plugin-up.nix @@ -9,14 +9,14 @@ buildPythonPackage rec { pname = "poetry-plugin-up"; - version = "0.4.0"; + version = "0.7.0"; format = "pyproject"; src = fetchFromGitHub { owner = "MousaZeidBaker"; repo = pname; rev = "refs/tags/${version}"; - hash = "sha256-ENw+6DdQkRLnAlIuIEdZzIsFP7ILqA9WatlVZYNJSxw="; + hash = "sha256-RjyRnCrHLKBJm8WMzQd0WcfpO8Ve+ydvUTN4EnVunlI="; }; nativeBuildInputs = [ diff --git a/pkgs/tools/security/cie-middleware-linux/default.nix b/pkgs/tools/security/cie-middleware-linux/default.nix index 7af3e9240f1e1..fa5ec2d2af830 100644 --- a/pkgs/tools/security/cie-middleware-linux/default.nix +++ b/pkgs/tools/security/cie-middleware-linux/default.nix @@ -20,13 +20,13 @@ let pname = "cie-middleware-linux"; - version = "1.4.4.0"; + version = "1.5.0"; src = fetchFromGitHub { owner = "M0rf30"; repo = pname; - rev = "${version}-podofo"; - sha256 = "sha256-Kyr9OTiY6roJ/wVJS/1aWfrrzDNQbuRTJQqo0akbMUU="; + rev = version; + sha256 = "sha256-Z8K2Ibg5bBfSql5HEapKgdfiCf/EIKTTD15oVeysQGk="; }; gradle = gradle_7; @@ -44,6 +44,7 @@ let buildPhase = '' # Run the fetchDeps task export GRADLE_USER_HOME=$(mktemp -d) + ls -l gradle --no-daemon -b cie-java/build.gradle fetchDeps ''; @@ -60,7 +61,7 @@ let outputHashAlgo = "sha256"; outputHashMode = "recursive"; - outputHash = "sha256-WzT5vYF9yCMU2A7EkLZyjgWrN3gD7pnkPXc3hDFqpD8="; + outputHash = "sha256-jtaH8dBpnx8KMJe+jzJfkvcx1NO4nL5jsRO4+GI+d0c="; }; in @@ -84,7 +85,7 @@ stdenv.mkDerivation { buildInputs = [ cryptopp fontconfig - podofo + podofo.dev openssl pcsclite curl @@ -95,6 +96,10 @@ stdenv.mkDerivation { # substitute the cieid command with this $out/bin/cieid substituteInPlace libs/pkcs11/src/CSP/AbilitaCIE.cpp \ --replace 'file = "cieid"' 'file = "'$out'/bin/cieid"' + + # revert https://github.com/M0Rf30/cie-middleware-linux/commit/1a389d8 + sed -i libs/meson.build \ + -e "s@podofo_dep = .\+@podofo_dep = dependency('libpodofo')@g" ''; # Note: we use pushd/popd to juggle between the diff --git a/pkgs/tools/security/der-ascii/default.nix b/pkgs/tools/security/der-ascii/default.nix index 5fc3b179b3ad1..28cab27731b13 100644 --- a/pkgs/tools/security/der-ascii/default.nix +++ b/pkgs/tools/security/der-ascii/default.nix @@ -2,13 +2,13 @@ buildGoModule rec { pname = "der-ascii"; - version = "0.1.0"; + version = "0.3.0"; src = fetchFromGitHub { owner = "google"; repo = pname; rev = "v${version}"; - sha256 = "1my93m1rx08kn2yms6k8w43byr8k61r1nra4b082j8b393wwxkqc"; + sha256 = "sha256-LgxGSZQNxwx08mK9G8mSuBFTOd3pC1mvz3Wz7Y+6XR4="; }; vendorHash = null; diff --git a/pkgs/tools/security/fulcio/default.nix b/pkgs/tools/security/fulcio/default.nix index 4d085fb9980a6..9c40c051bebcc 100644 --- a/pkgs/tools/security/fulcio/default.nix +++ b/pkgs/tools/security/fulcio/default.nix @@ -2,13 +2,13 @@ buildGoModule rec { pname = "fulcio"; - version = "1.4.1"; + version = "1.4.3"; src = fetchFromGitHub { owner = "sigstore"; repo = pname; rev = "v${version}"; - sha256 = "sha256-6muoKiryWTGIoy1U3kWjuka0X1+gcrUQOvbuas26H1M="; + sha256 = "sha256-LT8J9s008XQtDtNdH1ungQREqQUrlTsoxnlRLKimqLY="; # populate values that require us to use git. By doing this in postFetch we # can delete .git afterwards and maintain better reproducibility of the src. leaveDotGit = true; @@ -20,7 +20,7 @@ buildGoModule rec { find "$out" -name .git -print0 | xargs -0 rm -rf ''; }; - vendorHash = "sha256-i9RK9kNSB9FOnVbYcHLBHt8KKBQCNsEDONNm1IxgTJc="; + vendorHash = "sha256-ImZJXdOfMepMFU1z47XyNU39NGGdiCzQji2/tKVfibQ="; nativeBuildInputs = [ installShellFiles ]; diff --git a/pkgs/tools/security/honggfuzz/default.nix b/pkgs/tools/security/honggfuzz/default.nix index 3885316271b9e..7bb89718baca7 100644 --- a/pkgs/tools/security/honggfuzz/default.nix +++ b/pkgs/tools/security/honggfuzz/default.nix @@ -4,21 +4,20 @@ , makeWrapper , clang , llvm -# TODO: switch to latest versions when 2.6 release is out to include -# https://github.com/google/honggfuzz/commit/90fdf81006614664ef05e5e3c6f94d91610f11b2 -, libbfd_2_38, libopcodes_2_38 +, libbfd +, libopcodes , libunwind , libblocksruntime }: stdenv.mkDerivation rec { pname = "honggfuzz"; - version = "2.5"; + version = "2.6"; src = fetchFromGitHub { owner = "google"; repo = pname; rev = version; - sha256 = "sha256-TkyUKmiiSAfCnfQhSOUxuce6+dRyMmHy7vFK59jPIxM="; + sha256 = "sha256-/ra6g0qjjC8Lo8/n2XEbwnZ95yDHcGhYd5+TTvQ6FAc="; }; postPatch = '' @@ -30,7 +29,10 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ makeWrapper ]; buildInputs = [ llvm ]; - propagatedBuildInputs = [ libbfd_2_38 libopcodes_2_38 libunwind libblocksruntime ]; + propagatedBuildInputs = [ libbfd libopcodes libunwind libblocksruntime ]; + + # Fortify causes build failures: 'str*' defined both normally and as 'alias' attribute + hardeningDisable = [ "fortify" ]; makeFlags = [ "PREFIX=$(out)" ]; diff --git a/pkgs/tools/security/kubeclarity/default.nix b/pkgs/tools/security/kubeclarity/default.nix index ca4cb1bfb5923..4ad4044adbaa6 100644 --- a/pkgs/tools/security/kubeclarity/default.nix +++ b/pkgs/tools/security/kubeclarity/default.nix @@ -8,13 +8,13 @@ buildGoModule rec { pname = "kubeclarity"; - version = "2.21.1"; + version = "2.22.0"; src = fetchFromGitHub { owner = "openclarity"; repo = pname; rev = "refs/tags/v${version}"; - hash = "sha256-+kWqw8o5KlVciWIB8cCVkMuiqW0wpIfua5qVgXZG3ww="; + hash = "sha256-VpTLf4Z2l9Ix92GzcyJvj4j2j+aff8nc2qW9+2uaPBs="; }; vendorHash = "sha256-kYdKCHqzDbfCGMlTMPSHAQkSLyhkCl/OvV7CF5jdyaY="; diff --git a/pkgs/tools/security/ldeep/default.nix b/pkgs/tools/security/ldeep/default.nix index ebc1ca5922e54..79cb5f4def816 100644 --- a/pkgs/tools/security/ldeep/default.nix +++ b/pkgs/tools/security/ldeep/default.nix @@ -5,14 +5,14 @@ python3.pkgs.buildPythonApplication rec { pname = "ldeep"; - version = "1.0.42"; + version = "1.0.43"; format = "setuptools"; src = fetchFromGitHub { owner = "franc-pentest"; repo = "ldeep"; rev = "refs/tags/${version}"; - hash = "sha256-kXXZU4/nWUKAFJbcp9PFyPUxd+fRXJb6JbS/fybHh3g="; + hash = "sha256-JuhpfgKk+qb5halKpjlSWJGtuNA/QgELJnFqka33nlU="; }; nativeBuildInputs = with python3.pkgs; [ diff --git a/pkgs/tools/security/metasploit/Gemfile b/pkgs/tools/security/metasploit/Gemfile index 719091e6d9a60..99481a946b57d 100644 --- a/pkgs/tools/security/metasploit/Gemfile +++ b/pkgs/tools/security/metasploit/Gemfile @@ -1,4 +1,4 @@ # frozen_string_literal: true source "https://rubygems.org" -gem "metasploit-framework", git: "https://github.com/rapid7/metasploit-framework", ref: "refs/tags/6.3.39" +gem "metasploit-framework", git: "https://github.com/rapid7/metasploit-framework", ref: "refs/tags/6.3.40" diff --git a/pkgs/tools/security/metasploit/Gemfile.lock b/pkgs/tools/security/metasploit/Gemfile.lock index d9488beb17809..0441b9c8268f6 100644 --- a/pkgs/tools/security/metasploit/Gemfile.lock +++ b/pkgs/tools/security/metasploit/Gemfile.lock @@ -1,9 +1,9 @@ GIT remote: https://github.com/rapid7/metasploit-framework - revision: 77fb7ae14f17fd7f4851bca87e0c28c704797591 - ref: refs/tags/6.3.39 + revision: e4a23dc9d09f5b6b1b82768770e8063014a940bb + ref: refs/tags/6.3.40 specs: - metasploit-framework (6.3.39) + metasploit-framework (6.3.40) actionpack (~> 7.0.0) activerecord (~> 7.0.0) activesupport (~> 7.0.0) @@ -462,4 +462,4 @@ DEPENDENCIES metasploit-framework! BUNDLED WITH - 2.4.19 + 2.4.20 diff --git a/pkgs/tools/security/metasploit/default.nix b/pkgs/tools/security/metasploit/default.nix index d50d8760e21d4..433d49e237baa 100644 --- a/pkgs/tools/security/metasploit/default.nix +++ b/pkgs/tools/security/metasploit/default.nix @@ -15,13 +15,13 @@ let }; in stdenv.mkDerivation rec { pname = "metasploit-framework"; - version = "6.3.39"; + version = "6.3.40"; src = fetchFromGitHub { owner = "rapid7"; repo = "metasploit-framework"; rev = version; - sha256 = "sha256-EKLzIhrNiTUM3OtezPJL8g70BmR+vEyNcllyme5hH8o="; + sha256 = "sha256-vGCAkXLpsUvSXDf1H3pNStEYUZwFBxJnA7kdNJjqYwo="; }; nativeBuildInputs = [ makeWrapper ]; diff --git a/pkgs/tools/security/metasploit/gemset.nix b/pkgs/tools/security/metasploit/gemset.nix index 631d9f8c4dd8b..f5d060dd96549 100644 --- a/pkgs/tools/security/metasploit/gemset.nix +++ b/pkgs/tools/security/metasploit/gemset.nix @@ -654,12 +654,12 @@ platforms = []; source = { fetchSubmodules = false; - rev = "77fb7ae14f17fd7f4851bca87e0c28c704797591"; - sha256 = "1jhzc7p9jwjrfa6lrg3ych3g83pj9grcqppbvh63b2fd38ig78hh"; + rev = "e4a23dc9d09f5b6b1b82768770e8063014a940bb"; + sha256 = "02k3xac387dr0dki41q5ki8iilaa9mx1zx9pbk94pcg9fa8q0q5w"; type = "git"; url = "https://github.com/rapid7/metasploit-framework"; }; - version = "6.3.39"; + version = "6.3.40"; }; metasploit-model = { groups = ["default"]; diff --git a/pkgs/tools/system/netdata/default.nix b/pkgs/tools/system/netdata/default.nix index aaa597d4c7863..3c48c53bf90c5 100644 --- a/pkgs/tools/system/netdata/default.nix +++ b/pkgs/tools/system/netdata/default.nix @@ -118,6 +118,10 @@ stdenv.mkDerivation rec { ]; postFixup = '' + # remove once https://github.com/netdata/netdata/pull/16300 merged + substituteInPlace $out/bin/netdata-claim.sh \ + --replace /bin/echo echo + wrapProgram $out/bin/netdata-claim.sh --prefix PATH : ${lib.makeBinPath [ openssl ]} wrapProgram $out/libexec/netdata/plugins.d/cgroup-network-helper.sh --prefix PATH : ${lib.makeBinPath [ bash ]} wrapProgram $out/bin/netdatacli --set NETDATA_PIPENAME /run/netdata/ipc diff --git a/pkgs/tools/system/syslog-ng/default.nix b/pkgs/tools/system/syslog-ng/default.nix index 3c387cf28708e..f511323f9e558 100644 --- a/pkgs/tools/system/syslog-ng/default.nix +++ b/pkgs/tools/system/syslog-ng/default.nix @@ -34,7 +34,6 @@ }: let python-deps = ps: with ps; [ - pip boto3 botocore cachetools @@ -56,7 +55,7 @@ let websocket-client ply ]; - myPy3 = (python3.withPackages python-deps); + py = python3.withPackages python-deps; in stdenv.mkDerivation rec { pname = "syslog-ng"; @@ -68,7 +67,7 @@ stdenv.mkDerivation rec { rev = "syslog-ng-${version}"; hash = "sha256-NXwd4dyPfnHO3yjl3GPAMQYqenfpp7xFOil2G1e66w4="; }; - nativeBuildInputs = [ autoreconfHook autoconf-archive pkg-config which bison flex libxslt perl myPy3 ]; + nativeBuildInputs = [ autoreconfHook autoconf-archive pkg-config which bison flex libxslt perl ]; buildInputs = [ libcap @@ -76,7 +75,7 @@ stdenv.mkDerivation rec { openssl eventlog glib - myPy3 + py systemd riemann_c_client protobufc @@ -100,7 +99,7 @@ stdenv.mkDerivation rec { "--enable-dynamic-linking" "--enable-systemd" "--enable-smtp" - "--with-python-packages=system" + "--with-python-packages=none" "--with-hiredis=system" "--with-ivykis=system" "--with-librabbitmq-client=system" diff --git a/pkgs/tools/text/scraper/default.nix b/pkgs/tools/text/scraper/default.nix index 7c5b1a89b2525..05c4957f27dd0 100644 --- a/pkgs/tools/text/scraper/default.nix +++ b/pkgs/tools/text/scraper/default.nix @@ -2,14 +2,14 @@ rustPlatform.buildRustPackage rec { pname = "scraper"; - version = "0.18.0"; + version = "0.18.1"; src = fetchCrate { inherit pname version; - hash = "sha256-/OVUtRQH6Sc0TggN8UEA1GhVD4dXv8h5MFAXswgwSFE="; + hash = "sha256-fnX2v7VxVFgn9UT1+qWBvN+oDDI2DbK6UFKmby5aB5c="; }; - cargoHash = "sha256-zi6Jgibrx5kckqTj4nHBtiCFuHYmz4cyMwFkNQ6VXjc="; + cargoHash = "sha256-HeT3U4H/OM/91BdXTvZq+gpmOnt/P4wTlqc2dl4erlQ="; nativeBuildInputs = [ installShellFiles ]; diff --git a/pkgs/tools/text/tesh/default.nix b/pkgs/tools/text/tesh/default.nix index 0b702ae0052a4..abff7771add23 100644 --- a/pkgs/tools/text/tesh/default.nix +++ b/pkgs/tools/text/tesh/default.nix @@ -1,7 +1,7 @@ { python3Packages, fetchFromGitHub, fetchpatch }: let - version = "0.3.0"; + version = "0.3.2"; in python3Packages.buildPythonPackage rec { pname = "tesh"; inherit version; @@ -12,24 +12,9 @@ in python3Packages.buildPythonPackage rec { owner = "OceanSprint"; repo = "tesh"; rev = version; - hash = "sha256-/CSYz2YXbjKZszb1HMOCS+srVJ+TcFSeLeuz9VvtlI4="; + hash = "sha256-GIwg7Cv7tkLu81dmKT65c34eeVnRR5MIYfNwTE7j2Vs="; }; - patches = [ - # https://github.com/OceanSprint/tesh/pull/49 - (fetchpatch { - name = "replace-poetry-with-poetry-core-1.patch"; - url = "https://github.com/OceanSprint/tesh/commit/49b90f5a3c9cf111931393248943b1da966dc3ec.patch"; - hash = "sha256-s+eGO4NXTGbyXcLP37kCg4GDrjAsYIlOwNDR1Q7+1Uc="; - }) - # https://github.com/OceanSprint/tesh/pull/50 - (fetchpatch { - name = "replace-poetry-with-poetry-core-2.patch"; - url = "https://github.com/OceanSprint/tesh/commit/66798b54f28dc0b72159ee3a2144895cf945eaf0.patch"; - hash = "sha256-f3uL7TZlkrTOWYihwWNfhrY5/xlBrclAMnbxRNXCGJw="; - }) - ]; - checkInputs = [ python3Packages.pytest ]; nativeBuildInputs = [ python3Packages.poetry-core ]; propagatedBuildInputs = with python3Packages; [ click pexpect ]; diff --git a/pkgs/tools/typesetting/hayagriva/default.nix b/pkgs/tools/typesetting/hayagriva/default.nix index 522dbad6d51ed..6723e1acecdbf 100644 --- a/pkgs/tools/typesetting/hayagriva/default.nix +++ b/pkgs/tools/typesetting/hayagriva/default.nix @@ -5,17 +5,25 @@ rustPlatform.buildRustPackage rec { pname = "hayagriva"; - version = "0.3.2"; + version = "0.4.0"; src = fetchCrate { inherit pname version; - hash = "sha256-4HX0X8HDn0/D9mcruCVKeIs9ryCxYagW5eJ/DSqtprY="; + hash = "sha256-d4T+GF0bdMjpjwcN56yYpEw4aZCvJ19P1cbPuVhFR0A="; }; - cargoHash = "sha256-JvRWdoZ5/jG09ex7avkE3JUcdMGIsfirSx9PDyAtVfU="; + cargoHash = "sha256-mRKvCnW4XVXYzOKQ5rASwiwpLdqpEgGlq8W4gB7hHco="; buildFeatures = [ "cli" ]; + checkFlags = [ + # requires internet access + "--skip=try_archive" + + # requires a separate large repository + "--skip=csl::tests::test_csl" + ]; + meta = with lib; { description = "Work with references: Literature database management, storage, and citation formatting"; homepage = "https://github.com/typst/hayagriva"; diff --git a/pkgs/tools/typesetting/typst/Cargo.lock b/pkgs/tools/typesetting/typst/Cargo.lock index 71fb9e8f7130a..ae81d73200a35 100644 --- a/pkgs/tools/typesetting/typst/Cargo.lock +++ b/pkgs/tools/typesetting/typst/Cargo.lock @@ -21,21 +21,33 @@ dependencies = [ [[package]] name = "ahash" -version = "0.8.3" +version = "0.7.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5a824f2aa7e75a0c98c5a504fceb80649e9c35265d44525b5f94de4771a395cd" +dependencies = [ + "getrandom", + "once_cell", + "version_check", +] + +[[package]] +name = "ahash" +version = "0.8.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2c99f64d1e06488f620f932677e24bc6e2897582980441ae90a671415bd7ec2f" +checksum = "91429305e9f0a25f6205c5b8e0d2db09e0708a7a6df0f42212bb56c32c8ac97a" dependencies = [ "cfg-if", "getrandom", "once_cell", "version_check", + "zerocopy", ] [[package]] name = "aho-corasick" -version = "1.0.5" +version = "1.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0c378d78423fdad8089616f827526ee33c19f2fddbd5de1629152c9593ba4783" +checksum = "b2969dcb958b36655471fc61f7e416fa76033bdd4bfed0678d8fee1e2d07a1f0" dependencies = [ "memchr", ] @@ -57,9 +69,9 @@ dependencies = [ [[package]] name = "anstream" -version = "0.5.0" +version = "0.6.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b1f58811cfac344940f1a400b6e6231ce35171f614f26439e80f8c1465c5cc0c" +checksum = "2ab91ebe16eb252986481c5b62f6098f3b698a45e34b5b98200cf20dd2484a44" dependencies = [ "anstyle", "anstyle-parse", @@ -71,15 +83,15 @@ dependencies = [ [[package]] name = "anstyle" -version = "1.0.3" +version = "1.0.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b84bf0a05bbb2a83e5eb6fa36bb6e87baa08193c35ff52bbf6b38d8af2890e46" +checksum = "7079075b41f533b8c61d2a4d073c4676e1f8b249ff94a393b0595db304e0dd87" [[package]] name = "anstyle-parse" -version = "0.2.1" +version = "0.2.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "938874ff5980b03a87c5524b3ae5b59cf99b1d6bc836848df7bc5ada9643c333" +checksum = "317b9a89c1868f5ea6ff1d9539a69f45dffc21ce321ac1fd1160dfa48c8e2140" dependencies = [ "utf8parse", ] @@ -95,15 +107,24 @@ dependencies = [ [[package]] name = "anstyle-wincon" -version = "2.1.0" +version = "3.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "58f54d10c6dfa51283a066ceab3ec1ab78d13fae00aa49243a45e4571fb79dfd" +checksum = "f0699d10d2f4d628a98ee7b57b289abbc98ff3bad977cb3152709d4bf2330628" dependencies = [ "anstyle", "windows-sys", ] [[package]] +name = "approx" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cab112f0a86d568ea0e627cc1d6be74a1e9cd55214684db5561995f6dad897c6" +dependencies = [ + "num-traits", +] + +[[package]] name = "arrayref" version = "0.3.7" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -129,9 +150,9 @@ checksum = "7b7e4c2464d97fe331d41de9d5db0def0a96f4d823b8b32a2efd503578988973" [[package]] name = "base64" -version = "0.21.4" +version = "0.21.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9ba43ea6f343b788c8764558649e08df62f86c6ef251fdaeb1ffd010a9ae50a2" +checksum = "35636a1494ede3b646cc98f74f8e62c773a38a659ebc777a2cf26b9b74171df9" [[package]] name = "base64ct" @@ -141,11 +162,10 @@ checksum = "8c3c1a368f70d6cf7302d78f8f7093da241fb8e8807c05cc9e51a125895a6d5b" [[package]] name = "biblatex" -version = "0.8.0" +version = "0.8.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cc9fd60378277e44cd400ec5f35e768ce0d5a63d8d18ac7b1a9231196251dae5" +checksum = "2e41df82f0d1c4919d946bb0c7c3d179b6071246243d308a1bdee6cfecee3bc7" dependencies = [ - "chrono", "numerals", "paste", "strum", @@ -178,12 +198,6 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "349f9b6a179ed607305526ca489b34ad0a41aed5f7980fa90eb03160b69598fb" [[package]] -name = "bit_field" -version = "0.10.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dc827186963e592360843fb5ba4b973e145841266c1357f7180c43526f2e5b61" - -[[package]] name = "bitflags" version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -191,9 +205,9 @@ checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a" [[package]] name = "bitflags" -version = "2.4.0" +version = "2.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b4682ae6287fcf752ecaabbfcc7b6f9b72aa33933dc23a554d853aea8eea8635" +checksum = "327762f6e5a765692301e5bb513e0d9fef63be86bbc14528052b1cd3e6f03e07" dependencies = [ "serde", ] @@ -221,9 +235,31 @@ dependencies = [ [[package]] name = "bumpalo" -version = "3.13.0" +version = "3.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f30e7476521f6f8af1a1c4c0b8cc94f0bee37d91763d0ca2665f299b6cd8aec" + +[[package]] +name = "bytecheck" +version = "0.6.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b6372023ac861f6e6dc89c8344a8f398fb42aaba2b5dbc649ca0c0e9dbcb627" +dependencies = [ + "bytecheck_derive", + "ptr_meta", + "simdutf8", +] + +[[package]] +name = "bytecheck_derive" +version = "0.6.11" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a3e2c3daef883ecc1b5d58c15adae93470a91d425f3532ba1695849656af3fc1" +checksum = "a7ec4c6f261935ad534c0c22dbef2201b45918860eb1c574b972bd213a76af61" +dependencies = [ + "proc-macro2", + "quote", + "syn 1.0.109", +] [[package]] name = "bytemuck" @@ -233,9 +269,9 @@ checksum = "374d28ec25809ee0e23827c2ab573d729e293f281dfe393500e7ad618baa61c6" [[package]] name = "byteorder" -version = "1.4.3" +version = "1.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610" +checksum = "1fd0f2584146f6f2ef48085050886acf353beff7305ebd1ae69500e27c67f64b" [[package]] name = "bzip2" @@ -294,9 +330,9 @@ checksum = "aeea139b89efab957972956e5d3e4efb66a6c261f726abf6911040cc8ef700f7" [[package]] name = "chrono" -version = "0.4.30" +version = "0.4.31" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "defd4e7873dbddba6c7c91e199c7fcb946abc4a6a4ac3195400bcfb01b5de877" +checksum = "7f2c685bad3eb3d45a01354cedb7d5faa66194d1d58ba6e267a8de788f79db38" dependencies = [ "android-tzdata", "iana-time-zone", @@ -328,7 +364,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "defaa24ecc093c77630e6c15e17c51f5e187bf35ee514f4e2d67baaa96dae22b" dependencies = [ "ciborium-io", - "half 1.8.2", + "half", ] [[package]] @@ -342,10 +378,20 @@ dependencies = [ ] [[package]] +name = "citationberg" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4c857faf24e89710f105b623c174508070a9e11e056a749f251ca4c56f59ad88" +dependencies = [ + "quick-xml 0.28.2", + "serde", +] + +[[package]] name = "clap" -version = "4.4.3" +version = "4.4.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "84ed82781cea27b43c9b106a979fe450a13a31aab0500595fb3fc06616de08e6" +checksum = "ac495e00dcec98c83465d5ad66c5c4fabd652fd6686e7c6269b117e729a6f17b" dependencies = [ "clap_builder", "clap_derive", @@ -353,9 +399,9 @@ dependencies = [ [[package]] name = "clap_builder" -version = "4.4.2" +version = "4.4.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2bb9faaa7c2ef94b2743a21f5a29e6f0010dff4caa69ac8e9d6cf8b6fa74da08" +checksum = "c77ed9a32a62e6ca27175d00d29d05ca32e396ea1eb5fb01d8256b669cec7663" dependencies = [ "anstream", "anstyle", @@ -365,36 +411,36 @@ dependencies = [ [[package]] name = "clap_complete" -version = "4.4.1" +version = "4.4.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4110a1e6af615a9e6d0a36f805d5c99099f8bab9b8042f5bc1fa220a4a89e36f" +checksum = "bffe91f06a11b4b9420f62103854e90867812cd5d01557f853c5ee8e791b12ae" dependencies = [ "clap", ] [[package]] name = "clap_derive" -version = "4.4.2" +version = "4.4.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0862016ff20d69b84ef8247369fabf5c008a7417002411897d40ee1f4532b873" +checksum = "cf9804afaaf59a91e75b022a30fb7229a7901f60c755489cc61c9b423b836442" dependencies = [ "heck", "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", ] [[package]] name = "clap_lex" -version = "0.5.1" +version = "0.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cd7cc57abe963c6d3b9d8be5b06ba7c8957a930305ca90304f24ef040aa6f961" +checksum = "702fc72eb24e5a1e48ce58027a675bc24edd52096d5397d4aea7c6dd9eca0bd1" [[package]] name = "clap_mangen" -version = "0.2.13" +version = "0.2.15" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cf8e5f34d85d9e0bbe2491d100a7a7c1007bb2467b518080bfe311e8947197a9" +checksum = "d3be86020147691e1d2ef58f75346a3d4d94807bfc473e377d52f09f0f7d77f7" dependencies = [ "clap", "roff", @@ -462,10 +508,19 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e496a50fda8aacccc86d7529e2c1e0892dbd0f898a6b5645b5561b89c3210efa" [[package]] +name = "core_maths" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e3b02505ccb8c50b0aa21ace0fc08c3e53adebd4e58caa18a36152803c7709a3" +dependencies = [ + "libm", +] + +[[package]] name = "cpufeatures" -version = "0.2.9" +version = "0.2.11" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a17b76ff3a4162b0b27f354a0c87015ddad39d35f9c0c36607a3bdd175dde1f1" +checksum = "ce420fe07aecd3e67c5f910618fe65e94158f6dcc0adf44e00d69ce2bdfe0fd0" dependencies = [ "libc", ] @@ -523,12 +578,6 @@ dependencies = [ ] [[package]] -name = "crunchy" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7a81dae078cea95a014a339291cec439d2f232ebe854a9d672b796c6afafa9b7" - -[[package]] name = "crypto-common" version = "0.1.6" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -540,9 +589,9 @@ dependencies = [ [[package]] name = "csv" -version = "1.2.2" +version = "1.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "626ae34994d3d8d668f4269922248239db4ae42d538b14c398b74a52208e8086" +checksum = "ac574ff4d437a7b5ad237ef331c17ccca63c46479e5b5453eb8e10bb99a759fe" dependencies = [ "csv-core", "itoa", @@ -552,9 +601,9 @@ dependencies = [ [[package]] name = "csv-core" -version = "0.1.10" +version = "0.1.11" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2b2466559f260f48ad25fe6317b3c8dac77b5bdb5763ac7d9d6103530663bc90" +checksum = "5efa2b3d7902f4b634a20cae3c9c4e6209dc4779feb6863329607560143efa70" dependencies = [ "memchr", ] @@ -566,7 +615,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "978747c1d849a7d2ee5e8adc0159961c48fb7e5db2f06af6723b80123bb53856" dependencies = [ "cfg-if", - "hashbrown 0.14.0", + "hashbrown 0.14.2", "lock_api", "once_cell", "parking_lot_core", @@ -574,15 +623,18 @@ dependencies = [ [[package]] name = "data-url" -version = "0.2.0" +version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8d7439c3735f405729d52c3fbbe4de140eaf938a1fe47d227c27f8254d4302a5" +checksum = "41b319d1b62ffbd002e057f36bebd1f42b9f97927c9577461d855f3513c4289f" [[package]] name = "deranged" -version = "0.3.8" +version = "0.3.9" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f2696e8a945f658fd14dc3b87242e6b80cd0f36ff04ea560fa39082368847946" +checksum = "0f32d04922c60427da6f9fef14d042d9edddef64cb9d4ce0d64d0685fbeb1fd3" +dependencies = [ + "powerfmt", +] [[package]] name = "digest" @@ -624,7 +676,7 @@ checksum = "487585f4d0c6655fe74905e2504d8ad6908e4db67f744eb140876906c2f3175d" dependencies = [ "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", ] [[package]] @@ -635,9 +687,9 @@ checksum = "9ea835d29036a4087793836fa931b08837ad5e957da9e23886b29586fb9b6650" [[package]] name = "ecow" -version = "0.1.2" +version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1d1990d053cf6edf3f030682dba3b0eb65ef01fabb2686072765d8a17d6728e8" +checksum = "e6ea5e3f9cda726431da9d1a8d5a29785d544b31e98e1ca7a210906244002e02" dependencies = [ "serde", ] @@ -649,16 +701,22 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "a26ae43d7bcc3b814de94796a5e736d4029efb0ee900c12e2d54c993ad1a1e07" [[package]] +name = "embedded-io" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ef1a6892d9eef45c8fa6b9e0086428a2cca8491aca8f787c534a3d6d0bcb3ced" + +[[package]] name = "enum-ordinalize" -version = "3.1.13" +version = "3.1.15" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e4f76552f53cefc9a7f64987c3701b99d982f7690606fd67de1d09712fbf52f1" +checksum = "1bf1fa3f06bbff1ea5b1a9c7b14aa992a39657db60a2759457328d7e058f49ee" dependencies = [ "num-bigint", "num-traits", "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", ] [[package]] @@ -688,42 +746,15 @@ checksum = "5443807d6dff69373d433ab9ef5378ad8df50ca6298caf15de6e52e24aaf54d5" [[package]] name = "errno" -version = "0.3.3" +version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "136526188508e25c6fef639d7927dfb3e0e3084488bf202267829cf7fc23dbdd" +checksum = "ac3e13f66a2f95e32a39eaa81f6b95d42878ca0e1db0c7543723dfe12557e860" dependencies = [ - "errno-dragonfly", "libc", "windows-sys", ] [[package]] -name = "errno-dragonfly" -version = "0.1.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "aa68f1b12764fab894d2755d2518754e71b4fd80ecfb822714a1206c2aab39bf" -dependencies = [ - "cc", - "libc", -] - -[[package]] -name = "exr" -version = "1.7.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d1e481eb11a482815d3e9d618db8c42a93207134662873809335a92327440c18" -dependencies = [ - "bit_field", - "flume", - "half 2.2.1", - "lebe", - "miniz_oxide", - "rayon-core", - "smallvec", - "zune-inflate", -] - -[[package]] name = "fancy-regex" version = "0.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -734,6 +765,12 @@ dependencies = [ ] [[package]] +name = "fast-srgb8" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dd2e7510819d6fbf51a5545c8f922716ecfb14df168a3242f7d33e0239efe6a1" + +[[package]] name = "fastrand" version = "1.9.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -744,9 +781,9 @@ dependencies = [ [[package]] name = "fastrand" -version = "2.0.0" +version = "2.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6999dc1837253364c2ebb0704ba97994bd874e8f195d665c50b7548f6ea92764" +checksum = "25cbce373ec4653f1a01a31e8a5e5ec0c622dc27ff9c4e6606eefef5cbbed4a5" [[package]] name = "fdeflate" @@ -771,9 +808,9 @@ dependencies = [ [[package]] name = "flate2" -version = "1.0.27" +version = "1.0.28" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c6c98ee8095e9d1dcbf2fcc6d95acccb90d1c81db1e44725c6a984b1dbdfb010" +checksum = "46303f565772937ffe1d394a4fac6f411c6013172fadde9dcdb1e147a086940e" dependencies = [ "crc32fast", "miniz_oxide", @@ -786,34 +823,32 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "98de4bbd547a563b716d8dfa9aad1cb19bfab00f4fa09a6a4ed21dbcf44ce9c4" [[package]] -name = "flume" -version = "0.10.14" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1657b4441c3403d9f7b3409e47575237dac27b1b5726df654a6ecbf92f0f7577" -dependencies = [ - "futures-core", - "futures-sink", - "nanorand", - "pin-project", - "spin 0.9.8", -] - -[[package]] name = "fnv" version = "1.0.7" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1" [[package]] +name = "fontconfig-parser" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "674e258f4b5d2dcd63888c01c68413c51f565e8af99d2f7701c7b81d79ef41c4" +dependencies = [ + "roxmltree", +] + +[[package]] name = "fontdb" -version = "0.14.1" +version = "0.15.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "af8d8cbea8f21307d7e84bca254772981296f058a1d36b461bf4d83a7499fc9e" +checksum = "020e203f177c0fb250fb19455a252e838d2bbbce1f80f25ecc42402aafa8cd38" dependencies = [ + "fontconfig-parser", "log", + "memmap2", "slotmap", "tinyvec", - "ttf-parser 0.19.2", + "ttf-parser", ] [[package]] @@ -841,18 +876,6 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e6d5a32815ae3f33302d95fdcb2ce17862f8c65363dcfd29360480ba1001fc9c" [[package]] -name = "futures-core" -version = "0.3.28" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4bca583b7e26f571124fe5b7561d49cb2868d79116cfa0eefce955557c6fee8c" - -[[package]] -name = "futures-sink" -version = "0.3.28" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f43be4fe21a13b9781a69afa4985b0f6ee0e1afab2c6f454a8cf30e2b2237b6e" - -[[package]] name = "generic-array" version = "0.14.7" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -878,10 +901,8 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "be4136b2a15dd319360be1c07d9933517ccf0be8f16bf62a3bee4f0d618df427" dependencies = [ "cfg-if", - "js-sys", "libc", "wasi", - "wasm-bindgen", ] [[package]] @@ -901,45 +922,40 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "eabb4a44450da02c90444cf74558da904edde8fb4e9035a9a6a4e15445af0bd7" [[package]] -name = "half" -version = "2.2.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "02b4af3693f1b705df946e9fe5631932443781d0aabb423b62fcd4d73f6d2fd0" -dependencies = [ - "crunchy", -] - -[[package]] name = "hashbrown" version = "0.12.3" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888" +dependencies = [ + "ahash 0.7.7", +] [[package]] name = "hashbrown" -version = "0.14.0" +version = "0.14.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2c6201b9ff9fd90a5a3bac2e56a830d0caa509576f0e503818ee82c181b3437a" +checksum = "f93e7192158dbcda357bdec5fb5788eebf8bbac027f3f33e719d29135ae84156" [[package]] name = "hayagriva" -version = "0.3.2" +version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "065e90e53aa502be868a307f58ca6b46e31143641e809047c689de75619d8cea" +checksum = "c5af3d464a6b5ae882f15fe1da4e696fd96b77fee78ded933e0ad81d1d87cbc5" dependencies = [ "biblatex", - "chrono", - "isolang", - "lazy_static", - "linked-hash-map", + "ciborium", + "citationberg", + "indexmap 2.0.2", + "numerals", "paste", - "regex", - "strum", + "rkyv", + "serde", + "serde_yaml 0.9.27", "thiserror", "unic-langid", "unicode-segmentation", + "unscanny", "url", - "yaml-rust", ] [[package]] @@ -950,9 +966,9 @@ checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8" [[package]] name = "hermit-abi" -version = "0.3.2" +version = "0.3.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "443144c8cdadd93ebf52ddb4056d257f5b52c04d3c804e657d19eb73fc33668b" +checksum = "d77f7ec81a6d05a3abb01ab6eb7590f6083d08449fe5a1c8b1e620283546ccb7" [[package]] name = "hmac" @@ -965,9 +981,9 @@ dependencies = [ [[package]] name = "hypher" -version = "0.1.3" +version = "0.1.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "723e315d77ea8aa1aedf53ad979ff0e763cfa2a1b3403248e427ae052f403cad" +checksum = "94bf16dd62ea2bec617a6f8a3e1ba03107311783069a647787ac689d1f35321e" [[package]] name = "iai" @@ -979,16 +995,16 @@ dependencies = [ [[package]] name = "iana-time-zone" -version = "0.1.57" +version = "0.1.58" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2fad5b825842d2b38bd206f3e81d6957625fd7f0a361e345c30e01a0ae2dd613" +checksum = "8326b86b6cff230b97d0d312a6c40a60726df3332e721f72a1b035f451663b20" dependencies = [ "android_system_properties", "core-foundation-sys", "iana-time-zone-haiku", "js-sys", "wasm-bindgen", - "windows", + "windows-core", ] [[package]] @@ -1002,9 +1018,9 @@ dependencies = [ [[package]] name = "icu_collections" -version = "1.2.0" +version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ef8302d8dfd6044d3ddb3f807a5ef3d7bbca9a574959c6d6e4dc39aa7012d0d5" +checksum = "3907b2246e8dd5a29ead8a965e7c0c8a90e9b928e614a4279257d45c5e553e91" dependencies = [ "displaydoc", "serde", @@ -1015,9 +1031,9 @@ dependencies = [ [[package]] name = "icu_locid" -version = "1.2.0" +version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3003f85dccfc0e238ff567693248c59153a46f4e6125ba4020b973cef4d1d335" +checksum = "f284eb342dc49d3e9d9f3b188489d76b5d22dfb1d1a5e0d1941811253bac625c" dependencies = [ "displaydoc", "litemap", @@ -1027,13 +1043,35 @@ dependencies = [ ] [[package]] +name = "icu_locid_transform" +version = "1.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6551daf80882d8e68eee186cc19e132d8bde1b1f059a79b93384a5ca0e8fc5e7" +dependencies = [ + "displaydoc", + "icu_locid", + "icu_locid_transform_data", + "icu_provider", + "tinystr", + "zerovec", +] + +[[package]] +name = "icu_locid_transform_data" +version = "1.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2a741eba5431f75eb2f1f9022d3cffabcadda6771e54fb4e77c8ba8653e4da44" + +[[package]] name = "icu_properties" -version = "1.2.0" +version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ce0e1aa26851f16c9e04412a5911c86b7f8768dac8f8d4c5f1c568a7e5d7a434" +checksum = "3477ae70f8ca8dc08ff7574b5398ed0a2f2e4e6b66bdff2558a92ed67e262be1" dependencies = [ "displaydoc", "icu_collections", + "icu_locid_transform", + "icu_properties_data", "icu_provider", "serde", "tinystr", @@ -1041,10 +1079,16 @@ dependencies = [ ] [[package]] +name = "icu_properties_data" +version = "1.3.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "98507b488098f45eb95ef495612a2012e4d8ad6095dda86cb2f1728aa2204a60" + +[[package]] name = "icu_provider" -version = "1.2.0" +version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8dc312a7b6148f7dfe098047ae2494d12d4034f48ade58d4f353000db376e305" +checksum = "68acdef80034b5e35d8524e9817479d389a4f9774f3f0cbe1bf3884d80fd5934" dependencies = [ "displaydoc", "icu_locid", @@ -1052,6 +1096,7 @@ dependencies = [ "postcard", "serde", "stable_deref_trait", + "tinystr", "writeable", "yoke", "zerofrom", @@ -1060,59 +1105,65 @@ dependencies = [ [[package]] name = "icu_provider_adapters" -version = "1.2.0" +version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f4ae1e2bd0c41728b77e7c46e9afdec5e2127d1eedacc684724667d50c126bd3" +checksum = "36b380ef2d3d93b015cd0563d7e0d005cc07f82a5503716dbc191798d0079e1d" dependencies = [ "icu_locid", + "icu_locid_transform", "icu_provider", "tinystr", - "yoke", "zerovec", ] [[package]] name = "icu_provider_blob" -version = "1.2.0" +version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fd364c9a01f791a4bc04a74cf2a1d01d9f6926a40fd5ae1c28004e1e70d8338b" +checksum = "c31326d28c7f95a964a4f0ee86c24002da5f6db907e3bcb079949b4ff103b6a9" dependencies = [ "icu_provider", "postcard", "serde", "writeable", - "yoke", "zerovec", ] [[package]] name = "icu_provider_macros" -version = "1.2.0" +version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dd8b728b9421e93eff1d9f8681101b78fa745e0748c95c655c83f337044a7e10" +checksum = "2060258edfcfe32ca7058849bf0f146cb5c59aadbedf480333c0d0002f97bc99" dependencies = [ "proc-macro2", "quote", - "syn 1.0.109", + "syn 2.0.38", ] [[package]] name = "icu_segmenter" -version = "1.2.1" +version = "1.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c3300a7b6bf187be98a57264ad094f11f2e062c2e8263132af010ff522ee5495" +checksum = "bcb3c1981ce2187a745f391a741cb14e77453325acb3b2e014b05da51c0a39f2" dependencies = [ + "core_maths", "displaydoc", "icu_collections", "icu_locid", "icu_provider", - "num-traits", + "icu_segmenter_data", "serde", "utf8_iter", "zerovec", ] [[package]] +name = "icu_segmenter_data" +version = "1.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9703f6713044d1c0a1335a6d78ffece4c9380582416ace6feeb608e84d279fc7" + +[[package]] name = "idna" version = "0.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -1137,14 +1188,11 @@ dependencies = [ "bytemuck", "byteorder", "color_quant", - "exr", "gif", "jpeg-decoder", "num-rational", "num-traits", "png", - "qoi", - "tiff", ] [[package]] @@ -1184,12 +1232,12 @@ dependencies = [ [[package]] name = "indexmap" -version = "2.0.0" +version = "2.0.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d5477fe2230a79769d8dc68e0eabf5437907c0457a5614a9e8dddb67f65eb65d" +checksum = "8adf3ddd720272c6ea8bf59463c04e0f93d0bbf7c5439b691bca2987e0270897" dependencies = [ "equivalent", - "hashbrown 0.14.0", + "hashbrown 0.14.2", "rayon", "serde", ] @@ -1202,17 +1250,17 @@ checksum = "8e04e2fd2b8188ea827b32ef11de88377086d690286ab35747ef7f9bf3ccb590" [[package]] name = "inferno" -version = "0.11.16" +version = "0.11.17" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "73c0fefcb6d409a6587c07515951495d482006f89a21daa0f2f783aa4fd5e027" +checksum = "c50453ec3a6555fad17b1cd1a80d16af5bc7cb35094f64e429fd46549018c6a3" dependencies = [ - "ahash", + "ahash 0.8.6", "clap", "crossbeam-channel", "crossbeam-utils", "dashmap", "env_logger", - "indexmap 2.0.0", + "indexmap 2.0.2", "is-terminal", "itoa", "log", @@ -1292,15 +1340,6 @@ dependencies = [ ] [[package]] -name = "isolang" -version = "2.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f80f221db1bc708b71128757b9396727c04de86968081e18e89b0575e03be071" -dependencies = [ - "phf", -] - -[[package]] name = "itoa" version = "1.0.9" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -1308,9 +1347,9 @@ checksum = "af150ab688ff2122fcef229be89cb50dd66af9e01a4ff320cc137eecc9bacc38" [[package]] name = "jobserver" -version = "0.1.26" +version = "0.1.27" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "936cfd212a0155903bcbc060e316fb6cc7cbf2e1907329391ebadc1fe0ce77c2" +checksum = "8c37f63953c4c63420ed5fd3d6d398c719489b9f872b9fa683262f8edd363c7d" dependencies = [ "libc", ] @@ -1320,9 +1359,6 @@ name = "jpeg-decoder" version = "0.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "bc0000e42512c92e31c2252315bda326620a4e034105e900c98ec492fa077b3e" -dependencies = [ - "rayon", -] [[package]] name = "js-sys" @@ -1369,16 +1405,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646" [[package]] -name = "lebe" -version = "0.5.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "03087c2bad5e1034e8cace5926dec053fb3790248370865f5117a7d0213354c8" - -[[package]] name = "libc" -version = "0.2.148" +version = "0.2.149" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9cdc71e17332e86d2e1d38c1f99edcb6288ee11b815fb1a4b049eaa2114d369b" +checksum = "a08173bc88b7955d1b3145aa561539096c421ac8debde8cbc3612ec635fee29b" [[package]] name = "libdeflate-sys" @@ -1400,9 +1430,9 @@ dependencies = [ [[package]] name = "libm" -version = "0.2.7" +version = "0.2.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f7012b1bbb0719e1097c47611d3898568c546d597c2e74d66f6087edd5233ff4" +checksum = "4ec2a862134d2a7d32d7983ddcdd1c4923530833c9f2ea1a44fc5fa473989058" [[package]] name = "line-wrap" @@ -1421,9 +1451,9 @@ checksum = "0717cef1bc8b636c6e1c1bbdefc09e6322da8a9321966e8928ef80d20f7f770f" [[package]] name = "linux-raw-sys" -version = "0.4.7" +version = "0.4.10" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1a9bad9f94746442c783ca431b22403b519cd7fbeed0533fdd6328b2f2212128" +checksum = "da2479e8c062e40bf0066ffa0bc823de0a9368974af99c9f6df941d2c231e03f" [[package]] name = "lipsum" @@ -1437,15 +1467,15 @@ dependencies = [ [[package]] name = "litemap" -version = "0.7.0" +version = "0.7.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3a04a5b2b6f54acba899926491d0a6c59d98012938ca2ab5befb281c034e8f94" +checksum = "77a1a2647d5b7134127971a6de0d533c49de2159167e7f259c427195f87168a1" [[package]] name = "lock_api" -version = "0.4.10" +version = "0.4.11" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c1cc9717a20b1bb222f333e6a92fd32f7d8a18ddc5a3191a11af45dcbf4dcd16" +checksum = "3c168f8615b12bc01f9c17e2eb0cc07dcae1940121185446edc3744920e8ef45" dependencies = [ "autocfg", "scopeguard", @@ -1470,15 +1500,15 @@ dependencies = [ [[package]] name = "memchr" -version = "2.6.3" +version = "2.6.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8f232d6ef707e1956a43342693d2a31e72989554d58299d7a88738cc95b0d35c" +checksum = "f665ee40bc4a3c5590afb1e9677db74a508659dfd71e126420da8274909a0167" [[package]] name = "memmap2" -version = "0.7.1" +version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f49388d20533534cd19360ad3d6a7dadc885944aa802ba3995040c5ec11288c6" +checksum = "43a5a03cefb0d953ec0be133036f14e109412fa594edc2f77227249db66cc3ed" dependencies = [ "libc", ] @@ -1504,9 +1534,9 @@ dependencies = [ [[package]] name = "mio" -version = "0.8.8" +version = "0.8.9" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "927a765cd3fc26206e66b296465fa9d3e5ab003e651c1b3c060e7956d96b19d2" +checksum = "3dce281c5e46beae905d4de1870d8b1509a9142b62eedf18b443b011ca8343d0" dependencies = [ "libc", "log", @@ -1515,21 +1545,12 @@ dependencies = [ ] [[package]] -name = "nanorand" -version = "0.7.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6a51313c5820b0b02bd422f4b44776fbf47961755c74ce64afc73bfad10226c3" -dependencies = [ - "getrandom", -] - -[[package]] name = "notify" version = "6.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "6205bd8bb1e454ad2e27422015fb5e4f2bcc7e08fa8f27058670d208324a4d2d" dependencies = [ - "bitflags 2.4.0", + "bitflags 2.4.1", "crossbeam-channel", "filetime", "fsevent-sys", @@ -1596,22 +1617,11 @@ dependencies = [ [[package]] name = "num-traits" -version = "0.2.16" +version = "0.2.17" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f30b0abd723be7e2ffca1272140fac1a2f084c77ec3e123c192b66af1ee9e6c2" +checksum = "39e3200413f237f41ab11ad6d161bc7239c84dcb631773ccd7de3dfe4b5c267c" dependencies = [ "autocfg", - "libm", -] - -[[package]] -name = "num_cpus" -version = "1.16.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4161fcb6d602d4d2081af7c3a45852d875a03dd337a6bfdd6e06407b61342a43" -dependencies = [ - "hermit-abi", - "libc", ] [[package]] @@ -1621,15 +1631,6 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e25be21376a772d15f97ae789845340a9651d3c4246ff5ebb6a2b35f9c37bd31" [[package]] -name = "oklab" -version = "1.0.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "467e40ada50d13bab19019e3707862b5076ca15841f31ee1474c40397c1b9f11" -dependencies = [ - "rgb", -] - -[[package]] name = "once_cell" version = "1.18.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -1666,7 +1667,7 @@ dependencies = [ "bitvec", "crossbeam-channel", "filetime", - "indexmap 2.0.0", + "indexmap 2.0.2", "libdeflater", "log", "rayon", @@ -1677,14 +1678,37 @@ dependencies = [ ] [[package]] +name = "palette" +version = "0.7.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2e2f34147767aa758aa649415b50a69eeb46a67f9dc7db8011eeb3d84b351dc" +dependencies = [ + "approx", + "fast-srgb8", + "libm", + "palette_derive", +] + +[[package]] +name = "palette_derive" +version = "0.7.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b7db010ec5ff3d4385e4f133916faacd9dad0f6a09394c92d825b3aed310fa0a" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.38", +] + +[[package]] name = "parking_lot_core" -version = "0.9.8" +version = "0.9.9" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "93f00c865fe7cabf650081affecd3871070f26767e7b2070a3ffae14c654b447" +checksum = "4c42a9226546d68acdd9c0a280d17ce19bfe27a46bf68784e4066115788d008e" dependencies = [ "cfg-if", "libc", - "redox_syscall 0.3.5", + "redox_syscall 0.4.1", "smallvec", "windows-targets", ] @@ -1726,12 +1750,13 @@ dependencies = [ [[package]] name = "pdf-writer" -version = "0.8.1" +version = "0.9.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9d77bc47c8968aa63f86a7e6693e270a6cbd1e3b784c364f1711a0ddecc71447" +checksum = "690874e8cf95d36ddffbdbdaad6ef8714c88bf8085996b673559389a04e38a02" dependencies = [ "bitflags 1.3.2", "itoa", + "memchr", "ryu", ] @@ -1742,50 +1767,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9b2a4787296e9989611394c33f193f676704af1686e70b8f8033ab5ba9a35a94" [[package]] -name = "phf" -version = "0.11.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ade2d8b8f33c7333b51bcf0428d37e217e9f32192ae4772156f65063b8ce03dc" -dependencies = [ - "phf_shared", -] - -[[package]] -name = "phf_shared" -version = "0.11.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "90fcb95eef784c2ac79119d1dd819e162b5da872ce6f3c3abe1e8ca1c082f72b" -dependencies = [ - "siphasher", -] - -[[package]] name = "pico-args" version = "0.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "5be167a7af36ee22fe3115051bc51f6e6c7054c9348e28deb4f49bd6f705a315" [[package]] -name = "pin-project" -version = "1.1.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fda4ed1c6c173e3fc7a83629421152e01d7b1f9b7f65fb301e490e8cfc656422" -dependencies = [ - "pin-project-internal", -] - -[[package]] -name = "pin-project-internal" -version = "1.1.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4359fd9c9171ec6e8c62926d6faaf553a8dc3f64e1507e76da7911b4f6a04405" -dependencies = [ - "proc-macro2", - "quote", - "syn 2.0.32", -] - -[[package]] name = "pin-project-lite" version = "0.2.13" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -1797,7 +1784,7 @@ version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f67591f21f6668e63c1cd85adab066ac8a92bc7b962668dd8042197a6e4b8f8f" dependencies = [ - "ttf-parser 0.19.2", + "ttf-parser", ] [[package]] @@ -1808,14 +1795,14 @@ checksum = "26072860ba924cbfa98ea39c8c19b4dd6a4a25423dbdf219c1eca91aa0cf6964" [[package]] name = "plist" -version = "1.5.0" +version = "1.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bdc0001cfea3db57a2e24bc0d818e9e20e554b5f97fabb9bc231dc240269ae06" +checksum = "9a4a0cfc5fb21a09dc6af4bf834cf10d4a32fccd9e2ea468c4b1751a097487aa" dependencies = [ "base64", "indexmap 1.9.3", "line-wrap", - "quick-xml 0.29.0", + "quick-xml 0.30.0", "serde", "time", ] @@ -1835,15 +1822,22 @@ dependencies = [ [[package]] name = "postcard" -version = "1.0.7" +version = "1.0.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d534c6e61df1c7166e636ca612d9820d486fe96ddad37f7abc671517b297488e" +checksum = "a55c51ee6c0db07e68448e336cf8ea4131a620edefebf9893e759b2d793420f8" dependencies = [ "cobs", + "embedded-io", "serde", ] [[package]] +name = "powerfmt" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "439ee305def115ba05938db6eb1644ff94165c5ab5e9420d1c1bcedbba909391" + +[[package]] name = "ppv-lite86" version = "0.2.17" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -1851,9 +1845,9 @@ checksum = "5b40af805b3121feab8a3c29f04d8ad262fa8e0561883e7653e024ae4479e6de" [[package]] name = "proc-macro2" -version = "1.0.66" +version = "1.0.69" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "18fb31db3f9bddb2ea821cde30a9f70117e3f119938b5ee630b7403aa6e2ead9" +checksum = "134c189feb4956b20f6f547d2cf727d4c0fe06722b20a0eec87ed445a97f92da" dependencies = [ "unicode-ident", ] @@ -1868,6 +1862,26 @@ dependencies = [ ] [[package]] +name = "ptr_meta" +version = "0.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0738ccf7ea06b608c10564b31debd4f5bc5e197fc8bfe088f68ae5ce81e7a4f1" +dependencies = [ + "ptr_meta_derive", +] + +[[package]] +name = "ptr_meta_derive" +version = "0.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "16b845dbfca988fa33db069c0e230574d15a3088f147a87b64c7589eb662c9ac" +dependencies = [ + "proc-macro2", + "quote", + "syn 1.0.109", +] + +[[package]] name = "pulldown-cmark" version = "0.9.3" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -1880,28 +1894,29 @@ dependencies = [ ] [[package]] -name = "qoi" -version = "0.4.1" +name = "quick-xml" +version = "0.26.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7f6d64c71eb498fe9eae14ce4ec935c555749aef511cca85b5568910d6e48001" +checksum = "7f50b1c63b38611e7d4d7f68b82d3ad0cc71a2ad2e7f61fc10f1328d917c93cd" dependencies = [ - "bytemuck", + "memchr", ] [[package]] name = "quick-xml" -version = "0.26.0" +version = "0.28.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7f50b1c63b38611e7d4d7f68b82d3ad0cc71a2ad2e7f61fc10f1328d917c93cd" +checksum = "0ce5e73202a820a31f8a0ee32ada5e21029c81fd9e3ebf668a40832e4219d9d1" dependencies = [ "memchr", + "serde", ] [[package]] name = "quick-xml" -version = "0.29.0" +version = "0.30.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "81b9228215d82c7b61490fec1de287136b5de6f5700f6e58ea9ad61a7964ca51" +checksum = "eff6510e86862b57b210fd8cbe8ed3f0d7d600b9c2863cd4549a2e033c66e956" dependencies = [ "memchr", ] @@ -1948,9 +1963,9 @@ checksum = "ec0be4795e2f6a28069bec0b5ff3e2ac9bafc99e6a9a7dc3547996c5c816922c" [[package]] name = "rayon" -version = "1.7.0" +version = "1.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1d2df5196e37bcc87abebc0053e20787d73847bb33134a69841207dd0a47f03b" +checksum = "9c27db03db7734835b3f53954b534c91069375ce6ccaa2e065441e07d9b6cdb1" dependencies = [ "either", "rayon-core", @@ -1958,14 +1973,12 @@ dependencies = [ [[package]] name = "rayon-core" -version = "1.11.0" +version = "1.12.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4b8f95bd6966f5c87776639160a66bd8ab9895d9d4ab01ddba9fc60661aebe8d" +checksum = "5ce3fb6ad83f861aac485e76e1985cd109d9a3713802152be56c3b1f0e0658ed" dependencies = [ - "crossbeam-channel", "crossbeam-deque", "crossbeam-utils", - "num_cpus", ] [[package]] @@ -1993,6 +2006,15 @@ dependencies = [ ] [[package]] +name = "redox_syscall" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4722d768eff46b75989dd134e5c353f0d6296e5aaa3132e776cbdb56be7731aa" +dependencies = [ + "bitflags 1.3.2", +] + +[[package]] name = "redox_users" version = "0.4.3" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -2005,25 +2027,25 @@ dependencies = [ [[package]] name = "regex" -version = "1.9.5" +version = "1.10.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "697061221ea1b4a94a624f67d0ae2bfe4e22b8a17b6a192afb11046542cc8c47" +checksum = "380b951a9c5e80ddfd6136919eef32310721aa4aacd4889a8d39124b026ab343" dependencies = [ "aho-corasick", "memchr", "regex-automata", - "regex-syntax", + "regex-syntax 0.8.2", ] [[package]] name = "regex-automata" -version = "0.3.8" +version = "0.4.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c2f401f4955220693b56f8ec66ee9c78abffd8d1c4f23dc41a23839eb88f0795" +checksum = "5f804c7828047e88b2d32e2d7fe5a105da8ee3264f01902f796c8e067dc2483f" dependencies = [ "aho-corasick", "memchr", - "regex-syntax", + "regex-syntax 0.8.2", ] [[package]] @@ -2033,10 +2055,25 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "dbb5fb1acd8a1a18b3dd5be62d25485eb770e05afb408a9627d14d451bae12da" [[package]] +name = "regex-syntax" +version = "0.8.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c08c74e62047bb2de4ff487b251e4a92e24f48745648451635cec7d591162d9f" + +[[package]] +name = "rend" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a2571463863a6bd50c32f94402933f03457a3fbaf697a707c5be741e459f08fd" +dependencies = [ + "bytecheck", +] + +[[package]] name = "resvg" -version = "0.35.0" +version = "0.36.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b6554f47c38eca56827eea7f285c2a3018b4e12e0e195cc105833c008be338f1" +checksum = "cc7980f653f9a7db31acff916a262c3b78c562919263edea29bf41a056e20497" dependencies = [ "gif", "jpeg-decoder", @@ -2051,26 +2088,53 @@ dependencies = [ [[package]] name = "rgb" -version = "0.8.36" +version = "0.8.37" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "20ec2d3e3fc7a92ced357df9cebd5a10b6fb2aa1ee797bf7e9ce2f17dffc8f59" +checksum = "05aaa8004b64fd573fc9d002f4e632d51ad4f026c2b5ba95fcb6c2f32c2c47d8" dependencies = [ "bytemuck", ] [[package]] name = "ring" -version = "0.16.20" +version = "0.17.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3053cf52e236a3ed746dfc745aa9cacf1b791d846bdaf412f60a8d7d6e17c8fc" +checksum = "fb0205304757e5d899b9c2e448b867ffd03ae7f988002e47cd24954391394d0b" dependencies = [ "cc", + "getrandom", "libc", - "once_cell", - "spin 0.5.2", + "spin", "untrusted", - "web-sys", - "winapi", + "windows-sys", +] + +[[package]] +name = "rkyv" +version = "0.7.42" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0200c8230b013893c0b2d6213d6ec64ed2b9be2e0e016682b7224ff82cff5c58" +dependencies = [ + "bitvec", + "bytecheck", + "hashbrown 0.12.3", + "ptr_meta", + "rend", + "rkyv_derive", + "seahash", + "tinyvec", + "uuid", +] + +[[package]] +name = "rkyv_derive" +version = "0.7.42" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2e06b915b5c230a17d7a736d1e2e63ee753c256a8614ef3f5147b13a4f5541d" +dependencies = [ + "proc-macro2", + "quote", + "syn 1.0.109", ] [[package]] @@ -2081,9 +2145,9 @@ checksum = "b833d8d034ea094b1ea68aa6d5c740e0d04bad9d16568d08ba6f76823a114316" [[package]] name = "roxmltree" -version = "0.18.0" +version = "0.18.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d8f595a457b6b8c6cda66a48503e92ee8d19342f905948f29c383200ec9eb1d8" +checksum = "862340e351ce1b271a378ec53f304a5558f7db87f3769dc655a8f6ecbb68b302" dependencies = [ "xmlparser", ] @@ -2105,11 +2169,11 @@ dependencies = [ [[package]] name = "rustix" -version = "0.38.13" +version = "0.38.21" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d7db8590df6dfcd144d22afd1b83b36c21a18d7cbc1dc4bb5295a8712e9eb662" +checksum = "2b426b0506e5d50a7d8dafcf2e81471400deb602392c7dd110815afb4eaf02a3" dependencies = [ - "bitflags 2.4.0", + "bitflags 2.4.1", "errno", "libc", "linux-raw-sys", @@ -2118,13 +2182,13 @@ dependencies = [ [[package]] name = "rustls" -version = "0.21.7" +version = "0.21.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cd8d6c9f025a446bc4d18ad9632e69aec8f287aa84499ee335599fabd20c3fd8" +checksum = "446e14c5cda4f3f30fe71863c34ec70f5ac79d6087097ad0bb433e1be5edf04c" dependencies = [ "log", "ring", - "rustls-webpki 0.101.5", + "rustls-webpki", "sct", ] @@ -2139,19 +2203,9 @@ dependencies = [ [[package]] name = "rustls-webpki" -version = "0.100.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5f6a5fc258f1c1276dfe3016516945546e2d5383911efc0fc4f1cdc5df3a4ae3" -dependencies = [ - "ring", - "untrusted", -] - -[[package]] -name = "rustls-webpki" -version = "0.101.5" +version = "0.101.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "45a27e3b59326c16e23d30aeb7a36a24cc0d29e71d68ff611cdfb4a01d013bed" +checksum = "8b6275d1ee7a1cd780b64aca7726599a1dbc893b1e64144529e55c3c2f745765" dependencies = [ "ring", "untrusted", @@ -2165,17 +2219,17 @@ checksum = "7ffc183a10b4478d04cbbbfc96d0873219d962dd5accaff2ffbd4ceb7df837f4" [[package]] name = "rustybuzz" -version = "0.7.0" +version = "0.10.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "162bdf42e261bee271b3957691018634488084ef577dddeb6420a9684cab2a6a" +checksum = "71cd15fef9112a1f94ac64b58d1e4628192631ad6af4dc69997f995459c874e7" dependencies = [ "bitflags 1.3.2", "bytemuck", "smallvec", - "ttf-parser 0.18.1", + "ttf-parser", "unicode-bidi-mirroring", "unicode-ccc", - "unicode-general-category", + "unicode-properties", "unicode-script", ] @@ -2208,15 +2262,21 @@ checksum = "94143f37725109f92c262ed2cf5e59bce7498c01bcc1502d7b9afe439a4e9f49" [[package]] name = "sct" -version = "0.7.0" +version = "0.7.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d53dcdb7c9f8158937a7981b48accfd39a43af418591a5d008c7b22b5e1b7ca4" +checksum = "da046153aa2352493d6cb7da4b6e5c0c057d8a1d0a9aa8560baffdd945acd414" dependencies = [ "ring", "untrusted", ] [[package]] +name = "seahash" +version = "4.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1c107b6f4780854c8b126e228ea8869f4d7b71260f962fefb57b996b8959ba6b" + +[[package]] name = "self-replace" version = "1.3.5" source = "git+https://github.com/typst/self-replace#2e6d5e4808bba73b713fd85cf5616b7d846143c2" @@ -2228,35 +2288,35 @@ dependencies = [ [[package]] name = "semver" -version = "1.0.18" +version = "1.0.20" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b0293b4b29daaf487284529cc2f5675b8e57c61f70167ba415a463651fd6a918" +checksum = "836fa6a3e1e547f9a2c4040802ec865b5d85f4014efe00555d7090a3dcaa1090" [[package]] name = "serde" -version = "1.0.188" +version = "1.0.190" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cf9e0fcba69a370eed61bcf2b728575f726b50b55cba78064753d708ddc7549e" +checksum = "91d3c334ca1ee894a2c6f6ad698fe8c435b76d504b13d436f0685d648d6d96f7" dependencies = [ "serde_derive", ] [[package]] name = "serde_derive" -version = "1.0.188" +version = "1.0.190" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4eca7ac642d82aa35b60049a6eccb4be6be75e599bd2e9adb5f875a737654af2" +checksum = "67c5609f394e5c2bd7fc51efda478004ea80ef42fee983d5c67a65e34f32c0e3" dependencies = [ "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", ] [[package]] name = "serde_json" -version = "1.0.106" +version = "1.0.108" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2cc66a619ed80bf7a0f6b17dd063a84b88f6dea1813737cf469aef1d081142c2" +checksum = "3d1c7e3eac408d115102c4c24ad393e0821bb3a5df4d506a80f85f7a742a526b" dependencies = [ "itoa", "ryu", @@ -2265,9 +2325,9 @@ dependencies = [ [[package]] name = "serde_spanned" -version = "0.6.3" +version = "0.6.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "96426c9936fd7a0124915f9185ea1d20aa9445cc9821142f0a73bc9207a2e186" +checksum = "12022b835073e5b11e90a14f86838ceb1c8fb0325b72416845c487ac0fa95e80" dependencies = [ "serde", ] @@ -2286,11 +2346,11 @@ dependencies = [ [[package]] name = "serde_yaml" -version = "0.9.25" +version = "0.9.27" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1a49e178e4452f45cb61d0cd8cebc1b0fafd3e41929e996cef79aa3aca91f574" +checksum = "3cc7a1570e38322cfe4154732e5110f887ea57e22b76f4bfd32b5bdd3368666c" dependencies = [ - "indexmap 2.0.0", + "indexmap 2.0.2", "itoa", "ryu", "serde", @@ -2299,9 +2359,9 @@ dependencies = [ [[package]] name = "sha1" -version = "0.10.5" +version = "0.10.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f04293dc80c3993519f2d7f6f511707ee7094fe0c6d3406feb330cdb3540eba3" +checksum = "e3bf829a2d51ab4a5ddf1352d8470c140cadc8301b2ae1789db023f01cedd6ba" dependencies = [ "cfg-if", "cpufeatures", @@ -2310,9 +2370,9 @@ dependencies = [ [[package]] name = "sha2" -version = "0.10.7" +version = "0.10.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "479fb9d862239e610720565ca91403019f2f00410f1864c5aa7479b950a76ed8" +checksum = "793db75ad2bcafc3ffa7c68b215fee268f537982cd901d132f89c6343f3a3dc8" dependencies = [ "cfg-if", "cpufeatures", @@ -2321,9 +2381,9 @@ dependencies = [ [[package]] name = "sharded-slab" -version = "0.1.4" +version = "0.1.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "900fba806f70c630b0a382d0d825e17a0f19fcd059a2ade1ff237bcddf446b31" +checksum = "f40ca3c46823713e0d4209592e8d6e826aa57e928f09752619fc696c499637f6" dependencies = [ "lazy_static", ] @@ -2335,6 +2395,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d66dc143e6b11c1eddc06d5c423cfc97062865baf299914ab64caa38182078fe" [[package]] +name = "simdutf8" +version = "0.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f27f6278552951f1f2b8cf9da965d10969b2efdea95a6ec47987ab46edfe263a" + +[[package]] name = "simplecss" version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -2360,24 +2426,15 @@ dependencies = [ [[package]] name = "smallvec" -version = "1.11.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "62bb4feee49fdd9f707ef802e22365a35de4b7b299de4763d44bfea899442ff9" - -[[package]] -name = "spin" -version = "0.5.2" +version = "1.11.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6e63cff320ae2c57904679ba7cb63280a3dc4613885beafb148ee7bf9aa9042d" +checksum = "942b4a808e05215192e39f4ab80813e599068285906cc91aa64f923db842bd5a" [[package]] name = "spin" version = "0.9.8" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "6980e8d7511241f8acf4aebddbb1ff938df5eebe98691418c4468d0b72a96a67" -dependencies = [ - "lock_api", -] [[package]] name = "stable_deref_trait" @@ -2455,9 +2512,9 @@ checksum = "81cdd64d312baedb58e21336b31bc043b77e01cc99033ce76ef539f78e965ebc" [[package]] name = "svg2pdf" -version = "0.7.0" +version = "0.9.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0c267ce43e1b46631a121481ae2d7dc00dda163d486f0f600be772bbe24d6037" +checksum = "363c5346967da04bf3ebb3d8bafa7f52c53c810167047904df1960eac3fc08b7" dependencies = [ "image", "miniz_oxide", @@ -2467,9 +2524,9 @@ dependencies = [ [[package]] name = "svgtypes" -version = "0.11.0" +version = "0.12.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ed4b0611e7f3277f68c0fa18e385d9e2d26923691379690039548f867cef02a7" +checksum = "d71499ff2d42f59d26edb21369a308ede691421f79ebc0f001e2b1fd3a7c9e52" dependencies = [ "kurbo", "siphasher", @@ -2488,9 +2545,9 @@ dependencies = [ [[package]] name = "syn" -version = "2.0.32" +version = "2.0.38" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "239814284fd6f1a4ffe4ca893952cdd93c224b6a1571c9a9eadd670295c0c9e2" +checksum = "e96b79aaa137db8f61e26363a0c9b47d8b4ec75da28b7d1d614c2303e232408b" dependencies = [ "proc-macro2", "quote", @@ -2499,13 +2556,13 @@ dependencies = [ [[package]] name = "synstructure" -version = "0.12.6" +version = "0.13.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f36bdaa60a83aca3921b5259d5400cbf5e90fc51931376a9bd4a0eb79aa7210f" +checksum = "285ba80e733fac80aa4270fbcdf83772a79b80aa35c97075320abfee4a915b06" dependencies = [ "proc-macro2", "quote", - "syn 1.0.109", + "syn 2.0.38", "unicode-xid", ] @@ -2522,7 +2579,7 @@ dependencies = [ "fnv", "once_cell", "plist", - "regex-syntax", + "regex-syntax 0.7.5", "serde", "serde_json", "thiserror", @@ -2549,44 +2606,44 @@ dependencies = [ [[package]] name = "tempfile" -version = "3.8.0" +version = "3.8.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cb94d2f3cc536af71caac6b6fcebf65860b347e7ce0cc9ebe8f70d3e521054ef" +checksum = "7ef1adac450ad7f4b3c28589471ade84f25f731a7a0fe30d71dfa9f60fd808e5" dependencies = [ "cfg-if", - "fastrand 2.0.0", - "redox_syscall 0.3.5", + "fastrand 2.0.1", + "redox_syscall 0.4.1", "rustix", "windows-sys", ] [[package]] name = "termcolor" -version = "1.2.0" +version = "1.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "be55cf8942feac5c765c2c993422806843c9a9a45d4d5c407ad6dd2ea95eb9b6" +checksum = "6093bad37da69aab9d123a8091e4be0aa4a03e4d601ec641c327398315f62b64" dependencies = [ "winapi-util", ] [[package]] name = "thiserror" -version = "1.0.48" +version = "1.0.50" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9d6d7a740b8a666a7e828dd00da9c0dc290dff53154ea77ac109281de90589b7" +checksum = "f9a7210f5c9a7156bb50aa36aed4c95afb51df0df00713949448cf9e97d382d2" dependencies = [ "thiserror-impl", ] [[package]] name = "thiserror-impl" -version = "1.0.48" +version = "1.0.50" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "49922ecae66cc8a249b77e68d1d0623c1b2c514f0060c27cdc68bd62a1219d35" +checksum = "266b2e40bc00e5a6c09c3584011e08b06f123c00362c92b975ba9843aaaa14b8" dependencies = [ "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", ] [[package]] @@ -2600,24 +2657,14 @@ dependencies = [ ] [[package]] -name = "tiff" -version = "0.9.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6d172b0f4d3fba17ba89811858b9d3d97f928aece846475bbda076ca46736211" -dependencies = [ - "flate2", - "jpeg-decoder", - "weezl", -] - -[[package]] name = "time" -version = "0.3.28" +version = "0.3.30" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "17f6bb557fd245c28e6411aa56b6403c689ad95061f50e4be16c274e70a17e48" +checksum = "c4a34ab300f2dee6e562c10a046fc05e358b29f9bf92277f30c3c8d82275f6f5" dependencies = [ "deranged", "itoa", + "powerfmt", "serde", "time-core", "time-macros", @@ -2625,24 +2672,24 @@ dependencies = [ [[package]] name = "time-core" -version = "0.1.1" +version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7300fbefb4dadc1af235a9cef3737cea692a9d97e1b9cbcd4ebdae6f8868e6fb" +checksum = "ef927ca75afb808a4d64dd374f00a2adf8d0fcff8e7b184af886c3c87ec4a3f3" [[package]] name = "time-macros" -version = "0.2.14" +version = "0.2.15" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1a942f44339478ef67935ab2bbaec2fb0322496cf3cbe84b261e06ac3814c572" +checksum = "4ad70d68dba9e1f8aceda7aa6711965dfec1cac869f311a51bd08b3a2ccbce20" dependencies = [ "time-core", ] [[package]] name = "tiny-skia" -version = "0.10.0" +version = "0.11.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7db11798945fa5c3e5490c794ccca7c6de86d3afdd54b4eb324109939c6f37bc" +checksum = "3b72a92a05db376db09fe6d50b7948d106011761c05a6a45e23e17ee9b556222" dependencies = [ "arrayref", "arrayvec", @@ -2655,9 +2702,9 @@ dependencies = [ [[package]] name = "tiny-skia-path" -version = "0.10.0" +version = "0.11.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2f60aa35c89ac2687ace1a2556eaaea68e8c0d47408a2e3e7f5c98a489e7281c" +checksum = "6ac3865b9708fc7e1961a65c3a4fa55e984272f33092d3c859929f887fceb647" dependencies = [ "arrayref", "bytemuck", @@ -2666,9 +2713,9 @@ dependencies = [ [[package]] name = "tinystr" -version = "0.7.1" +version = "0.7.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7ac3f5b6856e931e15e07b478e98c8045239829a65f9156d4fa7e7788197a5ef" +checksum = "d5d0e245e80bdc9b4e5356fc45a72184abbc3861992603f515270e9340f5a219" dependencies = [ "displaydoc", "serde", @@ -2692,9 +2739,9 @@ checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20" [[package]] name = "toml" -version = "0.8.0" +version = "0.8.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c226a7bba6d859b63c92c4b4fe69c5b6b72d0cb897dbc8e6012298e6154cb56e" +checksum = "8ff9e3abce27ee2c9a37f9ad37238c1bdd4e789c84ba37df76aa4d528f5072cc" dependencies = [ "serde", "serde_spanned", @@ -2704,20 +2751,20 @@ dependencies = [ [[package]] name = "toml_datetime" -version = "0.6.3" +version = "0.6.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7cda73e2f1397b1262d6dfdcef8aafae14d1de7748d66822d3bfeeb6d03e5e4b" +checksum = "3550f4e9685620ac18a50ed434eb3aec30db8ba93b0287467bca5826ea25baf1" dependencies = [ "serde", ] [[package]] name = "toml_edit" -version = "0.20.0" +version = "0.20.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8ff63e60a958cefbb518ae1fd6566af80d9d4be430a33f3723dfc47d1d411d95" +checksum = "70f427fce4d84c72b5b732388bf4a9f4531b53f74e2887e3ecb2481f68f66d81" dependencies = [ - "indexmap 2.0.0", + "indexmap 2.0.2", "serde", "serde_spanned", "toml_datetime", @@ -2726,11 +2773,10 @@ dependencies = [ [[package]] name = "tracing" -version = "0.1.37" +version = "0.1.40" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8ce8c33a8d48bd45d624a6e523445fd21ec13d3653cd51f681abf67418f54eb8" +checksum = "c3523ab5a71916ccf420eebdf5521fcef02141234bbc0b8a49f2fdc4544364ef" dependencies = [ - "cfg-if", "pin-project-lite", "tracing-attributes", "tracing-core", @@ -2738,20 +2784,20 @@ dependencies = [ [[package]] name = "tracing-attributes" -version = "0.1.26" +version = "0.1.27" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5f4f31f56159e98206da9efd823404b79b6ef3143b4a7ab76e67b1751b25a4ab" +checksum = "34704c8d6ebcbc939824180af020566b01a7c01f80641264eba0999f6c2b6be7" dependencies = [ "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", ] [[package]] name = "tracing-core" -version = "0.1.31" +version = "0.1.32" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0955b8137a1df6f1a2e9a37d8a6656291ff0297c1a97c24e0d8425fe2312f79a" +checksum = "c06d3da6113f116aaee68e4d601191614c9053067f9ab7f6edbcb161237daa54" dependencies = [ "once_cell", "valuable", @@ -2780,12 +2826,12 @@ dependencies = [ [[package]] name = "tracing-log" -version = "0.1.3" +version = "0.1.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "78ddad33d2d10b1ed7eb9d1f518a5674713876e97e5bb9b7345a7984fbb4f922" +checksum = "f751112709b4e791d8ce53e32c4ed2d353565a795ce84da2285393f41557bdf2" dependencies = [ - "lazy_static", "log", + "once_cell", "tracing-core", ] @@ -2805,12 +2851,6 @@ dependencies = [ [[package]] name = "ttf-parser" -version = "0.18.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0609f771ad9c6155384897e1df4d948e692667cc0588548b68eb44d052b27633" - -[[package]] -name = "ttf-parser" version = "0.19.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "49d64318d8311fc2668e48b63969f4343e0a85c4a109aa8460d6672e364b8bd1" @@ -2823,28 +2863,28 @@ checksum = "6af6ae20167a9ece4bcb41af5b80f8a1f1df981f6391189ce00fd257af04126a" [[package]] name = "typenum" -version = "1.16.0" +version = "1.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "497961ef93d974e23eb6f433eb5fe1b7930b659f06d12dec6fc44a8f554c0bba" +checksum = "42ff0bf0c66b8238c6f3b578df37d0b7848e55df8577b3f74f92a69acceeb825" [[package]] name = "typst" -version = "0.8.0" +version = "0.9.0" dependencies = [ "base64", - "bitflags 2.4.0", + "bitflags 2.4.1", "bytemuck", "comemo", "ecow", "flate2", "fontdb", - "if_chain", "image", - "indexmap 2.0.0", + "indexmap 2.0.2", + "kurbo", "log", "miniz_oxide", - "oklab", "once_cell", + "palette", "pdf-writer", "pixglyph", "regex", @@ -2860,7 +2900,7 @@ dependencies = [ "tiny-skia", "toml", "tracing", - "ttf-parser 0.19.2", + "ttf-parser", "typst-macros", "typst-syntax", "unicode-ident", @@ -2877,7 +2917,7 @@ dependencies = [ [[package]] name = "typst-cli" -version = "0.8.0" +version = "0.9.0" dependencies = [ "chrono", "clap", @@ -2888,9 +2928,10 @@ dependencies = [ "dirs", "ecow", "env_proxy", + "filetime", "flate2", + "fontdb", "inferno", - "memmap2", "notify", "once_cell", "open", @@ -2902,7 +2943,7 @@ dependencies = [ "semver", "serde", "serde_json", - "serde_yaml 0.9.25", + "serde_yaml 0.9.27", "siphasher", "tar", "tempfile", @@ -2913,14 +2954,13 @@ dependencies = [ "typst", "typst-library", "ureq", - "walkdir", "xz2", "zip", ] [[package]] name = "typst-docs" -version = "0.8.0" +version = "0.9.0" dependencies = [ "comemo", "ecow", @@ -2929,7 +2969,7 @@ dependencies = [ "once_cell", "pulldown-cmark", "serde", - "serde_yaml 0.9.25", + "serde_yaml 0.9.27", "syntect", "typed-arena", "typst", @@ -2940,8 +2980,21 @@ dependencies = [ ] [[package]] +name = "typst-ide" +version = "0.9.0" +dependencies = [ + "comemo", + "ecow", + "if_chain", + "log", + "serde", + "typst", + "unscanny", +] + +[[package]] name = "typst-library" -version = "0.8.0" +version = "0.9.0" dependencies = [ "az", "chinese-number", @@ -2956,6 +3009,7 @@ dependencies = [ "icu_provider_adapters", "icu_provider_blob", "icu_segmenter", + "indexmap 2.0.2", "kurbo", "lipsum", "log", @@ -2963,13 +3017,13 @@ dependencies = [ "roxmltree", "rustybuzz", "serde_json", - "serde_yaml 0.9.25", + "serde_yaml 0.9.27", "smallvec", "syntect", "time", "toml", "tracing", - "ttf-parser 0.19.2", + "ttf-parser", "typed-arena", "typst", "unicode-bidi", @@ -2980,17 +3034,17 @@ dependencies = [ [[package]] name = "typst-macros" -version = "0.8.0" +version = "0.9.0" dependencies = [ "heck", "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", ] [[package]] name = "typst-syntax" -version = "0.8.0" +version = "0.9.0" dependencies = [ "comemo", "ecow", @@ -3005,7 +3059,7 @@ dependencies = [ [[package]] name = "typst-tests" -version = "0.8.0" +version = "0.9.0" dependencies = [ "clap", "comemo", @@ -3015,7 +3069,7 @@ dependencies = [ "oxipng", "rayon", "tiny-skia", - "ttf-parser 0.19.2", + "ttf-parser", "typst", "typst-library", "unscanny", @@ -3037,6 +3091,7 @@ version = "0.9.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e35bfd2f2b8796545b55d7d3fd3e89a0613f68a0d1c8bc28cb7ff96b411a35ff" dependencies = [ + "serde", "tinystr", ] @@ -3068,12 +3123,6 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "cc2520efa644f8268dce4dcd3050eaa7fc044fca03961e9998ac7e2e92b77cf1" [[package]] -name = "unicode-general-category" -version = "0.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2281c8c1d221438e373249e065ca4989c4c36952c211ff21a0ee91c44a3869e7" - -[[package]] name = "unicode-ident" version = "1.0.12" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -3120,9 +3169,9 @@ checksum = "b1d386ff53b415b7fe27b50bb44679e2cc4660272694b7b6f3326d8480823a94" [[package]] name = "unicode-width" -version = "0.1.10" +version = "0.1.11" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c0edd1e5b14653f783770bce4a4dabb4a5108a5370a5f5d8cfe8710c361f6c8b" +checksum = "e51733f11c9c4f72aa0c160008246859e340b00807569a0da0e7a1079b27ba85" [[package]] name = "unicode-xid" @@ -3150,22 +3199,22 @@ checksum = "e9df2af067a7953e9c3831320f35c1cc0600c30d44d9f7a12b01db1cd88d6b47" [[package]] name = "untrusted" -version = "0.7.1" +version = "0.9.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a156c684c91ea7d62626509bce3cb4e1d9ed5c4d978f7b4352658f96a4c26b4a" +checksum = "8ecb6da28b8a351d773b68d5825ac39017e680750f980f3a1a85cd8dd28a47c1" [[package]] name = "ureq" -version = "2.7.1" +version = "2.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0b11c96ac7ee530603dcdf68ed1557050f374ce55a5a07193ebf8cbc9f8927e9" +checksum = "f5ccd538d4a604753ebc2f17cd9946e89b77bf87f6a8e2309667c6f2e87855e3" dependencies = [ "base64", "flate2", "log", "once_cell", "rustls", - "rustls-webpki 0.100.3", + "rustls-webpki", "serde", "serde_json", "url", @@ -3181,13 +3230,14 @@ dependencies = [ "form_urlencoded", "idna", "percent-encoding", + "serde", ] [[package]] name = "usvg" -version = "0.35.0" +version = "0.36.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "14d09ddfb0d93bf84824c09336d32e42f80961a9d1680832eb24fdf249ce11e6" +checksum = "c51daa774fe9ee5efcf7b4fec13019b8119cda764d9a8b5b06df02bb1445c656" dependencies = [ "base64", "log", @@ -3200,9 +3250,9 @@ dependencies = [ [[package]] name = "usvg-parser" -version = "0.35.0" +version = "0.36.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d19bf93d230813599927d88557014e0908ecc3531666d47c634c6838bc8db408" +checksum = "45c88a5ffaa338f0e978ecf3d4e00d8f9f493e29bed0752e1a808a1db16afc40" dependencies = [ "data-url", "flate2", @@ -3218,9 +3268,9 @@ dependencies = [ [[package]] name = "usvg-text-layout" -version = "0.35.0" +version = "0.36.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "035044604e89652c0a2959b8b356946997a52649ba6cade45928c2842376feb4" +checksum = "4d2374378cb7a3fb8f33894e0fdb8625e1bbc4f25312db8d91f862130b541593" dependencies = [ "fontdb", "kurbo", @@ -3234,9 +3284,9 @@ dependencies = [ [[package]] name = "usvg-tree" -version = "0.35.0" +version = "0.36.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7939a7e4ed21cadb5d311d6339730681c3e24c3e81d60065be80e485d3fc8b92" +checksum = "6cacb0c5edeaf3e80e5afcf5b0d4004cc1d36318befc9a7c6606507e5d0f4062" dependencies = [ "rctree", "strict-num", @@ -3257,6 +3307,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "711b9620af191e0cdc7468a8d14e709c3dcdb115b36f838e601583af800a370a" [[package]] +name = "uuid" +version = "1.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "88ad59a7560b41a70d191093a945f0b87bc1deeda46fb237479708a1d6b6cdfc" + +[[package]] name = "valuable" version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -3305,7 +3361,7 @@ dependencies = [ "once_cell", "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", "wasm-bindgen-shared", ] @@ -3327,7 +3383,7 @@ checksum = "54681b18a46765f095758388f2d0cf16eb8d4169b639ab575a8f5693af210c7b" dependencies = [ "proc-macro2", "quote", - "syn 2.0.32", + "syn 2.0.38", "wasm-bindgen-backend", "wasm-bindgen-shared", ] @@ -3345,7 +3401,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "1f341edb80021141d4ae6468cbeefc50798716a347d4085c3811900049ea8945" dependencies = [ "smallvec", - "spin 0.9.8", + "spin", "wasmi_arena", "wasmi_core", "wasmparser-nostd", @@ -3379,23 +3435,10 @@ dependencies = [ ] [[package]] -name = "web-sys" -version = "0.3.64" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9b85cbef8c220a6abc02aefd892dfc0fc23afb1c6a426316ec33253a3877249b" -dependencies = [ - "js-sys", - "wasm-bindgen", -] - -[[package]] name = "webpki-roots" -version = "0.23.1" +version = "0.25.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b03058f88386e5ff5310d9111d53f48b17d732b401aeb83a8d5190f2ac459338" -dependencies = [ - "rustls-webpki 0.100.3", -] +checksum = "14247bb57be4f377dfb94c72830b8ce8fc6beac03cf4bf7b9732eadd414123fc" [[package]] name = "weezl" @@ -3421,9 +3464,9 @@ checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" [[package]] name = "winapi-util" -version = "0.1.5" +version = "0.1.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "70ec6ce85bb158151cae5e5c87f95a8e97d2c0c4b001223f33a334e3ce5de178" +checksum = "f29e6f9198ba0d26b4c9f07dbe6f9ed633e1f3d5b8b414090084349e46a52596" dependencies = [ "winapi", ] @@ -3435,10 +3478,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" [[package]] -name = "windows" -version = "0.48.0" +name = "windows-core" +version = "0.51.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e686886bc078bc1b0b600cac0147aadb815089b6e4da64016cbd754b6342700f" +checksum = "f1f8cf84f35d2db49a46868f947758c7a1138116f7fac3bc844f43ade1292e64" dependencies = [ "windows-targets", ] @@ -3511,18 +3554,18 @@ checksum = "ed94fce61571a4006852b7389a063ab983c02eb1bb37b47f8272ce92d06d9538" [[package]] name = "winnow" -version = "0.5.15" +version = "0.5.18" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7c2e3184b9c4e92ad5167ca73039d0c42476302ab603e2fec4487511f38ccefc" +checksum = "176b6138793677221d420fd2f0aeeced263f197688b36484660da767bca2fa32" dependencies = [ "memchr", ] [[package]] name = "writeable" -version = "0.5.2" +version = "0.5.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "60e49e42bdb1d5dc76f4cd78102f8f0714d32edfa3efb82286eb0f0b1fc0da0f" +checksum = "c0af0c3d13faebf8dda0b5256fa7096a2d5ccb662f7b9f54a40fe201077ab1c2" [[package]] name = "wyz" @@ -3544,9 +3587,9 @@ dependencies = [ [[package]] name = "xmlparser" -version = "0.13.5" +version = "0.13.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4d25c75bf9ea12c4040a97f829154768bbbce366287e2dc044af160cd79a13fd" +checksum = "66fee0b777b0f5ac1c69bb06d361268faafa61cd4682ae064a171c16c433e9e4" [[package]] name = "xmlwriter" @@ -3556,9 +3599,9 @@ checksum = "ec7a2a501ed189703dba8b08142f057e887dfc4b2cc4db2d343ac6376ba3e0b9" [[package]] name = "xmp-writer" -version = "0.1.0" +version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9fd742bbbb930fc972b28bf66b7546dfbc7bb9a4c7924299df0ae6a5641fcadf" +checksum = "4543ba138f64a94b19e1e9c66c165bca7e03d470e1c066cb76ea279d9d0e1989" [[package]] name = "xz2" @@ -3590,9 +3633,9 @@ dependencies = [ [[package]] name = "yoke" -version = "0.7.1" +version = "0.7.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1848075a23a28f9773498ee9a0f2cf58fcbad4f8c0ccf84a210ab33c6ae495de" +checksum = "61e38c508604d6bbbd292dadb3c02559aa7fff6b654a078a36217cad871636e4" dependencies = [ "serde", "stable_deref_trait", @@ -3602,42 +3645,62 @@ dependencies = [ [[package]] name = "yoke-derive" -version = "0.7.1" +version = "0.7.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "af46c169923ed7516eef0aa32b56d2651b229f57458ebe46b49ddd6efef5b7a2" +checksum = "d5e19fb6ed40002bab5403ffa37e53e0e56f914a4450c8765f533018db1db35f" dependencies = [ "proc-macro2", "quote", - "syn 1.0.109", + "syn 2.0.38", "synstructure", ] [[package]] +name = "zerocopy" +version = "0.7.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dd66a62464e3ffd4e37bd09950c2b9dd6c4f8767380fabba0d523f9a775bc85a" +dependencies = [ + "zerocopy-derive", +] + +[[package]] +name = "zerocopy-derive" +version = "0.7.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "255c4596d41e6916ced49cfafea18727b24d67878fa180ddfd69b9df34fd1726" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.38", +] + +[[package]] name = "zerofrom" -version = "0.1.2" +version = "0.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "df54d76c3251de27615dfcce21e636c172dafb2549cd7fd93e21c66f6ca6bea2" +checksum = "655b0814c5c0b19ade497851070c640773304939a6c0fd5f5fb43da0696d05b7" dependencies = [ "zerofrom-derive", ] [[package]] name = "zerofrom-derive" -version = "0.1.2" +version = "0.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b4eae7c1f7d4b8eafce526bc0771449ddc2f250881ae31c50d22c032b5a1c499" +checksum = "e6a647510471d372f2e6c2e6b7219e44d8c574d24fdc11c610a61455782f18c3" dependencies = [ "proc-macro2", "quote", - "syn 1.0.109", + "syn 2.0.38", "synstructure", ] [[package]] name = "zerovec" -version = "0.9.4" +version = "0.10.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "198f54134cd865f437820aa3b43d0ad518af4e68ee161b444cdd15d8e567c8ea" +checksum = "1194130c5b155bf8ae50ab16c86ab758cd695cf9ad176d2f870b744cbdbb572e" dependencies = [ "serde", "yoke", @@ -3647,14 +3710,13 @@ dependencies = [ [[package]] name = "zerovec-derive" -version = "0.9.4" +version = "0.10.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "486558732d5dde10d0f8cb2936507c1bb21bc539d924c949baf5f36a58e51bac" +checksum = "acabf549809064225ff8878baedc4ce3732ac3b07e7c7ce6e5c2ccdbc485c324" dependencies = [ "proc-macro2", "quote", - "syn 1.0.109", - "synstructure", + "syn 2.0.38", ] [[package]] @@ -3710,20 +3772,10 @@ dependencies = [ [[package]] name = "zstd-sys" -version = "2.0.8+zstd.1.5.5" +version = "2.0.9+zstd.1.5.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5556e6ee25d32df2586c098bbfa278803692a20d0ab9565e049480d52707ec8c" +checksum = "9e16efa8a874a0481a574084d34cc26fdb3b99627480f785888deb6386506656" dependencies = [ "cc", - "libc", "pkg-config", ] - -[[package]] -name = "zune-inflate" -version = "0.2.54" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "73ab332fe2f6680068f3582b16a24f90ad7096d5d39b974d1c0aff0125116f02" -dependencies = [ - "simd-adler32", -] diff --git a/pkgs/tools/typesetting/typst/default.nix b/pkgs/tools/typesetting/typst/default.nix index 1d9e95f5025ad..eeb25fa30bde6 100644 --- a/pkgs/tools/typesetting/typst/default.nix +++ b/pkgs/tools/typesetting/typst/default.nix @@ -8,13 +8,13 @@ rustPlatform.buildRustPackage rec { pname = "typst"; - version = "0.8.0"; + version = "0.9.0"; src = fetchFromGitHub { owner = "typst"; repo = "typst"; rev = "v${version}"; - hash = "sha256-q2b/PoNwpzarJbIPzokYgZRD2/Oe/XB40C4VXdwL/NA="; + hash = "sha256-LwRB/AQE8TZZyHEQ7kKB10itzEgYjg4R/k+YFqmutDc="; }; cargoLock = { diff --git a/pkgs/tools/video/lux/default.nix b/pkgs/tools/video/lux/default.nix index 79b3eec9e5bec..f6a4ea61f2dcc 100644 --- a/pkgs/tools/video/lux/default.nix +++ b/pkgs/tools/video/lux/default.nix @@ -1,33 +1,43 @@ -{ lib, buildGoModule, fetchFromGitHub, makeWrapper, ffmpeg }: +{ lib +, buildGoModule +, fetchFromGitHub +, makeWrapper +, ffmpeg +}: buildGoModule rec { pname = "lux"; - version = "0.19.0"; + version = "0.21.0"; + src = fetchFromGitHub { owner = "iawia002"; repo = "lux"; rev = "v${version}"; - sha256 = "sha256-klm1985qBErFfYIWPjr1/n6nYr/jA9dbrDMfw4bf1tM="; + hash = "sha256-LCYWfF7O8wByCJNDi2BZsI7EU6wJqhcr/sbNOoQ2Src="; }; nativeBuildInputs = [ makeWrapper ]; - vendorHash = "sha256-7wgGJYiIsVTRSuSb4a9LgYCkkayGhNMKqcIKoDxMuAM="; + vendorHash = "sha256-wW/jrsurmyLcDX+58lp0M+snJ2avEs0HciNZ8BgIqrI="; - ldflags = [ "-s" "-w" ]; + ldflags = [ + "-s" + "-w" + "-X github.com/iawia002/lux/app.version=v${version}" + ]; postInstall = '' wrapProgram $out/bin/lux \ --prefix PATH : ${lib.makeBinPath [ ffmpeg ]} ''; - doCheck = false; + doCheck = false; # require network meta = with lib; { description = "Fast and simple video download library and CLI tool written in Go"; homepage = "https://github.com/iawia002/lux"; changelog = "https://github.com/iawia002/lux/releases/tag/v${version}"; license = licenses.mit; - maintainers = []; + maintainers = with maintainers; [ galaxy ]; }; } diff --git a/pkgs/tools/wayland/wayland-proxy-virtwl/default.nix b/pkgs/tools/wayland/wayland-proxy-virtwl/default.nix index 25123ec9b2443..4e829d1e0b66a 100644 --- a/pkgs/tools/wayland/wayland-proxy-virtwl/default.nix +++ b/pkgs/tools/wayland/wayland-proxy-virtwl/default.nix @@ -8,17 +8,16 @@ ocamlPackages.buildDunePackage rec { pname = "wayland-proxy-virtwl"; - version = "unstable-2023-08-13"; + version = "unstable-2023-10-27"; src = fetchFromGitHub { owner = "talex5"; repo = pname; - rev = "050c49a377808105b895e81e7e498f35cc151e58"; - sha256 = "sha256-6YJv3CCED6LUSPFwYQyHUFkkvOWZGPNHVzw60b5F8+c="; + rev = "cc9548c4980ff33f86d5645ce337a79bf95d6139"; + sha256 = "sha256-aAqbPslTu+RLQPKPJQH2iYjcI8/De2WPk5nHULdfocU="; }; - minimalOCamlVersion = "4.12"; - duneVersion = "3"; + minimalOCamlVersion = "5.0"; nativeBuildInputs = [ pkg-config @@ -26,11 +25,11 @@ ocamlPackages.buildDunePackage rec { buildInputs = [ libdrm ] ++ (with ocamlPackages; [ dune-configurator + eio_main ppx_cstruct wayland cmdliner logs - cstruct-lwt ppx_cstruct ]); diff --git a/pkgs/tools/wayland/wl-mirror/default.nix b/pkgs/tools/wayland/wl-mirror/default.nix index 0746dd5ff09b3..eaaec0f0bb29d 100644 --- a/pkgs/tools/wayland/wl-mirror/default.nix +++ b/pkgs/tools/wayland/wl-mirror/default.nix @@ -28,13 +28,13 @@ in stdenv.mkDerivation rec { pname = "wl-mirror"; - version = "0.13.2"; + version = "0.14.2"; src = fetchFromGitHub { owner = "Ferdi265"; repo = "wl-mirror"; rev = "v${version}"; - hash = "sha256-dmdRe4GZ1W2gD7ZF1MudBqfZIm9HyBjISa+xB54BLz4="; + hash = "sha256-dEkTRpeJhqUGDCqTLVsFoDXgHvfEqMYt/9DEldjqv0Y="; }; strictDeps = true; diff --git a/pkgs/top-level/aliases.nix b/pkgs/top-level/aliases.nix index 5dc11a345a6dd..85ac74fae7dbd 100644 --- a/pkgs/top-level/aliases.nix +++ b/pkgs/top-level/aliases.nix @@ -134,6 +134,8 @@ mapAliases ({ chefdk = throw "chefdk has been removed due to being deprecated upstream by Chef Workstation"; # Added 2023-03-22 chocolateDoom = chocolate-doom; # Added 2023-05-01 chrome-gnome-shell = gnome-browser-connector; # Added 2022-07-27 + chromiumBeta = throw "'chromiumBeta' has been removed due to the lack of maintenance in nixpkgs. Consider using 'chromium' instead."; # Added 2023-10-18 + chromiumDev = throw "'chromiumDev' has been removed due to the lack of maintenance in nixpkgs. Consider using 'chromium' instead."; # Added 2023-10-18 citra = citra-nightly; # added 2022-05-17 clang-ocl = throw "'clang-ocl' has been replaced with 'rocmPackages.clang-ocl'"; # Added 2023-10-08 inherit (libsForQt5.mauiPackages) clip; # added 2022-05-17 @@ -317,6 +319,8 @@ mapAliases ({ godot-headless = throw "godot-headless has been renamed to godot3-headless to distinguish from version 4"; # Added 2023-07-16 godot-server = throw "godot-server has been renamed to godot3-server to distinguish from version 4"; # Added 2023-07-16 + google-chrome-beta = throw "'google-chrome-beta' has been removed due to the lack of maintenance in nixpkgs. Consider using 'google-chrome' instead."; # Added 2023-10-18 + google-chrome-dev = throw "'google-chrome-dev' has been removed due to the lack of maintenance in nixpkgs. Consider using 'google-chrome' instead."; # Added 2023-10-18 google-gflags = throw "'google-gflags' has been renamed to/replaced by 'gflags'"; # Converted to throw 2023-09-10 go-thumbnailer = thud; # Added 2023-09-21 gometer = throw "gometer has been removed from nixpkgs because goLance stopped offering Linux support"; # Added 2023-02-10 @@ -328,6 +332,9 @@ mapAliases ({ gradle_5 = throw "gradle_5 has been removed because it's no longer being updated"; # Added 2023-01-17 gr-ais = throw "'gr-ais' has been renamed to/replaced by 'gnuradio3_7.pkgs.ais'"; # Converted to throw 2023-09-10 graylog = throw "graylog is now available in versions 3.3 up to 5.0. Please mind the upgrade path and choose the appropriate version. Direct upgrading from 3.3 to 4.3 or above is not supported"; # Added 2023-04-24 + graylog-3_3 = throw "graylog 3.x is EOL. Please consider downgrading nixpkgs if you need an upgrade from 3.x to latest series."; # Added 2023-10-09 + graylog-4_0 = throw "graylog 4.x is EOL. Please consider downgrading nixpkgs if you need an upgrade from 4.x to latest series."; # Added 2023-10-09 + graylog-4_3 = throw "graylog 4.x is EOL. Please consider downgrading nixpkgs if you need an upgrade from 4.x to latest series."; # Added 2023-10-09 gr-gsm = throw "'gr-gsm' has been renamed to/replaced by 'gnuradio3_7.pkgs.gsm'"; # Converted to throw 2023-09-10 gringo = clingo; # added 2022-11-27 gr-limesdr = throw "'gr-limesdr' has been renamed to/replaced by 'gnuradio3_7.pkgs.limesdr'"; # Converted to throw 2023-09-10 @@ -336,6 +343,7 @@ mapAliases ({ gr-rds = throw "'gr-rds' has been renamed to/replaced by 'gnuradio3_7.pkgs.rds'"; # Converted to throw 2023-09-10 grub2_full = grub2; # Added 2022-11-18 grub = throw "grub1 was removed after not being maintained upstream for a decade. Please switch to another bootloader"; # Added 2023-04-11 + guile-disarchive = disarchive; # Added 2023-10-27 guile-lint = throw "'guile-lint' has been removed, please use 'guild lint' instead"; # Added 2023-10-16 ### H ### @@ -485,6 +493,7 @@ mapAliases ({ linuxPackages_6_3 = linuxKernel.packages.linux_6_3; linuxPackages_6_4 = linuxKernel.packages.linux_6_4; linuxPackages_6_5 = linuxKernel.packages.linux_6_5; + linuxPackages_6_6 = linuxKernel.packages.linux_6_6; linuxPackages_rpi0 = linuxKernel.packages.linux_rpi1; linuxPackages_rpi02w = linuxKernel.packages.linux_rpi3; linuxPackages_rpi1 = linuxKernel.packages.linux_rpi1; @@ -509,6 +518,7 @@ mapAliases ({ linux_6_3 = linuxKernel.kernels.linux_6_3; linux_6_4 = linuxKernel.kernels.linux_6_4; linux_6_5 = linuxKernel.kernels.linux_6_5; + linux_6_6 = linuxKernel.kernels.linux_6_6; linux_rpi0 = linuxKernel.kernels.linux_rpi1; linux_rpi02w = linuxKernel.kernels.linux_rpi3; linux_rpi1 = linuxKernel.kernels.linux_rpi1; diff --git a/pkgs/top-level/all-packages.nix b/pkgs/top-level/all-packages.nix index 901cb04deded9..77aaee8aa696e 100644 --- a/pkgs/top-level/all-packages.nix +++ b/pkgs/top-level/all-packages.nix @@ -285,7 +285,7 @@ with pkgs; _0x = callPackage ../tools/misc/0x { }; atuin = callPackage ../tools/misc/atuin { - inherit (darwin.apple_sdk.frameworks) Security SystemConfiguration; + inherit (darwin.apple_sdk.frameworks) AppKit Security SystemConfiguration; }; automatic-timezoned = callPackage ../tools/system/automatic-timezoned { }; @@ -364,6 +364,8 @@ with pkgs; blst = callPackage ../development/libraries/blst { }; + bloom = qt6Packages.callPackage ../development/tools/bloom { }; + bloodhound-py = callPackage ../tools/security/bloodhound-py { }; bodyclose = callPackage ../development/tools/bodyclose { }; @@ -1082,7 +1084,7 @@ with pkgs; mya = callPackage ../applications/misc/mya { }; mysql-shell = callPackage ../development/tools/mysql-shell { - inherit (darwin) cctools developer_cmds DarwinTools; + inherit (darwin) cctools DarwinTools; inherit (darwin.apple_sdk.frameworks) CoreServices; antlr = antlr4_10; boost = boost177; # Configure checks for specific version. @@ -1091,7 +1093,7 @@ with pkgs; }; mysql-shell-innovation = callPackage ../development/tools/mysql-shell/innovation.nix { - inherit (darwin) cctools developer_cmds DarwinTools; + inherit (darwin) cctools DarwinTools; inherit (darwin.apple_sdk.frameworks) CoreServices; antlr = antlr4_10; boost = boost177; # Configure checks for specific version. @@ -1588,8 +1590,8 @@ with pkgs; }; honggfuzz = callPackage ../tools/security/honggfuzz { - clang = clang_12; - llvm = llvm_12; + clang = clang_16; + llvm = llvm_16; }; aflplusplus = callPackage ../tools/security/aflplusplus { @@ -3989,7 +3991,9 @@ with pkgs; lesspass-cli = callPackage ../tools/security/lesspass-cli { }; - livebook = callPackage ../servers/web-apps/livebook { }; + livebook = callPackage ../servers/web-apps/livebook { + elixir = elixir_1_15; + }; lsix = callPackage ../tools/graphics/lsix { }; @@ -4796,7 +4800,9 @@ with pkgs; wayland-utils = callPackage ../tools/wayland/wayland-utils { }; - wayland-proxy-virtwl = callPackage ../tools/wayland/wayland-proxy-virtwl { }; + wayland-proxy-virtwl = callPackage ../tools/wayland/wayland-proxy-virtwl { + ocamlPackages = ocaml-ng.ocamlPackages_5_0; + }; waylogout = callPackage ../tools/wayland/waylogout { }; @@ -7786,7 +7792,7 @@ with pkgs; schildichat-desktop = callPackage ../applications/networking/instant-messengers/schildichat/schildichat-desktop.nix { inherit (darwin.apple_sdk.frameworks) Security AppKit CoreServices; - electron = electron_24; + electron = electron_25; }; schildichat-desktop-wayland = writeScriptBin "schildichat-desktop" '' #!/bin/sh @@ -8847,12 +8853,6 @@ with pkgs; grails = callPackage ../development/web/grails { jdk = null; }; - graylog-3_3 = callPackage ../tools/misc/graylog/3.3.nix { }; - - graylog-4_0 = callPackage ../tools/misc/graylog/4.0.nix { }; - - graylog-4_3 = callPackage ../tools/misc/graylog/4.3.nix { }; - graylog-5_0 = callPackage ../tools/misc/graylog/5.0.nix { }; graylog-5_1 = callPackage ../tools/misc/graylog/5.1.nix { }; @@ -12393,8 +12393,6 @@ with pkgs; pypass = with python3Packages; toPythonApplication pypass; - pyspread = libsForQt5.callPackage ../applications/office/pyspread { }; - teapot = callPackage ../applications/office/teapot { }; ticktick = callPackage ../applications/office/ticktick { }; @@ -13245,7 +13243,7 @@ with pkgs; sixpair = callPackage ../tools/misc/sixpair { }; sketchybar = darwin.apple_sdk_11_0.callPackage ../os-specific/darwin/sketchybar { - inherit (darwin.apple_sdk_11_0.frameworks) AppKit CoreAudio CoreWLAN CoreVideo DisplayServices IOKit MediaRemote SkyLight; + inherit (darwin.apple_sdk_11_0.frameworks) AppKit Carbon CoreAudio CoreWLAN CoreVideo DisplayServices IOKit MediaRemote SkyLight; }; sketchybar-app-font = callPackage ../data/fonts/sketchybar-app-font { }; @@ -15459,6 +15457,9 @@ with pkgs; ### DEVELOPMENT / COMPILERS + temurin-bin-21 = javaPackages.compiler.temurin-bin.jdk-21; + temurin-jre-bin-21 = javaPackages.compiler.temurin-bin.jre-21; + temurin-bin-20 = javaPackages.compiler.temurin-bin.jdk-20; temurin-jre-bin-20 = javaPackages.compiler.temurin-bin.jre-20; @@ -17765,6 +17766,11 @@ with pkgs; luarocks = luaPackages.luarocks; luarocks-nix = luaPackages.luarocks-nix; + luarocks-packages-updater = callPackage ../development/lua-modules/updater { + inherit (python3Packages) buildPythonApplication ; + }; + + luau = callPackage ../development/interpreters/luau { }; lune = callPackage ../development/interpreters/lune { }; @@ -19650,7 +19656,11 @@ with pkgs; mermerd = callPackage ../development/tools/database/mermerd { }; - python-matter-server = with python3Packages; toPythonApplication python-matter-server; + python-matter-server = with python3Packages; toPythonApplication ( + python-matter-server.overridePythonAttrs (oldAttrs: { + propagatedBuildInputs = oldAttrs.propagatedBuildInputs ++ oldAttrs.passthru.optional-dependencies.server; + }) + ); minify = callPackage ../development/web/minify { }; @@ -20939,7 +20949,11 @@ with pkgs; cpp-jwt = callPackage ../development/libraries/cpp-jwt { }; - ctranslate2 = callPackage ../development/libraries/ctranslate2 { }; + ctranslate2 = callPackage ../development/libraries/ctranslate2 { + stdenv = if pkgs.config.cudaSupport then gcc11Stdenv else stdenv; + withCUDA = pkgs.config.cudaSupport; + withCuDNN = pkgs.config.cudaSupport; + }; ubus = callPackage ../development/libraries/ubus { }; @@ -22248,8 +22262,6 @@ with pkgs; jarowinkler-cpp = callPackage ../development/libraries/jarowinkler-cpp { }; - jasper = callPackage ../development/libraries/jasper { }; - jbig2dec = callPackage ../development/libraries/jbig2dec { }; jbig2enc = callPackage ../development/libraries/jbig2enc { }; @@ -24335,10 +24347,6 @@ with pkgs; ffmpeg = ffmpeg_4; }; - opencv3WithoutCuda = opencv3.override { - enableCuda = false; - }; - opencv4 = callPackage ../development/libraries/opencv/4.x.nix { inherit (darwin.apple_sdk.frameworks) AVFoundation Cocoa VideoDecodeAcceleration CoreMedia MediaToolbox Accelerate; @@ -24346,6 +24354,10 @@ with pkgs; ffmpeg = ffmpeg_4; }; + opencv4WithoutCuda = opencv4.override { + enableCuda = false; + }; + opencv = opencv4; imath = callPackage ../development/libraries/imath { }; @@ -26335,6 +26347,7 @@ with pkgs; engelsystem = callPackage ../servers/web-apps/engelsystem { php = php81; }; envoy = callPackage ../servers/http/envoy { + go = go_1_20; jdk = openjdk11_headless; gn = gn1924; }; @@ -27069,14 +27082,12 @@ with pkgs; timescaledb-tune = callPackage ../development/tools/database/timescaledb-tune { }; inherit (import ../servers/sql/postgresql pkgs) - postgresql_11 postgresql_12 postgresql_13 postgresql_14 postgresql_15 postgresql_16 - postgresql_11_jit postgresql_12_jit postgresql_13_jit postgresql_14_jit @@ -27087,12 +27098,10 @@ with pkgs; postgresql_jit = postgresql_15_jit.override { this = postgresql_jit; }; postgresqlPackages = recurseIntoAttrs postgresql.pkgs; postgresqlJitPackages = recurseIntoAttrs postgresql_jit.pkgs; - postgresql11Packages = recurseIntoAttrs postgresql_11.pkgs; postgresql12Packages = recurseIntoAttrs postgresql_12.pkgs; postgresql13Packages = recurseIntoAttrs postgresql_13.pkgs; postgresql14Packages = recurseIntoAttrs postgresql_14.pkgs; postgresql16Packages = recurseIntoAttrs postgresql_16.pkgs; - postgresql11JitPackages = recurseIntoAttrs postgresql_11_jit.pkgs; postgresql12JitPackages = recurseIntoAttrs postgresql_12_jit.pkgs; postgresql13JitPackages = recurseIntoAttrs postgresql_13_jit.pkgs; postgresql14JitPackages = recurseIntoAttrs postgresql_14_jit.pkgs; @@ -30317,8 +30326,6 @@ with pkgs; anilibria-winmaclinux = libsForQt5.callPackage ../applications/video/anilibria-winmaclinux { }; - yggdrasil = callPackage ../tools/networking/yggdrasil { }; - masterpdfeditor = libsForQt5.callPackage ../applications/misc/masterpdfeditor { }; masterpdfeditor4 = libsForQt5.callPackage ../applications/misc/masterpdfeditor4 { }; @@ -30862,10 +30869,6 @@ with pkgs; chromium = callPackage ../applications/networking/browsers/chromium (config.chromium or {}); - chromiumBeta = lowPrio (chromium.override { channel = "beta"; }); - - chromiumDev = lowPrio (chromium.override { channel = "dev"; }); - chuck = callPackage ../applications/audio/chuck { inherit (darwin) DarwinTools; inherit (darwin.apple_sdk.frameworks) AppKit Carbon CoreAudio CoreMIDI CoreServices Kernel MultitouchSupport; @@ -31038,6 +31041,8 @@ with pkgs; dablin = callPackage ../applications/radio/dablin { }; + daktilo = callPackage ../tools/misc/daktilo { }; + darcs = haskell.lib.compose.overrideCabal (drv: { configureFlags = (lib.remove "-flibrary" drv.configureFlags or []) ++ ["-f-library"]; }) (haskell.lib.compose.justStaticExecutables haskellPackages.darcs); @@ -32264,10 +32269,6 @@ with pkgs; google-chrome = callPackage ../applications/networking/browsers/google-chrome { }; - google-chrome-beta = google-chrome.override { chromium = chromiumBeta; channel = "beta"; }; - - google-chrome-dev = google-chrome.override { chromium = chromiumDev; channel = "dev"; }; - go-graft = callPackage ../applications/networking/go-graft { }; gostatic = callPackage ../applications/misc/gostatic { }; @@ -32993,12 +32994,15 @@ with pkgs; jwm-settings-manager = callPackage ../applications/window-managers/jwm/jwm-settings-manager.nix { }; - k3s_1_24 = callPackage ../applications/networking/cluster/k3s/1_24 { }; - k3s_1_25 = callPackage ../applications/networking/cluster/k3s/1_25 { }; - inherit (callPackage ../applications/networking/cluster/k3s { }) - k3s_1_26 - k3s_1_27 - ; + k3s_1_24 = callPackage ../applications/networking/cluster/k3s/1_24 { + buildGoModule = buildGo120Module; + }; + k3s_1_25 = callPackage ../applications/networking/cluster/k3s/1_25 { + buildGoModule = buildGo120Module; + }; + inherit (callPackage ../applications/networking/cluster/k3s { + buildGoModule = buildGo120Module; + }) k3s_1_26 k3s_1_27; k3s = k3s_1_27; k3sup = callPackage ../applications/networking/cluster/k3sup { }; @@ -35448,6 +35452,8 @@ with pkgs; super-slicer = darwin.apple_sdk_11_0.callPackage ../applications/misc/prusa-slicer/super-slicer.nix { }; + super-slicer-beta = super-slicer.beta; + super-slicer-latest = super-slicer.latest; snapmaker-luban = callPackage ../applications/misc/snapmaker-luban { }; @@ -39800,7 +39806,7 @@ with pkgs; caffe = callPackage ../applications/science/math/caffe ({ inherit (config) cudaSupport; cudaPackages = cudaPackages_10_1; - opencv3 = opencv3WithoutCuda; # Used only for image loading. + opencv4 = opencv4WithoutCuda; # Used only for image loading. blas = openblas; inherit (darwin.apple_sdk.frameworks) Accelerate CoreGraphics CoreVideo; } // (config.caffe or {})); @@ -41937,7 +41943,7 @@ with pkgs; inherit (callPackage ../applications/misc/zettlr { texlive = texlive.combined.scheme-medium; - }) zettlr zettlr-beta; + }) zettlr; unpoller = callPackage ../servers/monitoring/unpoller { }; diff --git a/pkgs/top-level/java-packages.nix b/pkgs/top-level/java-packages.nix index 85383eca38e5b..a4bafcc71dd15 100644 --- a/pkgs/top-level/java-packages.nix +++ b/pkgs/top-level/java-packages.nix @@ -215,7 +215,7 @@ in { ../development/compilers/openjdk/21.nix ../development/compilers/zulu/21.nix { - openjdk21-bootstrap = temurin-bin.jdk-20; + openjdk21-bootstrap = temurin-bin.jdk-21; openjfx = openjfx21; }; diff --git a/pkgs/top-level/kodi-packages.nix b/pkgs/top-level/kodi-packages.nix index c9d57a8d14706..4fa6c3064558b 100644 --- a/pkgs/top-level/kodi-packages.nix +++ b/pkgs/top-level/kodi-packages.nix @@ -84,6 +84,8 @@ let self = rec { orftvthek = callPackage ../applications/video/kodi/addons/orftvthek { }; + radioparadise = callPackage ../applications/video/kodi/addons/radioparadise { }; + svtplay = callPackage ../applications/video/kodi/addons/svtplay { }; steam-controller = callPackage ../applications/video/kodi/addons/steam-controller { }; @@ -92,6 +94,8 @@ let self = rec { steam-library = callPackage ../applications/video/kodi/addons/steam-library { }; + somafm = callPackage ../applications/video/kodi/addons/somafm { }; + pdfreader = callPackage ../applications/video/kodi/addons/pdfreader { }; pvr-hts = callPackage ../applications/video/kodi/addons/pvr-hts { }; diff --git a/pkgs/top-level/linux-kernels.nix b/pkgs/top-level/linux-kernels.nix index d796fa7164d04..e4b1133109f9d 100644 --- a/pkgs/top-level/linux-kernels.nix +++ b/pkgs/top-level/linux-kernels.nix @@ -178,6 +178,14 @@ in { ]; }; + linux_6_6 = callPackage ../os-specific/linux/kernel/mainline.nix { + branch = "6.6"; + kernelPatches = [ + kernelPatches.bridge_stp_helper + kernelPatches.request_key_helper + ]; + }; + linux_testing = let testing = callPackage ../os-specific/linux/kernel/mainline.nix { # A special branch that tracks the kernel under the release process @@ -573,6 +581,7 @@ in { linux_5_15 = recurseIntoAttrs (packagesFor kernels.linux_5_15); linux_6_1 = recurseIntoAttrs (packagesFor kernels.linux_6_1); linux_6_5 = recurseIntoAttrs (packagesFor kernels.linux_6_5); + linux_6_6 = recurseIntoAttrs (packagesFor kernels.linux_6_6); } // lib.optionalAttrs config.allowAliases { linux_4_9 = throw "linux 4.9 was removed because it will reach its end of life within 22.11"; # Added 2022-11-08 linux_4_14 = throw "linux 4.14 was removed because it will reach its end of life within 23.11"; # Added 2023-10-11 @@ -633,7 +642,7 @@ in { packageAliases = { linux_default = packages.linux_6_1; # Update this when adding the newest kernel major version! - linux_latest = packages.linux_6_5; + linux_latest = packages.linux_6_6; linux_mptcp = throw "'linux_mptcp' has been moved to https://github.com/teto/mptcp-flake"; linux_rt_default = packages.linux_rt_5_4; linux_rt_latest = packages.linux_rt_6_1; diff --git a/pkgs/top-level/python-aliases.nix b/pkgs/top-level/python-aliases.nix index f0359945de1e9..f11511b81f962 100644 --- a/pkgs/top-level/python-aliases.nix +++ b/pkgs/top-level/python-aliases.nix @@ -129,6 +129,7 @@ mapAliases ({ eebrightbox = throw "eebrightbox is unmaintained upstream and has therefore been removed"; # added 2022-02-03 EasyProcess = easyprocess; # added 2023-02-19 email_validator = email-validator; # added 2022-06-22 + enhancements = throw "enhancements is unmaintained upstream and has therefore been removed"; # added 2023-10-27 et_xmlfile = et-xmlfile; # added 2023-10-16 ev3dev2 = python-ev3dev2; # added 2023-06-19 Fabric = fabric; # addedd 2023-02-19 @@ -245,6 +246,7 @@ mapAliases ({ notifymuch = throw "notifymuch has been promoted to a top-level attribute"; # added 2022-10-02 Nuitka = nuitka; # added 2023-02-19 ntlm-auth = throw "ntlm-auth has been removed, because it relies on the md4 implementation provided by openssl. Use pyspnego instead."; + openapi-schema-pydantic = throw "openapi-schema-pydantic has been removed, since it is no longer maintained"; # added 2023-10-30 opsdroid_get_image_size = opsdroid-get-image-size; # added 2023-10-16 ordereddict = throw "ordereddict has been removed because it is only useful on unsupported python versions."; # added 2022-05-28 pafy = throw "pafy has been removed because it is unmaintained and only a dependency of mps-youtube, itself superseded by yewtube"; # Added 2023-01-19 diff --git a/pkgs/top-level/python-packages.nix b/pkgs/top-level/python-packages.nix index c5dfe185aef67..a71c3ed14ea7f 100644 --- a/pkgs/top-level/python-packages.nix +++ b/pkgs/top-level/python-packages.nix @@ -2238,6 +2238,8 @@ self: super: with self; { compiledb = callPackage ../development/python-modules/compiledb { }; + complycube = callPackage ../development/python-modules/complycube { }; + compreffor = callPackage ../development/python-modules/compreffor { }; compressai = callPackage ../development/python-modules/compressai { }; @@ -3533,8 +3535,6 @@ self: super: with self; { energyzero = callPackage ../development/python-modules/energyzero { }; - enhancements = callPackage ../development/python-modules/enhancements { }; - enlighten = callPackage ../development/python-modules/enlighten { }; enocean = callPackage ../development/python-modules/enocean { }; @@ -7039,6 +7039,8 @@ self: super: with self; { mpmath = callPackage ../development/python-modules/mpmath { }; + mpris-server = callPackage ../development/python-modules/mpris-server { }; + mpv = callPackage ../development/python-modules/mpv { inherit (pkgs) mpv; }; @@ -8423,8 +8425,6 @@ self: super: with self; { openant = callPackage ../development/python-modules/openant { }; - openapi-schema-pydantic = callPackage ../development/python-modules/openapi-schema-pydantic { }; - openapi-schema-validator = callPackage ../development/python-modules/openapi-schema-validator { }; openapi-spec-validator = callPackage ../development/python-modules/openapi-spec-validator { }; @@ -11504,6 +11504,8 @@ self: super: with self; { python-olm = callPackage ../development/python-modules/python-olm { }; + python-on-whales = callPackage ../development/python-modules/python-on-whales { }; + python-opendata-transport = callPackage ../development/python-modules/python-opendata-transport { }; python-openstackclient = callPackage ../development/python-modules/python-openstackclient { }; @@ -15664,6 +15666,8 @@ self: super: with self; { withings-api = callPackage ../development/python-modules/withings-api { }; + withings-sync = callPackage ../development/python-modules/withings-sync { }; + wktutils = callPackage ../development/python-modules/wktutils { }; wled = callPackage ../development/python-modules/wled { }; |